diff --git a/.git-fixfiles b/.git-fixfiles
index 8d2d98a7..394f8593 100644
--- a/.git-fixfiles
+++ b/.git-fixfiles
@@ -1,4 +1,4 @@
 #!/bin/sh
 git update-index --assume-unchanged cpp/prebuilt/**/*.so
-git update-index --assume-unchanged cpp/iedriver/Generated/atoms.h
+#git update-index --assume-unchanged cpp/iedriver/Generated/atoms.h
 exit 0
diff --git a/.gitignore b/.gitignore
index addf95d3..8b55eabb 100644
--- a/.gitignore
+++ b/.gitignore
@@ -19,6 +19,9 @@ javascript/node/selenium-webdriver/node_modules/
 .idea/vcs.xml
 .idea/misc.xml
 .idea/workspace.xml
+.idea/projectCodeStyle.xml
+*.idea*
+*.iml
 .idea/dictionaries/
 .idea/scopes/
 .idea/qaplug_profiles.xml
@@ -66,4 +69,4 @@ GSYMS
 GTAGS
 .project
 Gemfile.lock
-/rb/.bundle
\ No newline at end of file
+/rb/.bundle
diff --git a/.idea/codeStyleSettings.xml b/.idea/codeStyleSettings.xml
index 15ed1f4f..1e106b98 100644
--- a/.idea/codeStyleSettings.xml
+++ b/.idea/codeStyleSettings.xml
@@ -409,10 +409,6 @@
           <option name="WHILE_BRACE_FORCE" value="3" />
           <option name="FOR_BRACE_FORCE" value="3" />
           <option name="PARENT_SETTINGS_INSTALLED" value="true" />
-          <indentOptions>
-            <option name="INDENT_SIZE" value="2" />
-            <option name="CONTINUATION_INDENT_SIZE" value="4" />
-          </indentOptions>
         </codeStyleSettings>
         <codeStyleSettings language="JavaScript">
           <option name="KEEP_BLANK_LINES_IN_CODE" value="1" />
diff --git a/.idea/libraries/commons_collections.xml b/.idea/libraries/commons_collections.xml
index f5558727..0514df76 100644
--- a/.idea/libraries/commons_collections.xml
+++ b/.idea/libraries/commons_collections.xml
@@ -1,11 +1,10 @@
 <component name="libraryTable">
   <library name="commons-collections">
     <CLASSES>
+      <root url="jar://$PROJECT_DIR$/third_party/java/commons-collections/commons-collections-3.2.1-sources.jar!/" />
       <root url="jar://$PROJECT_DIR$/third_party/java/commons-collections/commons-collections-3.2.1.jar!/" />
     </CLASSES>
     <JAVADOC />
-    <SOURCES>
-      <root url="jar://$PROJECT_DIR$/third_party/java/commons-collections/commons-collections-3.2.1-sources.jar!/" />
-    </SOURCES>
+    <SOURCES />
   </library>
 </component>
\ No newline at end of file
diff --git a/.idea/libraries/little_proxy.xml b/.idea/libraries/little_proxy.xml
index fb2af12b..ed627887 100644
--- a/.idea/libraries/little_proxy.xml
+++ b/.idea/libraries/little_proxy.xml
@@ -1,11 +1,11 @@
 <component name="libraryTable">
   <library name="little_proxy">
     <CLASSES>
-      <root url="jar://$PROJECT_DIR$/third_party/java/little_proxy/littleproxy-0.5.3.jar!/" />
+      <root url="jar://$PROJECT_DIR$/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT.jar!/" />
     </CLASSES>
     <JAVADOC />
     <SOURCES>
-      <root url="jar://$PROJECT_DIR$/third_party/java/little_proxy/littleproxy-0.5.3-sources.jar!/" />
+      <root url="jar://$PROJECT_DIR$/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT-sources.jar!/" />
     </SOURCES>
   </library>
 </component>
\ No newline at end of file
diff --git a/README.md b/README.md
index f8529a2a..7e6e59b7 100644
--- a/README.md
+++ b/README.md
@@ -1,4 +1,4 @@
-# Selenium
+# Selenium (branch with QtWebDriver)
 
 Selenium is an umbrella project for various tools and libraries that
 enable automation of web browsers.  Amongst other things it provides
@@ -6,6 +6,14 @@ the support infrastructure for the [W3C WebDriver
 specification](https://dvcs.w3.org/hg/webdriver/raw-file/tip/webdriver-spec.html),
 that lets you write interchangable code for all major web browsers.
 
+This fork of Selenium includes Java language bindings for [QtWebDriver]
+(https://github.com/cisco-open-source/qtwebdriver), see [QtWebDriverService]
+(https://github.com/cisco-open-source/selenium/blob/master/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverService.java) class.
+It is possible to test QWidget, QWebView, QQuick1 (Qt4),
+QQuick2 (Qt5) or hybrid applications using this driver. QtWebDriver features
+are covered by series tests included in this repository. Information
+how to run them is available below.
+
 The project is made possible by volunteer contributors who have put in
 thousands of hours of their own time, and made the source code freely
 available under the [Apache 2.0
@@ -180,6 +188,23 @@ Note that the `test_chrome` target requires that you have the separate
 [Chrome Driver](http://code.google.com/p/selenium/wiki/ChromeDriver)
 binary available on your `PATH`.
 
+To run QtWebDriver tests try:
+
+```sh
+./go test_qtwebkit
+./go test_wd_native_qt4
+./go test_wd_native_qt5
+./go test_wd_hybrid_qt4
+./go test_wd_hybrid_qt5
+./go test_wd_quick1
+./go test_wd_quick2
+```
+
+These targets require environment variable `qtwebdriver` to contain path
+to the separate [QtWebDriver](https://github.com/cisco-open-source/qtwebdriver)
+binary. Additional command line arguments to run this binary can be
+provided with `qtwebdriverargs` environment variable.
+
 If you are interested in a single language binding, try one of:
 
 ```sh
diff --git a/Rakefile b/Rakefile
index 9670cd5f..ab21878d 100644
--- a/Rakefile
+++ b/Rakefile
@@ -165,6 +165,16 @@ task :test_remote => [
   '//java/client/test/org/openqa/selenium/remote:client-tests:run',
   :test_remote_server
 ]
+task :test_qtwebkit => [
+  '//java/client/test/org/openqa/selenium/qtwebkit:test_qtwebkit:run'
+]
+task :test_wd_native_qt4 => [  '//java/client/test/org/openqa/selenium/qtwebkit/nativetests:nativetests_qt4:run' ]
+task :test_wd_native_qt5 => [  '//java/client/test/org/openqa/selenium/qtwebkit/nativetests:nativetests_qt5:run' ]
+task :test_wd_hybrid_qt4 => [  '//java/client/test/org/openqa/selenium/qtwebkit/hybridtests:hybrid_tests_qt4:run' ]
+task :test_wd_hybrid_qt5 => [  '//java/client/test/org/openqa/selenium/qtwebkit/hybridtests:hybrid_tests_qt5:run' ]
+task :test_wd_quick1 => [  '//java/client/test/org/openqa/selenium/qtwebkit/quick_tests:quick1_tests:run' ]
+task :test_wd_quick2 => [  '//java/client/test/org/openqa/selenium/qtwebkit/quick_tests:quick2_tests:run' ]
+task :test_wd_visualizer => [  '//java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests:test_wd_visualizer:run' ]
 task :test_safari => [ "//java/client/test/org/openqa/selenium/safari:test:run" ]
 task :test_phantomjs => [ "//java/client/test/org/openqa/selenium/phantomjs:test:run" ]
 task :test_support => [
diff --git a/android/Android.iml b/android/Android.iml
new file mode 100644
index 00000000..378c8d2c
--- /dev/null
+++ b/android/Android.iml
@@ -0,0 +1,82 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<module type="JAVA_MODULE" version="4">
+  <component name="FacetManager">
+    <facet type="android" name="Android">
+      <configuration>
+        <option name="GEN_FOLDER_RELATIVE_PATH_APT" value="/gen" />
+        <option name="GEN_FOLDER_RELATIVE_PATH_AIDL" value="/gen" />
+        <option name="MANIFEST_FILE_RELATIVE_PATH" value="/AndroidManifest.xml" />
+        <option name="RES_FOLDER_RELATIVE_PATH" value="/res" />
+        <option name="ASSETS_FOLDER_RELATIVE_PATH" value="/assets" />
+        <option name="LIBS_FOLDER_RELATIVE_PATH" value="/libs" />
+        <option name="REGENERATE_R_JAVA" value="true" />
+        <option name="REGENERATE_JAVA_BY_AIDL" value="true" />
+        <option name="USE_CUSTOM_APK_RESOURCE_FOLDER" value="false" />
+        <option name="CUSTOM_APK_RESOURCE_FOLDER" value="" />
+        <option name="USE_CUSTOM_COMPILER_MANIFEST" value="false" />
+        <option name="CUSTOM_COMPILER_MANIFEST" value="" />
+        <option name="APK_PATH" value="" />
+        <option name="LIBRARY_PROJECT" value="false" />
+        <option name="RUN_PROCESS_RESOURCES_MAVEN_TASK" value="true" />
+        <option name="GENERATE_UNSIGNED_APK" value="false" />
+        <option name="CUSTOM_DEBUG_KEYSTORE_PATH" value="" />
+        <option name="PACK_TEST_CODE" value="false" />
+        <option name="RUN_PROGUARD" value="false" />
+        <option name="PROGUARD_CFG_PATH" value="/proguard-project.txt" />
+        <resOverlayFolders>
+          <path>/res-overlay</path>
+        </resOverlayFolders>
+        <includeSystemProguardFile>true</includeSystemProguardFile>
+        <includeAssetsFromLibraries>false</includeAssetsFromLibraries>
+        <additionalNativeLibs />
+      </configuration>
+    </facet>
+  </component>
+  <component name="NewModuleRootManager" inherit-compiler-output="true">
+    <exclude-output />
+    <content url="file://$MODULE_DIR$">
+      <sourceFolder url="file://$MODULE_DIR$/gen" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/src" isTestSource="false" />
+    </content>
+    <orderEntry type="inheritedJdk" />
+    <orderEntry type="sourceFolder" forTests="false" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../third_party/java/android/android-14.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="webbit" level="project" />
+    <orderEntry type="library" name="selenium1" level="project" />
+    <orderEntry type="library" name="guava-libraries" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../build/java/server/test/org/openqa/selenium/remote/server/test_qtwebkit.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../third_party/closure/bin/compiler-20120917.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="server1" level="project" />
+    <orderEntry type="library" name="selenium2" level="project" />
+    <orderEntry type="library" name="logging" level="project" />
+    <orderEntry type="library" name="remote1" level="project" />
+    <orderEntry type="library" name="remote" level="project" />
+    <orderEntry type="module" module-name="Client" />
+    <orderEntry type="module" module-name="Server" />
+  </component>
+</module>
+
diff --git a/android/android.iml b/android/android.iml
new file mode 100644
index 00000000..b24688e0
--- /dev/null
+++ b/android/android.iml
@@ -0,0 +1,47 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<module type="JAVA_MODULE" version="4">
+  <component name="FacetManager">
+    <facet type="android" name="Android">
+      <configuration>
+        <option name="GEN_FOLDER_RELATIVE_PATH_APT" value="/gen" />
+        <option name="GEN_FOLDER_RELATIVE_PATH_AIDL" value="/gen" />
+        <option name="MANIFEST_FILE_RELATIVE_PATH" value="/AndroidManifest.xml" />
+        <option name="RES_FOLDER_RELATIVE_PATH" value="/res" />
+        <option name="ASSETS_FOLDER_RELATIVE_PATH" value="/assets" />
+        <option name="LIBS_FOLDER_RELATIVE_PATH" value="/libs" />
+        <option name="REGENERATE_R_JAVA" value="true" />
+        <option name="REGENERATE_JAVA_BY_AIDL" value="true" />
+        <option name="USE_CUSTOM_APK_RESOURCE_FOLDER" value="false" />
+        <option name="CUSTOM_APK_RESOURCE_FOLDER" value="" />
+        <option name="USE_CUSTOM_COMPILER_MANIFEST" value="false" />
+        <option name="CUSTOM_COMPILER_MANIFEST" value="" />
+        <option name="APK_PATH" value="" />
+        <option name="LIBRARY_PROJECT" value="false" />
+        <option name="RUN_PROCESS_RESOURCES_MAVEN_TASK" value="true" />
+        <option name="GENERATE_UNSIGNED_APK" value="false" />
+        <option name="CUSTOM_DEBUG_KEYSTORE_PATH" value="" />
+        <option name="PACK_TEST_CODE" value="false" />
+        <option name="RUN_PROGUARD" value="false" />
+        <option name="PROGUARD_CFG_PATH" value="/proguard.cfg" />
+        <resOverlayFolders />
+        <includeSystemProguardFile>false</includeSystemProguardFile>
+      </configuration>
+    </facet>
+  </component>
+  <component name="NewModuleRootManager" inherit-compiler-output="false">
+    <output url="file://$MODULE_DIR$/build/production" />
+    <output-test url="file://$MODULE_DIR$/build/test" />
+    <exclude-output />
+    <content url="file://$MODULE_DIR$">
+      <sourceFolder url="file://$MODULE_DIR$/src" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/gen" isTestSource="false" />
+    </content>
+    <orderEntry type="jdk" jdkName="Android 4.0.3 Platform" jdkType="Android SDK" />
+    <orderEntry type="sourceFolder" forTests="false" />
+    <orderEntry type="module" module-name="server" />
+    <orderEntry type="library" scope="PROVIDED" name="android" level="project" />
+    <orderEntry type="library" name="webbit" level="project" />
+    <orderEntry type="library" scope="TEST" name="junit" level="project" />
+  </component>
+</module>
+
diff --git a/android/gen/org/openqa/selenium/android/app/BuildConfig.java b/android/gen/org/openqa/selenium/android/app/BuildConfig.java
new file mode 100644
index 00000000..cd4e4aab
--- /dev/null
+++ b/android/gen/org/openqa/selenium/android/app/BuildConfig.java
@@ -0,0 +1,6 @@
+/** Automatically generated file. DO NOT MODIFY */
+package org.openqa.selenium.android.app;
+
+public final class BuildConfig {
+    public final static boolean DEBUG = true;
+}
\ No newline at end of file
diff --git a/build.xml b/build.xml
new file mode 100644
index 00000000..50d39ce8
--- /dev/null
+++ b/build.xml
@@ -0,0 +1,16 @@
+<project name="MyProject" default="dist" basedir=".">
+    <description>
+        simple example build file
+    </description>
+
+    <property name="report" value="./build/test_logs" />
+
+  	<target name="test">
+		<junitreport todir="${report}">
+			<fileset dir="${report}">
+				<include name="TEST-*.xml" />
+			</fileset>
+			<report format="frames" todir="${report}/html" />
+		</junitreport>
+  	</target>
+</project>
\ No newline at end of file
diff --git a/common/src/web/HTML5_Audio/mp3.mp3 b/common/src/web/HTML5_Audio/mp3.mp3
new file mode 100644
index 00000000..9d9233c0
Binary files /dev/null and b/common/src/web/HTML5_Audio/mp3.mp3 differ
diff --git a/common/src/web/HTML5_Audio/ogg.ogg b/common/src/web/HTML5_Audio/ogg.ogg
new file mode 100644
index 00000000..cbc0c84d
Binary files /dev/null and b/common/src/web/HTML5_Audio/ogg.ogg differ
diff --git a/common/src/web/HTML5_Audio/wav.wav b/common/src/web/HTML5_Audio/wav.wav
new file mode 100644
index 00000000..ac44342c
Binary files /dev/null and b/common/src/web/HTML5_Audio/wav.wav differ
diff --git a/common/src/web/HTML5_Audio/weba.weba b/common/src/web/HTML5_Audio/weba.weba
new file mode 100644
index 00000000..a397eb60
Binary files /dev/null and b/common/src/web/HTML5_Audio/weba.weba differ
diff --git a/common/src/web/HTML5_Audio_Test.html b/common/src/web/HTML5_Audio_Test.html
new file mode 100644
index 00000000..f02f8ef5
--- /dev/null
+++ b/common/src/web/HTML5_Audio_Test.html
@@ -0,0 +1,15 @@
+
+<!DOCTYPE html>
+<html>
+<body>
+
+<audio id="audioPlayer" controls preload="auto">
+<source src="HTML5_Audio/weba.weba">
+<source src="HTML5_Audio/ogg.ogg">
+<source src="HTML5_Audio/mp3.mp3">
+<source src="HTML5_Audio/wav.wav">
+  Your browser does not support the audio tag.
+</audio>
+
+</body>
+</html>
diff --git a/common/src/web/HTML5_Video/big_buck_bunny.mp4 b/common/src/web/HTML5_Video/big_buck_bunny.mp4
new file mode 100644
index 00000000..81d11df5
Binary files /dev/null and b/common/src/web/HTML5_Video/big_buck_bunny.mp4 differ
diff --git a/common/src/web/HTML5_Video/big_buck_bunny.ogv b/common/src/web/HTML5_Video/big_buck_bunny.ogv
new file mode 100644
index 00000000..e128d82b
Binary files /dev/null and b/common/src/web/HTML5_Video/big_buck_bunny.ogv differ
diff --git a/common/src/web/HTML5_Video/big_buck_bunny.webm b/common/src/web/HTML5_Video/big_buck_bunny.webm
new file mode 100644
index 00000000..42e2130c
Binary files /dev/null and b/common/src/web/HTML5_Video/big_buck_bunny.webm differ
diff --git a/common/src/web/HTML5_Video_Test.html b/common/src/web/HTML5_Video_Test.html
new file mode 100644
index 00000000..676de034
--- /dev/null
+++ b/common/src/web/HTML5_Video_Test.html
@@ -0,0 +1,13 @@
+<!DOCTYPE html>
+<html>
+<body>
+
+<video id="videoPlayer" controls>
+  <source src="HTML5_Video/big_buck_bunny.webm" type="video/webm">
+  <source src="HTML5_Video/big_buck_bunny.ogv" type="video/ogg">
+  <source src="HTML5_Video/videos/big_buck_bunny.mp4" type="video/mp4">
+  Your browser does not support the video tag.
+</video>
+
+</body>
+</html>
\ No newline at end of file
diff --git a/common/src/web/pageWithOnBeforeUnloadMessage.html b/common/src/web/pageWithOnBeforeUnloadMessage.html
index cb59707e..6e0a0ddc 100644
--- a/common/src/web/pageWithOnBeforeUnloadMessage.html
+++ b/common/src/web/pageWithOnBeforeUnloadMessage.html
@@ -1,7 +1,7 @@
 <!DOCTYPE html>
 <html>
   <head>
-    <!-- 
+    <!--
     This page differs from pageWithOnUnload.html in that it returns a string in the
     event handler, which causes a different type of alert to appear (the "Stay on
     page/Leave current page" alert).
diff --git a/common/src/web/pinch.html b/common/src/web/pinch.html
new file mode 100644
index 00000000..31d14c09
--- /dev/null
+++ b/common/src/web/pinch.html
@@ -0,0 +1,82 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.1//EN"
+        "http://www.w3.org/TR/xhtml11/DTD/xhtml11.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en">
+  <head>
+    <title>scripty2 demo | Photo fun</title>
+    <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+    
+    <script src="touch/prototype.js" type="text/javascript"></script>
+    <script src="touch/s2.js" type="text/javascript"></script>
+        <style type="text/css" media="screen">
+      html {
+        height: 100%;
+      }
+      body { 
+        font: 12px/15px Calibri, Verdana;
+        background:#844;
+        height: 100%;
+        overflow:hidden
+      }
+      img.manipulate {
+        border: 20px solid #fff;
+      }
+    </style>
+  </head>   
+  <body id="body">
+    <div id="debug"></div>
+    <div id="colorpicker"></div> 
+    <div id="result_scale">
+      &nbsp;
+    </div>   
+    <div id="result_rotate">
+      &nbsp;
+    </div>  
+    
+    <img id="picture" class="manipulate" src="touch/img.jpg" />
+ 
+    <script type="text/javascript" charset="utf-8">
+      S2.enableMultitouchSupport = true;
+    
+      (function(){     
+        // initial position & rotation
+        var left = 300, top = 200, width = 350,
+          z = 1, FRICTION = 2.5;
+
+        $$('.manipulate').each(function(img,i){
+          img.style.cssText += ';position:absolute;'+
+            'left:'+left+'px;top:'+top+'px;'+
+            'width:'+width+'px;';
+          // img.transform({ rotation: p[i][3] });
+          // img.morph('left:'+p[i][0]+'px;top:'+p[i][1]+'px',{duration:2,delay:i/2});
+           
+           // image rotating and scaling
+           img.observe('manipulate:update', function(event){
+             if(img.full) return;
+             
+             // limit scaling to 0.35 to 10
+             var scale = event.memo.scale < 0.35 ? 0.35 : 
+               event.memo.scale > 10 ? 10 : event.memo.scale;
+
+            console.log("scale ="+scale)
+            document.getElementById('result_scale').innerHTML = (scale).toFixed(1);
+
+               
+             img.style.cssText += 
+               ';z-index:'+(z++)+';left:'+(left+event.memo.panX)+
+               'px;top:'+(top+event.memo.panY)+'px;'+
+               ';';
+              
+             img.transform({ rotation: event.memo.rotation, scale: scale });
+             img._x = left+event.memo.panX;
+             img._y = top+event.memo.panY;
+
+             console.log("rotation ="+event.memo.rotation)
+             document.getElementById('result_rotate').innerHTML = (event.memo.rotation * 180/Math.PI).toFixed();;
+             
+             event.stop();
+           });           
+        });
+      })();
+    </script>
+  </body>
+</html>
\ No newline at end of file
diff --git a/common/src/web/quick1/BasicKeyboardInterfaceTest.qml b/common/src/web/quick1/BasicKeyboardInterfaceTest.qml
new file mode 100644
index 00000000..d3451170
--- /dev/null
+++ b/common/src/web/quick1/BasicKeyboardInterfaceTest.qml
@@ -0,0 +1,109 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 200
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "Changed: "
+                color: "darkgrey"
+            }
+
+            Text {
+                id: resultIsKeyDown
+                objectName: "resultIsKeyDown"
+            }
+
+            Text {
+                id: resultIsKeyUp
+                objectName: "resultIsKeyUp"
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "Modifier: "
+                color: "darkgrey"
+            }
+
+            Text {
+                id: resultModifier
+                objectName: "resultModifier"
+            }
+        }
+
+        TextInput {
+            id: enabledTextElement
+            objectName: "enabledTextElement"
+            width: parent.width
+            fillColor: "darkgrey"
+
+            Keys.onPressed: {
+                resultIsKeyDown.text = "Key Down";
+                var modifiers = ""
+
+                if (event.modifiers & Qt.ShiftModifier) modifiers += " Shift";
+                if (event.modifiers & Qt.ControlModifier) modifiers += " Ctrl";
+                if (event.modifiers & Qt.AltModifier) modifiers += " Alt";
+
+                resultModifier.text = modifiers;
+            }
+
+            Keys.onReleased: {
+                resultIsKeyUp.text = "Key Up";
+                var modifiers = ""
+
+                if (event.modifiers & Qt.ShiftModifier) modifiers += " Shift";
+                if (event.modifiers & Qt.ControlModifier) modifiers += " Ctrl";
+                if (event.modifiers & Qt.AltModifier) modifiers += " Alt";
+
+                resultModifier.text = modifiers;
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/BasicMouseInterfaceTest.qml b/common/src/web/quick1/BasicMouseInterfaceTest.qml
new file mode 100644
index 00000000..5b8705ac
--- /dev/null
+++ b/common/src/web/quick1/BasicMouseInterfaceTest.qml
@@ -0,0 +1,90 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.1
+
+Rectangle {
+    id: root
+    width: 600
+    height: 500
+
+    Rectangle {
+        property alias text: caption.text
+        property string lastButtonEvent: ""
+        id: pureButton
+        objectName: "pureButton"
+        width: 100
+        height: 100
+        border.color: "black"
+        color: "red"
+        Text {
+            id: caption
+            anchors.fill: parent;
+            verticalAlignment: Text.AlignVCenter;
+            horizontalAlignment:  Text.AlignHCenter;
+            text: "Click me"
+        }
+
+        MouseArea {
+            id: hotSpot
+            anchors.fill: parent;
+            acceptedButtons: Qt.LeftButton | Qt.RightButton
+            onClicked: {
+                if (mouse.button == Qt.LeftButton)
+                    caption.text = "Clicked";
+                if (mouse.button == Qt.RightButton)
+                    caption.text = "ContextClicked";
+            }
+            onDoubleClicked: caption.text = "DoubleClicked"
+            onPressed: pureButton.lastButtonEvent = "Pressed"
+            onReleased: pureButton.lastButtonEvent = "Released"
+        }
+    }
+
+        Rectangle {
+            id: itemToDrag
+            objectName: "itemToDrag"
+            width: 100
+            height: 100
+            x: 300
+            y: 300
+
+            border.color: "black"
+            color: "green"
+
+            Text {
+                anchors.fill: parent;
+                verticalAlignment: Text.AlignVCenter;
+                horizontalAlignment:  Text.AlignHCenter;
+                text: "Drag me"
+            }
+
+            MouseArea {
+                id: contentMouseArea
+                anchors.fill: parent
+                drag.target: itemToDrag
+                onPressed: console.log("-----------pressed--------------" + itemToDrag.x + " : " + itemToDrag.y)
+                onReleased: console.log("-----------released--------------" + itemToDrag.x + " : " + itemToDrag.y)
+                onPressAndHold: console.log("-----------pressAndHold-------------" + itemToDrag.x + " : " + itemToDrag.y)
+                onPositionChanged: console.log("----- update: (" + mouse.x +":"+ mouse.y+")" + "("+itemToDrag.x+":"+itemToDrag.y+")")
+            }
+        }
+}
diff --git a/common/src/web/quick1/ClickTest.qml b/common/src/web/quick1/ClickTest.qml
new file mode 100644
index 00000000..5264fe1b
--- /dev/null
+++ b/common/src/web/quick1/ClickTest.qml
@@ -0,0 +1,73 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        spacing: 20
+        width: 180
+
+        Text {
+            id: clickDisplay
+            objectName: "clickDisplay"
+            text: "no action"
+            font.pixelSize: 18
+        }
+
+        Rectangle {
+            id: button1
+            objectName: "button1"
+
+            width: parent.width
+            height: 40
+            color: "green"
+            Text {
+                //anchors.fill: parent
+                text: "push me"
+            }
+
+            MouseArea {
+                objectName: "mouseHotSpotButton1"
+                anchors.fill: parent
+                onClicked: { clickDisplay.text = "clicked button1" }
+            }
+        }
+
+        MouseArea {
+            objectName: "mouseHotSpotArea2"
+            width: 40
+            height: 40
+            onClicked: { clickDisplay.text = "clicked area 2" }
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/CoordinatesTest.qml b/common/src/web/quick1/CoordinatesTest.qml
new file mode 100644
index 00000000..2c6d83e0
--- /dev/null
+++ b/common/src/web/quick1/CoordinatesTest.qml
@@ -0,0 +1,90 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Rectangle {
+        id: zeroSizedElement
+        objectName: "zeroSizedElement"
+        x: 8
+        y: 8
+        width: 0
+        height: 0
+        border.color: "black"
+        color: "red"
+    }
+
+    Rectangle {
+        id: mainRectangle
+        objectName: "mainRectangle"
+        anchors.top: parent.top
+        anchors.left: parent.left
+        anchors.topMargin: 10
+        anchors.leftMargin: 10
+        width: 100
+        height: 100
+        border.color: "black"
+        color: "green"
+    }
+
+    Rectangle {
+        id: transparentRect
+        objectName: "transparentRect"
+        anchors.top: mainRectangle.bottom
+        anchors.left: mainRectangle.left
+        anchors.topMargin: 10
+        width: 100
+        height: 30
+        border.color: "black"
+        color: "red"
+        opacity: 0
+    }
+
+    Rectangle {
+        id: hiddenRect
+        objectName: "hiddenRect"
+        anchors.top: mainRectangle.top
+        anchors.left: mainRectangle.right
+        anchors.leftMargin: 10
+        width: 30
+        height: 100
+        border.color: "black"
+        color: "blue"
+        visible: false
+    }
+
+    Item {
+        id: invisibleItem
+        objectName: "invisibleItem"
+        x: 3
+        y: 3
+        width: 3
+        height: 3
+    }
+
+
+}
+
diff --git a/common/src/web/quick1/ElementAttributeTest.qml b/common/src/web/quick1/ElementAttributeTest.qml
new file mode 100644
index 00000000..9a0eeb65
--- /dev/null
+++ b/common/src/web/quick1/ElementAttributeTest.qml
@@ -0,0 +1,151 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                objectName: "displayedLabel"
+                text: "Visible Label"
+                color: "darkgrey"
+            }
+
+            Text {
+                objectName: "notDisplayedLabel"
+                text: "Invisible label."
+                visible: false
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Rectangle {
+                property alias text: buttonText1.text
+                id: button1
+                objectName: "workingButton"
+                enabled: true
+
+                width: 120
+                height: 40
+                color: "darkgrey"
+                Text {
+                    id: buttonText1
+                    text: "Working Button"
+                }
+            }
+
+            Rectangle {
+                property alias text: buttonText2.text
+                id: button2
+                objectName: "notWorkingButton"
+                enabled: false
+                visible: false
+
+                width: 120
+                height: 40
+                color: "darkgrey"
+                Text {
+                    id: buttonText2
+                    text: "Disabled button"
+                }
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+            Rectangle {
+                width: (parent.width - parent.spacing) / 2
+                height: 50
+                border.color: "black"
+                TextInput {
+                    id: disabledTextElement
+                    objectName: "disabledTextElement"
+                    anchors.fill: parent
+                    enabled: false
+                }
+            }
+
+            Rectangle {
+                width: (parent.width - parent.spacing) / 2
+                height: 50
+                border.color: "black"
+                TextInput {
+                    id: enabledTextElement
+                    objectName: "enabledTextElement"
+                    anchors.fill: parent
+                }
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 50
+            border.color: "black"
+            TextEdit {
+                id: areaWithDefaultText
+                objectName: "areaWithDefaultText"
+                anchors.fill: parent
+                text: "Example text"
+                readOnly: true
+                enabled: false
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 50
+            border.color: "black"
+            TextInput {
+                id: workingArea
+                objectName: "workingArea"
+                anchors.fill: parent
+            }
+        }
+
+    }
+}
+
diff --git a/common/src/web/quick1/FindingTest.qml b/common/src/web/quick1/FindingTest.qml
new file mode 100644
index 00000000..388957d0
--- /dev/null
+++ b/common/src/web/quick1/FindingTest.qml
@@ -0,0 +1,51 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Column {
+        spacing: 2
+
+        TextInput {
+            id: inputElement
+            objectName: "inputElement"
+            text: { "<b>" + "(^ ^)" + "</b>" }
+            font.pixelSize: 18
+        }
+
+        Rectangle { objectName: "hiddenRect"; color: "red"; width: 50; height: 50; visible: false }
+        Rectangle {
+            color: "green"; width: 20; height: 50;
+            MouseArea {
+                objectName: "mouseHotSpot"
+                anchors.fill: parent
+                onClicked: { parent.color = 'red' }
+            }
+        }
+        Rectangle { color: "blue"; width: 50; height: 20 }
+    }
+}
+
diff --git a/common/src/web/quick1/FormHandlingTest.qml b/common/src/web/quick1/FormHandlingTest.qml
new file mode 100644
index 00000000..d909ebf1
--- /dev/null
+++ b/common/src/web/quick1/FormHandlingTest.qml
@@ -0,0 +1,83 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+
+            Text {
+                id: notClickableLabel
+                objectName: "notClickableLabel"
+                text: "Label not clickable"
+                color: "darkgrey"
+            }
+
+            PushButton {
+                objectName: "changeLabelButton"
+                text: "Change Label"
+                onButtonClick: notClickableLabel.text = "Label changed"
+            }
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            text: "Example text"
+            fillColor: "darkgrey"
+        }
+
+        TextInput {
+            objectName: "emptyInput"
+            width: parent.width
+            fillColor: "darkgrey"
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            text: "Example text"
+            fillColor: "darkgrey"
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/JavascriptTest.qml b/common/src/web/quick1/JavascriptTest.qml
new file mode 100644
index 00000000..7c57bf8d
--- /dev/null
+++ b/common/src/web/quick1/JavascriptTest.qml
@@ -0,0 +1,84 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    id: mainItem
+    property string title: "Javascript Test Page"
+    width: 320
+    height: 400
+
+    function sayHello(toWhom) {
+        return "Hello " + toWhom + " !";
+    }
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            id: result
+            objectName: "result"
+            text: "default"
+            color: "darkgrey"
+            width: parent.width
+        }
+
+        PushButton {
+            objectName: "changeLabelButton"
+            text: "Say hello"
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            text: "Example text"
+            fillColor: "darkgrey"
+        }
+
+        TextInput {
+            objectName: "emptyInput"
+            width: parent.width
+            fillColor: "darkgrey"
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            text: "Example text"
+            fillColor: "darkgrey"
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/PushButton.qml b/common/src/web/quick1/PushButton.qml
new file mode 100644
index 00000000..935a8e78
--- /dev/null
+++ b/common/src/web/quick1/PushButton.qml
@@ -0,0 +1,43 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    id: button
+    color: "red"
+    property alias text: caption.text
+    signal buttonClick()
+    width: 96; height: 24;
+
+    Text {
+        id: caption;
+        anchors.fill: parent;
+        verticalAlignment: Text.AlignVCenter;
+        horizontalAlignment:  Text.AlignHCenter;
+    }
+
+    MouseArea {
+        id: hotSpot
+        anchors.fill: parent;
+        onClicked: buttonClick()
+    }
+}
diff --git a/common/src/web/quick1/StaleElementReferenceTest.qml b/common/src/web/quick1/StaleElementReferenceTest.qml
new file mode 100644
index 00000000..90c72637
--- /dev/null
+++ b/common/src/web/quick1/StaleElementReferenceTest.qml
@@ -0,0 +1,63 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 200
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            objectName: "captionLabel"
+            text: "This Is Caption"
+            width: parent.width
+        }
+
+        Rectangle {
+            objectName: "clickButton"
+            border.color: "black"
+            color: "green"
+            width: parent.width
+            height: parent.height / 2
+            Text {
+                text: "Click me"
+                anchors.fill: parent
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/TypingTest.qml b/common/src/web/quick1/TypingTest.qml
new file mode 100644
index 00000000..bf80917b
--- /dev/null
+++ b/common/src/web/quick1/TypingTest.qml
@@ -0,0 +1,79 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "You changed:"
+                color: "darkgrey"
+            }
+
+            Text {
+                id: result
+                objectName: "result"
+                text: "default"
+            }
+        }
+
+        TextInput {
+            id: enabledTextElement
+            objectName: "enabledTextElement"
+            width: parent.width
+            fillColor: "darkgrey"
+            onTextChanged: {
+                result.text = text;
+            }
+        }
+
+        TextEdit {
+            id: workingArea
+            objectName: "workingArea"
+            width: parent.width
+            height: parent.height - top - 40
+            fillColor: "darkgrey"
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/VisibilityTest.qml b/common/src/web/quick1/VisibilityTest.qml
new file mode 100644
index 00000000..b1efc6e3
--- /dev/null
+++ b/common/src/web/quick1/VisibilityTest.qml
@@ -0,0 +1,105 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+
+            Text {
+                objectName: "notDisplayedLabel"
+                text: "No Visible Label"
+                color: "darkgrey"
+                visible: false
+            }
+
+            Text {
+                objectName: "displayedLabel"
+                text: "Visible Label"
+                color: "darkgrey"
+            }
+
+            Text {
+                objectName: "zeroLabel"
+                color: "darkgrey"
+                width: 0
+                height: 0
+            }
+        }
+
+        Row {
+            spacing: 10
+
+            PushButton {
+                objectName: "buttonCanHide"
+                text: "Click to Hide"
+                onButtonClick: visible = false
+            }
+
+            PushButton {
+                objectName: "buttonHidden"
+                text: "hidden"
+                visible: false
+            }
+        }
+
+        TextInput {
+            objectName: "inputHidden"
+            width: parent.width
+            fillColor: "darkgrey"
+            visible: false
+        }
+
+        Rectangle {
+            objectName: "hiddenScrollArea"
+            width: parent.width
+            height: 100
+            border.color: "black"
+            visible: false
+
+            PushButton {
+                objectName: "buttonInScrollArea"
+                text: "Click here"
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/WebviewTest.qml b/common/src/web/quick1/WebviewTest.qml
new file mode 100644
index 00000000..a8a784ad
--- /dev/null
+++ b/common/src/web/quick1/WebviewTest.qml
@@ -0,0 +1,54 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+import CiscoQtWebKit 1.0
+
+Rectangle {
+    width: 640
+    height: 480
+    color: "yellow"
+
+    Text {
+        text: webView.url
+    }
+
+    Rectangle {
+        anchors.fill: parent
+        anchors.bottomMargin: 40
+        anchors.topMargin: 40
+        anchors.leftMargin: 40
+        anchors.rightMargin: 40
+        border.color: "black"
+        color: "blue"
+
+        CiscoWebView {
+            id: webView
+            html: "<p>This is <b>HTML</b>."
+            //preferredWidth: 640
+            //preferredHeight: 480
+            smooth: false
+            anchors.fill: parent
+        }
+    }
+}
+
+
diff --git a/common/src/web/quick1/WindowTest.qml b/common/src/web/quick1/WindowTest.qml
new file mode 100644
index 00000000..cdc1bcd5
--- /dev/null
+++ b/common/src/web/quick1/WindowTest.qml
@@ -0,0 +1,38 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Text {
+        id: content
+        text: "WindowTest"
+        font.pointSize: 24
+        verticalAlignment: Text.AlignVCenter
+        horizontalAlignment: Text.AlignHCenter
+        width: parent.width
+        height: parent.height
+    }
+}
\ No newline at end of file
diff --git a/common/src/web/quick1/XPathElementFindingTest.qml b/common/src/web/quick1/XPathElementFindingTest.qml
new file mode 100644
index 00000000..786017ee
--- /dev/null
+++ b/common/src/web/quick1/XPathElementFindingTest.qml
@@ -0,0 +1,116 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 500
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            objectName: "captionLabel"
+            text: "This Is Caption"
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Rectangle {
+                property alias text: captionText1.text
+                objectName: "defaultSelected"
+                height: 50
+                width: (parent.width - parent.spacing)/2
+                Text { id: captionText1; text: "First"; anchors.fill: parent; verticalAlignment: Text.AlignVCenter; horizontalAlignment:  Text.AlignHCenter; }
+                border.color: "black"
+                color: "green"
+            }
+
+            Rectangle {
+                property alias text: captionText2.text
+                objectName: "noSelected"
+                height: 50
+                width: (parent.width - parent.spacing)/2
+                Text { id: captionText2; text: "Second"; anchors.fill: parent; verticalAlignment: Text.AlignVCenter; horizontalAlignment:  Text.AlignHCenter; }
+                border.color: "black"
+                color: "yellow"
+            }
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            fillColor: "darkgrey"
+            text: "Example text"
+        }
+
+        TextInput {
+            objectName: "inputEmpty"
+            width: parent.width
+            fillColor: "darkgrey"
+        }
+
+        TextInput {
+            objectName: "inputDisabled"
+            width: parent.width
+            fillColor: "darkgrey"
+            text: "Read Only"
+            enabled: false
+            readOnly: false
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            fillColor: "darkgrey"
+            text: "Example text"
+        }
+
+        Item {
+            objectName: "scrollArea"
+            width: parent.width
+            height: 100
+
+            PushButton {
+                objectName: "buttonInScrollArea"
+                text: "Click here"
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick1/qmldir b/common/src/web/quick1/qmldir
new file mode 100644
index 00000000..da2def6b
--- /dev/null
+++ b/common/src/web/quick1/qmldir
@@ -0,0 +1 @@
+PushButton 1.0 PushButton.qml
diff --git a/common/src/web/quick2/BasicKeyboardInterfaceTest.qml b/common/src/web/quick2/BasicKeyboardInterfaceTest.qml
new file mode 100644
index 00000000..0d926deb
--- /dev/null
+++ b/common/src/web/quick2/BasicKeyboardInterfaceTest.qml
@@ -0,0 +1,108 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 200
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "Changed: "
+                color: "darkgrey"
+            }
+
+            Text {
+                id: resultIsKeyDown
+                objectName: "resultIsKeyDown"
+            }
+
+            Text {
+                id: resultIsKeyUp
+                objectName: "resultIsKeyUp"
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "Modifier: "
+                color: "darkgrey"
+            }
+
+            Text {
+                id: resultModifier
+                objectName: "resultModifier"
+            }
+        }
+
+        TextInput {
+            id: enabledTextElement
+            objectName: "enabledTextElement"
+            width: parent.width
+
+            Keys.onPressed: {
+                resultIsKeyDown.text = "Key Down";
+                var modifiers = ""
+
+                if (event.modifiers & Qt.ShiftModifier) modifiers += " Shift";
+                if (event.modifiers & Qt.ControlModifier) modifiers += " Ctrl";
+                if (event.modifiers & Qt.AltModifier) modifiers += " Alt";
+
+                resultModifier.text = modifiers;
+            }
+
+            Keys.onReleased: {
+                resultIsKeyUp.text = "Key Up";
+                var modifiers = ""
+
+                if (event.modifiers & Qt.ShiftModifier) modifiers += " Shift";
+                if (event.modifiers & Qt.ControlModifier) modifiers += " Ctrl";
+                if (event.modifiers & Qt.AltModifier) modifiers += " Alt";
+
+                resultModifier.text = modifiers;
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/BasicMouseInterfaceTest.qml b/common/src/web/quick2/BasicMouseInterfaceTest.qml
new file mode 100644
index 00000000..16e1b4cb
--- /dev/null
+++ b/common/src/web/quick2/BasicMouseInterfaceTest.qml
@@ -0,0 +1,88 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    id: root
+    width: 600
+    height: 500
+
+    Rectangle {
+        property alias text: caption.text
+        property string lastButtonEvent: ""
+        id: pureButton
+        objectName: "pureButton"
+        width: 100
+        height: 100
+        border.color: "black"
+        color: "red"
+        Text {
+            id: caption
+            anchors.fill: parent;
+            verticalAlignment: Text.AlignVCenter;
+            horizontalAlignment:  Text.AlignHCenter;
+            text: "Click me"
+        }
+
+        MouseArea {
+            id: hotSpot
+            anchors.fill: parent;
+            acceptedButtons: Qt.LeftButton | Qt.RightButton
+            onClicked: {
+                if (mouse.button == Qt.LeftButton)
+                    caption.text = "Clicked";
+                if (mouse.button == Qt.RightButton)
+                    caption.text = "ContextClicked";
+            }
+            onDoubleClicked: caption.text = "DoubleClicked"
+            onPressed: pureButton.lastButtonEvent = "Pressed"
+            onReleased: pureButton.lastButtonEvent = "Released"
+        }
+    }
+
+        Rectangle {
+            id: itemToDrag
+            objectName: "itemToDrag"
+            width: 100
+            height: 100
+            x: 300
+            y: 300
+
+            border.color: "black"
+            color: "green"
+
+            Text {
+                anchors.fill: parent;
+                verticalAlignment: Text.AlignVCenter;
+                horizontalAlignment:  Text.AlignHCenter;
+                text: "Drag me"
+            }
+
+            MouseArea {
+                id: contentMouseArea
+                anchors.fill: parent
+                drag.target: itemToDrag
+                onPressed: console.log("-----------pressed--------------" + itemToDrag.x + " : " + itemToDrag.y)
+                onReleased: console.log("-----------released--------------" + itemToDrag.x + " : " + itemToDrag.y)
+            }
+        }
+}
diff --git a/common/src/web/quick2/ClickTest.qml b/common/src/web/quick2/ClickTest.qml
new file mode 100644
index 00000000..2af3579e
--- /dev/null
+++ b/common/src/web/quick2/ClickTest.qml
@@ -0,0 +1,73 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        spacing: 20
+        width: 180
+
+        Text {
+            id: clickDisplay
+            objectName: "clickDisplay"
+            text: "no action"
+            font.pixelSize: 18
+        }
+
+        Rectangle {
+            id: button1
+            objectName: "button1"
+
+            width: parent.width
+            height: 40
+            color: "green"
+            Text {
+                //anchors.fill: parent
+                text: "push me"
+            }
+
+            MouseArea {
+                objectName: "mouseHotSpotButton1"
+                anchors.fill: parent
+                onClicked: { clickDisplay.text = "clicked button1" }
+            }
+        }
+
+        MouseArea {
+            objectName: "mouseHotSpotArea2"
+            width: 40
+            height: 40
+            onClicked: { clickDisplay.text = "clicked area 2" }
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/CoordinatesTest.qml b/common/src/web/quick2/CoordinatesTest.qml
new file mode 100644
index 00000000..96f37781
--- /dev/null
+++ b/common/src/web/quick2/CoordinatesTest.qml
@@ -0,0 +1,90 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Rectangle {
+        id: zeroSizedElement
+        objectName: "zeroSizedElement"
+        x: 8
+        y: 8
+        width: 0
+        height: 0
+        border.color: "black"
+        color: "red"
+    }
+
+    Rectangle {
+        id: mainRectangle
+        objectName: "mainRectangle"
+        anchors.top: parent.top
+        anchors.left: parent.left
+        anchors.topMargin: 10
+        anchors.leftMargin: 10
+        width: 100
+        height: 100
+        border.color: "black"
+        color: "green"
+    }
+
+    Rectangle {
+        id: transparentRect
+        objectName: "transparentRect"
+        anchors.top: mainRectangle.bottom
+        anchors.left: mainRectangle.left
+        anchors.topMargin: 10
+        width: 100
+        height: 30
+        border.color: "black"
+        color: "red"
+        opacity: 0
+    }
+
+    Rectangle {
+        id: hiddenRect
+        objectName: "hiddenRect"
+        anchors.top: mainRectangle.top
+        anchors.left: mainRectangle.right
+        anchors.leftMargin: 10
+        width: 30
+        height: 100
+        border.color: "black"
+        color: "blue"
+        visible: false
+    }
+
+    Item {
+        id: invisibleItem
+        objectName: "invisibleItem"
+        x: 3
+        y: 3
+        width: 3
+        height: 3
+    }
+
+
+}
+
diff --git a/common/src/web/quick2/ElementAttributeTest.qml b/common/src/web/quick2/ElementAttributeTest.qml
new file mode 100644
index 00000000..1d386fc3
--- /dev/null
+++ b/common/src/web/quick2/ElementAttributeTest.qml
@@ -0,0 +1,151 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                objectName: "displayedLabel"
+                text: "Visible Label"
+                color: "darkgrey"
+            }
+
+            Text {
+                objectName: "notDisplayedLabel"
+                text: "Invisible label."
+                visible: false
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Rectangle {
+                property alias text: buttonText1.text
+                id: button1
+                objectName: "workingButton"
+                enabled: true
+
+                width: 120
+                height: 40
+                color: "darkgrey"
+                Text {
+                    id: buttonText1
+                    text: "Working Button"
+                }
+            }
+
+            Rectangle {
+                property alias text: buttonText2.text
+                id: button2
+                objectName: "notWorkingButton"
+                enabled: false
+                visible: false
+
+                width: 120
+                height: 40
+                color: "darkgrey"
+                Text {
+                    id: buttonText2
+                    text: "Disabled button"
+                }
+            }
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+            Rectangle {
+                width: (parent.width - parent.spacing) / 2
+                height: 50
+                border.color: "black"
+                TextInput {
+                    id: disabledTextElement
+                    objectName: "disabledTextElement"
+                    anchors.fill: parent
+                    enabled: false
+                }
+            }
+
+            Rectangle {
+                width: (parent.width - parent.spacing) / 2
+                height: 50
+                border.color: "black"
+                TextInput {
+                    id: enabledTextElement
+                    objectName: "enabledTextElement"
+                    anchors.fill: parent
+                }
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 50
+            border.color: "black"
+            TextEdit {
+                id: areaWithDefaultText
+                objectName: "areaWithDefaultText"
+                anchors.fill: parent
+                text: "Example text"
+                readOnly: true
+                enabled: false
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 50
+            border.color: "black"
+            TextInput {
+                id: workingArea
+                objectName: "workingArea"
+                anchors.fill: parent
+            }
+        }
+
+    }
+}
+
diff --git a/common/src/web/quick2/FindingTest.qml b/common/src/web/quick2/FindingTest.qml
new file mode 100644
index 00000000..bfe936a0
--- /dev/null
+++ b/common/src/web/quick2/FindingTest.qml
@@ -0,0 +1,51 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Column {
+        spacing: 2
+
+        TextInput {
+            id: inputElement
+            objectName: "inputElement"
+            text: { "<b>" + "(^ ^)" + "</b>" }
+            font.pixelSize: 18
+        }
+
+        Rectangle { objectName: "hiddenRect"; color: "red"; width: 50; height: 50; visible: false }
+        Rectangle {
+            color: "green"; width: 20; height: 50;
+            MouseArea {
+                objectName: "mouseHotSpot"
+                anchors.fill: parent
+                onClicked: { parent.color = 'red' }
+            }
+        }
+        Rectangle { color: "blue"; width: 50; height: 20 }
+    }
+}
+
diff --git a/common/src/web/quick2/FormHandlingTest.qml b/common/src/web/quick2/FormHandlingTest.qml
new file mode 100644
index 00000000..63e6911b
--- /dev/null
+++ b/common/src/web/quick2/FormHandlingTest.qml
@@ -0,0 +1,80 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+
+            Text {
+                id: notClickableLabel
+                objectName: "notClickableLabel"
+                text: "Label not clickable"
+                color: "darkgrey"
+            }
+
+            PushButton {
+                objectName: "changeLabelButton"
+                text: "Change Label"
+                onButtonClick: notClickableLabel.text = "Label changed"
+            }
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            text: "Example text"
+        }
+
+        TextInput {
+            objectName: "emptyInput"
+            width: parent.width
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            text: "Example text"
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/JavascriptTest.qml b/common/src/web/quick2/JavascriptTest.qml
new file mode 100644
index 00000000..5302916e
--- /dev/null
+++ b/common/src/web/quick2/JavascriptTest.qml
@@ -0,0 +1,84 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    id: mainItem
+    property string title: "Javascript Test Page"
+    width: 320
+    height: 400
+
+    function sayHello(toWhom) {
+        return "Hello " + toWhom + " !";
+    }
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            id: result
+            objectName: "result"
+            text: "default"
+            color: "darkgrey"
+            width: parent.width
+        }
+
+        PushButton {
+            objectName: "changeLabelButton"
+            text: "Say hello"
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            text: "Example text"
+            //fillColor: "darkgrey"
+        }
+
+        TextInput {
+            objectName: "emptyInput"
+            width: parent.width
+            //fillColor: "darkgrey"
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            text: "Example text"
+            //fillColor: "darkgrey"
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/MultiTouchTest.qml b/common/src/web/quick2/MultiTouchTest.qml
new file mode 100644
index 00000000..7995a91d
--- /dev/null
+++ b/common/src/web/quick2/MultiTouchTest.qml
@@ -0,0 +1,92 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    width: 400
+    height: 600
+    color: "black"
+    Column {
+        spacing: 10
+        anchors.fill: parent
+
+        Row {
+            spacing: 10
+            Text {
+                text: "Zoom factor:"               
+                color: "white"
+            }
+            Text {
+                id: zoomFactorLbl
+                objectName: "zoomLbl"
+                color: "white"
+                text: "0"
+            }
+        }
+
+        Row {
+            spacing: 10
+            Text {
+                text: "Rotation:"
+                color: "white"
+            }
+            Text {
+                id: rotationLbl
+                objectName: "rotationLbl"
+                color: "white"
+                text: "0"
+            }
+        }
+
+        Rectangle {
+            height: 560
+            width: 400
+            color: "yellow"
+            Rectangle
+            {
+                id: actionItem
+                objectName: "pinchItem"
+                height: 20
+                width: 20
+                color: "blue"
+                anchors.centerIn: parent
+
+                PinchArea {
+                    anchors.fill: parent
+                    pinch.target: actionItem
+                    onPinchUpdated: {                  
+                        rotationLbl.text = Math.round(pinch.rotation)
+                        actionItem.rotation = Math.round(pinch.scale)
+                        zoomFactorLbl.text = pinch.scale
+                        actionItem.scale = pinch.scale
+                    }
+                    onPinchFinished: {
+                        rotationLbl.text = Math.round(pinch.rotation)
+                        actionItem.rotation = Math.round(pinch.rotation)
+                        zoomFactorLbl.text = pinch.scale
+                        actionItem.scale = pinch.scale
+                    }
+                }
+            }
+        }
+    }
+}
diff --git a/common/src/web/quick2/PushButton.qml b/common/src/web/quick2/PushButton.qml
new file mode 100644
index 00000000..9c6d0390
--- /dev/null
+++ b/common/src/web/quick2/PushButton.qml
@@ -0,0 +1,43 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    id: button
+    color: "red"
+    property alias text: caption.text
+    signal buttonClick()
+    width: 96; height: 24;
+
+    Text {
+        id: caption;
+        anchors.fill: parent;
+        verticalAlignment: Text.AlignVCenter;
+        horizontalAlignment:  Text.AlignHCenter;
+    }
+
+    MouseArea {
+        id: hotSpot
+        anchors.fill: parent;
+        onClicked: buttonClick()
+    }
+}
diff --git a/common/src/web/quick2/StaleElementReferenceTest.qml b/common/src/web/quick2/StaleElementReferenceTest.qml
new file mode 100644
index 00000000..830618f2
--- /dev/null
+++ b/common/src/web/quick2/StaleElementReferenceTest.qml
@@ -0,0 +1,63 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 200
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            objectName: "captionLabel"
+            text: "This Is Caption"
+            width: parent.width
+        }
+
+        Rectangle {
+            objectName: "clickButton"
+            border.color: "black"
+            color: "green"
+            width: parent.width
+            height: parent.height / 2
+            Text {
+                text: "Click me"
+                anchors.fill: parent
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/TestVideo.ogv b/common/src/web/quick2/TestVideo.ogv
new file mode 100644
index 00000000..e128d82b
Binary files /dev/null and b/common/src/web/quick2/TestVideo.ogv differ
diff --git a/common/src/web/quick2/TouchScrollTest.qml b/common/src/web/quick2/TouchScrollTest.qml
new file mode 100644
index 00000000..8af71c2d
--- /dev/null
+++ b/common/src/web/quick2/TouchScrollTest.qml
@@ -0,0 +1,311 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    id: root
+    width: 400
+    height: 620
+
+
+    ListView {
+        id: list_view
+        objectName: "listView"
+        anchors.fill: parent
+        spacing: 10
+        clip: true
+        property real maxVelocity: 0.0
+        onVerticalVelocityChanged: {
+            if (verticalVelocity > maxVelocity)
+            {
+                maxVelocity = verticalVelocity
+                resultLabel.text ="Flicked"
+            }
+
+        }
+        Text {
+            id: resultLabel
+            objectName: "resultLabel"
+            color: "black"
+        }
+
+        delegate: Item {
+            x: 0
+            height: 40
+            objectName: "item"+index
+            Rectangle {
+                width: root.width
+                height: 40
+                border.color: colorCode
+                border.width: 2
+                color: "white"
+
+                Text {
+                    text: name
+                    id: label
+                    anchors.verticalCenter: parent.verticalCenter
+                    anchors.horizontalCenter: parent.horizontalCenter
+                }
+
+            }
+
+        }
+
+        model: ListModel {
+            ListElement {
+                name: "Grey"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey2"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red2"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue2"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green2"
+                colorCode: "green"
+            }
+            ListElement {
+                name: "Grey3"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red3"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue3"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green3"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey4"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red4"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue4"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green4"
+                colorCode: "green"
+            }
+            ListElement {
+                name: "Grey5"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red5"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue5"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green5"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey6"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red6"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue6"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green6"
+                colorCode: "green"
+            }
+            ListElement {
+                name: "Grey7"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red7"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue7"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green7"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey8"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red8"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue8"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green8"
+                colorCode: "green"
+            }
+            ListElement {
+                name: "Grey9"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red9"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue9"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green9"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey10"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red10"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue10"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green10"
+                colorCode: "green"
+            }
+            ListElement {
+                name: "Grey11"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red11"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue11"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green11"
+                colorCode: "green"
+            }
+
+            ListElement {
+                name: "Grey12"
+                colorCode: "grey"
+            }
+
+            ListElement {
+                name: "Red12"
+                colorCode: "red"
+            }
+
+            ListElement {
+                name: "Blue12"
+                colorCode: "blue"
+            }
+
+            ListElement {
+                name: "Green12"
+                colorCode: "green"
+            }
+
+        }
+    }
+}
diff --git a/common/src/web/quick2/TouchTest.qml b/common/src/web/quick2/TouchTest.qml
new file mode 100644
index 00000000..f420225d
--- /dev/null
+++ b/common/src/web/quick2/TouchTest.qml
@@ -0,0 +1,170 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle{
+    width: 400
+    height: 620
+
+    Column
+    {
+        anchors.fill: parent
+        anchors.margins: 10
+        spacing: 10
+        Row{
+            spacing: 10
+            Text {
+                color: "black"
+                text: "Result: "
+            }
+            Text {
+                id: resultLabel
+                objectName: "resultLabel"
+                color: "black"
+                text: ""
+            }
+        }
+
+
+        Rectangle {
+            id: touchArea
+            objectName: "touchArea"
+            color: "#F1F1F1"
+
+            width: 380
+            height: 280
+            signal touchPress(int x, int y)
+            signal touchRelease(int x, int y)
+            signal touchMove(int x, int y)
+            Text {
+                anchors.centerIn: parent
+                color: "black"
+                text: "Touch Area"
+            }
+            MultiPointTouchArea {
+                anchors.fill: parent
+                touchPoints: [
+                    TouchPoint { id: point1 }
+                ]
+
+                onReleased: {
+                    releasePoint.visible = true
+                    touchArea.touchRelease(point1.x, point1.y)
+                    resultLabel.text = resultLabel.text+ "Released"
+                }
+
+                onUpdated: {
+                    movePoint.visible = true
+                    touchArea.touchMove(point1.x, point1.y)
+                    resultLabel.text = resultLabel.text + "Moved"
+                }
+
+                onPressed: {
+                    pressPoint.visible = true
+                    touchArea.touchPress(point1.x, point1.y)
+                    resultLabel.text = resultLabel.text + "Pressed"
+                }
+
+
+            }
+
+            Rectangle {
+                id: pressPoint
+                objectName: "pressPoint"
+                visible: false
+                width: 20
+                height: 20
+                radius: 10
+                color: "red"
+
+                function move(newx, newy) {
+                    x = newx - width/2;
+                    y = newy - height/2;
+                }
+            }
+
+            Rectangle {
+                id: movePoint
+                objectName: "movePoint"
+                visible: false
+                width: 20
+                height: 20
+                radius: 10
+                color: "yellow"
+
+                function move(newx, newy) {
+                    x = newx - width/2;
+                    y = newy - height/2;
+                }
+            }
+
+            Rectangle {
+                id: releasePoint
+                objectName: "releasePoint"
+                visible: false
+                width: 20
+                height: 20
+
+                radius: 10
+                color: "green"
+
+                function move(newx, newy) {
+                    x = newx - width/2;
+                    y = newy - height/2;
+                }
+            }
+
+            Component.onCompleted: {
+                touchArea.touchPress.connect(pressPoint.move);
+                touchArea.touchRelease.connect(releasePoint.move)
+                touchArea.touchMove.connect(movePoint.move)
+            }
+
+        }
+
+        Rectangle {
+            id: mouseArea
+            objectName: "mouseArea"
+            color: "#E1F1A1"
+
+            width: 380
+            height: 280
+            signal touchPress(int x, int y)
+            signal touchRelease(int x, int y)
+            signal touchMove(int x, int y)
+            Text {
+                anchors.centerIn: parent
+                color: "black"
+                text: "Mouse Area"
+            }
+
+            MouseArea {
+                anchors.fill: parent
+                onClicked: resultLabel.text = "Clicked"
+                onDoubleClicked:  resultLabel.text = "DoubleClicked"
+                onPressAndHold: resultLabel.text = "LongClicked"
+                onCanceled: resultLabel.text = "Canceled"
+            }
+        }
+
+     }
+}
diff --git a/common/src/web/quick2/TypingTest.qml b/common/src/web/quick2/TypingTest.qml
new file mode 100644
index 00000000..fc12445d
--- /dev/null
+++ b/common/src/web/quick2/TypingTest.qml
@@ -0,0 +1,92 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+import QtQuick.Controls 1.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Text {
+                text: "You changed:"
+                color: "darkgrey"
+            }
+
+            Text {
+                id: result
+                objectName: "result"
+                text: "default"
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 20
+            border.color: "black"
+
+            TextInput {
+                id: enabledTextElement
+                objectName: "enabledTextElement"
+                anchors.fill: parent
+                onTextChanged: {
+                    result.text = text;
+                }
+                onFocusChanged: console.log("textInput focus:"+activeFocus)
+            }
+        }
+
+        Rectangle {
+            width: parent.width
+            height: 80
+            border.color: "black"
+
+            TextEdit {
+                id: workingArea
+                objectName: "workingArea"
+                anchors.fill: parent
+                onFocusChanged: console.log("textEdit focus:"+activeFocus)
+            }
+        }
+    }
+
+}
+
diff --git a/common/src/web/quick2/VideoTest.qml b/common/src/web/quick2/VideoTest.qml
new file mode 100644
index 00000000..9cd9f6f5
--- /dev/null
+++ b/common/src/web/quick2/VideoTest.qml
@@ -0,0 +1,70 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+import QtMultimedia 5.0
+
+Rectangle {
+    id: root
+    width: 900
+    height: 700
+    MouseArea {
+        anchors.fill: parent
+        onClicked: {
+            Qt.quit();
+        }
+        z: 1.0
+    }
+
+    Rectangle{
+        width: 800
+        height: 600
+        color: "black"
+        anchors.horizontalCenter: parent.horizontalCenter
+        anchors.verticalCenter: parent.verticalCenter
+        transformOrigin: Item.Center
+
+        Video {
+            id: video
+            objectName: "videoPlayer"
+            width: metaData.resolution ? metaData.resolution.width : 0
+            height: metaData.resolution ? metaData.resolution.height : 0
+            transformOrigin: Item.BottomRight
+            anchors.horizontalCenter: parent.horizontalCenter
+            anchors.verticalCenter: parent.verticalCenter
+            source: "./TestVideo.ogv"
+
+            MouseArea {
+                anchors.fill: parent
+                onClicked: {
+                    video.play()
+                }
+                z: 3.0
+            }
+
+            focus: true
+            Keys.onSpacePressed: video.playbackState == MediaPlayer.PlayingState ? video.pause() : video.play()
+            Keys.onLeftPressed: video.seek(video.position - 5000)
+            Keys.onRightPressed: video.seek(video.position + 5000)
+        }
+        z: 2.0
+    }
+}
diff --git a/common/src/web/quick2/VisibilityTest.qml b/common/src/web/quick2/VisibilityTest.qml
new file mode 100644
index 00000000..3bc35dcd
--- /dev/null
+++ b/common/src/web/quick2/VisibilityTest.qml
@@ -0,0 +1,104 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 400
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Row {
+            spacing: 10
+
+            Text {
+                objectName: "notDisplayedLabel"
+                text: "No Visible Label"
+                color: "darkgrey"
+                visible: false
+            }
+
+            Text {
+                objectName: "displayedLabel"
+                text: "Visible Label"
+                color: "darkgrey"
+            }
+
+            Text {
+                objectName: "zeroLabel"
+                color: "darkgrey"
+                width: 0
+                height: 0
+            }
+        }
+
+        Row {
+            spacing: 10
+
+            PushButton {
+                objectName: "buttonCanHide"
+                text: "Click to Hide"
+                onButtonClick: visible = false
+            }
+
+            PushButton {
+                objectName: "buttonHidden"
+                text: "hidden"
+                visible: false
+            }
+        }
+
+        TextInput {
+            objectName: "inputHidden"
+            width: parent.width
+            visible: false
+        }
+
+        Rectangle {
+            objectName: "hiddenScrollArea"
+            width: parent.width
+            height: 100
+            border.color: "black"
+            visible: false
+
+            PushButton {
+                objectName: "buttonInScrollArea"
+                text: "Click here"
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/WindowTest.qml b/common/src/web/quick2/WindowTest.qml
new file mode 100644
index 00000000..7af309fc
--- /dev/null
+++ b/common/src/web/quick2/WindowTest.qml
@@ -0,0 +1,38 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 240
+
+    Text {
+        id: content
+        text: "WindowTest"
+        font.pointSize: 24
+        verticalAlignment: Text.AlignVCenter
+        horizontalAlignment: Text.AlignHCenter
+        width: parent.width
+        height: parent.height
+    }
+}
diff --git a/common/src/web/quick2/XPathElementFindingTest.qml b/common/src/web/quick2/XPathElementFindingTest.qml
new file mode 100644
index 00000000..8033ce16
--- /dev/null
+++ b/common/src/web/quick2/XPathElementFindingTest.qml
@@ -0,0 +1,112 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+import QtQuick 2.0
+
+Rectangle {
+    property string title
+    width: 320
+    height: 500
+
+    Column {
+        anchors.left: parent.left
+        anchors.leftMargin: 10
+
+        anchors.top: parent.top
+        anchors.topMargin: 10
+
+        anchors.right: parent.right
+        anchors.rightMargin: 10
+
+        anchors.bottom: parent.bottom
+        anchors.bottomMargin: 10
+
+        spacing: 20
+
+        Text {
+            objectName: "captionLabel"
+            text: "This Is Caption"
+        }
+
+        Row {
+            spacing: 10
+            width: parent.width
+
+            Rectangle {
+                property alias text: captionText1.text
+                objectName: "defaultSelected"
+                height: 50
+                width: (parent.width - parent.spacing)/2
+                Text { id: captionText1; text: "First"; anchors.fill: parent; verticalAlignment: Text.AlignVCenter; horizontalAlignment:  Text.AlignHCenter; }
+                border.color: "black"
+                color: "green"
+            }
+
+            Rectangle {
+                property alias text: captionText2.text
+                objectName: "noSelected"
+                height: 50
+                width: (parent.width - parent.spacing)/2
+                Text { id: captionText2; text: "Second"; anchors.fill: parent; verticalAlignment: Text.AlignVCenter; horizontalAlignment:  Text.AlignHCenter; }
+                border.color: "black"
+                color: "yellow"
+            }
+        }
+
+        TextInput {
+            objectName: "inputElement"
+            width: parent.width
+            text: "Example text"
+        }
+
+        TextInput {
+            objectName: "inputEmpty"
+            width: parent.width
+        }
+
+        TextInput {
+            objectName: "inputDisabled"
+            width: parent.width
+            text: "Read Only"
+            enabled: false
+            readOnly: false
+        }
+
+        TextEdit {
+            objectName: "workingArea"
+            width: parent.width
+            height: 100
+            text: "Example text"
+        }
+
+        Item {
+            objectName: "scrollArea"
+            width: parent.width
+            height: 100
+
+            PushButton {
+                objectName: "buttonInScrollArea"
+                text: "Click here"
+            }
+        }
+    }
+}
+
diff --git a/common/src/web/quick2/qmldir b/common/src/web/quick2/qmldir
new file mode 100644
index 00000000..da2def6b
--- /dev/null
+++ b/common/src/web/quick2/qmldir
@@ -0,0 +1 @@
+PushButton 1.0 PushButton.qml
diff --git a/common/src/web/touch/img.jpg b/common/src/web/touch/img.jpg
new file mode 100644
index 00000000..7d4a1ae5
Binary files /dev/null and b/common/src/web/touch/img.jpg differ
diff --git a/common/src/web/touch/prototype.js b/common/src/web/touch/prototype.js
new file mode 100644
index 00000000..cbf24c64
--- /dev/null
+++ b/common/src/web/touch/prototype.js
@@ -0,0 +1,6072 @@
+/*  Prototype JavaScript framework, version 1.7_rc2
+ *  (c) 2005-2010 Sam Stephenson
+ *
+ *  Prototype is freely distributable under the terms of an MIT-style license.
+ *  For details, see the Prototype web site: http://www.prototypejs.org/
+ *
+ *--------------------------------------------------------------------------*/
+
+var Prototype = {
+
+  Version: '1.7_rc2',
+
+  Browser: (function(){
+    var ua = navigator.userAgent;
+    var isOpera = Object.prototype.toString.call(window.opera) == '[object Opera]';
+    return {
+      IE:             !!window.attachEvent && !isOpera,
+      Opera:          isOpera,
+      WebKit:         ua.indexOf('AppleWebKit/') > -1,
+      Gecko:          ua.indexOf('Gecko') > -1 && ua.indexOf('KHTML') === -1,
+      MobileSafari:   /Apple.*Mobile/.test(ua)
+    }
+  })(),
+
+  BrowserFeatures: {
+    XPath: !!document.evaluate,
+
+    SelectorsAPI: !!document.querySelector,
+
+    ElementExtensions: (function() {
+      var constructor = window.Element || window.HTMLElement;
+      return !!(constructor && constructor.prototype);
+    })(),
+    SpecificElementExtensions: (function() {
+      if (typeof window.HTMLDivElement !== 'undefined')
+        return true;
+
+      var div = document.createElement('div'),
+          form = document.createElement('form'),
+          isSupported = false;
+
+      if (div['__proto__'] && (div['__proto__'] !== form['__proto__'])) {
+        isSupported = true;
+      }
+
+      div = form = null;
+
+      return isSupported;
+    })()
+  },
+
+  ScriptFragment: '<script[^>]*>([\\S\\s]*?)<\/script>',
+  JSONFilter: /^\/\*-secure-([\s\S]*)\*\/\s*$/,
+
+  emptyFunction: function() { },
+
+  K: function(x) { return x }
+};
+
+if (Prototype.Browser.MobileSafari)
+  Prototype.BrowserFeatures.SpecificElementExtensions = false;
+
+
+var Abstract = { };
+
+
+var Try = {
+  these: function() {
+    var returnValue;
+
+    for (var i = 0, length = arguments.length; i < length; i++) {
+      var lambda = arguments[i];
+      try {
+        returnValue = lambda();
+        break;
+      } catch (e) { }
+    }
+
+    return returnValue;
+  }
+};
+
+/* Based on Alex Arnell's inheritance implementation. */
+
+var Class = (function() {
+
+  var IS_DONTENUM_BUGGY = (function(){
+    for (var p in { toString: 1 }) {
+      if (p === 'toString') return false;
+    }
+    return true;
+  })();
+
+  function subclass() {};
+  function create() {
+    var parent = null, properties = $A(arguments);
+    if (Object.isFunction(properties[0]))
+      parent = properties.shift();
+
+    function klass() {
+      this.initialize.apply(this, arguments);
+    }
+
+    Object.extend(klass, Class.Methods);
+    klass.superclass = parent;
+    klass.subclasses = [];
+
+    if (parent) {
+      subclass.prototype = parent.prototype;
+      klass.prototype = new subclass;
+      parent.subclasses.push(klass);
+    }
+
+    for (var i = 0, length = properties.length; i < length; i++)
+      klass.addMethods(properties[i]);
+
+    if (!klass.prototype.initialize)
+      klass.prototype.initialize = Prototype.emptyFunction;
+
+    klass.prototype.constructor = klass;
+    return klass;
+  }
+
+  function addMethods(source) {
+    var ancestor   = this.superclass && this.superclass.prototype,
+        properties = Object.keys(source);
+
+    if (IS_DONTENUM_BUGGY) {
+      if (source.toString != Object.prototype.toString)
+        properties.push("toString");
+      if (source.valueOf != Object.prototype.valueOf)
+        properties.push("valueOf");
+    }
+
+    for (var i = 0, length = properties.length; i < length; i++) {
+      var property = properties[i], value = source[property];
+      if (ancestor && Object.isFunction(value) &&
+          value.argumentNames()[0] == "$super") {
+        var method = value;
+        value = (function(m) {
+          return function() { return ancestor[m].apply(this, arguments); };
+        })(property).wrap(method);
+
+        value.valueOf = method.valueOf.bind(method);
+        value.toString = method.toString.bind(method);
+      }
+      this.prototype[property] = value;
+    }
+
+    return this;
+  }
+
+  return {
+    create: create,
+    Methods: {
+      addMethods: addMethods
+    }
+  };
+})();
+(function() {
+
+  var _toString = Object.prototype.toString,
+      NULL_TYPE = 'Null',
+      UNDEFINED_TYPE = 'Undefined',
+      BOOLEAN_TYPE = 'Boolean',
+      NUMBER_TYPE = 'Number',
+      STRING_TYPE = 'String',
+      OBJECT_TYPE = 'Object',
+      BOOLEAN_CLASS = '[object Boolean]',
+      NUMBER_CLASS = '[object Number]',
+      STRING_CLASS = '[object String]',
+      ARRAY_CLASS = '[object Array]',
+      NATIVE_JSON_STRINGIFY_SUPPORT = window.JSON &&
+        typeof JSON.stringify === 'function' &&
+        JSON.stringify(0) === '0' &&
+        typeof JSON.stringify(Prototype.K) === 'undefined';
+
+  function Type(o) {
+    switch(o) {
+      case null: return NULL_TYPE;
+      case (void 0): return UNDEFINED_TYPE;
+    }
+    var type = typeof o;
+    switch(type) {
+      case 'boolean': return BOOLEAN_TYPE;
+      case 'number':  return NUMBER_TYPE;
+      case 'string':  return STRING_TYPE;
+    }
+    return OBJECT_TYPE;
+  }
+
+  function extend(destination, source) {
+    for (var property in source)
+      destination[property] = source[property];
+    return destination;
+  }
+
+  function inspect(object) {
+    try {
+      if (isUndefined(object)) return 'undefined';
+      if (object === null) return 'null';
+      return object.inspect ? object.inspect() : String(object);
+    } catch (e) {
+      if (e instanceof RangeError) return '...';
+      throw e;
+    }
+  }
+
+  function toJSON(value) {
+    return Str('', { '': value }, []);
+  }
+
+  function Str(key, holder, stack) {
+    var value = holder[key],
+        type = typeof value;
+
+    if (Type(value) === OBJECT_TYPE && typeof value.toJSON === 'function') {
+      value = value.toJSON(key);
+    }
+
+    var _class = _toString.call(value);
+
+    switch (_class) {
+      case NUMBER_CLASS:
+      case BOOLEAN_CLASS:
+      case STRING_CLASS:
+        value = value.valueOf();
+    }
+
+    switch (value) {
+      case null: return 'null';
+      case true: return 'true';
+      case false: return 'false';
+    }
+
+    type = typeof value;
+    switch (type) {
+      case 'string':
+        return value.inspect(true);
+      case 'number':
+        return isFinite(value) ? String(value) : 'null';
+      case 'object':
+
+        for (var i = 0, length = stack.length; i < length; i++) {
+          if (stack[i] === value) { throw new TypeError(); }
+        }
+        stack.push(value);
+
+        var partial = [];
+        if (_class === ARRAY_CLASS) {
+          for (var i = 0, length = value.length; i < length; i++) {
+            var str = Str(i, value, stack);
+            partial.push(typeof str === 'undefined' ? 'null' : str);
+          }
+          partial = '[' + partial.join(',') + ']';
+        } else {
+          var keys = Object.keys(value);
+          for (var i = 0, length = keys.length; i < length; i++) {
+            var key = keys[i], str = Str(key, value, stack);
+            if (typeof str !== "undefined") {
+               partial.push(key.inspect(true)+ ':' + str);
+             }
+          }
+          partial = '{' + partial.join(',') + '}';
+        }
+        stack.pop();
+        return partial;
+    }
+  }
+
+  function stringify(object) {
+    return JSON.stringify(object);
+  }
+
+  function toQueryString(object) {
+    return $H(object).toQueryString();
+  }
+
+  function toHTML(object) {
+    return object && object.toHTML ? object.toHTML() : String.interpret(object);
+  }
+
+  function keys(object) {
+    if (Type(object) !== OBJECT_TYPE) { throw new TypeError(); }
+    var results = [];
+    for (var property in object) {
+      if (object.hasOwnProperty(property)) {
+        results.push(property);
+      }
+    }
+    return results;
+  }
+
+  function values(object) {
+    var results = [];
+    for (var property in object)
+      results.push(object[property]);
+    return results;
+  }
+
+  function clone(object) {
+    return extend({ }, object);
+  }
+
+  function isElement(object) {
+    return !!(object && object.nodeType == 1);
+  }
+
+  function isArray(object) {
+    return _toString.call(object) === ARRAY_CLASS;
+  }
+
+  var hasNativeIsArray = (typeof Array.isArray == 'function')
+    && Array.isArray([]) && !Array.isArray({});
+
+  if (hasNativeIsArray) {
+    isArray = Array.isArray;
+  }
+
+  function isHash(object) {
+    return object instanceof Hash;
+  }
+
+  function isFunction(object) {
+    return typeof object === "function";
+  }
+
+  function isString(object) {
+    return _toString.call(object) === STRING_CLASS;
+  }
+
+  function isNumber(object) {
+    return _toString.call(object) === NUMBER_CLASS;
+  }
+
+  function isUndefined(object) {
+    return typeof object === "undefined";
+  }
+
+  extend(Object, {
+    extend:        extend,
+    inspect:       inspect,
+    toJSON:        NATIVE_JSON_STRINGIFY_SUPPORT ? stringify : toJSON,
+    toQueryString: toQueryString,
+    toHTML:        toHTML,
+    keys:          Object.keys || keys,
+    values:        values,
+    clone:         clone,
+    isElement:     isElement,
+    isArray:       isArray,
+    isHash:        isHash,
+    isFunction:    isFunction,
+    isString:      isString,
+    isNumber:      isNumber,
+    isUndefined:   isUndefined
+  });
+})();
+Object.extend(Function.prototype, (function() {
+  var slice = Array.prototype.slice;
+
+  function update(array, args) {
+    var arrayLength = array.length, length = args.length;
+    while (length--) array[arrayLength + length] = args[length];
+    return array;
+  }
+
+  function merge(array, args) {
+    array = slice.call(array, 0);
+    return update(array, args);
+  }
+
+  function argumentNames() {
+    var names = this.toString().match(/^[\s\(]*function[^(]*\(([^)]*)\)/)[1]
+      .replace(/\/\/.*?[\r\n]|\/\*(?:.|[\r\n])*?\*\//g, '')
+      .replace(/\s+/g, '').split(',');
+    return names.length == 1 && !names[0] ? [] : names;
+  }
+
+  function bind(context) {
+    if (arguments.length < 2 && Object.isUndefined(arguments[0])) return this;
+    var __method = this, args = slice.call(arguments, 1);
+    return function() {
+      var a = merge(args, arguments);
+      return __method.apply(context, a);
+    }
+  }
+
+  function bindAsEventListener(context) {
+    var __method = this, args = slice.call(arguments, 1);
+    return function(event) {
+      var a = update([event || window.event], args);
+      return __method.apply(context, a);
+    }
+  }
+
+  function curry() {
+    if (!arguments.length) return this;
+    var __method = this, args = slice.call(arguments, 0);
+    return function() {
+      var a = merge(args, arguments);
+      return __method.apply(this, a);
+    }
+  }
+
+  function delay(timeout) {
+    var __method = this, args = slice.call(arguments, 1);
+    timeout = timeout * 1000;
+    return window.setTimeout(function() {
+      return __method.apply(__method, args);
+    }, timeout);
+  }
+
+  function defer() {
+    var args = update([0.01], arguments);
+    return this.delay.apply(this, args);
+  }
+
+  function wrap(wrapper) {
+    var __method = this;
+    return function() {
+      var a = update([__method.bind(this)], arguments);
+      return wrapper.apply(this, a);
+    }
+  }
+
+  function methodize() {
+    if (this._methodized) return this._methodized;
+    var __method = this;
+    return this._methodized = function() {
+      var a = update([this], arguments);
+      return __method.apply(null, a);
+    };
+  }
+
+  return {
+    argumentNames:       argumentNames,
+    bind:                bind,
+    bindAsEventListener: bindAsEventListener,
+    curry:               curry,
+    delay:               delay,
+    defer:               defer,
+    wrap:                wrap,
+    methodize:           methodize
+  }
+})());
+
+
+
+(function(proto) {
+
+
+  function toISOString() {
+    return this.getUTCFullYear() + '-' +
+      (this.getUTCMonth() + 1).toPaddedString(2) + '-' +
+      this.getUTCDate().toPaddedString(2) + 'T' +
+      this.getUTCHours().toPaddedString(2) + ':' +
+      this.getUTCMinutes().toPaddedString(2) + ':' +
+      this.getUTCSeconds().toPaddedString(2) + 'Z';
+  }
+
+
+  function toJSON() {
+    return this.toISOString();
+  }
+
+  if (!proto.toISOString) proto.toISOString = toISOString;
+  if (!proto.toJSON) proto.toJSON = toJSON;
+
+})(Date.prototype);
+
+
+RegExp.prototype.match = RegExp.prototype.test;
+
+RegExp.escape = function(str) {
+  return String(str).replace(/([.*+?^=!:${}()|[\]\/\\])/g, '\\$1');
+};
+var PeriodicalExecuter = Class.create({
+  initialize: function(callback, frequency) {
+    this.callback = callback;
+    this.frequency = frequency;
+    this.currentlyExecuting = false;
+
+    this.registerCallback();
+  },
+
+  registerCallback: function() {
+    this.timer = setInterval(this.onTimerEvent.bind(this), this.frequency * 1000);
+  },
+
+  execute: function() {
+    this.callback(this);
+  },
+
+  stop: function() {
+    if (!this.timer) return;
+    clearInterval(this.timer);
+    this.timer = null;
+  },
+
+  onTimerEvent: function() {
+    if (!this.currentlyExecuting) {
+      try {
+        this.currentlyExecuting = true;
+        this.execute();
+        this.currentlyExecuting = false;
+      } catch(e) {
+        this.currentlyExecuting = false;
+        throw e;
+      }
+    }
+  }
+});
+Object.extend(String, {
+  interpret: function(value) {
+    return value == null ? '' : String(value);
+  },
+  specialChar: {
+    '\b': '\\b',
+    '\t': '\\t',
+    '\n': '\\n',
+    '\f': '\\f',
+    '\r': '\\r',
+    '\\': '\\\\'
+  }
+});
+
+Object.extend(String.prototype, (function() {
+  var NATIVE_JSON_PARSE_SUPPORT = window.JSON &&
+    typeof JSON.parse === 'function' &&
+    JSON.parse('{"test": true}').test;
+
+  function prepareReplacement(replacement) {
+    if (Object.isFunction(replacement)) return replacement;
+    var template = new Template(replacement);
+    return function(match) { return template.evaluate(match) };
+  }
+
+  function gsub(pattern, replacement) {
+    var result = '', source = this, match;
+    replacement = prepareReplacement(replacement);
+
+    if (Object.isString(pattern))
+      pattern = RegExp.escape(pattern);
+
+    if (!(pattern.length || pattern.source)) {
+      replacement = replacement('');
+      return replacement + source.split('').join(replacement) + replacement;
+    }
+
+    while (source.length > 0) {
+      if (match = source.match(pattern)) {
+        result += source.slice(0, match.index);
+        result += String.interpret(replacement(match));
+        source  = source.slice(match.index + match[0].length);
+      } else {
+        result += source, source = '';
+      }
+    }
+    return result;
+  }
+
+  function sub(pattern, replacement, count) {
+    replacement = prepareReplacement(replacement);
+    count = Object.isUndefined(count) ? 1 : count;
+
+    return this.gsub(pattern, function(match) {
+      if (--count < 0) return match[0];
+      return replacement(match);
+    });
+  }
+
+  function scan(pattern, iterator) {
+    this.gsub(pattern, iterator);
+    return String(this);
+  }
+
+  function truncate(length, truncation) {
+    length = length || 30;
+    truncation = Object.isUndefined(truncation) ? '...' : truncation;
+    return this.length > length ?
+      this.slice(0, length - truncation.length) + truncation : String(this);
+  }
+
+  function strip() {
+    return this.replace(/^\s+/, '').replace(/\s+$/, '');
+  }
+
+  function stripTags() {
+    return this.replace(/<\w+(\s+("[^"]*"|'[^']*'|[^>])+)?>|<\/\w+>/gi, '');
+  }
+
+  function stripScripts() {
+    return this.replace(new RegExp(Prototype.ScriptFragment, 'img'), '');
+  }
+
+  function extractScripts() {
+    var matchAll = new RegExp(Prototype.ScriptFragment, 'img'),
+        matchOne = new RegExp(Prototype.ScriptFragment, 'im');
+    return (this.match(matchAll) || []).map(function(scriptTag) {
+      return (scriptTag.match(matchOne) || ['', ''])[1];
+    });
+  }
+
+  function evalScripts() {
+    return this.extractScripts().map(function(script) { return eval(script) });
+  }
+
+  function escapeHTML() {
+    return this.replace(/&/g,'&amp;').replace(/</g,'&lt;').replace(/>/g,'&gt;');
+  }
+
+  function unescapeHTML() {
+    return this.stripTags().replace(/&lt;/g,'<').replace(/&gt;/g,'>').replace(/&amp;/g,'&');
+  }
+
+
+  function toQueryParams(separator) {
+    var match = this.strip().match(/([^?#]*)(#.*)?$/);
+    if (!match) return { };
+
+    return match[1].split(separator || '&').inject({ }, function(hash, pair) {
+      if ((pair = pair.split('='))[0]) {
+        var key = decodeURIComponent(pair.shift()),
+            value = pair.length > 1 ? pair.join('=') : pair[0];
+
+        if (value != undefined) value = decodeURIComponent(value);
+
+        if (key in hash) {
+          if (!Object.isArray(hash[key])) hash[key] = [hash[key]];
+          hash[key].push(value);
+        }
+        else hash[key] = value;
+      }
+      return hash;
+    });
+  }
+
+  function toArray() {
+    return this.split('');
+  }
+
+  function succ() {
+    return this.slice(0, this.length - 1) +
+      String.fromCharCode(this.charCodeAt(this.length - 1) + 1);
+  }
+
+  function times(count) {
+    return count < 1 ? '' : new Array(count + 1).join(this);
+  }
+
+  function camelize() {
+    return this.replace(/-+(.)?/g, function(match, chr) {
+      return chr ? chr.toUpperCase() : '';
+    });
+  }
+
+  function capitalize() {
+    return this.charAt(0).toUpperCase() + this.substring(1).toLowerCase();
+  }
+
+  function underscore() {
+    return this.replace(/::/g, '/')
+               .replace(/([A-Z]+)([A-Z][a-z])/g, '$1_$2')
+               .replace(/([a-z\d])([A-Z])/g, '$1_$2')
+               .replace(/-/g, '_')
+               .toLowerCase();
+  }
+
+  function dasherize() {
+    return this.replace(/_/g, '-');
+  }
+
+  function inspect(useDoubleQuotes) {
+    var escapedString = this.replace(/[\x00-\x1f\\]/g, function(character) {
+      if (character in String.specialChar) {
+        return String.specialChar[character];
+      }
+      return '\\u00' + character.charCodeAt().toPaddedString(2, 16);
+    });
+    if (useDoubleQuotes) return '"' + escapedString.replace(/"/g, '\\"') + '"';
+    return "'" + escapedString.replace(/'/g, '\\\'') + "'";
+  }
+
+  function unfilterJSON(filter) {
+    return this.replace(filter || Prototype.JSONFilter, '$1');
+  }
+
+  function isJSON() {
+    var str = this;
+    if (str.blank()) return false;
+    str = str.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@');
+    str = str.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']');
+    str = str.replace(/(?:^|:|,)(?:\s*\[)+/g, '');
+    return (/^[\],:{}\s]*$/).test(str);
+  }
+
+  function evalJSON(sanitize) {
+    var json = this.unfilterJSON(),
+        cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g;
+    if (cx.test(json)) {
+      json = json.replace(cx, function (a) {
+        return '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
+      });
+    }
+    try {
+      if (!sanitize || json.isJSON()) return eval('(' + json + ')');
+    } catch (e) { }
+    throw new SyntaxError('Badly formed JSON string: ' + this.inspect());
+  }
+
+  function parseJSON() {
+    var json = this.unfilterJSON();
+    return JSON.parse(json);
+  }
+
+  function include(pattern) {
+    return this.indexOf(pattern) > -1;
+  }
+
+  function startsWith(pattern) {
+    return this.lastIndexOf(pattern, 0) === 0;
+  }
+
+  function endsWith(pattern) {
+    var d = this.length - pattern.length;
+    return d >= 0 && this.indexOf(pattern, d) === d;
+  }
+
+  function empty() {
+    return this == '';
+  }
+
+  function blank() {
+    return /^\s*$/.test(this);
+  }
+
+  function interpolate(object, pattern) {
+    return new Template(this, pattern).evaluate(object);
+  }
+
+  return {
+    gsub:           gsub,
+    sub:            sub,
+    scan:           scan,
+    truncate:       truncate,
+    strip:          String.prototype.trim || strip,
+    stripTags:      stripTags,
+    stripScripts:   stripScripts,
+    extractScripts: extractScripts,
+    evalScripts:    evalScripts,
+    escapeHTML:     escapeHTML,
+    unescapeHTML:   unescapeHTML,
+    toQueryParams:  toQueryParams,
+    parseQuery:     toQueryParams,
+    toArray:        toArray,
+    succ:           succ,
+    times:          times,
+    camelize:       camelize,
+    capitalize:     capitalize,
+    underscore:     underscore,
+    dasherize:      dasherize,
+    inspect:        inspect,
+    unfilterJSON:   unfilterJSON,
+    isJSON:         isJSON,
+    evalJSON:       NATIVE_JSON_PARSE_SUPPORT ? parseJSON : evalJSON,
+    include:        include,
+    startsWith:     startsWith,
+    endsWith:       endsWith,
+    empty:          empty,
+    blank:          blank,
+    interpolate:    interpolate
+  };
+})());
+
+var Template = Class.create({
+  initialize: function(template, pattern) {
+    this.template = template.toString();
+    this.pattern = pattern || Template.Pattern;
+  },
+
+  evaluate: function(object) {
+    if (object && Object.isFunction(object.toTemplateReplacements))
+      object = object.toTemplateReplacements();
+
+    return this.template.gsub(this.pattern, function(match) {
+      if (object == null) return (match[1] + '');
+
+      var before = match[1] || '';
+      if (before == '\\') return match[2];
+
+      var ctx = object, expr = match[3],
+          pattern = /^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/;
+
+      match = pattern.exec(expr);
+      if (match == null) return before;
+
+      while (match != null) {
+        var comp = match[1].startsWith('[') ? match[2].replace(/\\\\]/g, ']') : match[1];
+        ctx = ctx[comp];
+        if (null == ctx || '' == match[3]) break;
+        expr = expr.substring('[' == match[3] ? match[1].length : match[0].length);
+        match = pattern.exec(expr);
+      }
+
+      return before + String.interpret(ctx);
+    });
+  }
+});
+Template.Pattern = /(^|.|\r|\n)(#\{(.*?)\})/;
+
+var $break = { };
+
+var Enumerable = (function() {
+  function each(iterator, context) {
+    var index = 0;
+    try {
+      this._each(function(value) {
+        iterator.call(context, value, index++);
+      });
+    } catch (e) {
+      if (e != $break) throw e;
+    }
+    return this;
+  }
+
+  function eachSlice(number, iterator, context) {
+    var index = -number, slices = [], array = this.toArray();
+    if (number < 1) return array;
+    while ((index += number) < array.length)
+      slices.push(array.slice(index, index+number));
+    return slices.collect(iterator, context);
+  }
+
+  function all(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var result = true;
+    this.each(function(value, index) {
+      result = result && !!iterator.call(context, value, index);
+      if (!result) throw $break;
+    });
+    return result;
+  }
+
+  function any(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var result = false;
+    this.each(function(value, index) {
+      if (result = !!iterator.call(context, value, index))
+        throw $break;
+    });
+    return result;
+  }
+
+  function collect(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var results = [];
+    this.each(function(value, index) {
+      results.push(iterator.call(context, value, index));
+    });
+    return results;
+  }
+
+  function detect(iterator, context) {
+    var result;
+    this.each(function(value, index) {
+      if (iterator.call(context, value, index)) {
+        result = value;
+        throw $break;
+      }
+    });
+    return result;
+  }
+
+  function findAll(iterator, context) {
+    var results = [];
+    this.each(function(value, index) {
+      if (iterator.call(context, value, index))
+        results.push(value);
+    });
+    return results;
+  }
+
+  function grep(filter, iterator, context) {
+    iterator = iterator || Prototype.K;
+    var results = [];
+
+    if (Object.isString(filter))
+      filter = new RegExp(RegExp.escape(filter));
+
+    this.each(function(value, index) {
+      if (filter.match(value))
+        results.push(iterator.call(context, value, index));
+    });
+    return results;
+  }
+
+  function include(object) {
+    if (Object.isFunction(this.indexOf))
+      if (this.indexOf(object) != -1) return true;
+
+    var found = false;
+    this.each(function(value) {
+      if (value == object) {
+        found = true;
+        throw $break;
+      }
+    });
+    return found;
+  }
+
+  function inGroupsOf(number, fillWith) {
+    fillWith = Object.isUndefined(fillWith) ? null : fillWith;
+    return this.eachSlice(number, function(slice) {
+      while(slice.length < number) slice.push(fillWith);
+      return slice;
+    });
+  }
+
+  function inject(memo, iterator, context) {
+    this.each(function(value, index) {
+      memo = iterator.call(context, memo, value, index);
+    });
+    return memo;
+  }
+
+  function invoke(method) {
+    var args = $A(arguments).slice(1);
+    return this.map(function(value) {
+      return value[method].apply(value, args);
+    });
+  }
+
+  function max(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var result;
+    this.each(function(value, index) {
+      value = iterator.call(context, value, index);
+      if (result == null || value >= result)
+        result = value;
+    });
+    return result;
+  }
+
+  function min(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var result;
+    this.each(function(value, index) {
+      value = iterator.call(context, value, index);
+      if (result == null || value < result)
+        result = value;
+    });
+    return result;
+  }
+
+  function partition(iterator, context) {
+    iterator = iterator || Prototype.K;
+    var trues = [], falses = [];
+    this.each(function(value, index) {
+      (iterator.call(context, value, index) ?
+        trues : falses).push(value);
+    });
+    return [trues, falses];
+  }
+
+  function pluck(property) {
+    var results = [];
+    this.each(function(value) {
+      results.push(value[property]);
+    });
+    return results;
+  }
+
+  function reject(iterator, context) {
+    var results = [];
+    this.each(function(value, index) {
+      if (!iterator.call(context, value, index))
+        results.push(value);
+    });
+    return results;
+  }
+
+  function sortBy(iterator, context) {
+    return this.map(function(value, index) {
+      return {
+        value: value,
+        criteria: iterator.call(context, value, index)
+      };
+    }).sort(function(left, right) {
+      var a = left.criteria, b = right.criteria;
+      return a < b ? -1 : a > b ? 1 : 0;
+    }).pluck('value');
+  }
+
+  function toArray() {
+    return this.map();
+  }
+
+  function zip() {
+    var iterator = Prototype.K, args = $A(arguments);
+    if (Object.isFunction(args.last()))
+      iterator = args.pop();
+
+    var collections = [this].concat(args).map($A);
+    return this.map(function(value, index) {
+      return iterator(collections.pluck(index));
+    });
+  }
+
+  function size() {
+    return this.toArray().length;
+  }
+
+  function inspect() {
+    return '#<Enumerable:' + this.toArray().inspect() + '>';
+  }
+
+
+
+
+
+
+
+
+
+  return {
+    each:       each,
+    eachSlice:  eachSlice,
+    all:        all,
+    every:      all,
+    any:        any,
+    some:       any,
+    collect:    collect,
+    map:        collect,
+    detect:     detect,
+    findAll:    findAll,
+    select:     findAll,
+    filter:     findAll,
+    grep:       grep,
+    include:    include,
+    member:     include,
+    inGroupsOf: inGroupsOf,
+    inject:     inject,
+    invoke:     invoke,
+    max:        max,
+    min:        min,
+    partition:  partition,
+    pluck:      pluck,
+    reject:     reject,
+    sortBy:     sortBy,
+    toArray:    toArray,
+    entries:    toArray,
+    zip:        zip,
+    size:       size,
+    inspect:    inspect,
+    find:       detect
+  };
+})();
+
+function $A(iterable) {
+  if (!iterable) return [];
+  if ('toArray' in Object(iterable)) return iterable.toArray();
+  var length = iterable.length || 0, results = new Array(length);
+  while (length--) results[length] = iterable[length];
+  return results;
+}
+
+
+function $w(string) {
+  if (!Object.isString(string)) return [];
+  string = string.strip();
+  return string ? string.split(/\s+/) : [];
+}
+
+Array.from = $A;
+
+
+(function() {
+  var arrayProto = Array.prototype,
+      slice = arrayProto.slice,
+      _each = arrayProto.forEach; // use native browser JS 1.6 implementation if available
+
+  function each(iterator) {
+    for (var i = 0, length = this.length; i < length; i++)
+      iterator(this[i]);
+  }
+  if (!_each) _each = each;
+
+  function clear() {
+    this.length = 0;
+    return this;
+  }
+
+  function first() {
+    return this[0];
+  }
+
+  function last() {
+    return this[this.length - 1];
+  }
+
+  function compact() {
+    return this.select(function(value) {
+      return value != null;
+    });
+  }
+
+  function flatten() {
+    return this.inject([], function(array, value) {
+      if (Object.isArray(value))
+        return array.concat(value.flatten());
+      array.push(value);
+      return array;
+    });
+  }
+
+  function without() {
+    var values = slice.call(arguments, 0);
+    return this.select(function(value) {
+      return !values.include(value);
+    });
+  }
+
+  function reverse(inline) {
+    return (inline === false ? this.toArray() : this)._reverse();
+  }
+
+  function uniq(sorted) {
+    return this.inject([], function(array, value, index) {
+      if (0 == index || (sorted ? array.last() != value : !array.include(value)))
+        array.push(value);
+      return array;
+    });
+  }
+
+  function intersect(array) {
+    return this.uniq().findAll(function(item) {
+      return array.detect(function(value) { return item === value });
+    });
+  }
+
+
+  function clone() {
+    return slice.call(this, 0);
+  }
+
+  function size() {
+    return this.length;
+  }
+
+  function inspect() {
+    return '[' + this.map(Object.inspect).join(', ') + ']';
+  }
+
+  function indexOf(item, i) {
+    i || (i = 0);
+    var length = this.length;
+    if (i < 0) i = length + i;
+    for (; i < length; i++)
+      if (this[i] === item) return i;
+    return -1;
+  }
+
+  function lastIndexOf(item, i) {
+    i = isNaN(i) ? this.length : (i < 0 ? this.length + i : i) + 1;
+    var n = this.slice(0, i).reverse().indexOf(item);
+    return (n < 0) ? n : i - n - 1;
+  }
+
+  function concat() {
+    var array = slice.call(this, 0), item;
+    for (var i = 0, length = arguments.length; i < length; i++) {
+      item = arguments[i];
+      if (Object.isArray(item) && !('callee' in item)) {
+        for (var j = 0, arrayLength = item.length; j < arrayLength; j++)
+          array.push(item[j]);
+      } else {
+        array.push(item);
+      }
+    }
+    return array;
+  }
+
+  Object.extend(arrayProto, Enumerable);
+
+  if (!arrayProto._reverse)
+    arrayProto._reverse = arrayProto.reverse;
+
+  Object.extend(arrayProto, {
+    _each:     _each,
+    clear:     clear,
+    first:     first,
+    last:      last,
+    compact:   compact,
+    flatten:   flatten,
+    without:   without,
+    reverse:   reverse,
+    uniq:      uniq,
+    intersect: intersect,
+    clone:     clone,
+    toArray:   clone,
+    size:      size,
+    inspect:   inspect
+  });
+
+  var CONCAT_ARGUMENTS_BUGGY = (function() {
+    return [].concat(arguments)[0][0] !== 1;
+  })(1,2)
+
+  if (CONCAT_ARGUMENTS_BUGGY) arrayProto.concat = concat;
+
+  if (!arrayProto.indexOf) arrayProto.indexOf = indexOf;
+  if (!arrayProto.lastIndexOf) arrayProto.lastIndexOf = lastIndexOf;
+})();
+function $H(object) {
+  return new Hash(object);
+};
+
+var Hash = Class.create(Enumerable, (function() {
+  function initialize(object) {
+    this._object = Object.isHash(object) ? object.toObject() : Object.clone(object);
+  }
+
+
+  function _each(iterator) {
+    for (var key in this._object) {
+      var value = this._object[key], pair = [key, value];
+      pair.key = key;
+      pair.value = value;
+      iterator(pair);
+    }
+  }
+
+  function set(key, value) {
+    return this._object[key] = value;
+  }
+
+  function get(key) {
+    if (this._object[key] !== Object.prototype[key])
+      return this._object[key];
+  }
+
+  function unset(key) {
+    var value = this._object[key];
+    delete this._object[key];
+    return value;
+  }
+
+  function toObject() {
+    return Object.clone(this._object);
+  }
+
+
+
+  function keys() {
+    return this.pluck('key');
+  }
+
+  function values() {
+    return this.pluck('value');
+  }
+
+  function index(value) {
+    var match = this.detect(function(pair) {
+      return pair.value === value;
+    });
+    return match && match.key;
+  }
+
+  function merge(object) {
+    return this.clone().update(object);
+  }
+
+  function update(object) {
+    return new Hash(object).inject(this, function(result, pair) {
+      result.set(pair.key, pair.value);
+      return result;
+    });
+  }
+
+  function toQueryPair(key, value) {
+    if (Object.isUndefined(value)) return key;
+    return key + '=' + encodeURIComponent(String.interpret(value));
+  }
+
+  function toQueryString() {
+    return this.inject([], function(results, pair) {
+      var key = encodeURIComponent(pair.key), values = pair.value;
+
+      if (values && typeof values == 'object') {
+        if (Object.isArray(values))
+          return results.concat(values.map(toQueryPair.curry(key)));
+      } else results.push(toQueryPair(key, values));
+      return results;
+    }).join('&');
+  }
+
+  function inspect() {
+    return '#<Hash:{' + this.map(function(pair) {
+      return pair.map(Object.inspect).join(': ');
+    }).join(', ') + '}>';
+  }
+
+  function clone() {
+    return new Hash(this);
+  }
+
+  return {
+    initialize:             initialize,
+    _each:                  _each,
+    set:                    set,
+    get:                    get,
+    unset:                  unset,
+    toObject:               toObject,
+    toTemplateReplacements: toObject,
+    keys:                   keys,
+    values:                 values,
+    index:                  index,
+    merge:                  merge,
+    update:                 update,
+    toQueryString:          toQueryString,
+    inspect:                inspect,
+    toJSON:                 toObject,
+    clone:                  clone
+  };
+})());
+
+Hash.from = $H;
+Object.extend(Number.prototype, (function() {
+  function toColorPart() {
+    return this.toPaddedString(2, 16);
+  }
+
+  function succ() {
+    return this + 1;
+  }
+
+  function times(iterator, context) {
+    $R(0, this, true).each(iterator, context);
+    return this;
+  }
+
+  function toPaddedString(length, radix) {
+    var string = this.toString(radix || 10);
+    return '0'.times(length - string.length) + string;
+  }
+
+  function abs() {
+    return Math.abs(this);
+  }
+
+  function round() {
+    return Math.round(this);
+  }
+
+  function ceil() {
+    return Math.ceil(this);
+  }
+
+  function floor() {
+    return Math.floor(this);
+  }
+
+  return {
+    toColorPart:    toColorPart,
+    succ:           succ,
+    times:          times,
+    toPaddedString: toPaddedString,
+    abs:            abs,
+    round:          round,
+    ceil:           ceil,
+    floor:          floor
+  };
+})());
+
+function $R(start, end, exclusive) {
+  return new ObjectRange(start, end, exclusive);
+}
+
+var ObjectRange = Class.create(Enumerable, (function() {
+  function initialize(start, end, exclusive) {
+    this.start = start;
+    this.end = end;
+    this.exclusive = exclusive;
+  }
+
+  function _each(iterator) {
+    var value = this.start;
+    while (this.include(value)) {
+      iterator(value);
+      value = value.succ();
+    }
+  }
+
+  function include(value) {
+    if (value < this.start)
+      return false;
+    if (this.exclusive)
+      return value < this.end;
+    return value <= this.end;
+  }
+
+  return {
+    initialize: initialize,
+    _each:      _each,
+    include:    include
+  };
+})());
+
+
+
+var Ajax = {
+  getTransport: function() {
+    return Try.these(
+      function() {return new XMLHttpRequest()},
+      function() {return new ActiveXObject('Msxml2.XMLHTTP')},
+      function() {return new ActiveXObject('Microsoft.XMLHTTP')}
+    ) || false;
+  },
+
+  activeRequestCount: 0
+};
+
+Ajax.Responders = {
+  responders: [],
+
+  _each: function(iterator) {
+    this.responders._each(iterator);
+  },
+
+  register: function(responder) {
+    if (!this.include(responder))
+      this.responders.push(responder);
+  },
+
+  unregister: function(responder) {
+    this.responders = this.responders.without(responder);
+  },
+
+  dispatch: function(callback, request, transport, json) {
+    this.each(function(responder) {
+      if (Object.isFunction(responder[callback])) {
+        try {
+          responder[callback].apply(responder, [request, transport, json]);
+        } catch (e) { }
+      }
+    });
+  }
+};
+
+Object.extend(Ajax.Responders, Enumerable);
+
+Ajax.Responders.register({
+  onCreate:   function() { Ajax.activeRequestCount++ },
+  onComplete: function() { Ajax.activeRequestCount-- }
+});
+Ajax.Base = Class.create({
+  initialize: function(options) {
+    this.options = {
+      method:       'post',
+      asynchronous: true,
+      contentType:  'application/x-www-form-urlencoded',
+      encoding:     'UTF-8',
+      parameters:   '',
+      evalJSON:     true,
+      evalJS:       true
+    };
+    Object.extend(this.options, options || { });
+
+    this.options.method = this.options.method.toLowerCase();
+
+    if (Object.isHash(this.options.parameters))
+      this.options.parameters = this.options.parameters.toObject();
+  }
+});
+Ajax.Request = Class.create(Ajax.Base, {
+  _complete: false,
+
+  initialize: function($super, url, options) {
+    $super(options);
+    this.transport = Ajax.getTransport();
+    this.request(url);
+  },
+
+  request: function(url) {
+    this.url = url;
+    this.method = this.options.method;
+    var params = Object.isString(this.options.parameters) ?
+          this.options.parameters :
+          Object.toQueryString(this.options.parameters);
+
+    if (!['get', 'post'].include(this.method)) {
+      params += (params ? '&' : '') + "_method=" + this.method;
+      this.method = 'post';
+    }
+
+    if (params) {
+      if (this.method == 'get')
+        this.url += (this.url.include('?') ? '&' : '?') + params;
+      else if (/Konqueror|Safari|KHTML/.test(navigator.userAgent))
+        params += '&_=';
+    }
+
+    this.parameters = params.toQueryParams();
+
+    try {
+      var response = new Ajax.Response(this);
+      if (this.options.onCreate) this.options.onCreate(response);
+      Ajax.Responders.dispatch('onCreate', this, response);
+
+      this.transport.open(this.method.toUpperCase(), this.url,
+        this.options.asynchronous);
+
+      if (this.options.asynchronous) this.respondToReadyState.bind(this).defer(1);
+
+      this.transport.onreadystatechange = this.onStateChange.bind(this);
+      this.setRequestHeaders();
+
+      this.body = this.method == 'post' ? (this.options.postBody || params) : null;
+      this.transport.send(this.body);
+
+      /* Force Firefox to handle ready state 4 for synchronous requests */
+      if (!this.options.asynchronous && this.transport.overrideMimeType)
+        this.onStateChange();
+
+    }
+    catch (e) {
+      this.dispatchException(e);
+    }
+  },
+
+  onStateChange: function() {
+    var readyState = this.transport.readyState;
+    if (readyState > 1 && !((readyState == 4) && this._complete))
+      this.respondToReadyState(this.transport.readyState);
+  },
+
+  setRequestHeaders: function() {
+    var headers = {
+      'X-Requested-With': 'XMLHttpRequest',
+      'X-Prototype-Version': Prototype.Version,
+      'Accept': 'text/javascript, text/html, application/xml, text/xml, */*'
+    };
+
+    if (this.method == 'post') {
+      headers['Content-type'] = this.options.contentType +
+        (this.options.encoding ? '; charset=' + this.options.encoding : '');
+
+      /* Force "Connection: close" for older Mozilla browsers to work
+       * around a bug where XMLHttpRequest sends an incorrect
+       * Content-length header. See Mozilla Bugzilla #246651.
+       */
+      if (this.transport.overrideMimeType &&
+          (navigator.userAgent.match(/Gecko\/(\d{4})/) || [0,2005])[1] < 2005)
+            headers['Connection'] = 'close';
+    }
+
+    if (typeof this.options.requestHeaders == 'object') {
+      var extras = this.options.requestHeaders;
+
+      if (Object.isFunction(extras.push))
+        for (var i = 0, length = extras.length; i < length; i += 2)
+          headers[extras[i]] = extras[i+1];
+      else
+        $H(extras).each(function(pair) { headers[pair.key] = pair.value });
+    }
+
+    for (var name in headers)
+      this.transport.setRequestHeader(name, headers[name]);
+  },
+
+  success: function() {
+    var status = this.getStatus();
+    return !status || (status >= 200 && status < 300);
+  },
+
+  getStatus: function() {
+    try {
+      return this.transport.status || 0;
+    } catch (e) { return 0 }
+  },
+
+  respondToReadyState: function(readyState) {
+    var state = Ajax.Request.Events[readyState], response = new Ajax.Response(this);
+
+    if (state == 'Complete') {
+      try {
+        this._complete = true;
+        (this.options['on' + response.status]
+         || this.options['on' + (this.success() ? 'Success' : 'Failure')]
+         || Prototype.emptyFunction)(response, response.headerJSON);
+      } catch (e) {
+        this.dispatchException(e);
+      }
+
+      var contentType = response.getHeader('Content-type');
+      if (this.options.evalJS == 'force'
+          || (this.options.evalJS && this.isSameOrigin() && contentType
+          && contentType.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i)))
+        this.evalResponse();
+    }
+
+    try {
+      (this.options['on' + state] || Prototype.emptyFunction)(response, response.headerJSON);
+      Ajax.Responders.dispatch('on' + state, this, response, response.headerJSON);
+    } catch (e) {
+      this.dispatchException(e);
+    }
+
+    if (state == 'Complete') {
+      this.transport.onreadystatechange = Prototype.emptyFunction;
+    }
+  },
+
+  isSameOrigin: function() {
+    var m = this.url.match(/^\s*https?:\/\/[^\/]*/);
+    return !m || (m[0] == '#{protocol}//#{domain}#{port}'.interpolate({
+      protocol: location.protocol,
+      domain: document.domain,
+      port: location.port ? ':' + location.port : ''
+    }));
+  },
+
+  getHeader: function(name) {
+    try {
+      return this.transport.getResponseHeader(name) || null;
+    } catch (e) { return null; }
+  },
+
+  evalResponse: function() {
+    try {
+      return eval((this.transport.responseText || '').unfilterJSON());
+    } catch (e) {
+      this.dispatchException(e);
+    }
+  },
+
+  dispatchException: function(exception) {
+    (this.options.onException || Prototype.emptyFunction)(this, exception);
+    Ajax.Responders.dispatch('onException', this, exception);
+  }
+});
+
+Ajax.Request.Events =
+  ['Uninitialized', 'Loading', 'Loaded', 'Interactive', 'Complete'];
+
+
+
+
+
+
+
+
+Ajax.Response = Class.create({
+  initialize: function(request){
+    this.request = request;
+    var transport  = this.transport  = request.transport,
+        readyState = this.readyState = transport.readyState;
+
+    if ((readyState > 2 && !Prototype.Browser.IE) || readyState == 4) {
+      this.status       = this.getStatus();
+      this.statusText   = this.getStatusText();
+      this.responseText = String.interpret(transport.responseText);
+      this.headerJSON   = this._getHeaderJSON();
+    }
+
+    if (readyState == 4) {
+      var xml = transport.responseXML;
+      this.responseXML  = Object.isUndefined(xml) ? null : xml;
+      this.responseJSON = this._getResponseJSON();
+    }
+  },
+
+  status:      0,
+
+  statusText: '',
+
+  getStatus: Ajax.Request.prototype.getStatus,
+
+  getStatusText: function() {
+    try {
+      return this.transport.statusText || '';
+    } catch (e) { return '' }
+  },
+
+  getHeader: Ajax.Request.prototype.getHeader,
+
+  getAllHeaders: function() {
+    try {
+      return this.getAllResponseHeaders();
+    } catch (e) { return null }
+  },
+
+  getResponseHeader: function(name) {
+    return this.transport.getResponseHeader(name);
+  },
+
+  getAllResponseHeaders: function() {
+    return this.transport.getAllResponseHeaders();
+  },
+
+  _getHeaderJSON: function() {
+    var json = this.getHeader('X-JSON');
+    if (!json) return null;
+    json = decodeURIComponent(escape(json));
+    try {
+      return json.evalJSON(this.request.options.sanitizeJSON ||
+        !this.request.isSameOrigin());
+    } catch (e) {
+      this.request.dispatchException(e);
+    }
+  },
+
+  _getResponseJSON: function() {
+    var options = this.request.options;
+    if (!options.evalJSON || (options.evalJSON != 'force' &&
+      !(this.getHeader('Content-type') || '').include('application/json')) ||
+        this.responseText.blank())
+          return null;
+    try {
+      return this.responseText.evalJSON(options.sanitizeJSON ||
+        !this.request.isSameOrigin());
+    } catch (e) {
+      this.request.dispatchException(e);
+    }
+  }
+});
+
+Ajax.Updater = Class.create(Ajax.Request, {
+  initialize: function($super, container, url, options) {
+    this.container = {
+      success: (container.success || container),
+      failure: (container.failure || (container.success ? null : container))
+    };
+
+    options = Object.clone(options);
+    var onComplete = options.onComplete;
+    options.onComplete = (function(response, json) {
+      this.updateContent(response.responseText);
+      if (Object.isFunction(onComplete)) onComplete(response, json);
+    }).bind(this);
+
+    $super(url, options);
+  },
+
+  updateContent: function(responseText) {
+    var receiver = this.container[this.success() ? 'success' : 'failure'],
+        options = this.options;
+
+    if (!options.evalScripts) responseText = responseText.stripScripts();
+
+    if (receiver = $(receiver)) {
+      if (options.insertion) {
+        if (Object.isString(options.insertion)) {
+          var insertion = { }; insertion[options.insertion] = responseText;
+          receiver.insert(insertion);
+        }
+        else options.insertion(receiver, responseText);
+      }
+      else receiver.update(responseText);
+    }
+  }
+});
+
+Ajax.PeriodicalUpdater = Class.create(Ajax.Base, {
+  initialize: function($super, container, url, options) {
+    $super(options);
+    this.onComplete = this.options.onComplete;
+
+    this.frequency = (this.options.frequency || 2);
+    this.decay = (this.options.decay || 1);
+
+    this.updater = { };
+    this.container = container;
+    this.url = url;
+
+    this.start();
+  },
+
+  start: function() {
+    this.options.onComplete = this.updateComplete.bind(this);
+    this.onTimerEvent();
+  },
+
+  stop: function() {
+    this.updater.options.onComplete = undefined;
+    clearTimeout(this.timer);
+    (this.onComplete || Prototype.emptyFunction).apply(this, arguments);
+  },
+
+  updateComplete: function(response) {
+    if (this.options.decay) {
+      this.decay = (response.responseText == this.lastText ?
+        this.decay * this.options.decay : 1);
+
+      this.lastText = response.responseText;
+    }
+    this.timer = this.onTimerEvent.bind(this).delay(this.decay * this.frequency);
+  },
+
+  onTimerEvent: function() {
+    this.updater = new Ajax.Updater(this.container, this.url, this.options);
+  }
+});
+
+
+function $(element) {
+  if (arguments.length > 1) {
+    for (var i = 0, elements = [], length = arguments.length; i < length; i++)
+      elements.push($(arguments[i]));
+    return elements;
+  }
+  if (Object.isString(element))
+    element = document.getElementById(element);
+  return Element.extend(element);
+}
+
+if (Prototype.BrowserFeatures.XPath) {
+  document._getElementsByXPath = function(expression, parentElement) {
+    var results = [];
+    var query = document.evaluate(expression, $(parentElement) || document,
+      null, XPathResult.ORDERED_NODE_SNAPSHOT_TYPE, null);
+    for (var i = 0, length = query.snapshotLength; i < length; i++)
+      results.push(Element.extend(query.snapshotItem(i)));
+    return results;
+  };
+}
+
+/*--------------------------------------------------------------------------*/
+
+if (!Node) var Node = { };
+
+if (!Node.ELEMENT_NODE) {
+  Object.extend(Node, {
+    ELEMENT_NODE: 1,
+    ATTRIBUTE_NODE: 2,
+    TEXT_NODE: 3,
+    CDATA_SECTION_NODE: 4,
+    ENTITY_REFERENCE_NODE: 5,
+    ENTITY_NODE: 6,
+    PROCESSING_INSTRUCTION_NODE: 7,
+    COMMENT_NODE: 8,
+    DOCUMENT_NODE: 9,
+    DOCUMENT_TYPE_NODE: 10,
+    DOCUMENT_FRAGMENT_NODE: 11,
+    NOTATION_NODE: 12
+  });
+}
+
+
+
+(function(global) {
+
+  var HAS_EXTENDED_CREATE_ELEMENT_SYNTAX = (function(){
+    try {
+      var el = document.createElement('<input name="x">');
+      return el.tagName.toLowerCase() === 'input' && el.name === 'x';
+    }
+    catch(err) {
+      return false;
+    }
+  })();
+
+  var element = global.Element;
+
+  global.Element = function(tagName, attributes) {
+    attributes = attributes || { };
+    tagName = tagName.toLowerCase();
+    var cache = Element.cache;
+    if (HAS_EXTENDED_CREATE_ELEMENT_SYNTAX && attributes.name) {
+      tagName = '<' + tagName + ' name="' + attributes.name + '">';
+      delete attributes.name;
+      return Element.writeAttribute(document.createElement(tagName), attributes);
+    }
+    if (!cache[tagName]) cache[tagName] = Element.extend(document.createElement(tagName));
+    return Element.writeAttribute(cache[tagName].cloneNode(false), attributes);
+  };
+
+  Object.extend(global.Element, element || { });
+  if (element) global.Element.prototype = element.prototype;
+
+})(this);
+
+Element.idCounter = 1;
+Element.cache = { };
+
+Element._purgeElement = function(element) {
+  var uid = element._prototypeUID;
+  if (uid) {
+    Element.stopObserving(element);
+    element._prototypeUID = void 0;
+    delete Element.Storage[uid];
+  }
+}
+
+Element.Methods = {
+  visible: function(element) {
+    return $(element).style.display != 'none';
+  },
+
+  toggle: function(element) {
+    element = $(element);
+    Element[Element.visible(element) ? 'hide' : 'show'](element);
+    return element;
+  },
+
+  hide: function(element) {
+    element = $(element);
+    element.style.display = 'none';
+    return element;
+  },
+
+  show: function(element) {
+    element = $(element);
+    element.style.display = '';
+    return element;
+  },
+
+  remove: function(element) {
+    element = $(element);
+    element.parentNode.removeChild(element);
+    return element;
+  },
+
+  update: (function(){
+
+    var SELECT_ELEMENT_INNERHTML_BUGGY = (function(){
+      var el = document.createElement("select"),
+          isBuggy = true;
+      el.innerHTML = "<option value=\"test\">test</option>";
+      if (el.options && el.options[0]) {
+        isBuggy = el.options[0].nodeName.toUpperCase() !== "OPTION";
+      }
+      el = null;
+      return isBuggy;
+    })();
+
+    var TABLE_ELEMENT_INNERHTML_BUGGY = (function(){
+      try {
+        var el = document.createElement("table");
+        if (el && el.tBodies) {
+          el.innerHTML = "<tbody><tr><td>test</td></tr></tbody>";
+          var isBuggy = typeof el.tBodies[0] == "undefined";
+          el = null;
+          return isBuggy;
+        }
+      } catch (e) {
+        return true;
+      }
+    })();
+
+    var SCRIPT_ELEMENT_REJECTS_TEXTNODE_APPENDING = (function () {
+      var s = document.createElement("script"),
+          isBuggy = false;
+      try {
+        s.appendChild(document.createTextNode(""));
+        isBuggy = !s.firstChild ||
+          s.firstChild && s.firstChild.nodeType !== 3;
+      } catch (e) {
+        isBuggy = true;
+      }
+      s = null;
+      return isBuggy;
+    })();
+
+    function update(element, content) {
+      element = $(element);
+      var purgeElement = Element._purgeElement;
+
+      var descendants = element.getElementsByTagName('*'),
+       i = descendants.length;
+      while (i--) purgeElement(descendants[i]);
+
+      if (content && content.toElement)
+        content = content.toElement();
+
+      if (Object.isElement(content))
+        return element.update().insert(content);
+
+      content = Object.toHTML(content);
+
+      var tagName = element.tagName.toUpperCase();
+
+      if (tagName === 'SCRIPT' && SCRIPT_ELEMENT_REJECTS_TEXTNODE_APPENDING) {
+        element.text = content;
+        return element;
+      }
+
+      if (SELECT_ELEMENT_INNERHTML_BUGGY || TABLE_ELEMENT_INNERHTML_BUGGY) {
+        if (tagName in Element._insertionTranslations.tags) {
+          while (element.firstChild) {
+            element.removeChild(element.firstChild);
+          }
+          Element._getContentFromAnonymousElement(tagName, content.stripScripts())
+            .each(function(node) {
+              element.appendChild(node)
+            });
+        }
+        else {
+          element.innerHTML = content.stripScripts();
+        }
+      }
+      else {
+        element.innerHTML = content.stripScripts();
+      }
+
+      content.evalScripts.bind(content).defer();
+      return element;
+    }
+
+    return update;
+  })(),
+
+  replace: function(element, content) {
+    element = $(element);
+    if (content && content.toElement) content = content.toElement();
+    else if (!Object.isElement(content)) {
+      content = Object.toHTML(content);
+      var range = element.ownerDocument.createRange();
+      range.selectNode(element);
+      content.evalScripts.bind(content).defer();
+      content = range.createContextualFragment(content.stripScripts());
+    }
+    element.parentNode.replaceChild(content, element);
+    return element;
+  },
+
+  insert: function(element, insertions) {
+    element = $(element);
+
+    if (Object.isString(insertions) || Object.isNumber(insertions) ||
+        Object.isElement(insertions) || (insertions && (insertions.toElement || insertions.toHTML)))
+          insertions = {bottom:insertions};
+
+    var content, insert, tagName, childNodes;
+
+    for (var position in insertions) {
+      content  = insertions[position];
+      position = position.toLowerCase();
+      insert = Element._insertionTranslations[position];
+
+      if (content && content.toElement) content = content.toElement();
+      if (Object.isElement(content)) {
+        insert(element, content);
+        continue;
+      }
+
+      content = Object.toHTML(content);
+
+      tagName = ((position == 'before' || position == 'after')
+        ? element.parentNode : element).tagName.toUpperCase();
+
+      childNodes = Element._getContentFromAnonymousElement(tagName, content.stripScripts());
+
+      if (position == 'top' || position == 'after') childNodes.reverse();
+      childNodes.each(insert.curry(element));
+
+      content.evalScripts.bind(content).defer();
+    }
+
+    return element;
+  },
+
+  wrap: function(element, wrapper, attributes) {
+    element = $(element);
+    if (Object.isElement(wrapper))
+      $(wrapper).writeAttribute(attributes || { });
+    else if (Object.isString(wrapper)) wrapper = new Element(wrapper, attributes);
+    else wrapper = new Element('div', wrapper);
+    if (element.parentNode)
+      element.parentNode.replaceChild(wrapper, element);
+    wrapper.appendChild(element);
+    return wrapper;
+  },
+
+  inspect: function(element) {
+    element = $(element);
+    var result = '<' + element.tagName.toLowerCase();
+    $H({'id': 'id', 'className': 'class'}).each(function(pair) {
+      var property = pair.first(),
+          attribute = pair.last(),
+          value = (element[property] || '').toString();
+      if (value) result += ' ' + attribute + '=' + value.inspect(true);
+    });
+    return result + '>';
+  },
+
+  recursivelyCollect: function(element, property, maximumLength) {
+    element = $(element);
+    maximumLength = maximumLength || -1;
+    var elements = [];
+
+    while (element = element[property]) {
+      if (element.nodeType == 1)
+        elements.push(Element.extend(element));
+      if (elements.length == maximumLength)
+        break;
+    }
+
+    return elements;
+  },
+
+  ancestors: function(element) {
+    return Element.recursivelyCollect(element, 'parentNode');
+  },
+
+  descendants: function(element) {
+    return Element.select(element, "*");
+  },
+
+  firstDescendant: function(element) {
+    element = $(element).firstChild;
+    while (element && element.nodeType != 1) element = element.nextSibling;
+    return $(element);
+  },
+
+  immediateDescendants: function(element) {
+    var results = [], child = $(element).firstChild;
+    while (child) {
+      if (child.nodeType === 1) {
+        results.push(Element.extend(child));
+      }
+      child = child.nextSibling;
+    }
+    return results;
+  },
+
+  previousSiblings: function(element, maximumLength) {
+    return Element.recursivelyCollect(element, 'previousSibling');
+  },
+
+  nextSiblings: function(element) {
+    return Element.recursivelyCollect(element, 'nextSibling');
+  },
+
+  siblings: function(element) {
+    element = $(element);
+    return Element.previousSiblings(element).reverse()
+      .concat(Element.nextSiblings(element));
+  },
+
+  match: function(element, selector) {
+    element = $(element);
+    if (Object.isString(selector))
+      return Prototype.Selector.match(element, selector);
+    return selector.match(element);
+  },
+
+  up: function(element, expression, index) {
+    element = $(element);
+    if (arguments.length == 1) return $(element.parentNode);
+    var ancestors = Element.ancestors(element);
+    return Object.isNumber(expression) ? ancestors[expression] :
+      Prototype.Selector.find(ancestors, expression, index);
+  },
+
+  down: function(element, expression, index) {
+    element = $(element);
+    if (arguments.length == 1) return Element.firstDescendant(element);
+    return Object.isNumber(expression) ? Element.descendants(element)[expression] :
+      Element.select(element, expression)[index || 0];
+  },
+
+  previous: function(element, expression, index) {
+    element = $(element);
+    if (Object.isNumber(expression)) index = expression, expression = false;
+    if (!Object.isNumber(index)) index = 0;
+
+    if (expression) {
+      return Prototype.Selector.find(element.previousSiblings(), expression, index);
+    } else {
+      return element.recursivelyCollect("previousSibling", index + 1)[index];
+    }
+  },
+
+  next: function(element, expression, index) {
+    element = $(element);
+    if (Object.isNumber(expression)) index = expression, expression = false;
+    if (!Object.isNumber(index)) index = 0;
+
+    if (expression) {
+      return Prototype.Selector.find(element.nextSiblings(), expression, index);
+    } else {
+      var maximumLength = Object.isNumber(index) ? index + 1 : 1;
+      return element.recursivelyCollect("nextSibling", index + 1)[index];
+    }
+  },
+
+
+  select: function(element) {
+    element = $(element);
+    var expressions = Array.prototype.slice.call(arguments, 1).join(', ');
+    return Prototype.Selector.select(expressions, element);
+  },
+
+  adjacent: function(element) {
+    element = $(element);
+    var expressions = Array.prototype.slice.call(arguments, 1).join(', ');
+    return Prototype.Selector.select(expressions, element.parentNode).without(element);
+  },
+
+  identify: function(element) {
+    element = $(element);
+    var id = Element.readAttribute(element, 'id');
+    if (id) return id;
+    do { id = 'anonymous_element_' + Element.idCounter++ } while ($(id));
+    Element.writeAttribute(element, 'id', id);
+    return id;
+  },
+
+  readAttribute: function(element, name) {
+    element = $(element);
+    if (Prototype.Browser.IE) {
+      var t = Element._attributeTranslations.read;
+      if (t.values[name]) return t.values[name](element, name);
+      if (t.names[name]) name = t.names[name];
+      if (name.include(':')) {
+        return (!element.attributes || !element.attributes[name]) ? null :
+         element.attributes[name].value;
+      }
+    }
+    return element.getAttribute(name);
+  },
+
+  writeAttribute: function(element, name, value) {
+    element = $(element);
+    var attributes = { }, t = Element._attributeTranslations.write;
+
+    if (typeof name == 'object') attributes = name;
+    else attributes[name] = Object.isUndefined(value) ? true : value;
+
+    for (var attr in attributes) {
+      name = t.names[attr] || attr;
+      value = attributes[attr];
+      if (t.values[attr]) name = t.values[attr](element, value);
+      if (value === false || value === null)
+        element.removeAttribute(name);
+      else if (value === true)
+        element.setAttribute(name, name);
+      else element.setAttribute(name, value);
+    }
+    return element;
+  },
+
+  getHeight: function(element) {
+    return Element.getDimensions(element).height;
+  },
+
+  getWidth: function(element) {
+    return Element.getDimensions(element).width;
+  },
+
+  classNames: function(element) {
+    return new Element.ClassNames(element);
+  },
+
+  hasClassName: function(element, className) {
+    if (!(element = $(element))) return;
+    var elementClassName = element.className;
+    return (elementClassName.length > 0 && (elementClassName == className ||
+      new RegExp("(^|\\s)" + className + "(\\s|$)").test(elementClassName)));
+  },
+
+  addClassName: function(element, className) {
+    if (!(element = $(element))) return;
+    if (!Element.hasClassName(element, className))
+      element.className += (element.className ? ' ' : '') + className;
+    return element;
+  },
+
+  removeClassName: function(element, className) {
+    if (!(element = $(element))) return;
+    element.className = element.className.replace(
+      new RegExp("(^|\\s+)" + className + "(\\s+|$)"), ' ').strip();
+    return element;
+  },
+
+  toggleClassName: function(element, className) {
+    if (!(element = $(element))) return;
+    return Element[Element.hasClassName(element, className) ?
+      'removeClassName' : 'addClassName'](element, className);
+  },
+
+  cleanWhitespace: function(element) {
+    element = $(element);
+    var node = element.firstChild;
+    while (node) {
+      var nextNode = node.nextSibling;
+      if (node.nodeType == 3 && !/\S/.test(node.nodeValue))
+        element.removeChild(node);
+      node = nextNode;
+    }
+    return element;
+  },
+
+  empty: function(element) {
+    return $(element).innerHTML.blank();
+  },
+
+  descendantOf: function(element, ancestor) {
+    element = $(element), ancestor = $(ancestor);
+
+    if (element.compareDocumentPosition)
+      return (element.compareDocumentPosition(ancestor) & 8) === 8;
+
+    if (ancestor.contains)
+      return ancestor.contains(element) && ancestor !== element;
+
+    while (element = element.parentNode)
+      if (element == ancestor) return true;
+
+    return false;
+  },
+
+  scrollTo: function(element) {
+    element = $(element);
+    var pos = Element.cumulativeOffset(element);
+    window.scrollTo(pos[0], pos[1]);
+    return element;
+  },
+
+  getStyle: function(element, style) {
+    element = $(element);
+    style = style == 'float' ? 'cssFloat' : style.camelize();
+    var value = element.style[style];
+    if (!value || value == 'auto') {
+      var css = document.defaultView.getComputedStyle(element, null);
+      value = css ? css[style] : null;
+    }
+    if (style == 'opacity') return value ? parseFloat(value) : 1.0;
+    return value == 'auto' ? null : value;
+  },
+
+  getOpacity: function(element) {
+    return $(element).getStyle('opacity');
+  },
+
+  setStyle: function(element, styles) {
+    element = $(element);
+    var elementStyle = element.style, match;
+    if (Object.isString(styles)) {
+      element.style.cssText += ';' + styles;
+      return styles.include('opacity') ?
+        element.setOpacity(styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) : element;
+    }
+    for (var property in styles)
+      if (property == 'opacity') element.setOpacity(styles[property]);
+      else
+        elementStyle[(property == 'float' || property == 'cssFloat') ?
+          (Object.isUndefined(elementStyle.styleFloat) ? 'cssFloat' : 'styleFloat') :
+            property] = styles[property];
+
+    return element;
+  },
+
+  setOpacity: function(element, value) {
+    element = $(element);
+    element.style.opacity = (value == 1 || value === '') ? '' :
+      (value < 0.00001) ? 0 : value;
+    return element;
+  },
+
+  makePositioned: function(element) {
+    element = $(element);
+    var pos = Element.getStyle(element, 'position');
+    if (pos == 'static' || !pos) {
+      element._madePositioned = true;
+      element.style.position = 'relative';
+      if (Prototype.Browser.Opera) {
+        element.style.top = 0;
+        element.style.left = 0;
+      }
+    }
+    return element;
+  },
+
+  undoPositioned: function(element) {
+    element = $(element);
+    if (element._madePositioned) {
+      element._madePositioned = undefined;
+      element.style.position =
+        element.style.top =
+        element.style.left =
+        element.style.bottom =
+        element.style.right = '';
+    }
+    return element;
+  },
+
+  makeClipping: function(element) {
+    element = $(element);
+    if (element._overflow) return element;
+    element._overflow = Element.getStyle(element, 'overflow') || 'auto';
+    if (element._overflow !== 'hidden')
+      element.style.overflow = 'hidden';
+    return element;
+  },
+
+  undoClipping: function(element) {
+    element = $(element);
+    if (!element._overflow) return element;
+    element.style.overflow = element._overflow == 'auto' ? '' : element._overflow;
+    element._overflow = null;
+    return element;
+  },
+
+  cumulativeOffset: function(element) {
+    var valueT = 0, valueL = 0;
+    if (element.parentNode) {
+      do {
+        valueT += element.offsetTop  || 0;
+        valueL += element.offsetLeft || 0;
+        element = element.offsetParent;
+      } while (element);
+    }
+    return Element._returnOffset(valueL, valueT);
+  },
+
+  positionedOffset: function(element) {
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+      element = element.offsetParent;
+      if (element) {
+        if (element.tagName.toUpperCase() == 'BODY') break;
+        var p = Element.getStyle(element, 'position');
+        if (p !== 'static') break;
+      }
+    } while (element);
+    return Element._returnOffset(valueL, valueT);
+  },
+
+  absolutize: function(element) {
+    element = $(element);
+    if (Element.getStyle(element, 'position') == 'absolute') return element;
+
+    var offsets = Element.positionedOffset(element),
+        top     = offsets[1],
+        left    = offsets[0],
+        width   = element.clientWidth,
+        height  = element.clientHeight;
+
+    element._originalLeft   = left - parseFloat(element.style.left  || 0);
+    element._originalTop    = top  - parseFloat(element.style.top || 0);
+    element._originalWidth  = element.style.width;
+    element._originalHeight = element.style.height;
+
+    element.style.position = 'absolute';
+    element.style.top    = top + 'px';
+    element.style.left   = left + 'px';
+    element.style.width  = width + 'px';
+    element.style.height = height + 'px';
+    return element;
+  },
+
+  relativize: function(element) {
+    element = $(element);
+    if (Element.getStyle(element, 'position') == 'relative') return element;
+
+    element.style.position = 'relative';
+    var top  = parseFloat(element.style.top  || 0) - (element._originalTop || 0),
+        left = parseFloat(element.style.left || 0) - (element._originalLeft || 0);
+
+    element.style.top    = top + 'px';
+    element.style.left   = left + 'px';
+    element.style.height = element._originalHeight;
+    element.style.width  = element._originalWidth;
+    return element;
+  },
+
+  cumulativeScrollOffset: function(element) {
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.scrollTop  || 0;
+      valueL += element.scrollLeft || 0;
+      element = element.parentNode;
+    } while (element);
+    return Element._returnOffset(valueL, valueT);
+  },
+
+  getOffsetParent: function(element) {
+    if (element.offsetParent) return $(element.offsetParent);
+    if (element == document.body) return $(element);
+
+    while ((element = element.parentNode) && element != document.body)
+      if (Element.getStyle(element, 'position') != 'static')
+        return $(element);
+
+    return $(document.body);
+  },
+
+  viewportOffset: function(forElement) {
+    var valueT = 0,
+        valueL = 0,
+        element = forElement;
+
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+
+      if (element.offsetParent == document.body &&
+        Element.getStyle(element, 'position') == 'absolute') break;
+
+    } while (element = element.offsetParent);
+
+    element = forElement;
+    do {
+      if (!Prototype.Browser.Opera || (element.tagName && (element.tagName.toUpperCase() == 'BODY'))) {
+        valueT -= element.scrollTop  || 0;
+        valueL -= element.scrollLeft || 0;
+      }
+    } while (element = element.parentNode);
+
+    return Element._returnOffset(valueL, valueT);
+  },
+
+  clonePosition: function(element, source) {
+    var options = Object.extend({
+      setLeft:    true,
+      setTop:     true,
+      setWidth:   true,
+      setHeight:  true,
+      offsetTop:  0,
+      offsetLeft: 0
+    }, arguments[2] || { });
+
+    source = $(source);
+    var p = Element.viewportOffset(source), delta = [0, 0], parent = null;
+
+    element = $(element);
+
+    if (Element.getStyle(element, 'position') == 'absolute') {
+      parent = Element.getOffsetParent(element);
+      delta = Element.viewportOffset(parent);
+    }
+
+    if (parent == document.body) {
+      delta[0] -= document.body.offsetLeft;
+      delta[1] -= document.body.offsetTop;
+    }
+
+    if (options.setLeft)   element.style.left  = (p[0] - delta[0] + options.offsetLeft) + 'px';
+    if (options.setTop)    element.style.top   = (p[1] - delta[1] + options.offsetTop) + 'px';
+    if (options.setWidth)  element.style.width = source.offsetWidth + 'px';
+    if (options.setHeight) element.style.height = source.offsetHeight + 'px';
+    return element;
+  }
+};
+
+Object.extend(Element.Methods, {
+  getElementsBySelector: Element.Methods.select,
+
+  childElements: Element.Methods.immediateDescendants
+});
+
+Element._attributeTranslations = {
+  write: {
+    names: {
+      className: 'class',
+      htmlFor:   'for'
+    },
+    values: { }
+  }
+};
+
+if (Prototype.Browser.Opera) {
+  Element.Methods.getStyle = Element.Methods.getStyle.wrap(
+    function(proceed, element, style) {
+      switch (style) {
+        case 'left': case 'top': case 'right': case 'bottom':
+          if (proceed(element, 'position') === 'static') return null;
+        case 'height': case 'width':
+          if (!Element.visible(element)) return null;
+
+          var dim = parseInt(proceed(element, style), 10);
+
+          if (dim !== element['offset' + style.capitalize()])
+            return dim + 'px';
+
+          var properties;
+          if (style === 'height') {
+            properties = ['border-top-width', 'padding-top',
+             'padding-bottom', 'border-bottom-width'];
+          }
+          else {
+            properties = ['border-left-width', 'padding-left',
+             'padding-right', 'border-right-width'];
+          }
+          return properties.inject(dim, function(memo, property) {
+            var val = proceed(element, property);
+            return val === null ? memo : memo - parseInt(val, 10);
+          }) + 'px';
+        default: return proceed(element, style);
+      }
+    }
+  );
+
+  Element.Methods.readAttribute = Element.Methods.readAttribute.wrap(
+    function(proceed, element, attribute) {
+      if (attribute === 'title') return element.title;
+      return proceed(element, attribute);
+    }
+  );
+}
+
+else if (Prototype.Browser.IE) {
+  Element.Methods.getOffsetParent = Element.Methods.getOffsetParent.wrap(
+    function(proceed, element) {
+      element = $(element);
+      if (!element.parentNode) return $(document.body);
+      var position = element.getStyle('position');
+      if (position !== 'static') return proceed(element);
+      element.setStyle({ position: 'relative' });
+      var value = proceed(element);
+      element.setStyle({ position: position });
+      return value;
+    }
+  );
+
+  $w('positionedOffset viewportOffset').each(function(method) {
+    Element.Methods[method] = Element.Methods[method].wrap(
+      function(proceed, element) {
+        element = $(element);
+        if (!element.parentNode) return Element._returnOffset(0, 0);
+        var position = element.getStyle('position');
+        if (position !== 'static') return proceed(element);
+        var offsetParent = element.getOffsetParent();
+        if (offsetParent && offsetParent.getStyle('position') === 'fixed')
+          offsetParent.setStyle({ zoom: 1 });
+        element.setStyle({ position: 'relative' });
+        var value = proceed(element);
+        element.setStyle({ position: position });
+        return value;
+      }
+    );
+  });
+
+  Element.Methods.getStyle = function(element, style) {
+    element = $(element);
+    style = (style == 'float' || style == 'cssFloat') ? 'styleFloat' : style.camelize();
+    var value = element.style[style];
+    if (!value && element.currentStyle) value = element.currentStyle[style];
+
+    if (style == 'opacity') {
+      if (value = (element.getStyle('filter') || '').match(/alpha\(opacity=(.*)\)/))
+        if (value[1]) return parseFloat(value[1]) / 100;
+      return 1.0;
+    }
+
+    if (value == 'auto') {
+      if ((style == 'width' || style == 'height') && (element.getStyle('display') != 'none'))
+        return element['offset' + style.capitalize()] + 'px';
+      return null;
+    }
+    return value;
+  };
+
+  Element.Methods.setOpacity = function(element, value) {
+    function stripAlpha(filter){
+      return filter.replace(/alpha\([^\)]*\)/gi,'');
+    }
+    element = $(element);
+    var currentStyle = element.currentStyle;
+    if ((currentStyle && !currentStyle.hasLayout) ||
+      (!currentStyle && element.style.zoom == 'normal'))
+        element.style.zoom = 1;
+
+    var filter = element.getStyle('filter'), style = element.style;
+    if (value == 1 || value === '') {
+      (filter = stripAlpha(filter)) ?
+        style.filter = filter : style.removeAttribute('filter');
+      return element;
+    } else if (value < 0.00001) value = 0;
+    style.filter = stripAlpha(filter) +
+      'alpha(opacity=' + (value * 100) + ')';
+    return element;
+  };
+
+  Element._attributeTranslations = (function(){
+
+    var classProp = 'className',
+        forProp = 'for',
+        el = document.createElement('div');
+
+    el.setAttribute(classProp, 'x');
+
+    if (el.className !== 'x') {
+      el.setAttribute('class', 'x');
+      if (el.className === 'x') {
+        classProp = 'class';
+      }
+    }
+    el = null;
+
+    el = document.createElement('label');
+    el.setAttribute(forProp, 'x');
+    if (el.htmlFor !== 'x') {
+      el.setAttribute('htmlFor', 'x');
+      if (el.htmlFor === 'x') {
+        forProp = 'htmlFor';
+      }
+    }
+    el = null;
+
+    return {
+      read: {
+        names: {
+          'class':      classProp,
+          'className':  classProp,
+          'for':        forProp,
+          'htmlFor':    forProp
+        },
+        values: {
+          _getAttr: function(element, attribute) {
+            return element.getAttribute(attribute);
+          },
+          _getAttr2: function(element, attribute) {
+            return element.getAttribute(attribute, 2);
+          },
+          _getAttrNode: function(element, attribute) {
+            var node = element.getAttributeNode(attribute);
+            return node ? node.value : "";
+          },
+          _getEv: (function(){
+
+            var el = document.createElement('div'), f;
+            el.onclick = Prototype.emptyFunction;
+            var value = el.getAttribute('onclick');
+
+            if (String(value).indexOf('{') > -1) {
+              f = function(element, attribute) {
+                attribute = element.getAttribute(attribute);
+                if (!attribute) return null;
+                attribute = attribute.toString();
+                attribute = attribute.split('{')[1];
+                attribute = attribute.split('}')[0];
+                return attribute.strip();
+              };
+            }
+            else if (value === '') {
+              f = function(element, attribute) {
+                attribute = element.getAttribute(attribute);
+                if (!attribute) return null;
+                return attribute.strip();
+              };
+            }
+            el = null;
+            return f;
+          })(),
+          _flag: function(element, attribute) {
+            return $(element).hasAttribute(attribute) ? attribute : null;
+          },
+          style: function(element) {
+            return element.style.cssText.toLowerCase();
+          },
+          title: function(element) {
+            return element.title;
+          }
+        }
+      }
+    }
+  })();
+
+  Element._attributeTranslations.write = {
+    names: Object.extend({
+      cellpadding: 'cellPadding',
+      cellspacing: 'cellSpacing'
+    }, Element._attributeTranslations.read.names),
+    values: {
+      checked: function(element, value) {
+        element.checked = !!value;
+      },
+
+      style: function(element, value) {
+        element.style.cssText = value ? value : '';
+      }
+    }
+  };
+
+  Element._attributeTranslations.has = {};
+
+  $w('colSpan rowSpan vAlign dateTime accessKey tabIndex ' +
+      'encType maxLength readOnly longDesc frameBorder').each(function(attr) {
+    Element._attributeTranslations.write.names[attr.toLowerCase()] = attr;
+    Element._attributeTranslations.has[attr.toLowerCase()] = attr;
+  });
+
+  (function(v) {
+    Object.extend(v, {
+      href:        v._getAttr2,
+      src:         v._getAttr2,
+      type:        v._getAttr,
+      action:      v._getAttrNode,
+      disabled:    v._flag,
+      checked:     v._flag,
+      readonly:    v._flag,
+      multiple:    v._flag,
+      onload:      v._getEv,
+      onunload:    v._getEv,
+      onclick:     v._getEv,
+      ondblclick:  v._getEv,
+      onmousedown: v._getEv,
+      onmouseup:   v._getEv,
+      onmouseover: v._getEv,
+      onmousemove: v._getEv,
+      onmouseout:  v._getEv,
+      onfocus:     v._getEv,
+      onblur:      v._getEv,
+      onkeypress:  v._getEv,
+      onkeydown:   v._getEv,
+      onkeyup:     v._getEv,
+      onsubmit:    v._getEv,
+      onreset:     v._getEv,
+      onselect:    v._getEv,
+      onchange:    v._getEv
+    });
+  })(Element._attributeTranslations.read.values);
+
+  if (Prototype.BrowserFeatures.ElementExtensions) {
+    (function() {
+      function _descendants(element) {
+        var nodes = element.getElementsByTagName('*'), results = [];
+        for (var i = 0, node; node = nodes[i]; i++)
+          if (node.tagName !== "!") // Filter out comment nodes.
+            results.push(node);
+        return results;
+      }
+
+      Element.Methods.down = function(element, expression, index) {
+        element = $(element);
+        if (arguments.length == 1) return element.firstDescendant();
+        return Object.isNumber(expression) ? _descendants(element)[expression] :
+          Element.select(element, expression)[index || 0];
+      }
+    })();
+  }
+
+}
+
+else if (Prototype.Browser.Gecko && /rv:1\.8\.0/.test(navigator.userAgent)) {
+  Element.Methods.setOpacity = function(element, value) {
+    element = $(element);
+    element.style.opacity = (value == 1) ? 0.999999 :
+      (value === '') ? '' : (value < 0.00001) ? 0 : value;
+    return element;
+  };
+}
+
+else if (Prototype.Browser.WebKit) {
+  Element.Methods.setOpacity = function(element, value) {
+    element = $(element);
+    element.style.opacity = (value == 1 || value === '') ? '' :
+      (value < 0.00001) ? 0 : value;
+
+    if (value == 1)
+      if (element.tagName.toUpperCase() == 'IMG' && element.width) {
+        element.width++; element.width--;
+      } else try {
+        var n = document.createTextNode(' ');
+        element.appendChild(n);
+        element.removeChild(n);
+      } catch (e) { }
+
+    return element;
+  };
+
+  Element.Methods.cumulativeOffset = function(element) {
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+      if (element.offsetParent == document.body)
+        if (Element.getStyle(element, 'position') == 'absolute') break;
+
+      element = element.offsetParent;
+    } while (element);
+
+    return Element._returnOffset(valueL, valueT);
+  };
+}
+
+if ('outerHTML' in document.documentElement) {
+  Element.Methods.replace = function(element, content) {
+    element = $(element);
+
+    if (content && content.toElement) content = content.toElement();
+    if (Object.isElement(content)) {
+      element.parentNode.replaceChild(content, element);
+      return element;
+    }
+
+    content = Object.toHTML(content);
+    var parent = element.parentNode, tagName = parent.tagName.toUpperCase();
+
+    if (Element._insertionTranslations.tags[tagName]) {
+      var nextSibling = element.next(),
+          fragments = Element._getContentFromAnonymousElement(tagName, content.stripScripts());
+      parent.removeChild(element);
+      if (nextSibling)
+        fragments.each(function(node) { parent.insertBefore(node, nextSibling) });
+      else
+        fragments.each(function(node) { parent.appendChild(node) });
+    }
+    else element.outerHTML = content.stripScripts();
+
+    content.evalScripts.bind(content).defer();
+    return element;
+  };
+}
+
+Element._returnOffset = function(l, t) {
+  var result = [l, t];
+  result.left = l;
+  result.top = t;
+  return result;
+};
+
+Element._getContentFromAnonymousElement = function(tagName, html) {
+  var div = new Element('div'),
+      t = Element._insertionTranslations.tags[tagName];
+  if (t) {
+    div.innerHTML = t[0] + html + t[1];
+    for (var i = t[2]; i--; ) {
+      div = div.firstChild;
+    }
+  }
+  else {
+    div.innerHTML = html;
+  }
+  return $A(div.childNodes);
+};
+
+Element._insertionTranslations = {
+  before: function(element, node) {
+    element.parentNode.insertBefore(node, element);
+  },
+  top: function(element, node) {
+    element.insertBefore(node, element.firstChild);
+  },
+  bottom: function(element, node) {
+    element.appendChild(node);
+  },
+  after: function(element, node) {
+    element.parentNode.insertBefore(node, element.nextSibling);
+  },
+  tags: {
+    TABLE:  ['<table>',                '</table>',                   1],
+    TBODY:  ['<table><tbody>',         '</tbody></table>',           2],
+    TR:     ['<table><tbody><tr>',     '</tr></tbody></table>',      3],
+    TD:     ['<table><tbody><tr><td>', '</td></tr></tbody></table>', 4],
+    SELECT: ['<select>',               '</select>',                  1]
+  }
+};
+
+(function() {
+  var tags = Element._insertionTranslations.tags;
+  Object.extend(tags, {
+    THEAD: tags.TBODY,
+    TFOOT: tags.TBODY,
+    TH:    tags.TD
+  });
+})();
+
+Element.Methods.Simulated = {
+  hasAttribute: function(element, attribute) {
+    attribute = Element._attributeTranslations.has[attribute] || attribute;
+    var node = $(element).getAttributeNode(attribute);
+    return !!(node && node.specified);
+  }
+};
+
+Element.Methods.ByTag = { };
+
+Object.extend(Element, Element.Methods);
+
+(function(div) {
+
+  if (!Prototype.BrowserFeatures.ElementExtensions && div['__proto__']) {
+    window.HTMLElement = { };
+    window.HTMLElement.prototype = div['__proto__'];
+    Prototype.BrowserFeatures.ElementExtensions = true;
+  }
+
+  div = null;
+
+})(document.createElement('div'));
+
+Element.extend = (function() {
+
+  function checkDeficiency(tagName) {
+    if (typeof window.Element != 'undefined') {
+      var proto = window.Element.prototype;
+      if (proto) {
+        var id = '_' + (Math.random()+'').slice(2),
+            el = document.createElement(tagName);
+        proto[id] = 'x';
+        var isBuggy = (el[id] !== 'x');
+        delete proto[id];
+        el = null;
+        return isBuggy;
+      }
+    }
+    return false;
+  }
+
+  function extendElementWith(element, methods) {
+    for (var property in methods) {
+      var value = methods[property];
+      if (Object.isFunction(value) && !(property in element))
+        element[property] = value.methodize();
+    }
+  }
+
+  var HTMLOBJECTELEMENT_PROTOTYPE_BUGGY = checkDeficiency('object');
+
+  if (Prototype.BrowserFeatures.SpecificElementExtensions) {
+    if (HTMLOBJECTELEMENT_PROTOTYPE_BUGGY) {
+      return function(element) {
+        if (element && typeof element._extendedByPrototype == 'undefined') {
+          var t = element.tagName;
+          if (t && (/^(?:object|applet|embed)$/i.test(t))) {
+            extendElementWith(element, Element.Methods);
+            extendElementWith(element, Element.Methods.Simulated);
+            extendElementWith(element, Element.Methods.ByTag[t.toUpperCase()]);
+          }
+        }
+        return element;
+      }
+    }
+    return Prototype.K;
+  }
+
+  var Methods = { }, ByTag = Element.Methods.ByTag;
+
+  var extend = Object.extend(function(element) {
+    if (!element || typeof element._extendedByPrototype != 'undefined' ||
+        element.nodeType != 1 || element == window) return element;
+
+    var methods = Object.clone(Methods),
+        tagName = element.tagName.toUpperCase();
+
+    if (ByTag[tagName]) Object.extend(methods, ByTag[tagName]);
+
+    extendElementWith(element, methods);
+
+    element._extendedByPrototype = Prototype.emptyFunction;
+    return element;
+
+  }, {
+    refresh: function() {
+      if (!Prototype.BrowserFeatures.ElementExtensions) {
+        Object.extend(Methods, Element.Methods);
+        Object.extend(Methods, Element.Methods.Simulated);
+      }
+    }
+  });
+
+  extend.refresh();
+  return extend;
+})();
+
+if (document.documentElement.hasAttribute) {
+  Element.hasAttribute = function(element, attribute) {
+    return element.hasAttribute(attribute);
+  };
+}
+else {
+  Element.hasAttribute = Element.Methods.Simulated.hasAttribute;
+}
+
+Element.addMethods = function(methods) {
+  var F = Prototype.BrowserFeatures, T = Element.Methods.ByTag;
+
+  if (!methods) {
+    Object.extend(Form, Form.Methods);
+    Object.extend(Form.Element, Form.Element.Methods);
+    Object.extend(Element.Methods.ByTag, {
+      "FORM":     Object.clone(Form.Methods),
+      "INPUT":    Object.clone(Form.Element.Methods),
+      "SELECT":   Object.clone(Form.Element.Methods),
+      "TEXTAREA": Object.clone(Form.Element.Methods)
+    });
+  }
+
+  if (arguments.length == 2) {
+    var tagName = methods;
+    methods = arguments[1];
+  }
+
+  if (!tagName) Object.extend(Element.Methods, methods || { });
+  else {
+    if (Object.isArray(tagName)) tagName.each(extend);
+    else extend(tagName);
+  }
+
+  function extend(tagName) {
+    tagName = tagName.toUpperCase();
+    if (!Element.Methods.ByTag[tagName])
+      Element.Methods.ByTag[tagName] = { };
+    Object.extend(Element.Methods.ByTag[tagName], methods);
+  }
+
+  function copy(methods, destination, onlyIfAbsent) {
+    onlyIfAbsent = onlyIfAbsent || false;
+    for (var property in methods) {
+      var value = methods[property];
+      if (!Object.isFunction(value)) continue;
+      if (!onlyIfAbsent || !(property in destination))
+        destination[property] = value.methodize();
+    }
+  }
+
+  function findDOMClass(tagName) {
+    var klass;
+    var trans = {
+      "OPTGROUP": "OptGroup", "TEXTAREA": "TextArea", "P": "Paragraph",
+      "FIELDSET": "FieldSet", "UL": "UList", "OL": "OList", "DL": "DList",
+      "DIR": "Directory", "H1": "Heading", "H2": "Heading", "H3": "Heading",
+      "H4": "Heading", "H5": "Heading", "H6": "Heading", "Q": "Quote",
+      "INS": "Mod", "DEL": "Mod", "A": "Anchor", "IMG": "Image", "CAPTION":
+      "TableCaption", "COL": "TableCol", "COLGROUP": "TableCol", "THEAD":
+      "TableSection", "TFOOT": "TableSection", "TBODY": "TableSection", "TR":
+      "TableRow", "TH": "TableCell", "TD": "TableCell", "FRAMESET":
+      "FrameSet", "IFRAME": "IFrame"
+    };
+    if (trans[tagName]) klass = 'HTML' + trans[tagName] + 'Element';
+    if (window[klass]) return window[klass];
+    klass = 'HTML' + tagName + 'Element';
+    if (window[klass]) return window[klass];
+    klass = 'HTML' + tagName.capitalize() + 'Element';
+    if (window[klass]) return window[klass];
+
+    var element = document.createElement(tagName),
+        proto = element['__proto__'] || element.constructor.prototype;
+
+    element = null;
+    return proto;
+  }
+
+  var elementPrototype = window.HTMLElement ? HTMLElement.prototype :
+   Element.prototype;
+
+  if (F.ElementExtensions) {
+    copy(Element.Methods, elementPrototype);
+    copy(Element.Methods.Simulated, elementPrototype, true);
+  }
+
+  if (F.SpecificElementExtensions) {
+    for (var tag in Element.Methods.ByTag) {
+      var klass = findDOMClass(tag);
+      if (Object.isUndefined(klass)) continue;
+      copy(T[tag], klass.prototype);
+    }
+  }
+
+  Object.extend(Element, Element.Methods);
+  delete Element.ByTag;
+
+  if (Element.extend.refresh) Element.extend.refresh();
+  Element.cache = { };
+};
+
+
+document.viewport = {
+
+  getDimensions: function() {
+    return { width: this.getWidth(), height: this.getHeight() };
+  },
+
+  getScrollOffsets: function() {
+    return Element._returnOffset(
+      window.pageXOffset || document.documentElement.scrollLeft || document.body.scrollLeft,
+      window.pageYOffset || document.documentElement.scrollTop  || document.body.scrollTop);
+  }
+};
+
+(function(viewport) {
+  var B = Prototype.Browser, doc = document, element, property = {};
+
+  function getRootElement() {
+    if (B.WebKit && !doc.evaluate)
+      return document;
+
+    if (B.Opera && window.parseFloat(window.opera.version()) < 9.5)
+      return document.body;
+
+    return document.documentElement;
+  }
+
+  function define(D) {
+    if (!element) element = getRootElement();
+
+    property[D] = 'client' + D;
+
+    viewport['get' + D] = function() { return element[property[D]] };
+    return viewport['get' + D]();
+  }
+
+  viewport.getWidth  = define.curry('Width');
+
+  viewport.getHeight = define.curry('Height');
+})(document.viewport);
+
+
+Element.Storage = {
+  UID: 1
+};
+
+Element.addMethods({
+  getStorage: function(element) {
+    if (!(element = $(element))) return;
+
+    var uid;
+    if (element === window) {
+      uid = 0;
+    } else {
+      if (typeof element._prototypeUID === "undefined")
+        element._prototypeUID = Element.Storage.UID++;
+      uid = element._prototypeUID;
+    }
+
+    if (!Element.Storage[uid])
+      Element.Storage[uid] = $H();
+
+    return Element.Storage[uid];
+  },
+
+  store: function(element, key, value) {
+    if (!(element = $(element))) return;
+
+    if (arguments.length === 2) {
+      Element.getStorage(element).update(key);
+    } else {
+      Element.getStorage(element).set(key, value);
+    }
+
+    return element;
+  },
+
+  retrieve: function(element, key, defaultValue) {
+    if (!(element = $(element))) return;
+    var hash = Element.getStorage(element), value = hash.get(key);
+
+    if (Object.isUndefined(value)) {
+      hash.set(key, defaultValue);
+      value = defaultValue;
+    }
+
+    return value;
+  },
+
+  clone: function(element, deep) {
+    if (!(element = $(element))) return;
+    var clone = element.cloneNode(deep);
+    clone._prototypeUID = void 0;
+    if (deep) {
+      var descendants = Element.select(clone, '*'),
+          i = descendants.length;
+      while (i--) {
+        descendants[i]._prototypeUID = void 0;
+      }
+    }
+    return Element.extend(clone);
+  },
+
+  purge: function(element) {
+    if (!(element = $(element))) return;
+    var purgeElement = Element._purgeElement;
+
+    purgeElement(element);
+
+    var descendants = element.getElementsByTagName('*'),
+     i = descendants.length;
+
+    while (i--) purgeElement(descendants[i]);
+
+    return null;
+  }
+});
+
+(function() {
+
+  function toDecimal(pctString) {
+    var match = pctString.match(/^(\d+)%?$/i);
+    if (!match) return null;
+    return (Number(match[1]) / 100);
+  }
+
+  function getPixelValue(value, property, context) {
+    var element = null;
+    if (Object.isElement(value)) {
+      element = value;
+      value = element.getStyle(property);
+    }
+
+    if (value === null) {
+      return null;
+    }
+
+    if ((/^(?:-)?\d+(\.\d+)?(px)?$/i).test(value)) {
+      return window.parseFloat(value);
+    }
+
+    var isPercentage = value.include('%'), isViewport = (context === document.viewport);
+
+    if (/\d/.test(value) && element && element.runtimeStyle && !(isPercentage && isViewport)) {
+      var style = element.style.left, rStyle = element.runtimeStyle.left;
+      element.runtimeStyle.left = element.currentStyle.left;
+      element.style.left = value || 0;
+      value = element.style.pixelLeft;
+      element.style.left = style;
+      element.runtimeStyle.left = rStyle;
+
+      return value;
+    }
+
+    if (element && isPercentage) {
+      context = context || element.parentNode;
+      var decimal = toDecimal(value);
+      var whole = null;
+      var position = element.getStyle('position');
+
+      var isHorizontal = property.include('left') || property.include('right') ||
+       property.include('width');
+
+      var isVertical =  property.include('top') || property.include('bottom') ||
+        property.include('height');
+
+      if (context === document.viewport) {
+        if (isHorizontal) {
+          whole = document.viewport.getWidth();
+        } else if (isVertical) {
+          whole = document.viewport.getHeight();
+        }
+      } else {
+        if (isHorizontal) {
+          whole = $(context).measure('width');
+        } else if (isVertical) {
+          whole = $(context).measure('height');
+        }
+      }
+
+      return (whole === null) ? 0 : whole * decimal;
+    }
+
+    return 0;
+  }
+
+  function toCSSPixels(number) {
+    if (Object.isString(number) && number.endsWith('px')) {
+      return number;
+    }
+    return number + 'px';
+  }
+
+  function isDisplayed(element) {
+    var originalElement = element;
+    while (element && element.parentNode) {
+      var display = element.getStyle('display');
+      if (display === 'none') {
+        return false;
+      }
+      element = $(element.parentNode);
+    }
+    return true;
+  }
+
+  var hasLayout = Prototype.K;
+  if ('currentStyle' in document.documentElement) {
+    hasLayout = function(element) {
+      if (!element.currentStyle.hasLayout) {
+        element.style.zoom = 1;
+      }
+      return element;
+    };
+  }
+
+  function cssNameFor(key) {
+    if (key.include('border')) key = key + '-width';
+    return key.camelize();
+  }
+
+  Element.Layout = Class.create(Hash, {
+    initialize: function($super, element, preCompute) {
+      $super();
+      this.element = $(element);
+
+      Element.Layout.PROPERTIES.each( function(property) {
+        this._set(property, null);
+      }, this);
+
+      if (preCompute) {
+        this._preComputing = true;
+        this._begin();
+        Element.Layout.PROPERTIES.each( this._compute, this );
+        this._end();
+        this._preComputing = false;
+      }
+    },
+
+    _set: function(property, value) {
+      return Hash.prototype.set.call(this, property, value);
+    },
+
+    set: function(property, value) {
+      throw "Properties of Element.Layout are read-only.";
+    },
+
+    get: function($super, property) {
+      var value = $super(property);
+      return value === null ? this._compute(property) : value;
+    },
+
+    _begin: function() {
+      if (this._prepared) return;
+
+      var element = this.element;
+      if (isDisplayed(element)) {
+        this._prepared = true;
+        return;
+      }
+
+      var originalStyles = {
+        position:   element.style.position   || '',
+        width:      element.style.width      || '',
+        visibility: element.style.visibility || '',
+        display:    element.style.display    || ''
+      };
+
+      element.store('prototype_original_styles', originalStyles);
+
+      var position = element.getStyle('position'),
+       width = element.getStyle('width');
+
+      var context = (position === 'fixed') ? document.viewport :
+       element.parentNode;
+
+      element.setStyle({
+        position:   'absolute',
+        visibility: 'hidden',
+        display:    'block'
+      });
+
+      var positionedWidth = element.getStyle('width');
+
+      var newWidth;
+      if (width && (positionedWidth === width)) {
+        newWidth = getPixelValue(element, 'width', context);
+      } else if (position === 'absolute' || position === 'fixed') {
+        newWidth = getPixelValue(element, 'width', context);
+      } else {
+        var parent = element.parentNode, pLayout = $(parent).getLayout();
+
+        newWidth = pLayout.get('width') -
+         this.get('margin-left') -
+         this.get('border-left') -
+         this.get('padding-left') -
+         this.get('padding-right') -
+         this.get('border-right') -
+         this.get('margin-right');
+      }
+
+      element.setStyle({ width: newWidth + 'px' });
+
+      this._prepared = true;
+    },
+
+    _end: function() {
+      var element = this.element;
+      var originalStyles = element.retrieve('prototype_original_styles');
+      element.store('prototype_original_styles', null);
+      element.setStyle(originalStyles);
+      this._prepared = false;
+    },
+
+    _compute: function(property) {
+      var COMPUTATIONS = Element.Layout.COMPUTATIONS;
+      if (!(property in COMPUTATIONS)) {
+        throw "Property not found.";
+      }
+
+      return this._set(property, COMPUTATIONS[property].call(this, this.element));
+    },
+
+    toObject: function() {
+      var args = $A(arguments);
+      var keys = (args.length === 0) ? Element.Layout.PROPERTIES :
+       args.join(' ').split(' ');
+      var obj = {};
+      keys.each( function(key) {
+        if (!Element.Layout.PROPERTIES.include(key)) return;
+        var value = this.get(key);
+        if (value != null) obj[key] = value;
+      }, this);
+      return obj;
+    },
+
+    toHash: function() {
+      var obj = this.toObject.apply(this, arguments);
+      return new Hash(obj);
+    },
+
+    toCSS: function() {
+      var args = $A(arguments);
+      var keys = (args.length === 0) ? Element.Layout.PROPERTIES :
+       args.join(' ').split(' ');
+      var css = {};
+
+      keys.each( function(key) {
+        if (!Element.Layout.PROPERTIES.include(key)) return;
+        if (Element.Layout.COMPOSITE_PROPERTIES.include(key)) return;
+
+        var value = this.get(key);
+        if (value != null) css[cssNameFor(key)] = value + 'px';
+      }, this);
+      return css;
+    },
+
+    inspect: function() {
+      return "#<Element.Layout>";
+    }
+  });
+
+  Object.extend(Element.Layout, {
+    PROPERTIES: $w('height width top left right bottom border-left border-right border-top border-bottom padding-left padding-right padding-top padding-bottom margin-top margin-bottom margin-left margin-right padding-box-width padding-box-height border-box-width border-box-height margin-box-width margin-box-height'),
+
+    COMPOSITE_PROPERTIES: $w('padding-box-width padding-box-height margin-box-width margin-box-height border-box-width border-box-height'),
+
+    COMPUTATIONS: {
+      'height': function(element) {
+        if (!this._preComputing) this._begin();
+
+        var bHeight = this.get('border-box-height');
+        if (bHeight <= 0) {
+          if (!this._preComputing) this._end();
+          return 0;
+        }
+
+        var bTop = this.get('border-top'),
+         bBottom = this.get('border-bottom');
+
+        var pTop = this.get('padding-top'),
+         pBottom = this.get('padding-bottom');
+
+        if (!this._preComputing) this._end();
+
+        return bHeight - bTop - bBottom - pTop - pBottom;
+      },
+
+      'width': function(element) {
+        if (!this._preComputing) this._begin();
+
+        var bWidth = this.get('border-box-width');
+        if (bWidth <= 0) {
+          if (!this._preComputing) this._end();
+          return 0;
+        }
+
+        var bLeft = this.get('border-left'),
+         bRight = this.get('border-right');
+
+        var pLeft = this.get('padding-left'),
+         pRight = this.get('padding-right');
+
+        if (!this._preComputing) this._end();
+
+        return bWidth - bLeft - bRight - pLeft - pRight;
+      },
+
+      'padding-box-height': function(element) {
+        var height = this.get('height'),
+         pTop = this.get('padding-top'),
+         pBottom = this.get('padding-bottom');
+
+        return height + pTop + pBottom;
+      },
+
+      'padding-box-width': function(element) {
+        var width = this.get('width'),
+         pLeft = this.get('padding-left'),
+         pRight = this.get('padding-right');
+
+        return width + pLeft + pRight;
+      },
+
+      'border-box-height': function(element) {
+        if (!this._preComputing) this._begin();
+        var height = element.offsetHeight;
+        if (!this._preComputing) this._end();
+        return height;
+      },
+
+      'border-box-width': function(element) {
+        if (!this._preComputing) this._begin();
+        var width = element.offsetWidth;
+        if (!this._preComputing) this._end();
+        return width;
+      },
+
+      'margin-box-height': function(element) {
+        var bHeight = this.get('border-box-height'),
+         mTop = this.get('margin-top'),
+         mBottom = this.get('margin-bottom');
+
+        if (bHeight <= 0) return 0;
+
+        return bHeight + mTop + mBottom;
+      },
+
+      'margin-box-width': function(element) {
+        var bWidth = this.get('border-box-width'),
+         mLeft = this.get('margin-left'),
+         mRight = this.get('margin-right');
+
+        if (bWidth <= 0) return 0;
+
+        return bWidth + mLeft + mRight;
+      },
+
+      'top': function(element) {
+        var offset = element.positionedOffset();
+        return offset.top;
+      },
+
+      'bottom': function(element) {
+        var offset = element.positionedOffset(),
+         parent = element.getOffsetParent(),
+         pHeight = parent.measure('height');
+
+        var mHeight = this.get('border-box-height');
+
+        return pHeight - mHeight - offset.top;
+      },
+
+      'left': function(element) {
+        var offset = element.positionedOffset();
+        return offset.left;
+      },
+
+      'right': function(element) {
+        var offset = element.positionedOffset(),
+         parent = element.getOffsetParent(),
+         pWidth = parent.measure('width');
+
+        var mWidth = this.get('border-box-width');
+
+        return pWidth - mWidth - offset.left;
+      },
+
+      'padding-top': function(element) {
+        return getPixelValue(element, 'paddingTop');
+      },
+
+      'padding-bottom': function(element) {
+        return getPixelValue(element, 'paddingBottom');
+      },
+
+      'padding-left': function(element) {
+        return getPixelValue(element, 'paddingLeft');
+      },
+
+      'padding-right': function(element) {
+        return getPixelValue(element, 'paddingRight');
+      },
+
+      'border-top': function(element) {
+        return getPixelValue(element, 'borderTopWidth');
+      },
+
+      'border-bottom': function(element) {
+        return getPixelValue(element, 'borderBottomWidth');
+      },
+
+      'border-left': function(element) {
+        return getPixelValue(element, 'borderLeftWidth');
+      },
+
+      'border-right': function(element) {
+        return getPixelValue(element, 'borderRightWidth');
+      },
+
+      'margin-top': function(element) {
+        return getPixelValue(element, 'marginTop');
+      },
+
+      'margin-bottom': function(element) {
+        return getPixelValue(element, 'marginBottom');
+      },
+
+      'margin-left': function(element) {
+        return getPixelValue(element, 'marginLeft');
+      },
+
+      'margin-right': function(element) {
+        return getPixelValue(element, 'marginRight');
+      }
+    }
+  });
+
+  if ('getBoundingClientRect' in document.documentElement) {
+    Object.extend(Element.Layout.COMPUTATIONS, {
+      'right': function(element) {
+        var parent = hasLayout(element.getOffsetParent());
+        var rect = element.getBoundingClientRect(),
+         pRect = parent.getBoundingClientRect();
+
+        return (pRect.right - rect.right).round();
+      },
+
+      'bottom': function(element) {
+        var parent = hasLayout(element.getOffsetParent());
+        var rect = element.getBoundingClientRect(),
+         pRect = parent.getBoundingClientRect();
+
+        return (pRect.bottom - rect.bottom).round();
+      }
+    });
+  }
+
+  Element.Offset = Class.create({
+    initialize: function(left, top) {
+      this.left = left.round();
+      this.top  = top.round();
+
+      this[0] = this.left;
+      this[1] = this.top;
+    },
+
+    relativeTo: function(offset) {
+      return new Element.Offset(
+        this.left - offset.left,
+        this.top  - offset.top
+      );
+    },
+
+    inspect: function() {
+      return "#<Element.Offset left: #{left} top: #{top}>".interpolate(this);
+    },
+
+    toString: function() {
+      return "[#{left}, #{top}]".interpolate(this);
+    },
+
+    toArray: function() {
+      return [this.left, this.top];
+    }
+  });
+
+  function getLayout(element, preCompute) {
+    return new Element.Layout(element, preCompute);
+  }
+
+  function measure(element, property) {
+    return $(element).getLayout().get(property);
+  }
+
+  function getDimensions(element) {
+    element = $(element);
+    var display = Element.getStyle(element, 'display');
+
+    if (display && display !== 'none') {
+      return { width: element.offsetWidth, height: element.offsetHeight };
+    }
+
+    var style = element.style;
+    var originalStyles = {
+      visibility: style.visibility,
+      position:   style.position,
+      display:    style.display
+    };
+
+    var newStyles = {
+      visibility: 'hidden',
+      display:    'block'
+    };
+
+    if (originalStyles.position !== 'fixed')
+      newStyles.position = 'absolute';
+
+    Element.setStyle(element, newStyles);
+
+    var dimensions = {
+      width:  element.offsetWidth,
+      height: element.offsetHeight
+    };
+
+    Element.setStyle(element, originalStyles);
+
+    return dimensions;
+  }
+
+  function getOffsetParent(element) {
+    if (isDetached(element)) return $(document.body);
+
+    var isInline = (Element.getStyle(element, 'display') === 'inline');
+    if (!isInline && element.offsetParent) return $(element.offsetParent);
+    if (element === document.body) return $(element);
+
+    while ((element = element.parentNode) && element !== document.body) {
+      if (Element.getStyle(element, 'position') !== 'static') {
+        return (element.nodeName === 'HTML') ? $(document.body) : $(element);
+      }
+    }
+
+    return $(document.body);
+  }
+
+
+  function cumulativeOffset(element) {
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+      element = element.offsetParent;
+    } while (element);
+    return new Element.Offset(valueL, valueT);
+  }
+
+  function positionedOffset(element) {
+    var layout = element.getLayout();
+
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+      element = element.offsetParent;
+      if (element) {
+        if (isBody(element)) break;
+        var p = Element.getStyle(element, 'position');
+        if (p !== 'static') break;
+      }
+    } while (element);
+
+    valueL -= layout.get('margin-top');
+    valueT -= layout.get('margin-left');
+
+    return new Element.Offset(valueL, valueT);
+  }
+
+  function cumulativeScrollOffset(element) {
+    var valueT = 0, valueL = 0;
+    do {
+      valueT += element.scrollTop  || 0;
+      valueL += element.scrollLeft || 0;
+      element = element.parentNode;
+    } while (element);
+    return new Element.Offset(valueL, valueT);
+  }
+
+  function viewportOffset(forElement) {
+    var valueT = 0, valueL = 0, docBody = document.body;
+
+    var element = forElement;
+    do {
+      valueT += element.offsetTop  || 0;
+      valueL += element.offsetLeft || 0;
+      if (element.offsetParent == docBody &&
+        Element.getStyle(element, 'position') == 'absolute') break;
+    } while (element = element.offsetParent);
+
+    element = forElement;
+    do {
+      if (element != docBody) {
+        valueT -= element.scrollTop  || 0;
+        valueL -= element.scrollLeft || 0;
+      }
+    } while (element = element.parentNode);
+    return new Element.Offset(valueL, valueT);
+  }
+
+  function absolutize(element) {
+    element = $(element);
+
+    if (Element.getStyle(element, 'position') === 'absolute') {
+      return element;
+    }
+
+    var offsetParent = getOffsetParent(element);
+    var eOffset = element.viewportOffset(),
+     pOffset = offsetParent.viewportOffset();
+
+    var offset = eOffset.relativeTo(pOffset);
+    var layout = element.getLayout();
+
+    element.store('prototype_absolutize_original_styles', {
+      left:   element.getStyle('left'),
+      top:    element.getStyle('top'),
+      width:  element.getStyle('width'),
+      height: element.getStyle('height')
+    });
+
+    element.setStyle({
+      position: 'absolute',
+      top:    offset.top + 'px',
+      left:   offset.left + 'px',
+      width:  layout.get('width') + 'px',
+      height: layout.get('height') + 'px'
+    });
+
+    return element;
+  }
+
+  function relativize(element) {
+    element = $(element);
+    if (Element.getStyle(element, 'position') === 'relative') {
+      return element;
+    }
+
+    var originalStyles =
+     element.retrieve('prototype_absolutize_original_styles');
+
+    if (originalStyles) element.setStyle(originalStyles);
+    return element;
+  }
+
+  Element.addMethods({
+    getLayout:              getLayout,
+    measure:                measure,
+    getDimensions:          getDimensions,
+    getOffsetParent:        getOffsetParent,
+    cumulativeOffset:       cumulativeOffset,
+    positionedOffset:       positionedOffset,
+    cumulativeScrollOffset: cumulativeScrollOffset,
+    viewportOffset:         viewportOffset,
+    absolutize:             absolutize,
+    relativize:             relativize
+  });
+
+  function isBody(element) {
+    return element.nodeName.toUpperCase() === 'BODY';
+  }
+
+  function isDetached(element) {
+    return element !== document.body &&
+     !Element.descendantOf(element, document.body);
+  }
+
+  if ('getBoundingClientRect' in document.documentElement) {
+    Element.addMethods({
+      viewportOffset: function(element) {
+        element = $(element);
+        if (isDetached(element)) return new Element.Offset(0, 0);
+
+        var rect  = element.getBoundingClientRect(),
+         docEl = document.documentElement;
+        return new Element.Offset(rect.left - docEl.clientLeft,
+         rect.top - docEl.clientTop);
+      },
+
+      positionedOffset: function(element) {
+        element = $(element);
+        var parent = element.getOffsetParent();
+        if (isDetached(element)) return new Element.Offset(0, 0);
+
+        if (element.offsetParent &&
+         element.offsetParent.nodeName.toUpperCase() === 'HTML') {
+          return positionedOffset(element);
+        }
+
+        var eOffset = element.viewportOffset(),
+         pOffset = isBody(parent) ? viewportOffset(parent) :
+          parent.viewportOffset();
+        var retOffset = eOffset.relativeTo(pOffset);
+
+        var layout = element.getLayout();
+        var top  = retOffset.top  - layout.get('margin-top');
+        var left = retOffset.left - layout.get('margin-left');
+
+        return new Element.Offset(left, top);
+      }
+    });
+  }
+})();
+window.$$ = function() {
+  var expression = $A(arguments).join(', ');
+  return Prototype.Selector.select(expression, document);
+};
+
+Prototype.Selector = (function() {
+
+  function select() {
+    throw new Error('Method "Prototype.Selector.select" must be defined.');
+  }
+
+  function match() {
+    throw new Error('Method "Prototype.Selector.match" must be defined.');
+  }
+
+  function find(elements, expression, index) {
+    index = index || 0;
+    var match = Prototype.Selector.match, length = elements.length, matchIndex = 0, i;
+
+    for (i = 0; i < length; i++) {
+      if (match(elements[i], expression) && index == matchIndex++) {
+        return Element.extend(elements[i]);
+      }
+    }
+  }
+
+  function extendElements(elements) {
+    for (var i = 0, length = elements.length; i < length; i++) {
+      Element.extend(elements[i]);
+    }
+    return elements;
+  }
+
+
+  var K = Prototype.K;
+
+  return {
+    select: select,
+    match: match,
+    find: find,
+    extendElements: (Element.extend === K) ? K : extendElements,
+    extendElement: Element.extend
+  };
+})();
+Prototype._original_property = window.Sizzle;
+/*!
+ * Sizzle CSS Selector Engine - v1.0
+ *  Copyright 2009, The Dojo Foundation
+ *  Released under the MIT, BSD, and GPL Licenses.
+ *  More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+	done = 0,
+	toString = Object.prototype.toString,
+	hasDuplicate = false,
+	baseHasDuplicate = true;
+
+[0, 0].sort(function(){
+	baseHasDuplicate = false;
+	return 0;
+});
+
+var Sizzle = function(selector, context, results, seed) {
+	results = results || [];
+	var origContext = context = context || document;
+
+	if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+		return [];
+	}
+
+	if ( !selector || typeof selector !== "string" ) {
+		return results;
+	}
+
+	var parts = [], m, set, checkSet, check, mode, extra, prune = true, contextXML = isXML(context),
+		soFar = selector;
+
+	while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) {
+		soFar = m[3];
+
+		parts.push( m[1] );
+
+		if ( m[2] ) {
+			extra = m[3];
+			break;
+		}
+	}
+
+	if ( parts.length > 1 && origPOS.exec( selector ) ) {
+		if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+			set = posProcess( parts[0] + parts[1], context );
+		} else {
+			set = Expr.relative[ parts[0] ] ?
+				[ context ] :
+				Sizzle( parts.shift(), context );
+
+			while ( parts.length ) {
+				selector = parts.shift();
+
+				if ( Expr.relative[ selector ] )
+					selector += parts.shift();
+
+				set = posProcess( selector, set );
+			}
+		}
+	} else {
+		if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+				Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+			var ret = Sizzle.find( parts.shift(), context, contextXML );
+			context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0];
+		}
+
+		if ( context ) {
+			var ret = seed ?
+				{ expr: parts.pop(), set: makeArray(seed) } :
+				Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+			set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set;
+
+			if ( parts.length > 0 ) {
+				checkSet = makeArray(set);
+			} else {
+				prune = false;
+			}
+
+			while ( parts.length ) {
+				var cur = parts.pop(), pop = cur;
+
+				if ( !Expr.relative[ cur ] ) {
+					cur = "";
+				} else {
+					pop = parts.pop();
+				}
+
+				if ( pop == null ) {
+					pop = context;
+				}
+
+				Expr.relative[ cur ]( checkSet, pop, contextXML );
+			}
+		} else {
+			checkSet = parts = [];
+		}
+	}
+
+	if ( !checkSet ) {
+		checkSet = set;
+	}
+
+	if ( !checkSet ) {
+		throw "Syntax error, unrecognized expression: " + (cur || selector);
+	}
+
+	if ( toString.call(checkSet) === "[object Array]" ) {
+		if ( !prune ) {
+			results.push.apply( results, checkSet );
+		} else if ( context && context.nodeType === 1 ) {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+					results.push( set[i] );
+				}
+			}
+		} else {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+					results.push( set[i] );
+				}
+			}
+		}
+	} else {
+		makeArray( checkSet, results );
+	}
+
+	if ( extra ) {
+		Sizzle( extra, origContext, results, seed );
+		Sizzle.uniqueSort( results );
+	}
+
+	return results;
+};
+
+Sizzle.uniqueSort = function(results){
+	if ( sortOrder ) {
+		hasDuplicate = baseHasDuplicate;
+		results.sort(sortOrder);
+
+		if ( hasDuplicate ) {
+			for ( var i = 1; i < results.length; i++ ) {
+				if ( results[i] === results[i-1] ) {
+					results.splice(i--, 1);
+				}
+			}
+		}
+	}
+
+	return results;
+};
+
+Sizzle.matches = function(expr, set){
+	return Sizzle(expr, null, null, set);
+};
+
+Sizzle.find = function(expr, context, isXML){
+	var set, match;
+
+	if ( !expr ) {
+		return [];
+	}
+
+	for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+		var type = Expr.order[i], match;
+
+		if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+			var left = match[1];
+			match.splice(1,1);
+
+			if ( left.substr( left.length - 1 ) !== "\\" ) {
+				match[1] = (match[1] || "").replace(/\\/g, "");
+				set = Expr.find[ type ]( match, context, isXML );
+				if ( set != null ) {
+					expr = expr.replace( Expr.match[ type ], "" );
+					break;
+				}
+			}
+		}
+	}
+
+	if ( !set ) {
+		set = context.getElementsByTagName("*");
+	}
+
+	return {set: set, expr: expr};
+};
+
+Sizzle.filter = function(expr, set, inplace, not){
+	var old = expr, result = [], curLoop = set, match, anyFound,
+		isXMLFilter = set && set[0] && isXML(set[0]);
+
+	while ( expr && set.length ) {
+		for ( var type in Expr.filter ) {
+			if ( (match = Expr.match[ type ].exec( expr )) != null ) {
+				var filter = Expr.filter[ type ], found, item;
+				anyFound = false;
+
+				if ( curLoop == result ) {
+					result = [];
+				}
+
+				if ( Expr.preFilter[ type ] ) {
+					match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+					if ( !match ) {
+						anyFound = found = true;
+					} else if ( match === true ) {
+						continue;
+					}
+				}
+
+				if ( match ) {
+					for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+						if ( item ) {
+							found = filter( item, match, i, curLoop );
+							var pass = not ^ !!found;
+
+							if ( inplace && found != null ) {
+								if ( pass ) {
+									anyFound = true;
+								} else {
+									curLoop[i] = false;
+								}
+							} else if ( pass ) {
+								result.push( item );
+								anyFound = true;
+							}
+						}
+					}
+				}
+
+				if ( found !== undefined ) {
+					if ( !inplace ) {
+						curLoop = result;
+					}
+
+					expr = expr.replace( Expr.match[ type ], "" );
+
+					if ( !anyFound ) {
+						return [];
+					}
+
+					break;
+				}
+			}
+		}
+
+		if ( expr == old ) {
+			if ( anyFound == null ) {
+				throw "Syntax error, unrecognized expression: " + expr;
+			} else {
+				break;
+			}
+		}
+
+		old = expr;
+	}
+
+	return curLoop;
+};
+
+var Expr = Sizzle.selectors = {
+	order: [ "ID", "NAME", "TAG" ],
+	match: {
+		ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,
+		ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+		TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,
+		CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
+		POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
+		PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/
+	},
+	leftMatch: {},
+	attrMap: {
+		"class": "className",
+		"for": "htmlFor"
+	},
+	attrHandle: {
+		href: function(elem){
+			return elem.getAttribute("href");
+		}
+	},
+	relative: {
+		"+": function(checkSet, part, isXML){
+			var isPartStr = typeof part === "string",
+				isTag = isPartStr && !/\W/.test(part),
+				isPartStrNotTag = isPartStr && !isTag;
+
+			if ( isTag && !isXML ) {
+				part = part.toUpperCase();
+			}
+
+			for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+				if ( (elem = checkSet[i]) ) {
+					while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+					checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ?
+						elem || false :
+						elem === part;
+				}
+			}
+
+			if ( isPartStrNotTag ) {
+				Sizzle.filter( part, checkSet, true );
+			}
+		},
+		">": function(checkSet, part, isXML){
+			var isPartStr = typeof part === "string";
+
+			if ( isPartStr && !/\W/.test(part) ) {
+				part = isXML ? part : part.toUpperCase();
+
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						var parent = elem.parentNode;
+						checkSet[i] = parent.nodeName === part ? parent : false;
+					}
+				}
+			} else {
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						checkSet[i] = isPartStr ?
+							elem.parentNode :
+							elem.parentNode === part;
+					}
+				}
+
+				if ( isPartStr ) {
+					Sizzle.filter( part, checkSet, true );
+				}
+			}
+		},
+		"": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( !/\W/.test(part) ) {
+				var nodeCheck = part = isXML ? part : part.toUpperCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+		},
+		"~": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( typeof part === "string" && !/\W/.test(part) ) {
+				var nodeCheck = part = isXML ? part : part.toUpperCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+		}
+	},
+	find: {
+		ID: function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? [m] : [];
+			}
+		},
+		NAME: function(match, context, isXML){
+			if ( typeof context.getElementsByName !== "undefined" ) {
+				var ret = [], results = context.getElementsByName(match[1]);
+
+				for ( var i = 0, l = results.length; i < l; i++ ) {
+					if ( results[i].getAttribute("name") === match[1] ) {
+						ret.push( results[i] );
+					}
+				}
+
+				return ret.length === 0 ? null : ret;
+			}
+		},
+		TAG: function(match, context){
+			return context.getElementsByTagName(match[1]);
+		}
+	},
+	preFilter: {
+		CLASS: function(match, curLoop, inplace, result, not, isXML){
+			match = " " + match[1].replace(/\\/g, "") + " ";
+
+			if ( isXML ) {
+				return match;
+			}
+
+			for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+				if ( elem ) {
+					if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) {
+						if ( !inplace )
+							result.push( elem );
+					} else if ( inplace ) {
+						curLoop[i] = false;
+					}
+				}
+			}
+
+			return false;
+		},
+		ID: function(match){
+			return match[1].replace(/\\/g, "");
+		},
+		TAG: function(match, curLoop){
+			for ( var i = 0; curLoop[i] === false; i++ ){}
+			return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase();
+		},
+		CHILD: function(match){
+			if ( match[1] == "nth" ) {
+				var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+					match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" ||
+					!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+				match[2] = (test[1] + (test[2] || 1)) - 0;
+				match[3] = test[3] - 0;
+			}
+
+			match[0] = done++;
+
+			return match;
+		},
+		ATTR: function(match, curLoop, inplace, result, not, isXML){
+			var name = match[1].replace(/\\/g, "");
+
+			if ( !isXML && Expr.attrMap[name] ) {
+				match[1] = Expr.attrMap[name];
+			}
+
+			if ( match[2] === "~=" ) {
+				match[4] = " " + match[4] + " ";
+			}
+
+			return match;
+		},
+		PSEUDO: function(match, curLoop, inplace, result, not){
+			if ( match[1] === "not" ) {
+				if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+					match[3] = Sizzle(match[3], null, null, curLoop);
+				} else {
+					var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+					if ( !inplace ) {
+						result.push.apply( result, ret );
+					}
+					return false;
+				}
+			} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+				return true;
+			}
+
+			return match;
+		},
+		POS: function(match){
+			match.unshift( true );
+			return match;
+		}
+	},
+	filters: {
+		enabled: function(elem){
+			return elem.disabled === false && elem.type !== "hidden";
+		},
+		disabled: function(elem){
+			return elem.disabled === true;
+		},
+		checked: function(elem){
+			return elem.checked === true;
+		},
+		selected: function(elem){
+			elem.parentNode.selectedIndex;
+			return elem.selected === true;
+		},
+		parent: function(elem){
+			return !!elem.firstChild;
+		},
+		empty: function(elem){
+			return !elem.firstChild;
+		},
+		has: function(elem, i, match){
+			return !!Sizzle( match[3], elem ).length;
+		},
+		header: function(elem){
+			return /h\d/i.test( elem.nodeName );
+		},
+		text: function(elem){
+			return "text" === elem.type;
+		},
+		radio: function(elem){
+			return "radio" === elem.type;
+		},
+		checkbox: function(elem){
+			return "checkbox" === elem.type;
+		},
+		file: function(elem){
+			return "file" === elem.type;
+		},
+		password: function(elem){
+			return "password" === elem.type;
+		},
+		submit: function(elem){
+			return "submit" === elem.type;
+		},
+		image: function(elem){
+			return "image" === elem.type;
+		},
+		reset: function(elem){
+			return "reset" === elem.type;
+		},
+		button: function(elem){
+			return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON";
+		},
+		input: function(elem){
+			return /input|select|textarea|button/i.test(elem.nodeName);
+		}
+	},
+	setFilters: {
+		first: function(elem, i){
+			return i === 0;
+		},
+		last: function(elem, i, match, array){
+			return i === array.length - 1;
+		},
+		even: function(elem, i){
+			return i % 2 === 0;
+		},
+		odd: function(elem, i){
+			return i % 2 === 1;
+		},
+		lt: function(elem, i, match){
+			return i < match[3] - 0;
+		},
+		gt: function(elem, i, match){
+			return i > match[3] - 0;
+		},
+		nth: function(elem, i, match){
+			return match[3] - 0 == i;
+		},
+		eq: function(elem, i, match){
+			return match[3] - 0 == i;
+		}
+	},
+	filter: {
+		PSEUDO: function(elem, match, i, array){
+			var name = match[1], filter = Expr.filters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			} else if ( name === "contains" ) {
+				return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0;
+			} else if ( name === "not" ) {
+				var not = match[3];
+
+				for ( var i = 0, l = not.length; i < l; i++ ) {
+					if ( not[i] === elem ) {
+						return false;
+					}
+				}
+
+				return true;
+			}
+		},
+		CHILD: function(elem, match){
+			var type = match[1], node = elem;
+			switch (type) {
+				case 'only':
+				case 'first':
+					while ( (node = node.previousSibling) )  {
+						if ( node.nodeType === 1 ) return false;
+					}
+					if ( type == 'first') return true;
+					node = elem;
+				case 'last':
+					while ( (node = node.nextSibling) )  {
+						if ( node.nodeType === 1 ) return false;
+					}
+					return true;
+				case 'nth':
+					var first = match[2], last = match[3];
+
+					if ( first == 1 && last == 0 ) {
+						return true;
+					}
+
+					var doneName = match[0],
+						parent = elem.parentNode;
+
+					if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+						var count = 0;
+						for ( node = parent.firstChild; node; node = node.nextSibling ) {
+							if ( node.nodeType === 1 ) {
+								node.nodeIndex = ++count;
+							}
+						}
+						parent.sizcache = doneName;
+					}
+
+					var diff = elem.nodeIndex - last;
+					if ( first == 0 ) {
+						return diff == 0;
+					} else {
+						return ( diff % first == 0 && diff / first >= 0 );
+					}
+			}
+		},
+		ID: function(elem, match){
+			return elem.nodeType === 1 && elem.getAttribute("id") === match;
+		},
+		TAG: function(elem, match){
+			return (match === "*" && elem.nodeType === 1) || elem.nodeName === match;
+		},
+		CLASS: function(elem, match){
+			return (" " + (elem.className || elem.getAttribute("class")) + " ")
+				.indexOf( match ) > -1;
+		},
+		ATTR: function(elem, match){
+			var name = match[1],
+				result = Expr.attrHandle[ name ] ?
+					Expr.attrHandle[ name ]( elem ) :
+					elem[ name ] != null ?
+						elem[ name ] :
+						elem.getAttribute( name ),
+				value = result + "",
+				type = match[2],
+				check = match[4];
+
+			return result == null ?
+				type === "!=" :
+				type === "=" ?
+				value === check :
+				type === "*=" ?
+				value.indexOf(check) >= 0 :
+				type === "~=" ?
+				(" " + value + " ").indexOf(check) >= 0 :
+				!check ?
+				value && result !== false :
+				type === "!=" ?
+				value != check :
+				type === "^=" ?
+				value.indexOf(check) === 0 :
+				type === "$=" ?
+				value.substr(value.length - check.length) === check :
+				type === "|=" ?
+				value === check || value.substr(0, check.length + 1) === check + "-" :
+				false;
+		},
+		POS: function(elem, match, i, array){
+			var name = match[2], filter = Expr.setFilters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			}
+		}
+	}
+};
+
+var origPOS = Expr.match.POS;
+
+for ( var type in Expr.match ) {
+	Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+	Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source );
+}
+
+var makeArray = function(array, results) {
+	array = Array.prototype.slice.call( array, 0 );
+
+	if ( results ) {
+		results.push.apply( results, array );
+		return results;
+	}
+
+	return array;
+};
+
+try {
+	Array.prototype.slice.call( document.documentElement.childNodes, 0 );
+
+} catch(e){
+	makeArray = function(array, results) {
+		var ret = results || [];
+
+		if ( toString.call(array) === "[object Array]" ) {
+			Array.prototype.push.apply( ret, array );
+		} else {
+			if ( typeof array.length === "number" ) {
+				for ( var i = 0, l = array.length; i < l; i++ ) {
+					ret.push( array[i] );
+				}
+			} else {
+				for ( var i = 0; array[i]; i++ ) {
+					ret.push( array[i] );
+				}
+			}
+		}
+
+		return ret;
+	};
+}
+
+var sortOrder;
+
+if ( document.documentElement.compareDocumentPosition ) {
+	sortOrder = function( a, b ) {
+		if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return 0;
+		}
+
+		var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( "sourceIndex" in document.documentElement ) {
+	sortOrder = function( a, b ) {
+		if ( !a.sourceIndex || !b.sourceIndex ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return 0;
+		}
+
+		var ret = a.sourceIndex - b.sourceIndex;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( document.createRange ) {
+	sortOrder = function( a, b ) {
+		if ( !a.ownerDocument || !b.ownerDocument ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return 0;
+		}
+
+		var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
+		aRange.setStart(a, 0);
+		aRange.setEnd(a, 0);
+		bRange.setStart(b, 0);
+		bRange.setEnd(b, 0);
+		var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+}
+
+(function(){
+	var form = document.createElement("div"),
+		id = "script" + (new Date).getTime();
+	form.innerHTML = "<a name='" + id + "'/>";
+
+	var root = document.documentElement;
+	root.insertBefore( form, root.firstChild );
+
+	if ( !!document.getElementById( id ) ) {
+		Expr.find.ID = function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+			}
+		};
+
+		Expr.filter.ID = function(elem, match){
+			var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+			return elem.nodeType === 1 && node && node.nodeValue === match;
+		};
+	}
+
+	root.removeChild( form );
+	root = form = null; // release memory in IE
+})();
+
+(function(){
+
+	var div = document.createElement("div");
+	div.appendChild( document.createComment("") );
+
+	if ( div.getElementsByTagName("*").length > 0 ) {
+		Expr.find.TAG = function(match, context){
+			var results = context.getElementsByTagName(match[1]);
+
+			if ( match[1] === "*" ) {
+				var tmp = [];
+
+				for ( var i = 0; results[i]; i++ ) {
+					if ( results[i].nodeType === 1 ) {
+						tmp.push( results[i] );
+					}
+				}
+
+				results = tmp;
+			}
+
+			return results;
+		};
+	}
+
+	div.innerHTML = "<a href='#'></a>";
+	if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+			div.firstChild.getAttribute("href") !== "#" ) {
+		Expr.attrHandle.href = function(elem){
+			return elem.getAttribute("href", 2);
+		};
+	}
+
+	div = null; // release memory in IE
+})();
+
+if ( document.querySelectorAll ) (function(){
+	var oldSizzle = Sizzle, div = document.createElement("div");
+	div.innerHTML = "<p class='TEST'></p>";
+
+	if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+		return;
+	}
+
+	Sizzle = function(query, context, extra, seed){
+		context = context || document;
+
+		if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+			try {
+				return makeArray( context.querySelectorAll(query), extra );
+			} catch(e){}
+		}
+
+		return oldSizzle(query, context, extra, seed);
+	};
+
+	for ( var prop in oldSizzle ) {
+		Sizzle[ prop ] = oldSizzle[ prop ];
+	}
+
+	div = null; // release memory in IE
+})();
+
+if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){
+	var div = document.createElement("div");
+	div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+	if ( div.getElementsByClassName("e").length === 0 )
+		return;
+
+	div.lastChild.className = "e";
+
+	if ( div.getElementsByClassName("e").length === 1 )
+		return;
+
+	Expr.order.splice(1, 0, "CLASS");
+	Expr.find.CLASS = function(match, context, isXML) {
+		if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+			return context.getElementsByClassName(match[1]);
+		}
+	};
+
+	div = null; // release memory in IE
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	var sibDir = dir == "previousSibling" && !isXML;
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			if ( sibDir && elem.nodeType === 1 ){
+				elem.sizcache = doneName;
+				elem.sizset = i;
+			}
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 && !isXML ){
+					elem.sizcache = doneName;
+					elem.sizset = i;
+				}
+
+				if ( elem.nodeName === cur ) {
+					match = elem;
+					break;
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	var sibDir = dir == "previousSibling" && !isXML;
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			if ( sibDir && elem.nodeType === 1 ) {
+				elem.sizcache = doneName;
+				elem.sizset = i;
+			}
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 ) {
+					if ( !isXML ) {
+						elem.sizcache = doneName;
+						elem.sizset = i;
+					}
+					if ( typeof cur !== "string" ) {
+						if ( elem === cur ) {
+							match = true;
+							break;
+						}
+
+					} else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+						match = elem;
+						break;
+					}
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+var contains = document.compareDocumentPosition ?  function(a, b){
+	return a.compareDocumentPosition(b) & 16;
+} : function(a, b){
+	return a !== b && (a.contains ? a.contains(b) : true);
+};
+
+var isXML = function(elem){
+	return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
+		!!elem.ownerDocument && elem.ownerDocument.documentElement.nodeName !== "HTML";
+};
+
+var posProcess = function(selector, context){
+	var tmpSet = [], later = "", match,
+		root = context.nodeType ? [context] : context;
+
+	while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+		later += match[0];
+		selector = selector.replace( Expr.match.PSEUDO, "" );
+	}
+
+	selector = Expr.relative[selector] ? selector + "*" : selector;
+
+	for ( var i = 0, l = root.length; i < l; i++ ) {
+		Sizzle( selector, root[i], tmpSet );
+	}
+
+	return Sizzle.filter( later, tmpSet );
+};
+
+
+window.Sizzle = Sizzle;
+
+})();
+
+;(function(engine) {
+  var extendElements = Prototype.Selector.extendElements;
+
+  function select(selector, scope) {
+    return extendElements(engine(selector, scope || document));
+  }
+
+  function match(element, selector) {
+    return engine.matches(selector, [element]).length == 1;
+  }
+
+  Prototype.Selector.engine = engine;
+  Prototype.Selector.select = select;
+  Prototype.Selector.match = match;
+})(Sizzle);
+
+window.Sizzle = Prototype._original_property;
+delete Prototype._original_property;
+
+var Form = {
+  reset: function(form) {
+    form = $(form);
+    form.reset();
+    return form;
+  },
+
+  serializeElements: function(elements, options) {
+    if (typeof options != 'object') options = { hash: !!options };
+    else if (Object.isUndefined(options.hash)) options.hash = true;
+    var key, value, submitted = false, submit = options.submit, accumulator, initial;
+
+    if (options.hash) {
+      initial = {};
+      accumulator = function(result, key, value) {
+        if (key in result) {
+          if (!Object.isArray(result[key])) result[key] = [result[key]];
+          result[key].push(value);
+        } else result[key] = value;
+        return result;
+      };
+    } else {
+      initial = '';
+      accumulator = function(result, key, value) {
+        return result + (result ? '&' : '') + encodeURIComponent(key) + '=' + encodeURIComponent(value);
+      }
+    }
+
+    return elements.inject(initial, function(result, element) {
+      if (!element.disabled && element.name) {
+        key = element.name; value = $(element).getValue();
+        if (value != null && element.type != 'file' && (element.type != 'submit' || (!submitted &&
+            submit !== false && (!submit || key == submit) && (submitted = true)))) {
+          result = accumulator(result, key, value);
+        }
+      }
+      return result;
+    });
+  }
+};
+
+Form.Methods = {
+  serialize: function(form, options) {
+    return Form.serializeElements(Form.getElements(form), options);
+  },
+
+  getElements: function(form) {
+    var elements = $(form).getElementsByTagName('*'),
+        element,
+        arr = [ ],
+        serializers = Form.Element.Serializers;
+    for (var i = 0; element = elements[i]; i++) {
+      arr.push(element);
+    }
+    return arr.inject([], function(elements, child) {
+      if (serializers[child.tagName.toLowerCase()])
+        elements.push(Element.extend(child));
+      return elements;
+    })
+  },
+
+  getInputs: function(form, typeName, name) {
+    form = $(form);
+    var inputs = form.getElementsByTagName('input');
+
+    if (!typeName && !name) return $A(inputs).map(Element.extend);
+
+    for (var i = 0, matchingInputs = [], length = inputs.length; i < length; i++) {
+      var input = inputs[i];
+      if ((typeName && input.type != typeName) || (name && input.name != name))
+        continue;
+      matchingInputs.push(Element.extend(input));
+    }
+
+    return matchingInputs;
+  },
+
+  disable: function(form) {
+    form = $(form);
+    Form.getElements(form).invoke('disable');
+    return form;
+  },
+
+  enable: function(form) {
+    form = $(form);
+    Form.getElements(form).invoke('enable');
+    return form;
+  },
+
+  findFirstElement: function(form) {
+    var elements = $(form).getElements().findAll(function(element) {
+      return 'hidden' != element.type && !element.disabled;
+    });
+    var firstByIndex = elements.findAll(function(element) {
+      return element.hasAttribute('tabIndex') && element.tabIndex >= 0;
+    }).sortBy(function(element) { return element.tabIndex }).first();
+
+    return firstByIndex ? firstByIndex : elements.find(function(element) {
+      return /^(?:input|select|textarea)$/i.test(element.tagName);
+    });
+  },
+
+  focusFirstElement: function(form) {
+    form = $(form);
+    form.findFirstElement().activate();
+    return form;
+  },
+
+  request: function(form, options) {
+    form = $(form), options = Object.clone(options || { });
+
+    var params = options.parameters, action = form.readAttribute('action') || '';
+    if (action.blank()) action = window.location.href;
+    options.parameters = form.serialize(true);
+
+    if (params) {
+      if (Object.isString(params)) params = params.toQueryParams();
+      Object.extend(options.parameters, params);
+    }
+
+    if (form.hasAttribute('method') && !options.method)
+      options.method = form.method;
+
+    return new Ajax.Request(action, options);
+  }
+};
+
+/*--------------------------------------------------------------------------*/
+
+
+Form.Element = {
+  focus: function(element) {
+    $(element).focus();
+    return element;
+  },
+
+  select: function(element) {
+    $(element).select();
+    return element;
+  }
+};
+
+Form.Element.Methods = {
+
+  serialize: function(element) {
+    element = $(element);
+    if (!element.disabled && element.name) {
+      var value = element.getValue();
+      if (value != undefined) {
+        var pair = { };
+        pair[element.name] = value;
+        return Object.toQueryString(pair);
+      }
+    }
+    return '';
+  },
+
+  getValue: function(element) {
+    element = $(element);
+    var method = element.tagName.toLowerCase();
+    return Form.Element.Serializers[method](element);
+  },
+
+  setValue: function(element, value) {
+    element = $(element);
+    var method = element.tagName.toLowerCase();
+    Form.Element.Serializers[method](element, value);
+    return element;
+  },
+
+  clear: function(element) {
+    $(element).value = '';
+    return element;
+  },
+
+  present: function(element) {
+    return $(element).value != '';
+  },
+
+  activate: function(element) {
+    element = $(element);
+    try {
+      element.focus();
+      if (element.select && (element.tagName.toLowerCase() != 'input' ||
+          !(/^(?:button|reset|submit)$/i.test(element.type))))
+        element.select();
+    } catch (e) { }
+    return element;
+  },
+
+  disable: function(element) {
+    element = $(element);
+    element.disabled = true;
+    return element;
+  },
+
+  enable: function(element) {
+    element = $(element);
+    element.disabled = false;
+    return element;
+  }
+};
+
+/*--------------------------------------------------------------------------*/
+
+var Field = Form.Element;
+
+var $F = Form.Element.Methods.getValue;
+
+/*--------------------------------------------------------------------------*/
+
+Form.Element.Serializers = {
+  input: function(element, value) {
+    switch (element.type.toLowerCase()) {
+      case 'checkbox':
+      case 'radio':
+        return Form.Element.Serializers.inputSelector(element, value);
+      default:
+        return Form.Element.Serializers.textarea(element, value);
+    }
+  },
+
+  inputSelector: function(element, value) {
+    if (Object.isUndefined(value)) return element.checked ? element.value : null;
+    else element.checked = !!value;
+  },
+
+  textarea: function(element, value) {
+    if (Object.isUndefined(value)) return element.value;
+    else element.value = value;
+  },
+
+  select: function(element, value) {
+    if (Object.isUndefined(value))
+      return this[element.type == 'select-one' ?
+        'selectOne' : 'selectMany'](element);
+    else {
+      var opt, currentValue, single = !Object.isArray(value);
+      for (var i = 0, length = element.length; i < length; i++) {
+        opt = element.options[i];
+        currentValue = this.optionValue(opt);
+        if (single) {
+          if (currentValue == value) {
+            opt.selected = true;
+            return;
+          }
+        }
+        else opt.selected = value.include(currentValue);
+      }
+    }
+  },
+
+  selectOne: function(element) {
+    var index = element.selectedIndex;
+    return index >= 0 ? this.optionValue(element.options[index]) : null;
+  },
+
+  selectMany: function(element) {
+    var values, length = element.length;
+    if (!length) return null;
+
+    for (var i = 0, values = []; i < length; i++) {
+      var opt = element.options[i];
+      if (opt.selected) values.push(this.optionValue(opt));
+    }
+    return values;
+  },
+
+  optionValue: function(opt) {
+    return Element.extend(opt).hasAttribute('value') ? opt.value : opt.text;
+  }
+};
+
+/*--------------------------------------------------------------------------*/
+
+
+Abstract.TimedObserver = Class.create(PeriodicalExecuter, {
+  initialize: function($super, element, frequency, callback) {
+    $super(callback, frequency);
+    this.element   = $(element);
+    this.lastValue = this.getValue();
+  },
+
+  execute: function() {
+    var value = this.getValue();
+    if (Object.isString(this.lastValue) && Object.isString(value) ?
+        this.lastValue != value : String(this.lastValue) != String(value)) {
+      this.callback(this.element, value);
+      this.lastValue = value;
+    }
+  }
+});
+
+Form.Element.Observer = Class.create(Abstract.TimedObserver, {
+  getValue: function() {
+    return Form.Element.getValue(this.element);
+  }
+});
+
+Form.Observer = Class.create(Abstract.TimedObserver, {
+  getValue: function() {
+    return Form.serialize(this.element);
+  }
+});
+
+/*--------------------------------------------------------------------------*/
+
+Abstract.EventObserver = Class.create({
+  initialize: function(element, callback) {
+    this.element  = $(element);
+    this.callback = callback;
+
+    this.lastValue = this.getValue();
+    if (this.element.tagName.toLowerCase() == 'form')
+      this.registerFormCallbacks();
+    else
+      this.registerCallback(this.element);
+  },
+
+  onElementEvent: function() {
+    var value = this.getValue();
+    if (this.lastValue != value) {
+      this.callback(this.element, value);
+      this.lastValue = value;
+    }
+  },
+
+  registerFormCallbacks: function() {
+    Form.getElements(this.element).each(this.registerCallback, this);
+  },
+
+  registerCallback: function(element) {
+    if (element.type) {
+      switch (element.type.toLowerCase()) {
+        case 'checkbox':
+        case 'radio':
+          Event.observe(element, 'click', this.onElementEvent.bind(this));
+          break;
+        default:
+          Event.observe(element, 'change', this.onElementEvent.bind(this));
+          break;
+      }
+    }
+  }
+});
+
+Form.Element.EventObserver = Class.create(Abstract.EventObserver, {
+  getValue: function() {
+    return Form.Element.getValue(this.element);
+  }
+});
+
+Form.EventObserver = Class.create(Abstract.EventObserver, {
+  getValue: function() {
+    return Form.serialize(this.element);
+  }
+});
+(function() {
+
+  var Event = {
+    KEY_BACKSPACE: 8,
+    KEY_TAB:       9,
+    KEY_RETURN:   13,
+    KEY_ESC:      27,
+    KEY_LEFT:     37,
+    KEY_UP:       38,
+    KEY_RIGHT:    39,
+    KEY_DOWN:     40,
+    KEY_DELETE:   46,
+    KEY_HOME:     36,
+    KEY_END:      35,
+    KEY_PAGEUP:   33,
+    KEY_PAGEDOWN: 34,
+    KEY_INSERT:   45,
+
+    cache: {}
+  };
+
+  var docEl = document.documentElement;
+  var MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED = 'onmouseenter' in docEl
+    && 'onmouseleave' in docEl;
+
+  var _isButton;
+  if (Prototype.Browser.IE) {
+    var buttonMap = { 0: 1, 1: 4, 2: 2 };
+    _isButton = function(event, code) {
+      return event.button === buttonMap[code];
+    };
+  } else if (Prototype.Browser.WebKit) {
+    _isButton = function(event, code) {
+      switch (code) {
+        case 0: return event.which == 1 && !event.metaKey;
+        case 1: return event.which == 1 && event.metaKey;
+        default: return false;
+      }
+    };
+  } else {
+    _isButton = function(event, code) {
+      return event.which ? (event.which === code + 1) : (event.button === code);
+    };
+  }
+
+  function isLeftClick(event)   { return _isButton(event, 0) }
+
+  function isMiddleClick(event) { return _isButton(event, 1) }
+
+  function isRightClick(event)  { return _isButton(event, 2) }
+
+  function element(event) {
+    event = Event.extend(event);
+
+    var node = event.target, type = event.type,
+     currentTarget = event.currentTarget;
+
+    if (currentTarget && currentTarget.tagName) {
+      if (type === 'load' || type === 'error' ||
+        (type === 'click' && currentTarget.tagName.toLowerCase() === 'input'
+          && currentTarget.type === 'radio'))
+            node = currentTarget;
+    }
+
+    if (node.nodeType == Node.TEXT_NODE)
+      node = node.parentNode;
+
+    return Element.extend(node);
+  }
+
+  function findElement(event, expression) {
+    var element = Event.element(event);
+    if (!expression) return element;
+    while (element) {
+      if (Object.isElement(element) && Prototype.Selector.match(element, expression)) {
+        return Element.extend(element);
+      }
+      element = element.parentNode;
+    }
+  }
+
+  function pointer(event) {
+    return { x: pointerX(event), y: pointerY(event) };
+  }
+
+  function pointerX(event) {
+    var docElement = document.documentElement,
+     body = document.body || { scrollLeft: 0 };
+
+    return event.pageX || (event.clientX +
+      (docElement.scrollLeft || body.scrollLeft) -
+      (docElement.clientLeft || 0));
+  }
+
+  function pointerY(event) {
+    var docElement = document.documentElement,
+     body = document.body || { scrollTop: 0 };
+
+    return  event.pageY || (event.clientY +
+       (docElement.scrollTop || body.scrollTop) -
+       (docElement.clientTop || 0));
+  }
+
+
+  function stop(event) {
+    Event.extend(event);
+    event.preventDefault();
+    event.stopPropagation();
+
+    event.stopped = true;
+  }
+
+  Event.Methods = {
+    isLeftClick: isLeftClick,
+    isMiddleClick: isMiddleClick,
+    isRightClick: isRightClick,
+
+    element: element,
+    findElement: findElement,
+
+    pointer: pointer,
+    pointerX: pointerX,
+    pointerY: pointerY,
+
+    stop: stop
+  };
+
+
+  var methods = Object.keys(Event.Methods).inject({ }, function(m, name) {
+    m[name] = Event.Methods[name].methodize();
+    return m;
+  });
+
+  if (Prototype.Browser.IE) {
+    function _relatedTarget(event) {
+      var element;
+      switch (event.type) {
+        case 'mouseover': element = event.fromElement; break;
+        case 'mouseout':  element = event.toElement;   break;
+        default: return null;
+      }
+      return Element.extend(element);
+    }
+
+    Object.extend(methods, {
+      stopPropagation: function() { this.cancelBubble = true },
+      preventDefault:  function() { this.returnValue = false },
+      inspect: function() { return '[object Event]' }
+    });
+
+    Event.extend = function(event, element) {
+      if (!event) return false;
+      if (event._extendedByPrototype) return event;
+
+      event._extendedByPrototype = Prototype.emptyFunction;
+      var pointer = Event.pointer(event);
+
+      Object.extend(event, {
+        target: event.srcElement || element,
+        relatedTarget: _relatedTarget(event),
+        pageX:  pointer.x,
+        pageY:  pointer.y
+      });
+
+      return Object.extend(event, methods);
+    };
+  } else {
+    Event.prototype = window.Event.prototype || document.createEvent('HTMLEvents').__proto__;
+    Object.extend(Event.prototype, methods);
+    Event.extend = Prototype.K;
+  }
+
+  function _createResponder(element, eventName, handler) {
+    var registry = Element.retrieve(element, 'prototype_event_registry');
+
+    if (Object.isUndefined(registry)) {
+      CACHE.push(element);
+      registry = Element.retrieve(element, 'prototype_event_registry', $H());
+    }
+
+    var respondersForEvent = registry.get(eventName);
+    if (Object.isUndefined(respondersForEvent)) {
+      respondersForEvent = [];
+      registry.set(eventName, respondersForEvent);
+    }
+
+    if (respondersForEvent.pluck('handler').include(handler)) return false;
+
+    var responder;
+    if (eventName.include(":")) {
+      responder = function(event) {
+        if (Object.isUndefined(event.eventName))
+          return false;
+
+        if (event.eventName !== eventName)
+          return false;
+
+        Event.extend(event, element);
+        handler.call(element, event);
+      };
+    } else {
+      if (!MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED &&
+       (eventName === "mouseenter" || eventName === "mouseleave")) {
+        if (eventName === "mouseenter" || eventName === "mouseleave") {
+          responder = function(event) {
+            Event.extend(event, element);
+
+            var parent = event.relatedTarget;
+            while (parent && parent !== element) {
+              try { parent = parent.parentNode; }
+              catch(e) { parent = element; }
+            }
+
+            if (parent === element) return;
+
+            handler.call(element, event);
+          };
+        }
+      } else {
+        responder = function(event) {
+          Event.extend(event, element);
+          handler.call(element, event);
+        };
+      }
+    }
+
+    responder.handler = handler;
+    respondersForEvent.push(responder);
+    return responder;
+  }
+
+  function _destroyCache() {
+    for (var i = 0, length = CACHE.length; i < length; i++) {
+      Event.stopObserving(CACHE[i]);
+      CACHE[i] = null;
+    }
+  }
+
+  var CACHE = [];
+
+  if (Prototype.Browser.IE)
+    window.attachEvent('onunload', _destroyCache);
+
+  if (Prototype.Browser.WebKit)
+    window.addEventListener('unload', Prototype.emptyFunction, false);
+
+
+  var _getDOMEventName = Prototype.K,
+      translations = { mouseenter: "mouseover", mouseleave: "mouseout" };
+
+  if (!MOUSEENTER_MOUSELEAVE_EVENTS_SUPPORTED) {
+    _getDOMEventName = function(eventName) {
+      return (translations[eventName] || eventName);
+    };
+  }
+
+  function observe(element, eventName, handler) {
+    element = $(element);
+
+    var responder = _createResponder(element, eventName, handler);
+
+    if (!responder) return element;
+
+    if (eventName.include(':')) {
+      if (element.addEventListener)
+        element.addEventListener("dataavailable", responder, false);
+      else {
+        element.attachEvent("ondataavailable", responder);
+        element.attachEvent("onlosecapture", responder);
+      }
+    } else {
+      var actualEventName = _getDOMEventName(eventName);
+
+      if (element.addEventListener)
+        element.addEventListener(actualEventName, responder, false);
+      else
+        element.attachEvent("on" + actualEventName, responder);
+    }
+
+    return element;
+  }
+
+  function stopObserving(element, eventName, handler) {
+    element = $(element);
+
+    var registry = Element.retrieve(element, 'prototype_event_registry');
+    if (!registry) return element;
+
+    if (!eventName) {
+      registry.each( function(pair) {
+        var eventName = pair.key;
+        stopObserving(element, eventName);
+      });
+      return element;
+    }
+
+    var responders = registry.get(eventName);
+    if (!responders) return element;
+
+    if (!handler) {
+      responders.each(function(r) {
+        stopObserving(element, eventName, r.handler);
+      });
+      return element;
+    }
+
+    var responder = responders.find( function(r) { return r.handler === handler; });
+    if (!responder) return element;
+
+    if (eventName.include(':')) {
+      if (element.removeEventListener)
+        element.removeEventListener("dataavailable", responder, false);
+      else {
+        element.detachEvent("ondataavailable", responder);
+        element.detachEvent("onlosecapture", responder);
+      }
+    } else {
+      var actualEventName = _getDOMEventName(eventName);
+      if (element.removeEventListener)
+        element.removeEventListener(actualEventName, responder, false);
+      else
+        element.detachEvent('on' + actualEventName, responder);
+    }
+
+    registry.set(eventName, responders.without(responder));
+
+    return element;
+  }
+
+  function fire(element, eventName, memo, bubble) {
+    element = $(element);
+
+    if (Object.isUndefined(bubble))
+      bubble = true;
+
+    if (element == document && document.createEvent && !element.dispatchEvent)
+      element = document.documentElement;
+
+    var event;
+    if (document.createEvent) {
+      event = document.createEvent('HTMLEvents');
+      event.initEvent('dataavailable', bubble, true);
+    } else {
+      event = document.createEventObject();
+      event.eventType = bubble ? 'ondataavailable' : 'onlosecapture';
+    }
+
+    event.eventName = eventName;
+    event.memo = memo || { };
+
+    if (document.createEvent)
+      element.dispatchEvent(event);
+    else
+      element.fireEvent(event.eventType, event);
+
+    return Event.extend(event);
+  }
+
+  Event.Handler = Class.create({
+    initialize: function(element, eventName, selector, callback) {
+      this.element   = $(element);
+      this.eventName = eventName;
+      this.selector  = selector;
+      this.callback  = callback;
+      this.handler   = this.handleEvent.bind(this);
+    },
+
+    start: function() {
+      Event.observe(this.element, this.eventName, this.handler);
+      return this;
+    },
+
+    stop: function() {
+      Event.stopObserving(this.element, this.eventName, this.handler);
+      return this;
+    },
+
+    handleEvent: function(event) {
+      var element = event.findElement(this.selector);
+      if (element) this.callback.call(this.element, event, element);
+    }
+  });
+
+  function on(element, eventName, selector, callback) {
+    element = $(element);
+    if (Object.isFunction(selector) && Object.isUndefined(callback)) {
+      callback = selector, selector = null;
+    }
+
+    return new Event.Handler(element, eventName, selector, callback).start();
+  }
+
+  Object.extend(Event, Event.Methods);
+
+  Object.extend(Event, {
+    fire:          fire,
+    observe:       observe,
+    stopObserving: stopObserving,
+    on:            on
+  });
+
+  Element.addMethods({
+    fire:          fire,
+
+    observe:       observe,
+
+    stopObserving: stopObserving,
+
+    on:            on
+  });
+
+  Object.extend(document, {
+    fire:          fire.methodize(),
+
+    observe:       observe.methodize(),
+
+    stopObserving: stopObserving.methodize(),
+
+    on:            on.methodize(),
+
+    loaded:        false
+  });
+
+  if (window.Event) Object.extend(window.Event, Event);
+  else window.Event = Event;
+})();
+
+(function() {
+  /* Support for the DOMContentLoaded event is based on work by Dan Webb,
+     Matthias Miller, Dean Edwards, John Resig, and Diego Perini. */
+
+  var timer;
+
+  function fireContentLoadedEvent() {
+    if (document.loaded) return;
+    if (timer) window.clearTimeout(timer);
+    document.loaded = true;
+    document.fire('dom:loaded');
+  }
+
+  function checkReadyState() {
+    if (document.readyState === 'complete') {
+      document.stopObserving('readystatechange', checkReadyState);
+      fireContentLoadedEvent();
+    }
+  }
+
+  function pollDoScroll() {
+    try { document.documentElement.doScroll('left'); }
+    catch(e) {
+      timer = pollDoScroll.defer();
+      return;
+    }
+    fireContentLoadedEvent();
+  }
+
+  if (document.addEventListener) {
+    document.addEventListener('DOMContentLoaded', fireContentLoadedEvent, false);
+  } else {
+    document.observe('readystatechange', checkReadyState);
+    if (window == top)
+      timer = pollDoScroll.defer();
+  }
+
+  Event.observe(window, 'load', fireContentLoadedEvent);
+})();
+
+Element.addMethods();
+
+/*------------------------------- DEPRECATED -------------------------------*/
+
+Hash.toQueryString = Object.toQueryString;
+
+var Toggle = { display: Element.toggle };
+
+Element.Methods.childOf = Element.Methods.descendantOf;
+
+var Insertion = {
+  Before: function(element, content) {
+    return Element.insert(element, {before:content});
+  },
+
+  Top: function(element, content) {
+    return Element.insert(element, {top:content});
+  },
+
+  Bottom: function(element, content) {
+    return Element.insert(element, {bottom:content});
+  },
+
+  After: function(element, content) {
+    return Element.insert(element, {after:content});
+  }
+};
+
+var $continue = new Error('"throw $continue" is deprecated, use "return" instead');
+
+var Position = {
+  includeScrollOffsets: false,
+
+  prepare: function() {
+    this.deltaX =  window.pageXOffset
+                || document.documentElement.scrollLeft
+                || document.body.scrollLeft
+                || 0;
+    this.deltaY =  window.pageYOffset
+                || document.documentElement.scrollTop
+                || document.body.scrollTop
+                || 0;
+  },
+
+  within: function(element, x, y) {
+    if (this.includeScrollOffsets)
+      return this.withinIncludingScrolloffsets(element, x, y);
+    this.xcomp = x;
+    this.ycomp = y;
+    this.offset = Element.cumulativeOffset(element);
+
+    return (y >= this.offset[1] &&
+            y <  this.offset[1] + element.offsetHeight &&
+            x >= this.offset[0] &&
+            x <  this.offset[0] + element.offsetWidth);
+  },
+
+  withinIncludingScrolloffsets: function(element, x, y) {
+    var offsetcache = Element.cumulativeScrollOffset(element);
+
+    this.xcomp = x + offsetcache[0] - this.deltaX;
+    this.ycomp = y + offsetcache[1] - this.deltaY;
+    this.offset = Element.cumulativeOffset(element);
+
+    return (this.ycomp >= this.offset[1] &&
+            this.ycomp <  this.offset[1] + element.offsetHeight &&
+            this.xcomp >= this.offset[0] &&
+            this.xcomp <  this.offset[0] + element.offsetWidth);
+  },
+
+  overlap: function(mode, element) {
+    if (!mode) return 0;
+    if (mode == 'vertical')
+      return ((this.offset[1] + element.offsetHeight) - this.ycomp) /
+        element.offsetHeight;
+    if (mode == 'horizontal')
+      return ((this.offset[0] + element.offsetWidth) - this.xcomp) /
+        element.offsetWidth;
+  },
+
+
+  cumulativeOffset: Element.Methods.cumulativeOffset,
+
+  positionedOffset: Element.Methods.positionedOffset,
+
+  absolutize: function(element) {
+    Position.prepare();
+    return Element.absolutize(element);
+  },
+
+  relativize: function(element) {
+    Position.prepare();
+    return Element.relativize(element);
+  },
+
+  realOffset: Element.Methods.cumulativeScrollOffset,
+
+  offsetParent: Element.Methods.getOffsetParent,
+
+  page: Element.Methods.viewportOffset,
+
+  clone: function(source, target, options) {
+    options = options || { };
+    return Element.clonePosition(target, source, options);
+  }
+};
+
+/*--------------------------------------------------------------------------*/
+
+if (!document.getElementsByClassName) document.getElementsByClassName = function(instanceMethods){
+  function iter(name) {
+    return name.blank() ? null : "[contains(concat(' ', @class, ' '), ' " + name + " ')]";
+  }
+
+  instanceMethods.getElementsByClassName = Prototype.BrowserFeatures.XPath ?
+  function(element, className) {
+    className = className.toString().strip();
+    var cond = /\s/.test(className) ? $w(className).map(iter).join('') : iter(className);
+    return cond ? document._getElementsByXPath('.//*' + cond, element) : [];
+  } : function(element, className) {
+    className = className.toString().strip();
+    var elements = [], classNames = (/\s/.test(className) ? $w(className) : null);
+    if (!classNames && !className) return elements;
+
+    var nodes = $(element).getElementsByTagName('*');
+    className = ' ' + className + ' ';
+
+    for (var i = 0, child, cn; child = nodes[i]; i++) {
+      if (child.className && (cn = ' ' + child.className + ' ') && (cn.include(className) ||
+          (classNames && classNames.all(function(name) {
+            return !name.toString().blank() && cn.include(' ' + name + ' ');
+          }))))
+        elements.push(Element.extend(child));
+    }
+    return elements;
+  };
+
+  return function(className, parentElement) {
+    return $(parentElement || document.body).getElementsByClassName(className);
+  };
+}(Element.Methods);
+
+/*--------------------------------------------------------------------------*/
+
+Element.ClassNames = Class.create();
+Element.ClassNames.prototype = {
+  initialize: function(element) {
+    this.element = $(element);
+  },
+
+  _each: function(iterator) {
+    this.element.className.split(/\s+/).select(function(name) {
+      return name.length > 0;
+    })._each(iterator);
+  },
+
+  set: function(className) {
+    this.element.className = className;
+  },
+
+  add: function(classNameToAdd) {
+    if (this.include(classNameToAdd)) return;
+    this.set($A(this).concat(classNameToAdd).join(' '));
+  },
+
+  remove: function(classNameToRemove) {
+    if (!this.include(classNameToRemove)) return;
+    this.set($A(this).without(classNameToRemove).join(' '));
+  },
+
+  toString: function() {
+    return $A(this).join(' ');
+  }
+};
+
+Object.extend(Element.ClassNames.prototype, Enumerable);
+
+/*--------------------------------------------------------------------------*/
+
+(function() {
+  window.Selector = Class.create({
+    initialize: function(expression) {
+      this.expression = expression.strip();
+    },
+
+    findElements: function(rootElement) {
+      return Prototype.Selector.select(this.expression, rootElement);
+    },
+
+    match: function(element) {
+      return Prototype.Selector.match(element, this.expression);
+    },
+
+    toString: function() {
+      return this.expression;
+    },
+
+    inspect: function() {
+      return "#<Selector: " + this.expression + ">";
+    }
+  });
+
+  Object.extend(Selector, {
+    matchElements: function(elements, expression) {
+      var match = Prototype.Selector.match,
+          results = [];
+
+      for (var i = 0, length = elements.length; i < length; i++) {
+        var element = elements[i];
+        if (match(element, expression)) {
+          results.push(Element.extend(element));
+        }
+      }
+      return results;
+    },
+
+    findElement: function(elements, expression, index) {
+      index = index || 0;
+      var matchIndex = 0, element;
+      for (var i = 0, length = elements.length; i < length; i++) {
+        element = elements[i];
+        if (Prototype.Selector.match(element, expression) && index === matchIndex++) {
+          return Element.extend(element);
+        }
+      }
+    },
+
+    findChildElements: function(element, expressions) {
+      var selector = expressions.toArray().join(', ');
+      return Prototype.Selector.select(selector, element || document);
+    }
+  });
+})();
diff --git a/common/src/web/touch/prototype.s2.min.js b/common/src/web/touch/prototype.s2.min.js
new file mode 100644
index 00000000..5905f779
--- /dev/null
+++ b/common/src/web/touch/prototype.s2.min.js
@@ -0,0 +1,50 @@
+var Prototype={Version:"1.7_rc2",Browser:(function(){var b=navigator.userAgent;var a=Object.prototype.toString.call(window.opera)=="[object Opera]";return{IE:!!window.attachEvent&&!a,Opera:a,WebKit:b.indexOf("AppleWebKit/")>-1,Gecko:b.indexOf("Gecko")>-1&&b.indexOf("KHTML")===-1,MobileSafari:/Apple.*Mobile/.test(b)}})(),BrowserFeatures:{XPath:!!document.evaluate,SelectorsAPI:!!document.querySelector,ElementExtensions:(function(){var a=window.Element||window.HTMLElement;return !!(a&&a.prototype)})(),SpecificElementExtensions:(function(){if(typeof window.HTMLDivElement!=="undefined"){return true}var c=document.createElement("div"),b=document.createElement("form"),a=false;if(c.__proto__&&(c.__proto__!==b.__proto__)){a=true}c=b=null;return a})()},ScriptFragment:"<script[^>]*>([\\S\\s]*?)<\/script>",JSONFilter:/^\/\*-secure-([\s\S]*)\*\/\s*$/,emptyFunction:function(){},K:function(a){return a}};if(Prototype.Browser.MobileSafari){Prototype.BrowserFeatures.SpecificElementExtensions=false}var Abstract={};var Try={these:function(){var c;for(var b=0,d=arguments.length;b<d;b++){var a=arguments[b];try{c=a();break}catch(f){}}return c}};var Class=(function(){var d=(function(){for(var e in {toString:1}){if(e==="toString"){return false}}return true})();function a(){}function b(){var h=null,g=$A(arguments);if(Object.isFunction(g[0])){h=g.shift()}function e(){this.initialize.apply(this,arguments)}Object.extend(e,Class.Methods);e.superclass=h;e.subclasses=[];if(h){a.prototype=h.prototype;e.prototype=new a;h.subclasses.push(e)}for(var f=0,j=g.length;f<j;f++){e.addMethods(g[f])}if(!e.prototype.initialize){e.prototype.initialize=Prototype.emptyFunction}e.prototype.constructor=e;return e}function c(l){var g=this.superclass&&this.superclass.prototype,f=Object.keys(l);if(d){if(l.toString!=Object.prototype.toString){f.push("toString")}if(l.valueOf!=Object.prototype.valueOf){f.push("valueOf")}}for(var e=0,h=f.length;e<h;e++){var k=f[e],j=l[k];if(g&&Object.isFunction(j)&&j.argumentNames()[0]=="$super"){var m=j;j=(function(i){return function(){return g[i].apply(this,arguments)}})(k).wrap(m);j.valueOf=m.valueOf.bind(m);j.toString=m.toString.bind(m)}this.prototype[k]=j}return this}return{create:b,Methods:{addMethods:c}}})();(function(){var A=Object.prototype.toString,z="Null",o="Undefined",u="Boolean",f="Number",s="String",E="Object",w="[object Boolean]",g="[object Number]",l="[object String]",h="[object Array]",i=window.JSON&&typeof JSON.stringify==="function"&&JSON.stringify(0)==="0"&&typeof JSON.stringify(Prototype.K)==="undefined";function k(G){switch(G){case null:return z;case (void 0):return o}var F=typeof G;switch(F){case"boolean":return u;case"number":return f;case"string":return s}return E}function x(F,H){for(var G in H){F[G]=H[G]}return F}function C(F){try{if(c(F)){return"undefined"}if(F===null){return"null"}return F.inspect?F.inspect():String(F)}catch(G){if(G instanceof RangeError){return"..."}throw G}}function B(F){return D("",{"":F},[])}function D(O,L,M){var N=L[O],K=typeof N;if(k(N)===E&&typeof N.toJSON==="function"){N=N.toJSON(O)}var H=A.call(N);switch(H){case g:case w:case l:N=N.valueOf()}switch(N){case null:return"null";case true:return"true";case false:return"false"}K=typeof N;switch(K){case"string":return N.inspect(true);case"number":return isFinite(N)?String(N):"null";case"object":for(var G=0,F=M.length;G<F;G++){if(M[G]===N){throw new TypeError()}}M.push(N);var J=[];if(H===h){for(var G=0,F=N.length;G<F;G++){var I=D(G,N,M);J.push(typeof I==="undefined"?"null":I)}J="["+J.join(",")+"]"}else{var P=Object.keys(N);for(var G=0,F=P.length;G<F;G++){var O=P[G],I=D(O,N,M);if(typeof I!=="undefined"){J.push(O.inspect(true)+":"+I)}}J="{"+J.join(",")+"}"}M.pop();return J}}function v(F){return JSON.stringify(F)}function j(F){return $H(F).toQueryString()}function p(F){return F&&F.toHTML?F.toHTML():String.interpret(F)}function r(F){if(k(F)!==E){throw new TypeError()}var G=[];for(var H in F){if(F.hasOwnProperty(H)){G.push(H)}}return G}function d(F){var G=[];for(var H in F){G.push(F[H])}return G}function y(F){return x({},F)}function t(F){return !!(F&&F.nodeType==1)}function m(F){return A.call(F)===h}var b=(typeof Array.isArray=="function")&&Array.isArray([])&&!Array.isArray({});if(b){m=Array.isArray}function e(F){return F instanceof Hash}function a(F){return typeof F==="function"}function n(F){return A.call(F)===l}function q(F){return A.call(F)===g}function c(F){return typeof F==="undefined"}x(Object,{extend:x,inspect:C,toJSON:i?v:B,toQueryString:j,toHTML:p,keys:Object.keys||r,values:d,clone:y,isElement:t,isArray:m,isHash:e,isFunction:a,isString:n,isNumber:q,isUndefined:c})})();Object.extend(Function.prototype,(function(){var k=Array.prototype.slice;function d(o,l){var n=o.length,m=l.length;while(m--){o[n+m]=l[m]}return o}function i(m,l){m=k.call(m,0);return d(m,l)}function g(){var l=this.toString().match(/^[\s\(]*function[^(]*\(([^)]*)\)/)[1].replace(/\/\/.*?[\r\n]|\/\*(?:.|[\r\n])*?\*\//g,"").replace(/\s+/g,"").split(",");return l.length==1&&!l[0]?[]:l}function h(n){if(arguments.length<2&&Object.isUndefined(arguments[0])){return this}var l=this,m=k.call(arguments,1);return function(){var o=i(m,arguments);return l.apply(n,o)}}function f(n){var l=this,m=k.call(arguments,1);return function(p){var o=d([p||window.event],m);return l.apply(n,o)}}function j(){if(!arguments.length){return this}var l=this,m=k.call(arguments,0);return function(){var n=i(m,arguments);return l.apply(this,n)}}function e(n){var l=this,m=k.call(arguments,1);n=n*1000;return window.setTimeout(function(){return l.apply(l,m)},n)}function a(){var l=d([0.01],arguments);return this.delay.apply(this,l)}function c(m){var l=this;return function(){var n=d([l.bind(this)],arguments);return m.apply(this,n)}}function b(){if(this._methodized){return this._methodized}var l=this;return this._methodized=function(){var m=d([this],arguments);return l.apply(null,m)}}return{argumentNames:g,bind:h,bindAsEventListener:f,curry:j,delay:e,defer:a,wrap:c,methodize:b}})());(function(c){function b(){return this.getUTCFullYear()+"-"+(this.getUTCMonth()+1).toPaddedString(2)+"-"+this.getUTCDate().toPaddedString(2)+"T"+this.getUTCHours().toPaddedString(2)+":"+this.getUTCMinutes().toPaddedString(2)+":"+this.getUTCSeconds().toPaddedString(2)+"Z"}function a(){return this.toISOString()}if(!c.toISOString){c.toISOString=b}if(!c.toJSON){c.toJSON=a}})(Date.prototype);RegExp.prototype.match=RegExp.prototype.test;RegExp.escape=function(a){return String(a).replace(/([.*+?^=!:${}()|[\]\/\\])/g,"\\$1")};var PeriodicalExecuter=Class.create({initialize:function(b,a){this.callback=b;this.frequency=a;this.currentlyExecuting=false;this.registerCallback()},registerCallback:function(){this.timer=setInterval(this.onTimerEvent.bind(this),this.frequency*1000)},execute:function(){this.callback(this)},stop:function(){if(!this.timer){return}clearInterval(this.timer);this.timer=null},onTimerEvent:function(){if(!this.currentlyExecuting){try{this.currentlyExecuting=true;this.execute();this.currentlyExecuting=false}catch(a){this.currentlyExecuting=false;throw a}}}});Object.extend(String,{interpret:function(a){return a==null?"":String(a)},specialChar:{"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r","\\":"\\\\"}});Object.extend(String.prototype,(function(){var NATIVE_JSON_PARSE_SUPPORT=window.JSON&&typeof JSON.parse==="function"&&JSON.parse('{"test": true}').test;function prepareReplacement(replacement){if(Object.isFunction(replacement)){return replacement}var template=new Template(replacement);return function(match){return template.evaluate(match)}}function gsub(pattern,replacement){var result="",source=this,match;replacement=prepareReplacement(replacement);if(Object.isString(pattern)){pattern=RegExp.escape(pattern)}if(!(pattern.length||pattern.source)){replacement=replacement("");return replacement+source.split("").join(replacement)+replacement}while(source.length>0){if(match=source.match(pattern)){result+=source.slice(0,match.index);result+=String.interpret(replacement(match));source=source.slice(match.index+match[0].length)}else{result+=source,source=""}}return result}function sub(pattern,replacement,count){replacement=prepareReplacement(replacement);count=Object.isUndefined(count)?1:count;return this.gsub(pattern,function(match){if(--count<0){return match[0]}return replacement(match)})}function scan(pattern,iterator){this.gsub(pattern,iterator);return String(this)}function truncate(length,truncation){length=length||30;truncation=Object.isUndefined(truncation)?"...":truncation;return this.length>length?this.slice(0,length-truncation.length)+truncation:String(this)}function strip(){return this.replace(/^\s+/,"").replace(/\s+$/,"")}function stripTags(){return this.replace(/<\w+(\s+("[^"]*"|'[^']*'|[^>])+)?>|<\/\w+>/gi,"")}function stripScripts(){return this.replace(new RegExp(Prototype.ScriptFragment,"img"),"")}function extractScripts(){var matchAll=new RegExp(Prototype.ScriptFragment,"img"),matchOne=new RegExp(Prototype.ScriptFragment,"im");return(this.match(matchAll)||[]).map(function(scriptTag){return(scriptTag.match(matchOne)||["",""])[1]})}function evalScripts(){return this.extractScripts().map(function(script){return eval(script)})}function escapeHTML(){return this.replace(/&/g,"&amp;").replace(/</g,"&lt;").replace(/>/g,"&gt;")}function unescapeHTML(){return this.stripTags().replace(/&lt;/g,"<").replace(/&gt;/g,">").replace(/&amp;/g,"&")}function toQueryParams(separator){var match=this.strip().match(/([^?#]*)(#.*)?$/);if(!match){return{}}return match[1].split(separator||"&").inject({},function(hash,pair){if((pair=pair.split("="))[0]){var key=decodeURIComponent(pair.shift()),value=pair.length>1?pair.join("="):pair[0];if(value!=undefined){value=decodeURIComponent(value)}if(key in hash){if(!Object.isArray(hash[key])){hash[key]=[hash[key]]}hash[key].push(value)}else{hash[key]=value}}return hash})}function toArray(){return this.split("")}function succ(){return this.slice(0,this.length-1)+String.fromCharCode(this.charCodeAt(this.length-1)+1)}function times(count){return count<1?"":new Array(count+1).join(this)}function camelize(){return this.replace(/-+(.)?/g,function(match,chr){return chr?chr.toUpperCase():""})}function capitalize(){return this.charAt(0).toUpperCase()+this.substring(1).toLowerCase()}function underscore(){return this.replace(/::/g,"/").replace(/([A-Z]+)([A-Z][a-z])/g,"$1_$2").replace(/([a-z\d])([A-Z])/g,"$1_$2").replace(/-/g,"_").toLowerCase()}function dasherize(){return this.replace(/_/g,"-")}function inspect(useDoubleQuotes){var escapedString=this.replace(/[\x00-\x1f\\]/g,function(character){if(character in String.specialChar){return String.specialChar[character]}return"\\u00"+character.charCodeAt().toPaddedString(2,16)});if(useDoubleQuotes){return'"'+escapedString.replace(/"/g,'\\"')+'"'}return"'"+escapedString.replace(/'/g,"\\'")+"'"}function unfilterJSON(filter){return this.replace(filter||Prototype.JSONFilter,"$1")}function isJSON(){var str=this;if(str.blank()){return false}str=str.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@");str=str.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]");str=str.replace(/(?:^|:|,)(?:\s*\[)+/g,"");return(/^[\],:{}\s]*$/).test(str)}function evalJSON(sanitize){var json=this.unfilterJSON(),cx=/[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g;if(cx.test(json)){json=json.replace(cx,function(a){return"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})}try{if(!sanitize||json.isJSON()){return eval("("+json+")")}}catch(e){}throw new SyntaxError("Badly formed JSON string: "+this.inspect())}function parseJSON(){var json=this.unfilterJSON();return JSON.parse(json)}function include(pattern){return this.indexOf(pattern)>-1}function startsWith(pattern){return this.lastIndexOf(pattern,0)===0}function endsWith(pattern){var d=this.length-pattern.length;return d>=0&&this.indexOf(pattern,d)===d}function empty(){return this==""}function blank(){return/^\s*$/.test(this)}function interpolate(object,pattern){return new Template(this,pattern).evaluate(object)}return{gsub:gsub,sub:sub,scan:scan,truncate:truncate,strip:String.prototype.trim||strip,stripTags:stripTags,stripScripts:stripScripts,extractScripts:extractScripts,evalScripts:evalScripts,escapeHTML:escapeHTML,unescapeHTML:unescapeHTML,toQueryParams:toQueryParams,parseQuery:toQueryParams,toArray:toArray,succ:succ,times:times,camelize:camelize,capitalize:capitalize,underscore:underscore,dasherize:dasherize,inspect:inspect,unfilterJSON:unfilterJSON,isJSON:isJSON,evalJSON:NATIVE_JSON_PARSE_SUPPORT?parseJSON:evalJSON,include:include,startsWith:startsWith,endsWith:endsWith,empty:empty,blank:blank,interpolate:interpolate}})());var Template=Class.create({initialize:function(a,b){this.template=a.toString();this.pattern=b||Template.Pattern},evaluate:function(a){if(a&&Object.isFunction(a.toTemplateReplacements)){a=a.toTemplateReplacements()}return this.template.gsub(this.pattern,function(d){if(a==null){return(d[1]+"")}var f=d[1]||"";if(f=="\\"){return d[2]}var b=a,g=d[3],e=/^([^.[]+|\[((?:.*?[^\\])?)\])(\.|\[|$)/;d=e.exec(g);if(d==null){return f}while(d!=null){var c=d[1].startsWith("[")?d[2].replace(/\\\\]/g,"]"):d[1];b=b[c];if(null==b||""==d[3]){break}g=g.substring("["==d[3]?d[1].length:d[0].length);d=e.exec(g)}return f+String.interpret(b)})}});Template.Pattern=/(^|.|\r|\n)(#\{(.*?)\})/;var $break={};var Enumerable=(function(){function c(y,x){var w=0;try{this._each(function(A){y.call(x,A,w++)})}catch(z){if(z!=$break){throw z}}return this}function r(z,y,x){var w=-z,A=[],B=this.toArray();if(z<1){return B}while((w+=z)<B.length){A.push(B.slice(w,w+z))}return A.collect(y,x)}function b(y,x){y=y||Prototype.K;var w=true;this.each(function(A,z){w=w&&!!y.call(x,A,z);if(!w){throw $break}});return w}function i(y,x){y=y||Prototype.K;var w=false;this.each(function(A,z){if(w=!!y.call(x,A,z)){throw $break}});return w}function j(y,x){y=y||Prototype.K;var w=[];this.each(function(A,z){w.push(y.call(x,A,z))});return w}function t(y,x){var w;this.each(function(A,z){if(y.call(x,A,z)){w=A;throw $break}});return w}function h(y,x){var w=[];this.each(function(A,z){if(y.call(x,A,z)){w.push(A)}});return w}function g(z,y,x){y=y||Prototype.K;var w=[];if(Object.isString(z)){z=new RegExp(RegExp.escape(z))}this.each(function(B,A){if(z.match(B)){w.push(y.call(x,B,A))}});return w}function a(w){if(Object.isFunction(this.indexOf)){if(this.indexOf(w)!=-1){return true}}var x=false;this.each(function(y){if(y==w){x=true;throw $break}});return x}function q(x,w){w=Object.isUndefined(w)?null:w;return this.eachSlice(x,function(y){while(y.length<x){y.push(w)}return y})}function l(w,y,x){this.each(function(A,z){w=y.call(x,w,A,z)});return w}function v(x){var w=$A(arguments).slice(1);return this.map(function(y){return y[x].apply(y,w)})}function p(y,x){y=y||Prototype.K;var w;this.each(function(A,z){A=y.call(x,A,z);if(w==null||A>=w){w=A}});return w}function n(y,x){y=y||Prototype.K;var w;this.each(function(A,z){A=y.call(x,A,z);if(w==null||A<w){w=A}});return w}function e(z,x){z=z||Prototype.K;var y=[],w=[];this.each(function(B,A){(z.call(x,B,A)?y:w).push(B)});return[y,w]}function f(x){var w=[];this.each(function(y){w.push(y[x])});return w}function d(y,x){var w=[];this.each(function(A,z){if(!y.call(x,A,z)){w.push(A)}});return w}function m(x,w){return this.map(function(z,y){return{value:z,criteria:x.call(w,z,y)}}).sort(function(B,A){var z=B.criteria,y=A.criteria;return z<y?-1:z>y?1:0}).pluck("value")}function o(){return this.map()}function s(){var x=Prototype.K,w=$A(arguments);if(Object.isFunction(w.last())){x=w.pop()}var y=[this].concat(w).map($A);return this.map(function(A,z){return x(y.pluck(z))})}function k(){return this.toArray().length}function u(){return"#<Enumerable:"+this.toArray().inspect()+">"}return{each:c,eachSlice:r,all:b,every:b,any:i,some:i,collect:j,map:j,detect:t,findAll:h,select:h,filter:h,grep:g,include:a,member:a,inGroupsOf:q,inject:l,invoke:v,max:p,min:n,partition:e,pluck:f,reject:d,sortBy:m,toArray:o,entries:o,zip:s,size:k,inspect:u,find:t}})();function $A(c){if(!c){return[]}if("toArray" in Object(c)){return c.toArray()}var b=c.length||0,a=new Array(b);while(b--){a[b]=c[b]}return a}function $w(a){if(!Object.isString(a)){return[]}a=a.strip();return a?a.split(/\s+/):[]}Array.from=$A;(function(){var r=Array.prototype,m=r.slice,o=r.forEach;function b(v){for(var u=0,w=this.length;u<w;u++){v(this[u])}}if(!o){o=b}function l(){this.length=0;return this}function d(){return this[0]}function g(){return this[this.length-1]}function i(){return this.select(function(u){return u!=null})}function t(){return this.inject([],function(v,u){if(Object.isArray(u)){return v.concat(u.flatten())}v.push(u);return v})}function h(){var u=m.call(arguments,0);return this.select(function(v){return !u.include(v)})}function f(u){return(u===false?this.toArray():this)._reverse()}function k(u){return this.inject([],function(x,w,v){if(0==v||(u?x.last()!=w:!x.include(w))){x.push(w)}return x})}function p(u){return this.uniq().findAll(function(v){return u.detect(function(w){return v===w})})}function q(){return m.call(this,0)}function j(){return this.length}function s(){return"["+this.map(Object.inspect).join(", ")+"]"}function a(w,u){u||(u=0);var v=this.length;if(u<0){u=v+u}for(;u<v;u++){if(this[u]===w){return u}}return -1}function n(v,u){u=isNaN(u)?this.length:(u<0?this.length+u:u)+1;var w=this.slice(0,u).reverse().indexOf(v);return(w<0)?w:u-w-1}function c(){var z=m.call(this,0),x;for(var v=0,w=arguments.length;v<w;v++){x=arguments[v];if(Object.isArray(x)&&!("callee" in x)){for(var u=0,y=x.length;u<y;u++){z.push(x[u])}}else{z.push(x)}}return z}Object.extend(r,Enumerable);if(!r._reverse){r._reverse=r.reverse}Object.extend(r,{_each:o,clear:l,first:d,last:g,compact:i,flatten:t,without:h,reverse:f,uniq:k,intersect:p,clone:q,toArray:q,size:j,inspect:s});var e=(function(){return[].concat(arguments)[0][0]!==1})(1,2);if(e){r.concat=c}if(!r.indexOf){r.indexOf=a}if(!r.lastIndexOf){r.lastIndexOf=n}})();function $H(a){return new Hash(a)}var Hash=Class.create(Enumerable,(function(){function e(p){this._object=Object.isHash(p)?p.toObject():Object.clone(p)}function f(q){for(var p in this._object){var r=this._object[p],s=[p,r];s.key=p;s.value=r;q(s)}}function j(p,q){return this._object[p]=q}function c(p){if(this._object[p]!==Object.prototype[p]){return this._object[p]}}function m(p){var q=this._object[p];delete this._object[p];return q}function o(){return Object.clone(this._object)}function n(){return this.pluck("key")}function l(){return this.pluck("value")}function g(q){var p=this.detect(function(r){return r.value===q});return p&&p.key}function i(p){return this.clone().update(p)}function d(p){return new Hash(p).inject(this,function(q,r){q.set(r.key,r.value);return q})}function b(p,q){if(Object.isUndefined(q)){return p}return p+"="+encodeURIComponent(String.interpret(q))}function a(){return this.inject([],function(r,s){var q=encodeURIComponent(s.key),p=s.value;if(p&&typeof p=="object"){if(Object.isArray(p)){return r.concat(p.map(b.curry(q)))}}else{r.push(b(q,p))}return r}).join("&")}function k(){return"#<Hash:{"+this.map(function(p){return p.map(Object.inspect).join(": ")}).join(", ")+"}>"}function h(){return new Hash(this)}return{initialize:e,_each:f,set:j,get:c,unset:m,toObject:o,toTemplateReplacements:o,keys:n,values:l,index:g,merge:i,update:d,toQueryString:a,inspect:k,toJSON:o,clone:h}})());Hash.from=$H;Object.extend(Number.prototype,(function(){function d(){return this.toPaddedString(2,16)}function b(){return this+1}function h(j,i){$R(0,this,true).each(j,i);return this}function g(k,j){var i=this.toString(j||10);return"0".times(k-i.length)+i}function a(){return Math.abs(this)}function c(){return Math.round(this)}function e(){return Math.ceil(this)}function f(){return Math.floor(this)}return{toColorPart:d,succ:b,times:h,toPaddedString:g,abs:a,round:c,ceil:e,floor:f}})());function $R(c,a,b){return new ObjectRange(c,a,b)}var ObjectRange=Class.create(Enumerable,(function(){function b(f,d,e){this.start=f;this.end=d;this.exclusive=e}function c(d){var e=this.start;while(this.include(e)){d(e);e=e.succ()}}function a(d){if(d<this.start){return false}if(this.exclusive){return d<this.end}return d<=this.end}return{initialize:b,_each:c,include:a}})());var Ajax={getTransport:function(){return Try.these(function(){return new XMLHttpRequest()},function(){return new ActiveXObject("Msxml2.XMLHTTP")},function(){return new ActiveXObject("Microsoft.XMLHTTP")})||false},activeRequestCount:0};Ajax.Responders={responders:[],_each:function(a){this.responders._each(a)},register:function(a){if(!this.include(a)){this.responders.push(a)}},unregister:function(a){this.responders=this.responders.without(a)},dispatch:function(d,b,c,a){this.each(function(f){if(Object.isFunction(f[d])){try{f[d].apply(f,[b,c,a])}catch(g){}}})}};Object.extend(Ajax.Responders,Enumerable);Ajax.Responders.register({onCreate:function(){Ajax.activeRequestCount++},onComplete:function(){Ajax.activeRequestCount--}});Ajax.Base=Class.create({initialize:function(a){this.options={method:"post",asynchronous:true,contentType:"application/x-www-form-urlencoded",encoding:"UTF-8",parameters:"",evalJSON:true,evalJS:true};Object.extend(this.options,a||{});this.options.method=this.options.method.toLowerCase();if(Object.isHash(this.options.parameters)){this.options.parameters=this.options.parameters.toObject()}}});Ajax.Request=Class.create(Ajax.Base,{_complete:false,initialize:function($super,b,a){$super(a);this.transport=Ajax.getTransport();this.request(b)},request:function(b){this.url=b;this.method=this.options.method;var d=Object.isString(this.options.parameters)?this.options.parameters:Object.toQueryString(this.options.parameters);if(!["get","post"].include(this.method)){d+=(d?"&":"")+"_method="+this.method;this.method="post"}if(d){if(this.method=="get"){this.url+=(this.url.include("?")?"&":"?")+d}else{if(/Konqueror|Safari|KHTML/.test(navigator.userAgent)){d+="&_="}}}this.parameters=d.toQueryParams();try{var a=new Ajax.Response(this);if(this.options.onCreate){this.options.onCreate(a)}Ajax.Responders.dispatch("onCreate",this,a);this.transport.open(this.method.toUpperCase(),this.url,this.options.asynchronous);if(this.options.asynchronous){this.respondToReadyState.bind(this).defer(1)}this.transport.onreadystatechange=this.onStateChange.bind(this);this.setRequestHeaders();this.body=this.method=="post"?(this.options.postBody||d):null;this.transport.send(this.body);if(!this.options.asynchronous&&this.transport.overrideMimeType){this.onStateChange()}}catch(c){this.dispatchException(c)}},onStateChange:function(){var a=this.transport.readyState;if(a>1&&!((a==4)&&this._complete)){this.respondToReadyState(this.transport.readyState)}},setRequestHeaders:function(){var e={"X-Requested-With":"XMLHttpRequest","X-Prototype-Version":Prototype.Version,Accept:"text/javascript, text/html, application/xml, text/xml, */*"};if(this.method=="post"){e["Content-type"]=this.options.contentType+(this.options.encoding?"; charset="+this.options.encoding:"");if(this.transport.overrideMimeType&&(navigator.userAgent.match(/Gecko\/(\d{4})/)||[0,2005])[1]<2005){e.Connection="close"}}if(typeof this.options.requestHeaders=="object"){var c=this.options.requestHeaders;if(Object.isFunction(c.push)){for(var b=0,d=c.length;b<d;b+=2){e[c[b]]=c[b+1]}}else{$H(c).each(function(f){e[f.key]=f.value})}}for(var a in e){this.transport.setRequestHeader(a,e[a])}},success:function(){var a=this.getStatus();return !a||(a>=200&&a<300)},getStatus:function(){try{return this.transport.status||0}catch(a){return 0}},respondToReadyState:function(a){var c=Ajax.Request.Events[a],b=new Ajax.Response(this);if(c=="Complete"){try{this._complete=true;(this.options["on"+b.status]||this.options["on"+(this.success()?"Success":"Failure")]||Prototype.emptyFunction)(b,b.headerJSON)}catch(d){this.dispatchException(d)}var f=b.getHeader("Content-type");if(this.options.evalJS=="force"||(this.options.evalJS&&this.isSameOrigin()&&f&&f.match(/^\s*(text|application)\/(x-)?(java|ecma)script(;.*)?\s*$/i))){this.evalResponse()}}try{(this.options["on"+c]||Prototype.emptyFunction)(b,b.headerJSON);Ajax.Responders.dispatch("on"+c,this,b,b.headerJSON)}catch(d){this.dispatchException(d)}if(c=="Complete"){this.transport.onreadystatechange=Prototype.emptyFunction}},isSameOrigin:function(){var a=this.url.match(/^\s*https?:\/\/[^\/]*/);return !a||(a[0]=="#{protocol}//#{domain}#{port}".interpolate({protocol:location.protocol,domain:document.domain,port:location.port?":"+location.port:""}))},getHeader:function(a){try{return this.transport.getResponseHeader(a)||null}catch(b){return null}},evalResponse:function(){try{return eval((this.transport.responseText||"").unfilterJSON())}catch(e){this.dispatchException(e)}},dispatchException:function(a){(this.options.onException||Prototype.emptyFunction)(this,a);Ajax.Responders.dispatch("onException",this,a)}});Ajax.Request.Events=["Uninitialized","Loading","Loaded","Interactive","Complete"];Ajax.Response=Class.create({initialize:function(c){this.request=c;var d=this.transport=c.transport,a=this.readyState=d.readyState;if((a>2&&!Prototype.Browser.IE)||a==4){this.status=this.getStatus();this.statusText=this.getStatusText();this.responseText=String.interpret(d.responseText);this.headerJSON=this._getHeaderJSON()}if(a==4){var b=d.responseXML;this.responseXML=Object.isUndefined(b)?null:b;this.responseJSON=this._getResponseJSON()}},status:0,statusText:"",getStatus:Ajax.Request.prototype.getStatus,getStatusText:function(){try{return this.transport.statusText||""}catch(a){return""}},getHeader:Ajax.Request.prototype.getHeader,getAllHeaders:function(){try{return this.getAllResponseHeaders()}catch(a){return null}},getResponseHeader:function(a){return this.transport.getResponseHeader(a)},getAllResponseHeaders:function(){return this.transport.getAllResponseHeaders()},_getHeaderJSON:function(){var a=this.getHeader("X-JSON");if(!a){return null}a=decodeURIComponent(escape(a));try{return a.evalJSON(this.request.options.sanitizeJSON||!this.request.isSameOrigin())}catch(b){this.request.dispatchException(b)}},_getResponseJSON:function(){var a=this.request.options;if(!a.evalJSON||(a.evalJSON!="force"&&!(this.getHeader("Content-type")||"").include("application/json"))||this.responseText.blank()){return null}try{return this.responseText.evalJSON(a.sanitizeJSON||!this.request.isSameOrigin())}catch(b){this.request.dispatchException(b)}}});Ajax.Updater=Class.create(Ajax.Request,{initialize:function($super,a,c,b){this.container={success:(a.success||a),failure:(a.failure||(a.success?null:a))};b=Object.clone(b);var d=b.onComplete;b.onComplete=(function(e,f){this.updateContent(e.responseText);if(Object.isFunction(d)){d(e,f)}}).bind(this);$super(c,b)},updateContent:function(d){var c=this.container[this.success()?"success":"failure"],a=this.options;if(!a.evalScripts){d=d.stripScripts()}if(c=$(c)){if(a.insertion){if(Object.isString(a.insertion)){var b={};b[a.insertion]=d;c.insert(b)}else{a.insertion(c,d)}}else{c.update(d)}}}});Ajax.PeriodicalUpdater=Class.create(Ajax.Base,{initialize:function($super,a,c,b){$super(b);this.onComplete=this.options.onComplete;this.frequency=(this.options.frequency||2);this.decay=(this.options.decay||1);this.updater={};this.container=a;this.url=c;this.start()},start:function(){this.options.onComplete=this.updateComplete.bind(this);this.onTimerEvent()},stop:function(){this.updater.options.onComplete=undefined;clearTimeout(this.timer);(this.onComplete||Prototype.emptyFunction).apply(this,arguments)},updateComplete:function(a){if(this.options.decay){this.decay=(a.responseText==this.lastText?this.decay*this.options.decay:1);this.lastText=a.responseText}this.timer=this.onTimerEvent.bind(this).delay(this.decay*this.frequency)},onTimerEvent:function(){this.updater=new Ajax.Updater(this.container,this.url,this.options)}});function $(b){if(arguments.length>1){for(var a=0,d=[],c=arguments.length;a<c;a++){d.push($(arguments[a]))}return d}if(Object.isString(b)){b=document.getElementById(b)}return Element.extend(b)}if(Prototype.BrowserFeatures.XPath){document._getElementsByXPath=function(f,a){var c=[];var e=document.evaluate(f,$(a)||document,null,XPathResult.ORDERED_NODE_SNAPSHOT_TYPE,null);for(var b=0,d=e.snapshotLength;b<d;b++){c.push(Element.extend(e.snapshotItem(b)))}return c}}if(!Node){var Node={}}if(!Node.ELEMENT_NODE){Object.extend(Node,{ELEMENT_NODE:1,ATTRIBUTE_NODE:2,TEXT_NODE:3,CDATA_SECTION_NODE:4,ENTITY_REFERENCE_NODE:5,ENTITY_NODE:6,PROCESSING_INSTRUCTION_NODE:7,COMMENT_NODE:8,DOCUMENT_NODE:9,DOCUMENT_TYPE_NODE:10,DOCUMENT_FRAGMENT_NODE:11,NOTATION_NODE:12})}(function(c){var b=(function(){try{var d=document.createElement('<input name="x">');return d.tagName.toLowerCase()==="input"&&d.name==="x"}catch(e){return false}})();var a=c.Element;c.Element=function(f,e){e=e||{};f=f.toLowerCase();var d=Element.cache;if(b&&e.name){f="<"+f+' name="'+e.name+'">';delete e.name;return Element.writeAttribute(document.createElement(f),e)}if(!d[f]){d[f]=Element.extend(document.createElement(f))}return Element.writeAttribute(d[f].cloneNode(false),e)};Object.extend(c.Element,a||{});if(a){c.Element.prototype=a.prototype}})(this);Element.idCounter=1;Element.cache={};Element._purgeElement=function(b){var a=b._prototypeUID;if(a){Element.stopObserving(b);b._prototypeUID=void 0;delete Element.Storage[a]}};Element.Methods={visible:function(a){return $(a).style.display!="none"},toggle:function(a){a=$(a);Element[Element.visible(a)?"hide":"show"](a);return a},hide:function(a){a=$(a);a.style.display="none";return a},show:function(a){a=$(a);a.style.display="";return a},remove:function(a){a=$(a);a.parentNode.removeChild(a);return a},update:(function(){var b=(function(){var e=document.createElement("select"),f=true;e.innerHTML='<option value="test">test</option>';if(e.options&&e.options[0]){f=e.options[0].nodeName.toUpperCase()!=="OPTION"}e=null;return f})();var a=(function(){try{var f=document.createElement("table");if(f&&f.tBodies){f.innerHTML="<tbody><tr><td>test</td></tr></tbody>";var h=typeof f.tBodies[0]=="undefined";f=null;return h}}catch(g){return true}})();var d=(function(){var f=document.createElement("script"),h=false;try{f.appendChild(document.createTextNode(""));h=!f.firstChild||f.firstChild&&f.firstChild.nodeType!==3}catch(g){h=true}f=null;return h})();function c(h,j){h=$(h);var e=Element._purgeElement;var k=h.getElementsByTagName("*"),g=k.length;while(g--){e(k[g])}if(j&&j.toElement){j=j.toElement()}if(Object.isElement(j)){return h.update().insert(j)}j=Object.toHTML(j);var f=h.tagName.toUpperCase();if(f==="SCRIPT"&&d){h.text=j;return h}if(b||a){if(f in Element._insertionTranslations.tags){while(h.firstChild){h.removeChild(h.firstChild)}Element._getContentFromAnonymousElement(f,j.stripScripts()).each(function(i){h.appendChild(i)})}else{h.innerHTML=j.stripScripts()}}else{h.innerHTML=j.stripScripts()}j.evalScripts.bind(j).defer();return h}return c})(),replace:function(b,c){b=$(b);if(c&&c.toElement){c=c.toElement()}else{if(!Object.isElement(c)){c=Object.toHTML(c);var a=b.ownerDocument.createRange();a.selectNode(b);c.evalScripts.bind(c).defer();c=a.createContextualFragment(c.stripScripts())}}b.parentNode.replaceChild(c,b);return b},insert:function(c,e){c=$(c);if(Object.isString(e)||Object.isNumber(e)||Object.isElement(e)||(e&&(e.toElement||e.toHTML))){e={bottom:e}}var d,f,b,g;for(var a in e){d=e[a];a=a.toLowerCase();f=Element._insertionTranslations[a];if(d&&d.toElement){d=d.toElement()}if(Object.isElement(d)){f(c,d);continue}d=Object.toHTML(d);b=((a=="before"||a=="after")?c.parentNode:c).tagName.toUpperCase();g=Element._getContentFromAnonymousElement(b,d.stripScripts());if(a=="top"||a=="after"){g.reverse()}g.each(f.curry(c));d.evalScripts.bind(d).defer()}return c},wrap:function(b,c,a){b=$(b);if(Object.isElement(c)){$(c).writeAttribute(a||{})}else{if(Object.isString(c)){c=new Element(c,a)}else{c=new Element("div",c)}}if(b.parentNode){b.parentNode.replaceChild(c,b)}c.appendChild(b);return c},inspect:function(b){b=$(b);var a="<"+b.tagName.toLowerCase();$H({id:"id",className:"class"}).each(function(f){var e=f.first(),c=f.last(),d=(b[e]||"").toString();if(d){a+=" "+c+"="+d.inspect(true)}});return a+">"},recursivelyCollect:function(a,c,d){a=$(a);d=d||-1;var b=[];while(a=a[c]){if(a.nodeType==1){b.push(Element.extend(a))}if(b.length==d){break}}return b},ancestors:function(a){return Element.recursivelyCollect(a,"parentNode")},descendants:function(a){return Element.select(a,"*")},firstDescendant:function(a){a=$(a).firstChild;while(a&&a.nodeType!=1){a=a.nextSibling}return $(a)},immediateDescendants:function(b){var a=[],c=$(b).firstChild;while(c){if(c.nodeType===1){a.push(Element.extend(c))}c=c.nextSibling}return a},previousSiblings:function(a,b){return Element.recursivelyCollect(a,"previousSibling")},nextSiblings:function(a){return Element.recursivelyCollect(a,"nextSibling")},siblings:function(a){a=$(a);return Element.previousSiblings(a).reverse().concat(Element.nextSiblings(a))},match:function(b,a){b=$(b);if(Object.isString(a)){return Prototype.Selector.match(b,a)}return a.match(b)},up:function(b,d,a){b=$(b);if(arguments.length==1){return $(b.parentNode)}var c=Element.ancestors(b);return Object.isNumber(d)?c[d]:Prototype.Selector.find(c,d,a)},down:function(b,c,a){b=$(b);if(arguments.length==1){return Element.firstDescendant(b)}return Object.isNumber(c)?Element.descendants(b)[c]:Element.select(b,c)[a||0]},previous:function(b,c,a){b=$(b);if(Object.isNumber(c)){a=c,c=false}if(!Object.isNumber(a)){a=0}if(c){return Prototype.Selector.find(b.previousSiblings(),c,a)}else{return b.recursivelyCollect("previousSibling",a+1)[a]}},next:function(b,d,a){b=$(b);if(Object.isNumber(d)){a=d,d=false}if(!Object.isNumber(a)){a=0}if(d){return Prototype.Selector.find(b.nextSiblings(),d,a)}else{var c=Object.isNumber(a)?a+1:1;return b.recursivelyCollect("nextSibling",a+1)[a]}},select:function(a){a=$(a);var b=Array.prototype.slice.call(arguments,1).join(", ");return Prototype.Selector.select(b,a)},adjacent:function(a){a=$(a);var b=Array.prototype.slice.call(arguments,1).join(", ");return Prototype.Selector.select(b,a.parentNode).without(a)},identify:function(a){a=$(a);var b=Element.readAttribute(a,"id");if(b){return b}do{b="anonymous_element_"+Element.idCounter++}while($(b));Element.writeAttribute(a,"id",b);return b},readAttribute:function(c,a){c=$(c);if(Prototype.Browser.IE){var b=Element._attributeTranslations.read;if(b.values[a]){return b.values[a](c,a)}if(b.names[a]){a=b.names[a]}if(a.include(":")){return(!c.attributes||!c.attributes[a])?null:c.attributes[a].value}}return c.getAttribute(a)},writeAttribute:function(e,c,f){e=$(e);var b={},d=Element._attributeTranslations.write;if(typeof c=="object"){b=c}else{b[c]=Object.isUndefined(f)?true:f}for(var a in b){c=d.names[a]||a;f=b[a];if(d.values[a]){c=d.values[a](e,f)}if(f===false||f===null){e.removeAttribute(c)}else{if(f===true){e.setAttribute(c,c)}else{e.setAttribute(c,f)}}}return e},getHeight:function(a){return Element.getDimensions(a).height},getWidth:function(a){return Element.getDimensions(a).width},classNames:function(a){return new Element.ClassNames(a)},hasClassName:function(a,b){if(!(a=$(a))){return}var c=a.className;return(c.length>0&&(c==b||new RegExp("(^|\\s)"+b+"(\\s|$)").test(c)))},addClassName:function(a,b){if(!(a=$(a))){return}if(!Element.hasClassName(a,b)){a.className+=(a.className?" ":"")+b}return a},removeClassName:function(a,b){if(!(a=$(a))){return}a.className=a.className.replace(new RegExp("(^|\\s+)"+b+"(\\s+|$)")," ").strip();return a},toggleClassName:function(a,b){if(!(a=$(a))){return}return Element[Element.hasClassName(a,b)?"removeClassName":"addClassName"](a,b)},cleanWhitespace:function(b){b=$(b);var c=b.firstChild;while(c){var a=c.nextSibling;if(c.nodeType==3&&!/\S/.test(c.nodeValue)){b.removeChild(c)}c=a}return b},empty:function(a){return $(a).innerHTML.blank()},descendantOf:function(b,a){b=$(b),a=$(a);if(b.compareDocumentPosition){return(b.compareDocumentPosition(a)&8)===8}if(a.contains){return a.contains(b)&&a!==b}while(b=b.parentNode){if(b==a){return true}}return false},scrollTo:function(a){a=$(a);var b=Element.cumulativeOffset(a);window.scrollTo(b[0],b[1]);return a},getStyle:function(b,c){b=$(b);c=c=="float"?"cssFloat":c.camelize();var d=b.style[c];if(!d||d=="auto"){var a=document.defaultView.getComputedStyle(b,null);d=a?a[c]:null}if(c=="opacity"){return d?parseFloat(d):1}return d=="auto"?null:d},getOpacity:function(a){return $(a).getStyle("opacity")},setStyle:function(b,c){b=$(b);var e=b.style,a;if(Object.isString(c)){b.style.cssText+=";"+c;return c.include("opacity")?b.setOpacity(c.match(/opacity:\s*(\d?\.?\d*)/)[1]):b}for(var d in c){if(d=="opacity"){b.setOpacity(c[d])}else{e[(d=="float"||d=="cssFloat")?(Object.isUndefined(e.styleFloat)?"cssFloat":"styleFloat"):d]=c[d]}}return b},setOpacity:function(a,b){a=$(a);a.style.opacity=(b==1||b==="")?"":(b<0.00001)?0:b;return a},makePositioned:function(a){a=$(a);var b=Element.getStyle(a,"position");if(b=="static"||!b){a._madePositioned=true;a.style.position="relative";if(Prototype.Browser.Opera){a.style.top=0;a.style.left=0}}return a},undoPositioned:function(a){a=$(a);if(a._madePositioned){a._madePositioned=undefined;a.style.position=a.style.top=a.style.left=a.style.bottom=a.style.right=""}return a},makeClipping:function(a){a=$(a);if(a._overflow){return a}a._overflow=Element.getStyle(a,"overflow")||"auto";if(a._overflow!=="hidden"){a.style.overflow="hidden"}return a},undoClipping:function(a){a=$(a);if(!a._overflow){return a}a.style.overflow=a._overflow=="auto"?"":a._overflow;a._overflow=null;return a},cumulativeOffset:function(b){var a=0,c=0;if(b.parentNode){do{a+=b.offsetTop||0;c+=b.offsetLeft||0;b=b.offsetParent}while(b)}return Element._returnOffset(c,a)},positionedOffset:function(b){var a=0,d=0;do{a+=b.offsetTop||0;d+=b.offsetLeft||0;b=b.offsetParent;if(b){if(b.tagName.toUpperCase()=="BODY"){break}var c=Element.getStyle(b,"position");if(c!=="static"){break}}}while(b);return Element._returnOffset(d,a)},absolutize:function(b){b=$(b);if(Element.getStyle(b,"position")=="absolute"){return b}var d=Element.positionedOffset(b),f=d[1],e=d[0],c=b.clientWidth,a=b.clientHeight;b._originalLeft=e-parseFloat(b.style.left||0);b._originalTop=f-parseFloat(b.style.top||0);b._originalWidth=b.style.width;b._originalHeight=b.style.height;b.style.position="absolute";b.style.top=f+"px";b.style.left=e+"px";b.style.width=c+"px";b.style.height=a+"px";return b},relativize:function(a){a=$(a);if(Element.getStyle(a,"position")=="relative"){return a}a.style.position="relative";var c=parseFloat(a.style.top||0)-(a._originalTop||0),b=parseFloat(a.style.left||0)-(a._originalLeft||0);a.style.top=c+"px";a.style.left=b+"px";a.style.height=a._originalHeight;a.style.width=a._originalWidth;return a},cumulativeScrollOffset:function(b){var a=0,c=0;do{a+=b.scrollTop||0;c+=b.scrollLeft||0;b=b.parentNode}while(b);return Element._returnOffset(c,a)},getOffsetParent:function(a){if(a.offsetParent){return $(a.offsetParent)}if(a==document.body){return $(a)}while((a=a.parentNode)&&a!=document.body){if(Element.getStyle(a,"position")!="static"){return $(a)}}return $(document.body)},viewportOffset:function(d){var a=0,c=0,b=d;do{a+=b.offsetTop||0;c+=b.offsetLeft||0;if(b.offsetParent==document.body&&Element.getStyle(b,"position")=="absolute"){break}}while(b=b.offsetParent);b=d;do{if(!Prototype.Browser.Opera||(b.tagName&&(b.tagName.toUpperCase()=="BODY"))){a-=b.scrollTop||0;c-=b.scrollLeft||0}}while(b=b.parentNode);return Element._returnOffset(c,a)},clonePosition:function(b,d){var a=Object.extend({setLeft:true,setTop:true,setWidth:true,setHeight:true,offsetTop:0,offsetLeft:0},arguments[2]||{});d=$(d);var e=Element.viewportOffset(d),f=[0,0],c=null;b=$(b);if(Element.getStyle(b,"position")=="absolute"){c=Element.getOffsetParent(b);f=Element.viewportOffset(c)}if(c==document.body){f[0]-=document.body.offsetLeft;f[1]-=document.body.offsetTop}if(a.setLeft){b.style.left=(e[0]-f[0]+a.offsetLeft)+"px"}if(a.setTop){b.style.top=(e[1]-f[1]+a.offsetTop)+"px"}if(a.setWidth){b.style.width=d.offsetWidth+"px"}if(a.setHeight){b.style.height=d.offsetHeight+"px"}return b}};Object.extend(Element.Methods,{getElementsBySelector:Element.Methods.select,childElements:Element.Methods.immediateDescendants});Element._attributeTranslations={write:{names:{className:"class",htmlFor:"for"},values:{}}};if(Prototype.Browser.Opera){Element.Methods.getStyle=Element.Methods.getStyle.wrap(function(d,b,c){switch(c){case"left":case"top":case"right":case"bottom":if(d(b,"position")==="static"){return null}case"height":case"width":if(!Element.visible(b)){return null}var e=parseInt(d(b,c),10);if(e!==b["offset"+c.capitalize()]){return e+"px"}var a;if(c==="height"){a=["border-top-width","padding-top","padding-bottom","border-bottom-width"]}else{a=["border-left-width","padding-left","padding-right","border-right-width"]}return a.inject(e,function(f,g){var h=d(b,g);return h===null?f:f-parseInt(h,10)})+"px";default:return d(b,c)}});Element.Methods.readAttribute=Element.Methods.readAttribute.wrap(function(c,a,b){if(b==="title"){return a.title}return c(a,b)})}else{if(Prototype.Browser.IE){Element.Methods.getOffsetParent=Element.Methods.getOffsetParent.wrap(function(c,b){b=$(b);if(!b.parentNode){return $(document.body)}var a=b.getStyle("position");if(a!=="static"){return c(b)}b.setStyle({position:"relative"});var d=c(b);b.setStyle({position:a});return d});$w("positionedOffset viewportOffset").each(function(a){Element.Methods[a]=Element.Methods[a].wrap(function(e,c){c=$(c);if(!c.parentNode){return Element._returnOffset(0,0)}var b=c.getStyle("position");if(b!=="static"){return e(c)}var d=c.getOffsetParent();if(d&&d.getStyle("position")==="fixed"){d.setStyle({zoom:1})}c.setStyle({position:"relative"});var f=e(c);c.setStyle({position:b});return f})});Element.Methods.getStyle=function(a,b){a=$(a);b=(b=="float"||b=="cssFloat")?"styleFloat":b.camelize();var c=a.style[b];if(!c&&a.currentStyle){c=a.currentStyle[b]}if(b=="opacity"){if(c=(a.getStyle("filter")||"").match(/alpha\(opacity=(.*)\)/)){if(c[1]){return parseFloat(c[1])/100}}return 1}if(c=="auto"){if((b=="width"||b=="height")&&(a.getStyle("display")!="none")){return a["offset"+b.capitalize()]+"px"}return null}return c};Element.Methods.setOpacity=function(b,e){function f(g){return g.replace(/alpha\([^\)]*\)/gi,"")}b=$(b);var a=b.currentStyle;if((a&&!a.hasLayout)||(!a&&b.style.zoom=="normal")){b.style.zoom=1}var d=b.getStyle("filter"),c=b.style;if(e==1||e===""){(d=f(d))?c.filter=d:c.removeAttribute("filter");return b}else{if(e<0.00001){e=0}}c.filter=f(d)+"alpha(opacity="+(e*100)+")";return b};Element._attributeTranslations=(function(){var b="className",a="for",c=document.createElement("div");c.setAttribute(b,"x");if(c.className!=="x"){c.setAttribute("class","x");if(c.className==="x"){b="class"}}c=null;c=document.createElement("label");c.setAttribute(a,"x");if(c.htmlFor!=="x"){c.setAttribute("htmlFor","x");if(c.htmlFor==="x"){a="htmlFor"}}c=null;return{read:{names:{"class":b,className:b,"for":a,htmlFor:a},values:{_getAttr:function(d,e){return d.getAttribute(e)},_getAttr2:function(d,e){return d.getAttribute(e,2)},_getAttrNode:function(d,f){var e=d.getAttributeNode(f);return e?e.value:""},_getEv:(function(){var d=document.createElement("div"),g;d.onclick=Prototype.emptyFunction;var e=d.getAttribute("onclick");if(String(e).indexOf("{")>-1){g=function(f,h){h=f.getAttribute(h);if(!h){return null}h=h.toString();h=h.split("{")[1];h=h.split("}")[0];return h.strip()}}else{if(e===""){g=function(f,h){h=f.getAttribute(h);if(!h){return null}return h.strip()}}}d=null;return g})(),_flag:function(d,e){return $(d).hasAttribute(e)?e:null},style:function(d){return d.style.cssText.toLowerCase()},title:function(d){return d.title}}}}})();Element._attributeTranslations.write={names:Object.extend({cellpadding:"cellPadding",cellspacing:"cellSpacing"},Element._attributeTranslations.read.names),values:{checked:function(a,b){a.checked=!!b},style:function(a,b){a.style.cssText=b?b:""}}};Element._attributeTranslations.has={};$w("colSpan rowSpan vAlign dateTime accessKey tabIndex encType maxLength readOnly longDesc frameBorder").each(function(a){Element._attributeTranslations.write.names[a.toLowerCase()]=a;Element._attributeTranslations.has[a.toLowerCase()]=a});(function(a){Object.extend(a,{href:a._getAttr2,src:a._getAttr2,type:a._getAttr,action:a._getAttrNode,disabled:a._flag,checked:a._flag,readonly:a._flag,multiple:a._flag,onload:a._getEv,onunload:a._getEv,onclick:a._getEv,ondblclick:a._getEv,onmousedown:a._getEv,onmouseup:a._getEv,onmouseover:a._getEv,onmousemove:a._getEv,onmouseout:a._getEv,onfocus:a._getEv,onblur:a._getEv,onkeypress:a._getEv,onkeydown:a._getEv,onkeyup:a._getEv,onsubmit:a._getEv,onreset:a._getEv,onselect:a._getEv,onchange:a._getEv})})(Element._attributeTranslations.read.values);if(Prototype.BrowserFeatures.ElementExtensions){(function(){function a(e){var b=e.getElementsByTagName("*"),d=[];for(var c=0,f;f=b[c];c++){if(f.tagName!=="!"){d.push(f)}}return d}Element.Methods.down=function(c,d,b){c=$(c);if(arguments.length==1){return c.firstDescendant()}return Object.isNumber(d)?a(c)[d]:Element.select(c,d)[b||0]}})()}}else{if(Prototype.Browser.Gecko&&/rv:1\.8\.0/.test(navigator.userAgent)){Element.Methods.setOpacity=function(a,b){a=$(a);a.style.opacity=(b==1)?0.999999:(b==="")?"":(b<0.00001)?0:b;return a}}else{if(Prototype.Browser.WebKit){Element.Methods.setOpacity=function(a,b){a=$(a);a.style.opacity=(b==1||b==="")?"":(b<0.00001)?0:b;if(b==1){if(a.tagName.toUpperCase()=="IMG"&&a.width){a.width++;a.width--}else{try{var d=document.createTextNode(" ");a.appendChild(d);a.removeChild(d)}catch(c){}}}return a};Element.Methods.cumulativeOffset=function(b){var a=0,c=0;do{a+=b.offsetTop||0;c+=b.offsetLeft||0;if(b.offsetParent==document.body){if(Element.getStyle(b,"position")=="absolute"){break}}b=b.offsetParent}while(b);return Element._returnOffset(c,a)}}}}}if("outerHTML" in document.documentElement){Element.Methods.replace=function(c,e){c=$(c);if(e&&e.toElement){e=e.toElement()}if(Object.isElement(e)){c.parentNode.replaceChild(e,c);return c}e=Object.toHTML(e);var d=c.parentNode,b=d.tagName.toUpperCase();if(Element._insertionTranslations.tags[b]){var f=c.next(),a=Element._getContentFromAnonymousElement(b,e.stripScripts());d.removeChild(c);if(f){a.each(function(g){d.insertBefore(g,f)})}else{a.each(function(g){d.appendChild(g)})}}else{c.outerHTML=e.stripScripts()}e.evalScripts.bind(e).defer();return c}}Element._returnOffset=function(b,c){var a=[b,c];a.left=b;a.top=c;return a};Element._getContentFromAnonymousElement=function(d,c){var e=new Element("div"),b=Element._insertionTranslations.tags[d];if(b){e.innerHTML=b[0]+c+b[1];for(var a=b[2];a--;){e=e.firstChild}}else{e.innerHTML=c}return $A(e.childNodes)};Element._insertionTranslations={before:function(a,b){a.parentNode.insertBefore(b,a)},top:function(a,b){a.insertBefore(b,a.firstChild)},bottom:function(a,b){a.appendChild(b)},after:function(a,b){a.parentNode.insertBefore(b,a.nextSibling)},tags:{TABLE:["<table>","</table>",1],TBODY:["<table><tbody>","</tbody></table>",2],TR:["<table><tbody><tr>","</tr></tbody></table>",3],TD:["<table><tbody><tr><td>","</td></tr></tbody></table>",4],SELECT:["<select>","</select>",1]}};(function(){var a=Element._insertionTranslations.tags;Object.extend(a,{THEAD:a.TBODY,TFOOT:a.TBODY,TH:a.TD})})();Element.Methods.Simulated={hasAttribute:function(a,c){c=Element._attributeTranslations.has[c]||c;var b=$(a).getAttributeNode(c);return !!(b&&b.specified)}};Element.Methods.ByTag={};Object.extend(Element,Element.Methods);(function(a){if(!Prototype.BrowserFeatures.ElementExtensions&&a.__proto__){window.HTMLElement={};window.HTMLElement.prototype=a.__proto__;Prototype.BrowserFeatures.ElementExtensions=true}a=null})(document.createElement("div"));Element.extend=(function(){function c(g){if(typeof window.Element!="undefined"){var i=window.Element.prototype;if(i){var k="_"+(Math.random()+"").slice(2),h=document.createElement(g);i[k]="x";var j=(h[k]!=="x");delete i[k];h=null;return j}}return false}function b(h,g){for(var j in g){var i=g[j];if(Object.isFunction(i)&&!(j in h)){h[j]=i.methodize()}}}var d=c("object");if(Prototype.BrowserFeatures.SpecificElementExtensions){if(d){return function(h){if(h&&typeof h._extendedByPrototype=="undefined"){var g=h.tagName;if(g&&(/^(?:object|applet|embed)$/i.test(g))){b(h,Element.Methods);b(h,Element.Methods.Simulated);b(h,Element.Methods.ByTag[g.toUpperCase()])}}return h}}return Prototype.K}var a={},e=Element.Methods.ByTag;var f=Object.extend(function(i){if(!i||typeof i._extendedByPrototype!="undefined"||i.nodeType!=1||i==window){return i}var g=Object.clone(a),h=i.tagName.toUpperCase();if(e[h]){Object.extend(g,e[h])}b(i,g);i._extendedByPrototype=Prototype.emptyFunction;return i},{refresh:function(){if(!Prototype.BrowserFeatures.ElementExtensions){Object.extend(a,Element.Methods);Object.extend(a,Element.Methods.Simulated)}}});f.refresh();return f})();if(document.documentElement.hasAttribute){Element.hasAttribute=function(a,b){return a.hasAttribute(b)}}else{Element.hasAttribute=Element.Methods.Simulated.hasAttribute}Element.addMethods=function(c){var i=Prototype.BrowserFeatures,d=Element.Methods.ByTag;if(!c){Object.extend(Form,Form.Methods);Object.extend(Form.Element,Form.Element.Methods);Object.extend(Element.Methods.ByTag,{FORM:Object.clone(Form.Methods),INPUT:Object.clone(Form.Element.Methods),SELECT:Object.clone(Form.Element.Methods),TEXTAREA:Object.clone(Form.Element.Methods)})}if(arguments.length==2){var b=c;c=arguments[1]}if(!b){Object.extend(Element.Methods,c||{})}else{if(Object.isArray(b)){b.each(g)}else{g(b)}}function g(k){k=k.toUpperCase();if(!Element.Methods.ByTag[k]){Element.Methods.ByTag[k]={}}Object.extend(Element.Methods.ByTag[k],c)}function a(m,l,k){k=k||false;for(var o in m){var n=m[o];if(!Object.isFunction(n)){continue}if(!k||!(o in l)){l[o]=n.methodize()}}}function e(n){var k;var m={OPTGROUP:"OptGroup",TEXTAREA:"TextArea",P:"Paragraph",FIELDSET:"FieldSet",UL:"UList",OL:"OList",DL:"DList",DIR:"Directory",H1:"Heading",H2:"Heading",H3:"Heading",H4:"Heading",H5:"Heading",H6:"Heading",Q:"Quote",INS:"Mod",DEL:"Mod",A:"Anchor",IMG:"Image",CAPTION:"TableCaption",COL:"TableCol",COLGROUP:"TableCol",THEAD:"TableSection",TFOOT:"TableSection",TBODY:"TableSection",TR:"TableRow",TH:"TableCell",TD:"TableCell",FRAMESET:"FrameSet",IFRAME:"IFrame"};if(m[n]){k="HTML"+m[n]+"Element"}if(window[k]){return window[k]}k="HTML"+n+"Element";if(window[k]){return window[k]}k="HTML"+n.capitalize()+"Element";if(window[k]){return window[k]}var l=document.createElement(n),o=l.__proto__||l.constructor.prototype;l=null;return o}var h=window.HTMLElement?HTMLElement.prototype:Element.prototype;if(i.ElementExtensions){a(Element.Methods,h);a(Element.Methods.Simulated,h,true)}if(i.SpecificElementExtensions){for(var j in Element.Methods.ByTag){var f=e(j);if(Object.isUndefined(f)){continue}a(d[j],f.prototype)}}Object.extend(Element,Element.Methods);delete Element.ByTag;if(Element.extend.refresh){Element.extend.refresh()}Element.cache={}};document.viewport={getDimensions:function(){return{width:this.getWidth(),height:this.getHeight()}},getScrollOffsets:function(){return Element._returnOffset(window.pageXOffset||document.documentElement.scrollLeft||document.body.scrollLeft,window.pageYOffset||document.documentElement.scrollTop||document.body.scrollTop)}};(function(b){var g=Prototype.Browser,e=document,c,d={};function a(){if(g.WebKit&&!e.evaluate){return document}if(g.Opera&&window.parseFloat(window.opera.version())<9.5){return document.body}return document.documentElement}function f(h){if(!c){c=a()}d[h]="client"+h;b["get"+h]=function(){return c[d[h]]};return b["get"+h]()}b.getWidth=f.curry("Width");b.getHeight=f.curry("Height")})(document.viewport);Element.Storage={UID:1};Element.addMethods({getStorage:function(b){if(!(b=$(b))){return}var a;if(b===window){a=0}else{if(typeof b._prototypeUID==="undefined"){b._prototypeUID=Element.Storage.UID++}a=b._prototypeUID}if(!Element.Storage[a]){Element.Storage[a]=$H()}return Element.Storage[a]},store:function(b,a,c){if(!(b=$(b))){return}if(arguments.length===2){Element.getStorage(b).update(a)}else{Element.getStorage(b).set(a,c)}return b},retrieve:function(c,b,a){if(!(c=$(c))){return}var e=Element.getStorage(c),d=e.get(b);if(Object.isUndefined(d)){e.set(b,a);d=a}return d},clone:function(c,a){if(!(c=$(c))){return}var e=c.cloneNode(a);e._prototypeUID=void 0;if(a){var d=Element.select(e,"*"),b=d.length;while(b--){d[b]._prototypeUID=void 0}}return Element.extend(e)},purge:function(c){if(!(c=$(c))){return}var a=Element._purgeElement;a(c);var d=c.getElementsByTagName("*"),b=d.length;while(b--){a(d[b])}return null}});(function(){function g(t){var s=t.match(/^(\d+)%?$/i);if(!s){return null}return(Number(s[1])/100)}function m(D,E,t){var w=null;if(Object.isElement(D)){w=D;D=w.getStyle(E)}if(D===null){return null}if((/^(?:-)?\d+(\.\d+)?(px)?$/i).test(D)){return window.parseFloat(D)}var y=D.include("%"),u=(t===document.viewport);if(/\d/.test(D)&&w&&w.runtimeStyle&&!(y&&u)){var s=w.style.left,C=w.runtimeStyle.left;w.runtimeStyle.left=w.currentStyle.left;w.style.left=D||0;D=w.style.pixelLeft;w.style.left=s;w.runtimeStyle.left=C;return D}if(w&&y){t=t||w.parentNode;var v=g(D);var z=null;var x=w.getStyle("position");var B=E.include("left")||E.include("right")||E.include("width");var A=E.include("top")||E.include("bottom")||E.include("height");if(t===document.viewport){if(B){z=document.viewport.getWidth()}else{if(A){z=document.viewport.getHeight()}}}else{if(B){z=$(t).measure("width")}else{if(A){z=$(t).measure("height")}}}return(z===null)?0:z*v}return 0}function f(s){if(Object.isString(s)&&s.endsWith("px")){return s}return s+"px"}function i(t){var s=t;while(t&&t.parentNode){var u=t.getStyle("display");if(u==="none"){return false}t=$(t.parentNode)}return true}var d=Prototype.K;if("currentStyle" in document.documentElement){d=function(s){if(!s.currentStyle.hasLayout){s.style.zoom=1}return s}}function e(s){if(s.include("border")){s=s+"-width"}return s.camelize()}Element.Layout=Class.create(Hash,{initialize:function($super,t,s){$super();this.element=$(t);Element.Layout.PROPERTIES.each(function(u){this._set(u,null)},this);if(s){this._preComputing=true;this._begin();Element.Layout.PROPERTIES.each(this._compute,this);this._end();this._preComputing=false}},_set:function(t,s){return Hash.prototype.set.call(this,t,s)},set:function(t,s){throw"Properties of Element.Layout are read-only."},get:function($super,t){var s=$super(t);return s===null?this._compute(t):s},_begin:function(){if(this._prepared){return}var w=this.element;if(i(w)){this._prepared=true;return}var y={position:w.style.position||"",width:w.style.width||"",visibility:w.style.visibility||"",display:w.style.display||""};w.store("prototype_original_styles",y);var z=w.getStyle("position"),s=w.getStyle("width");var t=(z==="fixed")?document.viewport:w.parentNode;w.setStyle({position:"absolute",visibility:"hidden",display:"block"});var u=w.getStyle("width");var v;if(s&&(u===s)){v=m(w,"width",t)}else{if(z==="absolute"||z==="fixed"){v=m(w,"width",t)}else{var A=w.parentNode,x=$(A).getLayout();v=x.get("width")-this.get("margin-left")-this.get("border-left")-this.get("padding-left")-this.get("padding-right")-this.get("border-right")-this.get("margin-right")}}w.setStyle({width:v+"px"});this._prepared=true},_end:function(){var t=this.element;var s=t.retrieve("prototype_original_styles");t.store("prototype_original_styles",null);t.setStyle(s);this._prepared=false},_compute:function(t){var s=Element.Layout.COMPUTATIONS;if(!(t in s)){throw"Property not found."}return this._set(t,s[t].call(this,this.element))},toObject:function(){var s=$A(arguments);var t=(s.length===0)?Element.Layout.PROPERTIES:s.join(" ").split(" ");var u={};t.each(function(v){if(!Element.Layout.PROPERTIES.include(v)){return}var w=this.get(v);if(w!=null){u[v]=w}},this);return u},toHash:function(){var s=this.toObject.apply(this,arguments);return new Hash(s)},toCSS:function(){var s=$A(arguments);var u=(s.length===0)?Element.Layout.PROPERTIES:s.join(" ").split(" ");var t={};u.each(function(v){if(!Element.Layout.PROPERTIES.include(v)){return}if(Element.Layout.COMPOSITE_PROPERTIES.include(v)){return}var w=this.get(v);if(w!=null){t[e(v)]=w+"px"}},this);return t},inspect:function(){return"#<Element.Layout>"}});Object.extend(Element.Layout,{PROPERTIES:$w("height width top left right bottom border-left border-right border-top border-bottom padding-left padding-right padding-top padding-bottom margin-top margin-bottom margin-left margin-right padding-box-width padding-box-height border-box-width border-box-height margin-box-width margin-box-height"),COMPOSITE_PROPERTIES:$w("padding-box-width padding-box-height margin-box-width margin-box-height border-box-width border-box-height"),COMPUTATIONS:{height:function(u){if(!this._preComputing){this._begin()}var s=this.get("border-box-height");if(s<=0){if(!this._preComputing){this._end()}return 0}var v=this.get("border-top"),t=this.get("border-bottom");var x=this.get("padding-top"),w=this.get("padding-bottom");if(!this._preComputing){this._end()}return s-v-t-x-w},width:function(u){if(!this._preComputing){this._begin()}var t=this.get("border-box-width");if(t<=0){if(!this._preComputing){this._end()}return 0}var x=this.get("border-left"),s=this.get("border-right");var v=this.get("padding-left"),w=this.get("padding-right");if(!this._preComputing){this._end()}return t-x-s-v-w},"padding-box-height":function(t){var s=this.get("height"),v=this.get("padding-top"),u=this.get("padding-bottom");return s+v+u},"padding-box-width":function(s){var t=this.get("width"),u=this.get("padding-left"),v=this.get("padding-right");return t+u+v},"border-box-height":function(t){if(!this._preComputing){this._begin()}var s=t.offsetHeight;if(!this._preComputing){this._end()}return s},"border-box-width":function(s){if(!this._preComputing){this._begin()}var t=s.offsetWidth;if(!this._preComputing){this._end()}return t},"margin-box-height":function(t){var s=this.get("border-box-height"),u=this.get("margin-top"),v=this.get("margin-bottom");if(s<=0){return 0}return s+u+v},"margin-box-width":function(u){var t=this.get("border-box-width"),v=this.get("margin-left"),s=this.get("margin-right");if(t<=0){return 0}return t+v+s},top:function(s){var t=s.positionedOffset();return t.top},bottom:function(s){var v=s.positionedOffset(),t=s.getOffsetParent(),u=t.measure("height");var w=this.get("border-box-height");return u-w-v.top},left:function(s){var t=s.positionedOffset();return t.left},right:function(u){var w=u.positionedOffset(),v=u.getOffsetParent(),s=v.measure("width");var t=this.get("border-box-width");return s-t-w.left},"padding-top":function(s){return m(s,"paddingTop")},"padding-bottom":function(s){return m(s,"paddingBottom")},"padding-left":function(s){return m(s,"paddingLeft")},"padding-right":function(s){return m(s,"paddingRight")},"border-top":function(s){return m(s,"borderTopWidth")},"border-bottom":function(s){return m(s,"borderBottomWidth")},"border-left":function(s){return m(s,"borderLeftWidth")},"border-right":function(s){return m(s,"borderRightWidth")},"margin-top":function(s){return m(s,"marginTop")},"margin-bottom":function(s){return m(s,"marginBottom")},"margin-left":function(s){return m(s,"marginLeft")},"margin-right":function(s){return m(s,"marginRight")}}});if("getBoundingClientRect" in document.documentElement){Object.extend(Element.Layout.COMPUTATIONS,{right:function(t){var u=d(t.getOffsetParent());var v=t.getBoundingClientRect(),s=u.getBoundingClientRect();return(s.right-v.right).round()},bottom:function(t){var u=d(t.getOffsetParent());var v=t.getBoundingClientRect(),s=u.getBoundingClientRect();return(s.bottom-v.bottom).round()}})}Element.Offset=Class.create({initialize:function(t,s){this.left=t.round();this.top=s.round();this[0]=this.left;this[1]=this.top},relativeTo:function(s){return new Element.Offset(this.left-s.left,this.top-s.top)},inspect:function(){return"#<Element.Offset left: #{left} top: #{top}>".interpolate(this)},toString:function(){return"[#{left}, #{top}]".interpolate(this)},toArray:function(){return[this.left,this.top]}});function p(t,s){return new Element.Layout(t,s)}function b(s,t){return $(s).getLayout().get(t)}function l(t){t=$(t);var x=Element.getStyle(t,"display");if(x&&x!=="none"){return{width:t.offsetWidth,height:t.offsetHeight}}var u=t.style;var s={visibility:u.visibility,position:u.position,display:u.display};var w={visibility:"hidden",display:"block"};if(s.position!=="fixed"){w.position="absolute"}Element.setStyle(t,w);var v={width:t.offsetWidth,height:t.offsetHeight};Element.setStyle(t,s);return v}function j(s){if(c(s)){return $(document.body)}var t=(Element.getStyle(s,"display")==="inline");if(!t&&s.offsetParent){return $(s.offsetParent)}if(s===document.body){return $(s)}while((s=s.parentNode)&&s!==document.body){if(Element.getStyle(s,"position")!=="static"){return(s.nodeName==="HTML")?$(document.body):$(s)}}return $(document.body)}function r(t){var s=0,u=0;do{s+=t.offsetTop||0;u+=t.offsetLeft||0;t=t.offsetParent}while(t);return new Element.Offset(u,s)}function n(t){var u=t.getLayout();var s=0,w=0;do{s+=t.offsetTop||0;w+=t.offsetLeft||0;t=t.offsetParent;if(t){if(k(t)){break}var v=Element.getStyle(t,"position");if(v!=="static"){break}}}while(t);w-=u.get("margin-top");s-=u.get("margin-left");return new Element.Offset(w,s)}function a(t){var s=0,u=0;do{s+=t.scrollTop||0;u+=t.scrollLeft||0;t=t.parentNode}while(t);return new Element.Offset(u,s)}function q(w){var s=0,v=0,u=document.body;var t=w;do{s+=t.offsetTop||0;v+=t.offsetLeft||0;if(t.offsetParent==u&&Element.getStyle(t,"position")=="absolute"){break}}while(t=t.offsetParent);t=w;do{if(t!=u){s-=t.scrollTop||0;v-=t.scrollLeft||0}}while(t=t.parentNode);return new Element.Offset(v,s)}function o(s){s=$(s);if(Element.getStyle(s,"position")==="absolute"){return s}var w=j(s);var v=s.viewportOffset(),t=w.viewportOffset();var x=v.relativeTo(t);var u=s.getLayout();s.store("prototype_absolutize_original_styles",{left:s.getStyle("left"),top:s.getStyle("top"),width:s.getStyle("width"),height:s.getStyle("height")});s.setStyle({position:"absolute",top:x.top+"px",left:x.left+"px",width:u.get("width")+"px",height:u.get("height")+"px"});return s}function h(t){t=$(t);if(Element.getStyle(t,"position")==="relative"){return t}var s=t.retrieve("prototype_absolutize_original_styles");if(s){t.setStyle(s)}return t}Element.addMethods({getLayout:p,measure:b,getDimensions:l,getOffsetParent:j,cumulativeOffset:r,positionedOffset:n,cumulativeScrollOffset:a,viewportOffset:q,absolutize:o,relativize:h});function k(s){return s.nodeName.toUpperCase()==="BODY"}function c(s){return s!==document.body&&!Element.descendantOf(s,document.body)}if("getBoundingClientRect" in document.documentElement){Element.addMethods({viewportOffset:function(s){s=$(s);if(c(s)){return new Element.Offset(0,0)}var t=s.getBoundingClientRect(),u=document.documentElement;return new Element.Offset(t.left-u.clientLeft,t.top-u.clientTop)},positionedOffset:function(t){t=$(t);var v=t.getOffsetParent();if(c(t)){return new Element.Offset(0,0)}if(t.offsetParent&&t.offsetParent.nodeName.toUpperCase()==="HTML"){return n(t)}var x=t.viewportOffset(),u=k(v)?q(v):v.viewportOffset();var s=x.relativeTo(u);var w=t.getLayout();var z=s.top-w.get("margin-top");var y=s.left-w.get("margin-left");return new Element.Offset(y,z)}})}})();window.$$=function(){var a=$A(arguments).join(", ");return Prototype.Selector.select(a,document)};Prototype.Selector=(function(){function a(){throw new Error('Method "Prototype.Selector.select" must be defined.')}function c(){throw new Error('Method "Prototype.Selector.match" must be defined.')}function d(l,m,h){h=h||0;var g=Prototype.Selector.match,k=l.length,f=0,j;for(j=0;j<k;j++){if(g(l[j],m)&&h==f++){return Element.extend(l[j])}}}function e(h){for(var f=0,g=h.length;f<g;f++){Element.extend(h[f])}return h}var b=Prototype.K;return{select:a,match:c,find:d,extendElements:(Element.extend===b)?b:e,extendElement:Element.extend}})();Prototype._original_property=window.Sizzle;
+/*
+ * Sizzle CSS Selector Engine - v1.0
+ *  Copyright 2009, The Dojo Foundation
+ *  Released under the MIT, BSD, and GPL Licenses.
+ *  More information: http://sizzlejs.com/
+ */
+(function(){var q=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,j=0,d=Object.prototype.toString,o=false,i=true;[0,0].sort(function(){i=false;return 0});var b=function(E,u,B,w){B=B||[];var e=u=u||document;if(u.nodeType!==1&&u.nodeType!==9){return[]}if(!E||typeof E!=="string"){return B}var C=[],D,z,I,H,A,t,s=true,x=p(u),G=E;while((q.exec(""),D=q.exec(G))!==null){G=D[3];C.push(D[1]);if(D[2]){t=D[3];break}}if(C.length>1&&k.exec(E)){if(C.length===2&&f.relative[C[0]]){z=g(C[0]+C[1],u)}else{z=f.relative[C[0]]?[u]:b(C.shift(),u);while(C.length){E=C.shift();if(f.relative[E]){E+=C.shift()}z=g(E,z)}}}else{if(!w&&C.length>1&&u.nodeType===9&&!x&&f.match.ID.test(C[0])&&!f.match.ID.test(C[C.length-1])){var J=b.find(C.shift(),u,x);u=J.expr?b.filter(J.expr,J.set)[0]:J.set[0]}if(u){var J=w?{expr:C.pop(),set:a(w)}:b.find(C.pop(),C.length===1&&(C[0]==="~"||C[0]==="+")&&u.parentNode?u.parentNode:u,x);z=J.expr?b.filter(J.expr,J.set):J.set;if(C.length>0){I=a(z)}else{s=false}while(C.length){var v=C.pop(),y=v;if(!f.relative[v]){v=""}else{y=C.pop()}if(y==null){y=u}f.relative[v](I,y,x)}}else{I=C=[]}}if(!I){I=z}if(!I){throw"Syntax error, unrecognized expression: "+(v||E)}if(d.call(I)==="[object Array]"){if(!s){B.push.apply(B,I)}else{if(u&&u.nodeType===1){for(var F=0;I[F]!=null;F++){if(I[F]&&(I[F]===true||I[F].nodeType===1&&h(u,I[F]))){B.push(z[F])}}}else{for(var F=0;I[F]!=null;F++){if(I[F]&&I[F].nodeType===1){B.push(z[F])}}}}}else{a(I,B)}if(t){b(t,e,B,w);b.uniqueSort(B)}return B};b.uniqueSort=function(s){if(c){o=i;s.sort(c);if(o){for(var e=1;e<s.length;e++){if(s[e]===s[e-1]){s.splice(e--,1)}}}}return s};b.matches=function(e,s){return b(e,null,null,s)};b.find=function(y,e,z){var x,v;if(!y){return[]}for(var u=0,t=f.order.length;u<t;u++){var w=f.order[u],v;if((v=f.leftMatch[w].exec(y))){var s=v[1];v.splice(1,1);if(s.substr(s.length-1)!=="\\"){v[1]=(v[1]||"").replace(/\\/g,"");x=f.find[w](v,e,z);if(x!=null){y=y.replace(f.match[w],"");break}}}}if(!x){x=e.getElementsByTagName("*")}return{set:x,expr:y}};b.filter=function(B,A,E,u){var t=B,G=[],y=A,w,e,x=A&&A[0]&&p(A[0]);while(B&&A.length){for(var z in f.filter){if((w=f.match[z].exec(B))!=null){var s=f.filter[z],F,D;e=false;if(y==G){G=[]}if(f.preFilter[z]){w=f.preFilter[z](w,y,E,G,u,x);if(!w){e=F=true}else{if(w===true){continue}}}if(w){for(var v=0;(D=y[v])!=null;v++){if(D){F=s(D,w,v,y);var C=u^!!F;if(E&&F!=null){if(C){e=true}else{y[v]=false}}else{if(C){G.push(D);e=true}}}}}if(F!==undefined){if(!E){y=G}B=B.replace(f.match[z],"");if(!e){return[]}break}}}if(B==t){if(e==null){throw"Syntax error, unrecognized expression: "+B}else{break}}t=B}return y};var f=b.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")}},relative:{"+":function(y,e,x){var v=typeof e==="string",z=v&&!/\W/.test(e),w=v&&!z;if(z&&!x){e=e.toUpperCase()}for(var u=0,t=y.length,s;u<t;u++){if((s=y[u])){while((s=s.previousSibling)&&s.nodeType!==1){}y[u]=w||s&&s.nodeName===e?s||false:s===e}}if(w){b.filter(e,y,true)}},">":function(x,s,y){var v=typeof s==="string";if(v&&!/\W/.test(s)){s=y?s:s.toUpperCase();for(var t=0,e=x.length;t<e;t++){var w=x[t];if(w){var u=w.parentNode;x[t]=u.nodeName===s?u:false}}}else{for(var t=0,e=x.length;t<e;t++){var w=x[t];if(w){x[t]=v?w.parentNode:w.parentNode===s}}if(v){b.filter(s,x,true)}}},"":function(u,s,w){var t=j++,e=r;if(!/\W/.test(s)){var v=s=w?s:s.toUpperCase();e=n}e("parentNode",s,t,u,v,w)},"~":function(u,s,w){var t=j++,e=r;if(typeof s==="string"&&!/\W/.test(s)){var v=s=w?s:s.toUpperCase();e=n}e("previousSibling",s,t,u,v,w)}},find:{ID:function(s,t,u){if(typeof t.getElementById!=="undefined"&&!u){var e=t.getElementById(s[1]);return e?[e]:[]}},NAME:function(t,w,x){if(typeof w.getElementsByName!=="undefined"){var s=[],v=w.getElementsByName(t[1]);for(var u=0,e=v.length;u<e;u++){if(v[u].getAttribute("name")===t[1]){s.push(v[u])}}return s.length===0?null:s}},TAG:function(e,s){return s.getElementsByTagName(e[1])}},preFilter:{CLASS:function(u,s,t,e,x,y){u=" "+u[1].replace(/\\/g,"")+" ";if(y){return u}for(var v=0,w;(w=s[v])!=null;v++){if(w){if(x^(w.className&&(" "+w.className+" ").indexOf(u)>=0)){if(!t){e.push(w)}}else{if(t){s[v]=false}}}}return false},ID:function(e){return e[1].replace(/\\/g,"")},TAG:function(s,e){for(var t=0;e[t]===false;t++){}return e[t]&&p(e[t])?s[1]:s[1].toUpperCase()},CHILD:function(e){if(e[1]=="nth"){var s=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(e[2]=="even"&&"2n"||e[2]=="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(s[1]+(s[2]||1))-0;e[3]=s[3]-0}e[0]=j++;return e},ATTR:function(v,s,t,e,w,x){var u=v[1].replace(/\\/g,"");if(!x&&f.attrMap[u]){v[1]=f.attrMap[u]}if(v[2]==="~="){v[4]=" "+v[4]+" "}return v},PSEUDO:function(v,s,t,e,w){if(v[1]==="not"){if((q.exec(v[3])||"").length>1||/^\w/.test(v[3])){v[3]=b(v[3],null,null,s)}else{var u=b.filter(v[3],s,t,true^w);if(!t){e.push.apply(e,u)}return false}}else{if(f.match.POS.test(v[0])||f.match.CHILD.test(v[0])){return true}}return v},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){e.parentNode.selectedIndex;return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(t,s,e){return !!b(e[3],t).length},header:function(e){return/h\d/i.test(e.nodeName)},text:function(e){return"text"===e.type},radio:function(e){return"radio"===e.type},checkbox:function(e){return"checkbox"===e.type},file:function(e){return"file"===e.type},password:function(e){return"password"===e.type},submit:function(e){return"submit"===e.type},image:function(e){return"image"===e.type},reset:function(e){return"reset"===e.type},button:function(e){return"button"===e.type||e.nodeName.toUpperCase()==="BUTTON"},input:function(e){return/input|select|textarea|button/i.test(e.nodeName)}},setFilters:{first:function(s,e){return e===0},last:function(t,s,e,u){return s===u.length-1},even:function(s,e){return e%2===0},odd:function(s,e){return e%2===1},lt:function(t,s,e){return s<e[3]-0},gt:function(t,s,e){return s>e[3]-0},nth:function(t,s,e){return e[3]-0==s},eq:function(t,s,e){return e[3]-0==s}},filter:{PSEUDO:function(x,t,u,y){var s=t[1],v=f.filters[s];if(v){return v(x,u,t,y)}else{if(s==="contains"){return(x.textContent||x.innerText||"").indexOf(t[3])>=0}else{if(s==="not"){var w=t[3];for(var u=0,e=w.length;u<e;u++){if(w[u]===x){return false}}return true}}}},CHILD:function(e,u){var x=u[1],s=e;switch(x){case"only":case"first":while((s=s.previousSibling)){if(s.nodeType===1){return false}}if(x=="first"){return true}s=e;case"last":while((s=s.nextSibling)){if(s.nodeType===1){return false}}return true;case"nth":var t=u[2],A=u[3];if(t==1&&A==0){return true}var w=u[0],z=e.parentNode;if(z&&(z.sizcache!==w||!e.nodeIndex)){var v=0;for(s=z.firstChild;s;s=s.nextSibling){if(s.nodeType===1){s.nodeIndex=++v}}z.sizcache=w}var y=e.nodeIndex-A;if(t==0){return y==0}else{return(y%t==0&&y/t>=0)}}},ID:function(s,e){return s.nodeType===1&&s.getAttribute("id")===e},TAG:function(s,e){return(e==="*"&&s.nodeType===1)||s.nodeName===e},CLASS:function(s,e){return(" "+(s.className||s.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(w,u){var t=u[1],e=f.attrHandle[t]?f.attrHandle[t](w):w[t]!=null?w[t]:w.getAttribute(t),x=e+"",v=u[2],s=u[4];return e==null?v==="!=":v==="="?x===s:v==="*="?x.indexOf(s)>=0:v==="~="?(" "+x+" ").indexOf(s)>=0:!s?x&&e!==false:v==="!="?x!=s:v==="^="?x.indexOf(s)===0:v==="$="?x.substr(x.length-s.length)===s:v==="|="?x===s||x.substr(0,s.length+1)===s+"-":false},POS:function(v,s,t,w){var e=s[2],u=f.setFilters[e];if(u){return u(v,t,s,w)}}}};var k=f.match.POS;for(var m in f.match){f.match[m]=new RegExp(f.match[m].source+/(?![^\[]*\])(?![^\(]*\))/.source);f.leftMatch[m]=new RegExp(/(^(?:.|\r|\n)*?)/.source+f.match[m].source)}var a=function(s,e){s=Array.prototype.slice.call(s,0);if(e){e.push.apply(e,s);return e}return s};try{Array.prototype.slice.call(document.documentElement.childNodes,0)}catch(l){a=function(v,u){var s=u||[];if(d.call(v)==="[object Array]"){Array.prototype.push.apply(s,v)}else{if(typeof v.length==="number"){for(var t=0,e=v.length;t<e;t++){s.push(v[t])}}else{for(var t=0;v[t];t++){s.push(v[t])}}}return s}}var c;if(document.documentElement.compareDocumentPosition){c=function(s,e){if(!s.compareDocumentPosition||!e.compareDocumentPosition){if(s==e){o=true}return 0}var t=s.compareDocumentPosition(e)&4?-1:s===e?0:1;if(t===0){o=true}return t}}else{if("sourceIndex" in document.documentElement){c=function(s,e){if(!s.sourceIndex||!e.sourceIndex){if(s==e){o=true}return 0}var t=s.sourceIndex-e.sourceIndex;if(t===0){o=true}return t}}else{if(document.createRange){c=function(u,s){if(!u.ownerDocument||!s.ownerDocument){if(u==s){o=true}return 0}var t=u.ownerDocument.createRange(),e=s.ownerDocument.createRange();t.setStart(u,0);t.setEnd(u,0);e.setStart(s,0);e.setEnd(s,0);var v=t.compareBoundaryPoints(Range.START_TO_END,e);if(v===0){o=true}return v}}}}(function(){var s=document.createElement("div"),t="script"+(new Date).getTime();s.innerHTML="<a name='"+t+"'/>";var e=document.documentElement;e.insertBefore(s,e.firstChild);if(!!document.getElementById(t)){f.find.ID=function(v,w,x){if(typeof w.getElementById!=="undefined"&&!x){var u=w.getElementById(v[1]);return u?u.id===v[1]||typeof u.getAttributeNode!=="undefined"&&u.getAttributeNode("id").nodeValue===v[1]?[u]:undefined:[]}};f.filter.ID=function(w,u){var v=typeof w.getAttributeNode!=="undefined"&&w.getAttributeNode("id");return w.nodeType===1&&v&&v.nodeValue===u}}e.removeChild(s);e=s=null})();(function(){var e=document.createElement("div");e.appendChild(document.createComment(""));if(e.getElementsByTagName("*").length>0){f.find.TAG=function(s,w){var v=w.getElementsByTagName(s[1]);if(s[1]==="*"){var u=[];for(var t=0;v[t];t++){if(v[t].nodeType===1){u.push(v[t])}}v=u}return v}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){f.attrHandle.href=function(s){return s.getAttribute("href",2)}}e=null})();if(document.querySelectorAll){(function(){var e=b,t=document.createElement("div");t.innerHTML="<p class='TEST'></p>";if(t.querySelectorAll&&t.querySelectorAll(".TEST").length===0){return}b=function(x,w,u,v){w=w||document;if(!v&&w.nodeType===9&&!p(w)){try{return a(w.querySelectorAll(x),u)}catch(y){}}return e(x,w,u,v)};for(var s in e){b[s]=e[s]}t=null})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var e=document.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}f.order.splice(1,0,"CLASS");f.find.CLASS=function(s,t,u){if(typeof t.getElementsByClassName!=="undefined"&&!u){return t.getElementsByClassName(s[1])}};e=null})()}function n(s,x,w,B,y,A){var z=s=="previousSibling"&&!A;for(var u=0,t=B.length;u<t;u++){var e=B[u];if(e){if(z&&e.nodeType===1){e.sizcache=w;e.sizset=u}e=e[s];var v=false;while(e){if(e.sizcache===w){v=B[e.sizset];break}if(e.nodeType===1&&!A){e.sizcache=w;e.sizset=u}if(e.nodeName===x){v=e;break}e=e[s]}B[u]=v}}}function r(s,x,w,B,y,A){var z=s=="previousSibling"&&!A;for(var u=0,t=B.length;u<t;u++){var e=B[u];if(e){if(z&&e.nodeType===1){e.sizcache=w;e.sizset=u}e=e[s];var v=false;while(e){if(e.sizcache===w){v=B[e.sizset];break}if(e.nodeType===1){if(!A){e.sizcache=w;e.sizset=u}if(typeof x!=="string"){if(e===x){v=true;break}}else{if(b.filter(x,[e]).length>0){v=e;break}}}e=e[s]}B[u]=v}}}var h=document.compareDocumentPosition?function(s,e){return s.compareDocumentPosition(e)&16}:function(s,e){return s!==e&&(s.contains?s.contains(e):true)};var p=function(e){return e.nodeType===9&&e.documentElement.nodeName!=="HTML"||!!e.ownerDocument&&e.ownerDocument.documentElement.nodeName!=="HTML"};var g=function(e,y){var u=[],v="",w,t=y.nodeType?[y]:y;while((w=f.match.PSEUDO.exec(e))){v+=w[0];e=e.replace(f.match.PSEUDO,"")}e=f.relative[e]?e+"*":e;for(var x=0,s=t.length;x<s;x++){b(e,t[x],u)}return b.filter(v,u)};window.Sizzle=b})();(function(c){var d=Prototype.Selector.extendElements;function a(e,f){return d(c(e,f||document))}function b(f,e){return c.matches(e,[f]).length==1}Prototype.Selector.engine=c;Prototype.Selector.select=a;Prototype.Selector.match=b})(Sizzle);window.Sizzle=Prototype._original_property;delete Prototype._original_property;var Form={reset:function(a){a=$(a);a.reset();return a},serializeElements:function(h,d){if(typeof d!="object"){d={hash:!!d}}else{if(Object.isUndefined(d.hash)){d.hash=true}}var e,g,a=false,f=d.submit,b,c;if(d.hash){c={};b=function(i,j,k){if(j in i){if(!Object.isArray(i[j])){i[j]=[i[j]]}i[j].push(k)}else{i[j]=k}return i}}else{c="";b=function(i,j,k){return i+(i?"&":"")+encodeURIComponent(j)+"="+encodeURIComponent(k)}}return h.inject(c,function(i,j){if(!j.disabled&&j.name){e=j.name;g=$(j).getValue();if(g!=null&&j.type!="file"&&(j.type!="submit"||(!a&&f!==false&&(!f||e==f)&&(a=true)))){i=b(i,e,g)}}return i})}};Form.Methods={serialize:function(b,a){return Form.serializeElements(Form.getElements(b),a)},getElements:function(e){var f=$(e).getElementsByTagName("*"),d,a=[],c=Form.Element.Serializers;for(var b=0;d=f[b];b++){a.push(d)}return a.inject([],function(g,h){if(c[h.tagName.toLowerCase()]){g.push(Element.extend(h))}return g})},getInputs:function(g,c,d){g=$(g);var a=g.getElementsByTagName("input");if(!c&&!d){return $A(a).map(Element.extend)}for(var e=0,h=[],f=a.length;e<f;e++){var b=a[e];if((c&&b.type!=c)||(d&&b.name!=d)){continue}h.push(Element.extend(b))}return h},disable:function(a){a=$(a);Form.getElements(a).invoke("disable");return a},enable:function(a){a=$(a);Form.getElements(a).invoke("enable");return a},findFirstElement:function(b){var c=$(b).getElements().findAll(function(d){return"hidden"!=d.type&&!d.disabled});var a=c.findAll(function(d){return d.hasAttribute("tabIndex")&&d.tabIndex>=0}).sortBy(function(d){return d.tabIndex}).first();return a?a:c.find(function(d){return/^(?:input|select|textarea)$/i.test(d.tagName)})},focusFirstElement:function(a){a=$(a);a.findFirstElement().activate();return a},request:function(b,a){b=$(b),a=Object.clone(a||{});var d=a.parameters,c=b.readAttribute("action")||"";if(c.blank()){c=window.location.href}a.parameters=b.serialize(true);if(d){if(Object.isString(d)){d=d.toQueryParams()}Object.extend(a.parameters,d)}if(b.hasAttribute("method")&&!a.method){a.method=b.method}return new Ajax.Request(c,a)}};Form.Element={focus:function(a){$(a).focus();return a},select:function(a){$(a).select();return a}};Form.Element.Methods={serialize:function(a){a=$(a);if(!a.disabled&&a.name){var b=a.getValue();if(b!=undefined){var c={};c[a.name]=b;return Object.toQueryString(c)}}return""},getValue:function(a){a=$(a);var b=a.tagName.toLowerCase();return Form.Element.Serializers[b](a)},setValue:function(a,b){a=$(a);var c=a.tagName.toLowerCase();Form.Element.Serializers[c](a,b);return a},clear:function(a){$(a).value="";return a},present:function(a){return $(a).value!=""},activate:function(a){a=$(a);try{a.focus();if(a.select&&(a.tagName.toLowerCase()!="input"||!(/^(?:button|reset|submit)$/i.test(a.type)))){a.select()}}catch(b){}return a},disable:function(a){a=$(a);a.disabled=true;return a},enable:function(a){a=$(a);a.disabled=false;return a}};var Field=Form.Element;var $F=Form.Element.Methods.getValue;Form.Element.Serializers={input:function(a,b){switch(a.type.toLowerCase()){case"checkbox":case"radio":return Form.Element.Serializers.inputSelector(a,b);default:return Form.Element.Serializers.textarea(a,b)}},inputSelector:function(a,b){if(Object.isUndefined(b)){return a.checked?a.value:null}else{a.checked=!!b}},textarea:function(a,b){if(Object.isUndefined(b)){return a.value}else{a.value=b}},select:function(c,f){if(Object.isUndefined(f)){return this[c.type=="select-one"?"selectOne":"selectMany"](c)}else{var b,d,g=!Object.isArray(f);for(var a=0,e=c.length;a<e;a++){b=c.options[a];d=this.optionValue(b);if(g){if(d==f){b.selected=true;return}}else{b.selected=f.include(d)}}}},selectOne:function(b){var a=b.selectedIndex;return a>=0?this.optionValue(b.options[a]):null},selectMany:function(d){var a,e=d.length;if(!e){return null}for(var c=0,a=[];c<e;c++){var b=d.options[c];if(b.selected){a.push(this.optionValue(b))}}return a},optionValue:function(a){return Element.extend(a).hasAttribute("value")?a.value:a.text}};Abstract.TimedObserver=Class.create(PeriodicalExecuter,{initialize:function($super,a,b,c){$super(c,b);this.element=$(a);this.lastValue=this.getValue()},execute:function(){var a=this.getValue();if(Object.isString(this.lastValue)&&Object.isString(a)?this.lastValue!=a:String(this.lastValue)!=String(a)){this.callback(this.element,a);this.lastValue=a}}});Form.Element.Observer=Class.create(Abstract.TimedObserver,{getValue:function(){return Form.Element.getValue(this.element)}});Form.Observer=Class.create(Abstract.TimedObserver,{getValue:function(){return Form.serialize(this.element)}});Abstract.EventObserver=Class.create({initialize:function(a,b){this.element=$(a);this.callback=b;this.lastValue=this.getValue();if(this.element.tagName.toLowerCase()=="form"){this.registerFormCallbacks()}else{this.registerCallback(this.element)}},onElementEvent:function(){var a=this.getValue();if(this.lastValue!=a){this.callback(this.element,a);this.lastValue=a}},registerFormCallbacks:function(){Form.getElements(this.element).each(this.registerCallback,this)},registerCallback:function(a){if(a.type){switch(a.type.toLowerCase()){case"checkbox":case"radio":Event.observe(a,"click",this.onElementEvent.bind(this));break;default:Event.observe(a,"change",this.onElementEvent.bind(this));break}}}});Form.Element.EventObserver=Class.create(Abstract.EventObserver,{getValue:function(){return Form.Element.getValue(this.element)}});Form.EventObserver=Class.create(Abstract.EventObserver,{getValue:function(){return Form.serialize(this.element)}});(function(){var x={KEY_BACKSPACE:8,KEY_TAB:9,KEY_RETURN:13,KEY_ESC:27,KEY_LEFT:37,KEY_UP:38,KEY_RIGHT:39,KEY_DOWN:40,KEY_DELETE:46,KEY_HOME:36,KEY_END:35,KEY_PAGEUP:33,KEY_PAGEDOWN:34,KEY_INSERT:45,cache:{}};var e=document.documentElement;var y="onmouseenter" in e&&"onmouseleave" in e;var q;if(Prototype.Browser.IE){var i={0:1,1:4,2:2};q=function(A,z){return A.button===i[z]}}else{if(Prototype.Browser.WebKit){q=function(A,z){switch(z){case 0:return A.which==1&&!A.metaKey;case 1:return A.which==1&&A.metaKey;default:return false}}}else{q=function(A,z){return A.which?(A.which===z+1):(A.button===z)}}}function t(z){return q(z,0)}function s(z){return q(z,1)}function m(z){return q(z,2)}function c(B){B=x.extend(B);var A=B.target,z=B.type,C=B.currentTarget;if(C&&C.tagName){if(z==="load"||z==="error"||(z==="click"&&C.tagName.toLowerCase()==="input"&&C.type==="radio")){A=C}}if(A.nodeType==Node.TEXT_NODE){A=A.parentNode}return Element.extend(A)}function o(A,B){var z=x.element(A);if(!B){return z}while(z){if(Object.isElement(z)&&Prototype.Selector.match(z,B)){return Element.extend(z)}z=z.parentNode}}function r(z){return{x:b(z),y:a(z)}}function b(B){var A=document.documentElement,z=document.body||{scrollLeft:0};return B.pageX||(B.clientX+(A.scrollLeft||z.scrollLeft)-(A.clientLeft||0))}function a(B){var A=document.documentElement,z=document.body||{scrollTop:0};return B.pageY||(B.clientY+(A.scrollTop||z.scrollTop)-(A.clientTop||0))}function p(z){x.extend(z);z.preventDefault();z.stopPropagation();z.stopped=true}x.Methods={isLeftClick:t,isMiddleClick:s,isRightClick:m,element:c,findElement:o,pointer:r,pointerX:b,pointerY:a,stop:p};var v=Object.keys(x.Methods).inject({},function(z,A){z[A]=x.Methods[A].methodize();return z});if(Prototype.Browser.IE){function h(A){var z;switch(A.type){case"mouseover":z=A.fromElement;break;case"mouseout":z=A.toElement;break;default:return null}return Element.extend(z)}Object.extend(v,{stopPropagation:function(){this.cancelBubble=true},preventDefault:function(){this.returnValue=false},inspect:function(){return"[object Event]"}});x.extend=function(A,z){if(!A){return false}if(A._extendedByPrototype){return A}A._extendedByPrototype=Prototype.emptyFunction;var B=x.pointer(A);Object.extend(A,{target:A.srcElement||z,relatedTarget:h(A),pageX:B.x,pageY:B.y});return Object.extend(A,v)}}else{x.prototype=window.Event.prototype||document.createEvent("HTMLEvents").__proto__;Object.extend(x.prototype,v);x.extend=Prototype.K}function n(D,C,E){var B=Element.retrieve(D,"prototype_event_registry");if(Object.isUndefined(B)){d.push(D);B=Element.retrieve(D,"prototype_event_registry",$H())}var z=B.get(C);if(Object.isUndefined(z)){z=[];B.set(C,z)}if(z.pluck("handler").include(E)){return false}var A;if(C.include(":")){A=function(F){if(Object.isUndefined(F.eventName)){return false}if(F.eventName!==C){return false}x.extend(F,D);E.call(D,F)}}else{if(!y&&(C==="mouseenter"||C==="mouseleave")){if(C==="mouseenter"||C==="mouseleave"){A=function(G){x.extend(G,D);var F=G.relatedTarget;while(F&&F!==D){try{F=F.parentNode}catch(H){F=D}}if(F===D){return}E.call(D,G)}}}else{A=function(F){x.extend(F,D);E.call(D,F)}}}A.handler=E;z.push(A);return A}function g(){for(var z=0,A=d.length;z<A;z++){x.stopObserving(d[z]);d[z]=null}}var d=[];if(Prototype.Browser.IE){window.attachEvent("onunload",g)}if(Prototype.Browser.WebKit){window.addEventListener("unload",Prototype.emptyFunction,false)}var l=Prototype.K,f={mouseenter:"mouseover",mouseleave:"mouseout"};if(!y){l=function(z){return(f[z]||z)}}function u(C,B,D){C=$(C);var A=n(C,B,D);if(!A){return C}if(B.include(":")){if(C.addEventListener){C.addEventListener("dataavailable",A,false)}else{C.attachEvent("ondataavailable",A);C.attachEvent("onlosecapture",A)}}else{var z=l(B);if(C.addEventListener){C.addEventListener(z,A,false)}else{C.attachEvent("on"+z,A)}}return C}function k(E,C,F){E=$(E);var B=Element.retrieve(E,"prototype_event_registry");if(!B){return E}if(!C){B.each(function(H){var G=H.key;k(E,G)});return E}var D=B.get(C);if(!D){return E}if(!F){D.each(function(G){k(E,C,G.handler)});return E}var A=D.find(function(G){return G.handler===F});if(!A){return E}if(C.include(":")){if(E.removeEventListener){E.removeEventListener("dataavailable",A,false)}else{E.detachEvent("ondataavailable",A);E.detachEvent("onlosecapture",A)}}else{var z=l(C);if(E.removeEventListener){E.removeEventListener(z,A,false)}else{E.detachEvent("on"+z,A)}}B.set(C,D.without(A));return E}function w(C,B,A,z){C=$(C);if(Object.isUndefined(z)){z=true}if(C==document&&document.createEvent&&!C.dispatchEvent){C=document.documentElement}var D;if(document.createEvent){D=document.createEvent("HTMLEvents");D.initEvent("dataavailable",z,true)}else{D=document.createEventObject();D.eventType=z?"ondataavailable":"onlosecapture"}D.eventName=B;D.memo=A||{};if(document.createEvent){C.dispatchEvent(D)}else{C.fireEvent(D.eventType,D)}return x.extend(D)}x.Handler=Class.create({initialize:function(B,A,z,C){this.element=$(B);this.eventName=A;this.selector=z;this.callback=C;this.handler=this.handleEvent.bind(this)},start:function(){x.observe(this.element,this.eventName,this.handler);return this},stop:function(){x.stopObserving(this.element,this.eventName,this.handler);return this},handleEvent:function(A){var z=A.findElement(this.selector);if(z){this.callback.call(this.element,A,z)}}});function j(B,A,z,C){B=$(B);if(Object.isFunction(z)&&Object.isUndefined(C)){C=z,z=null}return new x.Handler(B,A,z,C).start()}Object.extend(x,x.Methods);Object.extend(x,{fire:w,observe:u,stopObserving:k,on:j});Element.addMethods({fire:w,observe:u,stopObserving:k,on:j});Object.extend(document,{fire:w.methodize(),observe:u.methodize(),stopObserving:k.methodize(),on:j.methodize(),loaded:false});if(window.Event){Object.extend(window.Event,x)}else{window.Event=x}})();(function(){var d;function a(){if(document.loaded){return}if(d){window.clearTimeout(d)}document.loaded=true;document.fire("dom:loaded")}function c(){if(document.readyState==="complete"){document.stopObserving("readystatechange",c);a()}}function b(){try{document.documentElement.doScroll("left")}catch(f){d=b.defer();return}a()}if(document.addEventListener){document.addEventListener("DOMContentLoaded",a,false)}else{document.observe("readystatechange",c);if(window==top){d=b.defer()}}Event.observe(window,"load",a)})();Element.addMethods();Hash.toQueryString=Object.toQueryString;var Toggle={display:Element.toggle};Element.Methods.childOf=Element.Methods.descendantOf;var Insertion={Before:function(a,b){return Element.insert(a,{before:b})},Top:function(a,b){return Element.insert(a,{top:b})},Bottom:function(a,b){return Element.insert(a,{bottom:b})},After:function(a,b){return Element.insert(a,{after:b})}};var $continue=new Error('"throw $continue" is deprecated, use "return" instead');var Position={includeScrollOffsets:false,prepare:function(){this.deltaX=window.pageXOffset||document.documentElement.scrollLeft||document.body.scrollLeft||0;this.deltaY=window.pageYOffset||document.documentElement.scrollTop||document.body.scrollTop||0},within:function(b,a,c){if(this.includeScrollOffsets){return this.withinIncludingScrolloffsets(b,a,c)}this.xcomp=a;this.ycomp=c;this.offset=Element.cumulativeOffset(b);return(c>=this.offset[1]&&c<this.offset[1]+b.offsetHeight&&a>=this.offset[0]&&a<this.offset[0]+b.offsetWidth)},withinIncludingScrolloffsets:function(b,a,d){var c=Element.cumulativeScrollOffset(b);this.xcomp=a+c[0]-this.deltaX;this.ycomp=d+c[1]-this.deltaY;this.offset=Element.cumulativeOffset(b);return(this.ycomp>=this.offset[1]&&this.ycomp<this.offset[1]+b.offsetHeight&&this.xcomp>=this.offset[0]&&this.xcomp<this.offset[0]+b.offsetWidth)},overlap:function(b,a){if(!b){return 0}if(b=="vertical"){return((this.offset[1]+a.offsetHeight)-this.ycomp)/a.offsetHeight}if(b=="horizontal"){return((this.offset[0]+a.offsetWidth)-this.xcomp)/a.offsetWidth}},cumulativeOffset:Element.Methods.cumulativeOffset,positionedOffset:Element.Methods.positionedOffset,absolutize:function(a){Position.prepare();return Element.absolutize(a)},relativize:function(a){Position.prepare();return Element.relativize(a)},realOffset:Element.Methods.cumulativeScrollOffset,offsetParent:Element.Methods.getOffsetParent,page:Element.Methods.viewportOffset,clone:function(b,c,a){a=a||{};return Element.clonePosition(c,b,a)}};if(!document.getElementsByClassName){document.getElementsByClassName=function(b){function a(c){return c.blank()?null:"[contains(concat(' ', @class, ' '), ' "+c+" ')]"}b.getElementsByClassName=Prototype.BrowserFeatures.XPath?function(c,e){e=e.toString().strip();var d=/\s/.test(e)?$w(e).map(a).join(""):a(e);return d?document._getElementsByXPath(".//*"+d,c):[]}:function(e,f){f=f.toString().strip();var g=[],h=(/\s/.test(f)?$w(f):null);if(!h&&!f){return g}var c=$(e).getElementsByTagName("*");f=" "+f+" ";for(var d=0,k,j;k=c[d];d++){if(k.className&&(j=" "+k.className+" ")&&(j.include(f)||(h&&h.all(function(i){return !i.toString().blank()&&j.include(" "+i+" ")})))){g.push(Element.extend(k))}}return g};return function(d,c){return $(c||document.body).getElementsByClassName(d)}}(Element.Methods)}Element.ClassNames=Class.create();Element.ClassNames.prototype={initialize:function(a){this.element=$(a)},_each:function(a){this.element.className.split(/\s+/).select(function(b){return b.length>0})._each(a)},set:function(a){this.element.className=a},add:function(a){if(this.include(a)){return}this.set($A(this).concat(a).join(" "))},remove:function(a){if(!this.include(a)){return}this.set($A(this).without(a).join(" "))},toString:function(){return $A(this).join(" ")}};Object.extend(Element.ClassNames.prototype,Enumerable);(function(){window.Selector=Class.create({initialize:function(a){this.expression=a.strip()},findElements:function(a){return Prototype.Selector.select(this.expression,a)},match:function(a){return Prototype.Selector.match(a,this.expression)},toString:function(){return this.expression},inspect:function(){return"#<Selector: "+this.expression+">"}});Object.extend(Selector,{matchElements:function(f,g){var a=Prototype.Selector.match,d=[];for(var c=0,e=f.length;c<e;c++){var b=f[c];if(a(b,g)){d.push(Element.extend(b))}}return d},findElement:function(f,g,b){b=b||0;var a=0,d;for(var c=0,e=f.length;c<e;c++){d=f[c];if(Prototype.Selector.match(d,g)&&b===a++){return Element.extend(d)}}},findChildElements:function(b,c){var a=c.toArray().join(", ");return Prototype.Selector.select(a,b||document)}})})();
+/*
+ *  script.aculo.us version 2.0.0_a6
+ *  (c) 2005-2010 Thomas Fuchs
+ *
+ *  script.aculo.us is freely distributable under the terms of an MIT-style license.
+ *----------------------------------------------------------------------------------*/
+var S2={Version:"2.0.0_a6",Extensions:{}};Function.prototype.optionize=function(){var a=this,c=a.argumentNames(),b=this.length-1;var d=function(){var f=$A(arguments);var e=(typeof f.last()==="object")?f.pop():{};var g=[];if(b>0){g=((f.length>0?f:[null]).inGroupsOf(b).flatten()).concat(e)}return a.apply(this,g)};d.argumentNames=function(){return c};return d};Function.ABSTRACT=function(){throw"Abstract method. Implement in subclass."};Object.extend(Number.prototype,{constrain:function(e,d){var c=(e<d)?e:d;var a=(e<d)?d:e;var b=Number(this);if(b<c){b=c}if(b>a){b=a}return b},nearer:function(c,b){var a=Number(this);var e=Math.abs(a-c);var d=Math.abs(a-b);return(e<d)?c:b},tween:function(b,a){return this+(b-this)*a}});Object.propertize=function(b,a){return Object.isString(b)?a[b]:b};S2.CSS={PROPERTY_MAP:{backgroundColor:"color",borderBottomColor:"color",borderBottomWidth:"length",borderLeftColor:"color",borderLeftWidth:"length",borderRightColor:"color",borderRightWidth:"length",borderSpacing:"length",borderTopColor:"color",borderTopWidth:"length",bottom:"length",color:"color",fontSize:"length",fontWeight:"integer",height:"length",left:"length",letterSpacing:"length",lineHeight:"length",marginBottom:"length",marginLeft:"length",marginRight:"length",marginTop:"length",maxHeight:"length",maxWidth:"length",minHeight:"length",minWidth:"length",opacity:"number",outlineColor:"color",outlineOffset:"length",outlineWidth:"length",paddingBottom:"length",paddingLeft:"length",paddingRight:"length",paddingTop:"length",right:"length",textIndent:"length",top:"length",width:"length",wordSpacing:"length",zIndex:"integer",zoom:"number"},VENDOR_MAP:{webkit:{DEFAULT:$w("border-radius box-shadow transform transition transition-duration transition-timing-function transition-property transition-delay border-top-left-radius border-top-right-radius border-bottom-left-radius border-bottom-right-radius")},moz:{DEFAULT:$w("border-radius box-shadow transform transition transition-duration transition-timing-function transition-property transition-delay "),"border-top-left-radius":"-moz-border-radius-topleft","border-top-right-radius":"-moz-border-radius-topright","border-bottom-left-radius":"-moz-border-radius-bottomleft","border-bottom-right-radius":"-moz-border-radius-bottomright"},o:{}},VENDOR_PREFIX:null,LENGTH:/^(([\+\-]?[0-9\.]+)(em|ex|px|in|cm|mm|pt|pc|\%))|0$/,NUMBER:/([\+-]*\d+\.?\d*)/,__parseStyleElement:document.createElement("div"),parseStyle:function(a){S2.CSS.__parseStyleElement.innerHTML='<div style="'+a+'"></div>';var c=S2.CSS.__parseStyleElement.childNodes[0].style,b={};S2.CSS.NUMERIC_PROPERTIES.each(function(d){if(c[d]){b[d]=c[d]}});S2.CSS.COLOR_PROPERTIES.each(function(d){if(c[d]){b[d]=S2.CSS.colorFromString(c[d])}});if(Prototype.Browser.IE&&a.include("opacity")){b.opacity=a.match(/opacity:\s*((?:0|1)?(?:\.\d*)?)/)[1]}return b},parse:function(a){return S2.CSS.parseStyle(a)},normalize:function(b,c){if(Object.isHash(c)){c=c.toObject()}if(typeof c==="string"){c=S2.CSS.parseStyle(c)}var a={},e;for(var d in c){e=b.getStyle(d);if(c[d]!==e){a[d]=c[d]}}return a},serialize:function(b){if(Object.isHash(b)){b=b.toObject()}var a="",d;for(var c in b){d=b[c];c=this.vendorizeProperty(c);a+=(c+": "+d+";")}return a},vendorizeProperty:function(c){var b=S2.CSS.VENDOR_PREFIX;c=c.underscore().dasherize();if(b){var a=S2.CSS.VENDOR_MAP[b.toLowerCase()];if(a.DEFAULT.include(c)){c=b+"-"+c}else{if(a[c]){c=a[c]}}}if(c.match(/^(?:webkit|moz|ms|o|khtml)-/)){c="-"+c}return c},normalizeColor:function(a){if(!a||a=="rgba(0, 0, 0, 0)"||a=="transparent"){a="#ffffff"}a=S2.CSS.colorFromString(a);return[parseInt(a.slice(1,3),16),parseInt(a.slice(3,5),16),parseInt(a.slice(5,7),16)]},colorFromString:function(a){var c="#",d,b;if(a.slice(0,4)=="rgb("){d=a.slice(4,a.length-1).split(",");b=3;while(b--){c+=parseInt(d[2-b]).toColorPart()}}else{if(a.slice(0,1)=="#"){if(a.length==4){for(b=1;b<4;b++){c+=(a.charAt(b)+a.charAt(b)).toLowerCase()}}if(a.length==7){c=a.toLowerCase()}}else{c=a}}return(c.length==7?c:(arguments[1]||c))},interpolateColor:function(c,b,a){c=S2.CSS.normalizeColor(c);b=S2.CSS.normalizeColor(b);return"#"+[0,1,2].map(function(d){return Math.max(Math.min(c[d].tween(b[d],a).round(),255),0).toColorPart()}).join("")},interpolateNumber:function(c,b,a){return 1*((c||0).tween(b,a).toFixed(3))},interpolateLength:function(c,b,a){if(!c||parseFloat(c)===0){c="0"+b.gsub(S2.CSS.NUMBER,"")}b.scan(S2.CSS.NUMBER,function(d){b=1*(d[1])});return c.gsub(S2.CSS.NUMBER,function(d){return(1*(parseFloat(d[1]).tween(b,a).toFixed(3))).toString()})},interpolateInteger:function(c,b,a){return parseInt(c).tween(b,a).round()},interpolate:function(b,d,c,a){return S2.CSS["interpolate"+S2.CSS.PROPERTY_MAP[b.camelize()].capitalize()](d,c,a)},ElementMethods:{getStyles:function(b){var a=document.defaultView.getComputedStyle($(b),null);return S2.CSS.PROPERTIES.inject({},function(c,d){c[d]=a[d];return c})}}};S2.CSS.PROPERTIES=[];for(var property in S2.CSS.PROPERTY_MAP){S2.CSS.PROPERTIES.push(property)}S2.CSS.NUMERIC_PROPERTIES=S2.CSS.PROPERTIES.findAll(function(a){return !a.endsWith("olor")});S2.CSS.COLOR_PROPERTIES=S2.CSS.PROPERTIES.findAll(function(a){return a.endsWith("olor")});if(!(document.defaultView&&document.defaultView.getComputedStyle)){S2.CSS.ElementMethods.getStyles=function(b){b=$(b);var a=b.currentStyle,c;c=S2.CSS.PROPERTIES.inject({},function(e,d){e[d]=a[d];return e});if(!c.opacity){c.opacity=b.getOpacity()}return c}}Element.addMethods(S2.CSS.ElementMethods);(function(){var d=document.createElement("div");var a=d.style,c=$w("webkit Moz");var b=c.detect(function(e){return typeof a[e+"BorderRadius"]!=="undefined"});S2.CSS.VENDOR_PREFIX=b;d=null})();S2.FX=(function(){var c=[],g,f,e=0;function d(i){e+=i;if(e>0){f.start()}else{f.stop()}}function b(){var l=f.getTimestamp();for(var k=0,j;j=c[k];k++){j.render(l)}}function a(i){if(g){return}c.push(g=new S2.FX.Queue());S2.FX.DefaultOptions.queue=g;f=i||new S2.FX.Heartbeat();document.observe("effect:heartbeat",b).observe("effect:queued",d.curry(1)).observe("effect:dequeued",d.curry(-1))}function h(i){if(!i){i=(new Date()).valueOf()}var j=new Date(i);return j.getSeconds()+"."+j.getMilliseconds()+"s"}return{initialize:a,getQueues:function(){return c},addQueue:function(i){c.push(i)},getHeartbeat:function(){return f},setHeartbeat:function(i){f=i},formatTimestamp:h}})();Object.extend(S2.FX,{DefaultOptions:{transition:"sinusoidal",position:"parallel",fps:60,duration:0.2},elementDoesNotExistError:{name:"ElementDoesNotExistError",message:"The specified DOM element does not exist, but is required for this effect to operate"},parseOptions:function(a){if(Object.isNumber(a)){a={duration:a}}else{if(Object.isFunction(a)){a={after:a}}else{if(Object.isString(a)){a={duration:a=="slow"?1:a=="fast"?0.1:0.2}}}}return a||{}},ready:function(b){var c=this._ready;var a=b._prototypeUID;if(!a){return true}bool=c[a];return Object.isUndefined(bool)?true:bool},setReady:function(c,a){var d=this._ready;var b=c._prototypeUID;if(!b){c.getStorage();b=c._prototypeUID}d[b]=a},_ready:{}});S2.FX.Base=Class.create({initialize:function(a){S2.FX.initialize();this.updateWithoutWrappers=this.update;if(a&&a.queue&&!S2.FX.getQueues().include(a.queue)){S2.FX.addQueue(a.queue)}this.setOptions(a);this.duration=this.options.duration*1000;this.state="idle";["after","before"].each(function(b){this[b]=function(c){c(this);return this}},this)},setOptions:function(a){a=S2.FX.parseOptions(a);this.options=Object.extend(this.options||Object.extend({},S2.FX.DefaultOptions),a);if(a.tween){this.options.transition=a.tween}if(this.options.beforeUpdate||this.options.afterUpdate){this.update=this.updateWithoutWrappers.wrap(function(c,b){if(this.options.beforeUpdate){this.options.beforeUpdate(this,b)}c(b);if(this.options.afterUpdate){this.options.afterUpdate(this,b)}}.bind(this))}if(this.options.transition===false){this.options.transition=S2.FX.Transitions.linear}this.options.transition=Object.propertize(this.options.transition,S2.FX.Transitions)},play:function(a){this.setOptions(a);this.frameCount=0;this.state="idle";this.options.queue.add(this);this.maxFrames=this.options.fps*this.duration/1000;return this},render:function(b){if(this.options.debug){}if(b>=this.startsAt){if(this.state=="idle"&&S2.FX.ready(this.element)){this.debug("starting the effect at "+S2.FX.formatTimestamp(b));this.endsAt=this.startsAt+this.duration;this.start();this.frameCount++;return this}if(b>=this.endsAt&&this.state!=="finished"){this.debug("stopping the effect at "+S2.FX.formatTimestamp(b));this.finish();return this}if(this.state==="running"){var a=1-(this.endsAt-b)/this.duration;if((this.maxFrames*a).floor()>this.frameCount){this.update(this.options.transition(a));this.frameCount++}}}return this},start:function(){if(this.options.before){this.options.before(this)}if(this.setup){this.setup()}this.state="running";this.update(this.options.transition(0))},cancel:function(a){if(this.state!=="running"){return}if(this.teardown){this.teardown()}if(a&&this.options.after){this.options.after(this)}this.state="finished"},finish:function(){if(this.state!=="running"){return}this.update(this.options.transition(1));this.cancel(true)},inspect:function(){return"#<S2.FX:"+[this.state,this.startsAt,this.endsAt].inspect()+">"},update:Prototype.emptyFunction,debug:function(a){if(!this.options.debug){return}if(window.console&&console.log){console.log(a)}}});S2.FX.Element=Class.create(S2.FX.Base,{initialize:function($super,b,a){if(!(this.element=$(b))){throw (S2.FX.elementDoesNotExistError)}this.operators=[];return $super(a)},animate:function(){var b=$A(arguments),a=b.shift();a=a.charAt(0).toUpperCase()+a.substring(1);this.operators.push(new S2.FX.Operators[a](this,b[0],b[1]||{}))},play:function($super,b,a){if(b){this.element=$(b)}this.operators=[];return $super(a)},update:function(a){for(var c=0,b;b=this.operators[c];c++){b.render(a)}}});S2.FX.Heartbeat=Class.create({initialize:function(a){this.options=Object.extend({framerate:Prototype.Browser.MobileSafari?20:60},a);this.beat=this.beat.bind(this)},start:function(){if(this.heartbeatInterval){return}this.heartbeatInterval=setInterval(this.beat,1000/this.options.framerate);this.updateTimestamp()},stop:function(){if(!this.heartbeatInterval){return}clearInterval(this.heartbeatInterval);this.heartbeatInterval=null;this.timestamp=null},beat:function(){this.updateTimestamp();document.fire("effect:heartbeat")},getTimestamp:function(){return this.timestamp||this.generateTimestamp()},generateTimestamp:function(){return new Date().getTime()},updateTimestamp:function(){this.timestamp=this.generateTimestamp()}});S2.FX.Queue=(function(){return function(){var b=this;var e=[];function f(){return e}function h(){return e.length>0}function g(i){c(i);e.push(i);document.fire("effect:queued",b);return b}function a(i){e=e.without(i);document.fire("effect:dequeued",b);delete i;return b}function d(l){for(var j=0,k;k=e[j];j++){k.render(l);if(k.state==="finished"){a(k)}}return b}function c(m){var i=m.options.position||"parallel",l=S2.FX.getHeartbeat().getTimestamp();var j;if(i==="end"){j=e.without(m).pluck("endsAt").max()||l;if(j<l){j=l}}else{j=l}var k=(m.options.delay||0)*1000;m.startsAt=j+k;var n=(m.options.duration||1)*1000;m.endsAt=m.startsAt+n}Object.extend(b,{getEffects:f,active:h,add:g,remove:a,render:d})}})();S2.FX.Attribute=Class.create(S2.FX.Base,{initialize:function($super,b,e,d,a,c){b=Object.isString(b)?$(b):b;this.method=Object.isFunction(c)?c.bind(b):Object.isFunction(b[c])?b[c].bind(b):function(f){b[c]=f};this.to=d;this.from=e;return $super(a)},update:function(a){this.method(this.from.tween(this.to,a))}});S2.FX.Style=Class.create(S2.FX.Element,{setup:function(){this.animate("style",this.element,{style:this.options.style})}});S2.FX.Operators={};S2.FX.Operators.Base=Class.create({initialize:function(c,b,a){this.effect=c;this.object=b;this.options=Object.extend({transition:Prototype.K},a)},inspect:function(){return"#<S2.FX.Operators.Base:"+this.lastValue+">"},setup:function(){},valueAt:function(a){},applyValue:function(a){},render:function(a){var b=this.valueAt(this.options.transition(a));this.applyValue(b);this.lastValue=b}});S2.FX.Operators.Style=Class.create(S2.FX.Operators.Base,{initialize:function($super,g,a,h){$super(g,a,h);this.element=$(this.object);this.style=Object.isString(this.options.style)?S2.CSS.parseStyle(this.options.style):this.options.style;var b=this.options.propertyTransitions||{};this.tweens=[];for(var f in this.style){var e=f.underscore().dasherize(),d=this.element.getStyle(e),c=this.style[f];if(d!=c){this.tweens.push([e,S2.CSS.interpolate.curry(e,d,c),f in b?Object.propertize(b[f],S2.FX.Transitions):Prototype.K])}}},valueAt:function(a){return this.tweens.map(function(b){return b[0]+":"+b[1](b[2](a))}).join(";")},applyValue:function(a){if(this.currentStyle==a){return}this.element.setStyle(a);this.currentStyle=a}});S2.FX.Morph=Class.create(S2.FX.Element,{setup:function(){if(this.options.change){this.setupWrappers()}else{if(this.options.style){this.animate("style",this.destinationElement||this.element,{style:this.options.style,propertyTransitions:this.options.propertyTransitions||{}})}}},teardown:function(){if(this.options.change){this.teardownWrappers()}},setupWrappers:function(){var a=this.element.getStyle("float"),f,b,d,c,e;this.transitionElement=new Element("div").setStyle({position:"relative",overflow:"hidden","float":a});this.element.setStyle({"float":"none"}).insert({before:this.transitionElement});this.sourceElementWrapper=this.element.cloneWithoutIDs().wrap("div");this.destinationElementWrapper=this.element.wrap("div");this.transitionElement.insert(this.sourceElementWrapper).insert(this.destinationElementWrapper);f=this.sourceElementWrapper.getHeight();b=this.sourceElementWrapper.getWidth();this.options.change();d=this.destinationElementWrapper.getHeight();c=this.destinationElementWrapper.getWidth();this.outerWrapper=new Element("div");this.transitionElement.insert({before:this.outerWrapper});this.outerWrapper.setStyle({overflow:"hidden",height:f+"px",width:b+"px"}).appendChild(this.transitionElement);e=Math.max(d,f),maxWidth=Math.max(c,b);this.transitionElement.setStyle({height:f+"px",width:b+"px"});this.sourceElementWrapper.setStyle({position:"absolute",height:e+"px",width:maxWidth+"px",top:0,left:0});this.destinationElementWrapper.setStyle({position:"absolute",height:e+"px",width:maxWidth+"px",top:0,left:0,opacity:0,zIndex:2000});this.outerWrapper.insert({before:this.transitionElement}).remove();this.animate("style",this.transitionElement,{style:"height:"+d+"px; width:"+c+"px"});this.animate("style",this.destinationElementWrapper,{style:"opacity: 1.0"})},teardownWrappers:function(){var a=this.destinationElementWrapper.down();if(a){this.transitionElement.insert({before:a})}this.transitionElement.remove()}});S2.FX.Parallel=Class.create(S2.FX.Base,{initialize:function($super,b,a){this.effects=b||[];return $super(a||{})},setup:function(){this.effects.invoke("setup")},update:function(a){this.effects.invoke("update",a)}});S2.FX.Operators.Scroll=Class.create(S2.FX.Operators.Base,{initialize:function($super,c,b,a){$super(c,b,a);this.start=b.scrollTop;this.end=this.options.scrollTo},valueAt:function(a){return this.start+((this.end-this.start)*a)},applyValue:function(a){this.object.scrollTop=a.round()}});S2.FX.Scroll=Class.create(S2.FX.Element,{setup:function(){this.animate("scroll",this.element,{scrollTo:this.options.to})}});S2.FX.SlideDown=Class.create(S2.FX.Element,{setup:function(){var a=this.destinationElement||this.element;var c=a.getLayout();var b={height:c.get("height")+"px",paddingTop:c.get("padding-top")+"px",paddingBottom:c.get("padding-bottom")+"px"};a.setStyle({height:"0",paddingTop:"0",paddingBottom:"0",overflow:"hidden"}).show();this.animate("style",a,{style:b,propertyTransitions:{}})},teardown:function(){var a=this.destinationElement||this.element;a.setStyle({height:"",paddingTop:"",paddingBottom:"",overflow:"visible"})}});S2.FX.SlideUp=Class.create(S2.FX.Morph,{setup:function(){var a=this.destinationElement||this.element;var c=a.getLayout();var b={height:"0px",paddingTop:"0px",paddingBottom:"0px"};a.setStyle({overflow:"hidden"});this.animate("style",a,{style:b,propertyTransitions:{}})},teardown:function(){var a=this.destinationElement||this.element;a.setStyle({height:"",paddingTop:"",paddingBottom:"",overflow:"visible"}).hide()}});S2.FX.Transitions={linear:Prototype.K,sinusoidal:function(a){return(-Math.cos(a*Math.PI)/2)+0.5},reverse:function(a){return 1-a},mirror:function(b,a){a=a||S2.FX.Transitions.sinusoidal;if(b<0.5){return a(b*2)}else{return a(1-(b-0.5)*2)}},flicker:function(a){var a=a+(Math.random()-0.5)/5;return S2.FX.Transitions.sinusoidal(a<0?0:a>1?1:a)},wobble:function(a){return(-Math.cos(a*Math.PI*(9*a))/2)+0.5},pulse:function(b,a){return(-Math.cos((b*((a||5)-0.5)*2)*Math.PI)/2)+0.5},blink:function(b,a){return Math.round(b*(a||5))%2},spring:function(a){return 1-(Math.cos(a*4.5*Math.PI)*Math.exp(-a*6))},none:Prototype.K.curry(0),full:Prototype.K.curry(1)};
+/*
+ *  Copyright (c) 2006 Apple Computer, Inc. All rights reserved.
+ *
+ *  Redistribution and use in source and binary forms, with or without
+ *  modification, are permitted provided that the following conditions are met:
+ *
+ *  1. Redistributions of source code must retain the above copyright notice,
+ *  this list of conditions and the following disclaimer.
+ *
+ *  2. Redistributions in binary form must reproduce the above copyright notice,
+ *  this list of conditions and the following disclaimer in the documentation
+ *  and/or other materials provided with the distribution.
+ *
+ *  3. Neither the name of the copyright holder(s) nor the names of any
+ *  contributors may be used to endorse or promote products derived from
+ *  this software without specific prior written permission.
+ *
+ *  THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ *  "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO,
+ *  THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ *  ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE
+ *  FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+ *  (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+ *  LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON
+ *  ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ *  (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ *  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+(function(){function a(p,d,c,l,k,b){var o=0,u=0,f=0,m=0,r=0,e=0;function j(v){return((o*v+u)*v+f)*v}function i(v){return((m*v+r)*v+e)*v}function s(v){return(3*o*v+2*u)*v+f}function n(t){return 1/(200*t)}function h(t,v){return i(g(t,v))}function q(t){if(t>=0){return t}else{return 0-t}}function g(t,C){var B,A,y,v,z,w;for(y=t,w=0;w<8;w++){v=j(y)-t;if(q(v)<C){return y}z=s(y);if(q(z)<0.000001){break}y=y-v/z}B=0;A=1;y=t;if(y<B){return B}if(y>A){return A}while(B<A){v=j(y);if(q(v-t)<C){return y}if(t>v){B=y}else{A=y}y=(A-B)*0.5+B}return y}f=3*d;u=3*(l-d)-f;o=1-f-u;e=3*c;r=3*(k-c)-e;m=1-e-r;return h(p,n(b))}S2.FX.cubicBezierTransition=function(c,e,b,d){return(function(f){return a(f,c,e,b,d,1)})}})();S2.FX.Transitions.webkitCubic=S2.FX.cubicBezierTransition(0.25,0.1,0.25,1);S2.FX.Transitions.webkitEaseInOut=S2.FX.cubicBezierTransition(0.42,0,0.58,1);
+/*
+ *  TERMS OF USE - EASING EQUATIONS
+ *  Open source under the BSD License.
+ *  Easing Equations (c) 2003 Robert Penner, all rights reserved.
+ */
+Object.extend(S2.FX.Transitions,{easeInQuad:function(a){return Math.pow(a,2)},easeOutQuad:function(a){return -(Math.pow((a-1),2)-1)},easeInOutQuad:function(a){if((a/=0.5)<1){return 0.5*Math.pow(a,2)}return -0.5*((a-=2)*a-2)},easeInCubic:function(a){return Math.pow(a,3)},easeOutCubic:function(a){return(Math.pow((a-1),3)+1)},easeInOutCubic:function(a){if((a/=0.5)<1){return 0.5*Math.pow(a,3)}return 0.5*(Math.pow((a-2),3)+2)},easeInQuart:function(a){return Math.pow(a,4)},easeOutQuart:function(a){return -(Math.pow((a-1),4)-1)},easeInOutQuart:function(a){if((a/=0.5)<1){return 0.5*Math.pow(a,4)}return -0.5*((a-=2)*Math.pow(a,3)-2)},easeInQuint:function(a){return Math.pow(a,5)},easeOutQuint:function(a){return(Math.pow((a-1),5)+1)},easeInOutQuint:function(a){if((a/=0.5)<1){return 0.5*Math.pow(a,5)}return 0.5*(Math.pow((a-2),5)+2)},easeInSine:function(a){return -Math.cos(a*(Math.PI/2))+1},easeOutSine:function(a){return Math.sin(a*(Math.PI/2))},easeInOutSine:function(a){return(-0.5*(Math.cos(Math.PI*a)-1))},easeInExpo:function(a){return(a==0)?0:Math.pow(2,10*(a-1))},easeOutExpo:function(a){return(a==1)?1:-Math.pow(2,-10*a)+1},easeInOutExpo:function(a){if(a==0){return 0}if(a==1){return 1}if((a/=0.5)<1){return 0.5*Math.pow(2,10*(a-1))}return 0.5*(-Math.pow(2,-10*--a)+2)},easeInCirc:function(a){return -(Math.sqrt(1-(a*a))-1)},easeOutCirc:function(a){return Math.sqrt(1-Math.pow((a-1),2))},easeInOutCirc:function(a){if((a/=0.5)<1){return -0.5*(Math.sqrt(1-a*a)-1)}return 0.5*(Math.sqrt(1-(a-=2)*a)+1)},easeOutBounce:function(a){if((a)<(1/2.75)){return(7.5625*a*a)}else{if(a<(2/2.75)){return(7.5625*(a-=(1.5/2.75))*a+0.75)}else{if(a<(2.5/2.75)){return(7.5625*(a-=(2.25/2.75))*a+0.9375)}else{return(7.5625*(a-=(2.625/2.75))*a+0.984375)}}}},easeInBack:function(b){var a=1.70158;return(b)*b*((a+1)*b-a)},easeOutBack:function(b){var a=1.70158;return(b=b-1)*b*((a+1)*b+a)+1},easeInOutBack:function(b){var a=1.70158;if((b/=0.5)<1){return 0.5*(b*b*(((a*=(1.525))+1)*b-a))}return 0.5*((b-=2)*b*(((a*=(1.525))+1)*b+a)+2)},elastic:function(a){return -1*Math.pow(4,-8*a)*Math.sin((a*6-1)*(2*Math.PI)/2)+1},swingFromTo:function(b){var a=1.70158;return((b/=0.5)<1)?0.5*(b*b*(((a*=(1.525))+1)*b-a)):0.5*((b-=2)*b*(((a*=(1.525))+1)*b+a)+2)},swingFrom:function(b){var a=1.70158;return b*b*((a+1)*b-a)},swingTo:function(b){var a=1.70158;return(b-=1)*b*((a+1)*b+a)+1},bounce:function(a){if(a<(1/2.75)){return(7.5625*a*a)}else{if(a<(2/2.75)){return(7.5625*(a-=(1.5/2.75))*a+0.75)}else{if(a<(2.5/2.75)){return(7.5625*(a-=(2.25/2.75))*a+0.9375)}else{return(7.5625*(a-=(2.625/2.75))*a+0.984375)}}}},bouncePast:function(a){if(a<(1/2.75)){return(7.5625*a*a)}else{if(a<(2/2.75)){return 2-(7.5625*(a-=(1.5/2.75))*a+0.75)}else{if(a<(2.5/2.75)){return 2-(7.5625*(a-=(2.25/2.75))*a+0.9375)}else{return 2-(7.5625*(a-=(2.625/2.75))*a+0.984375)}}}},easeFromTo:function(a){if((a/=0.5)<1){return 0.5*Math.pow(a,4)}return -0.5*((a-=2)*Math.pow(a,3)-2)},easeFrom:function(a){return Math.pow(a,4)},easeTo:function(a){return Math.pow(a,0.25)}});(function(k){Hash.addMethods({hasKey:function(m){return(m in this._object)}});var a=false;var f=false;function d(){var m=navigator.userAgent,n=navigator.appVersion;return(!m.include("Chrome")&&n.include("10_6"))||Prototype.Browser.MobileSafari}(function(){var n=document.createElement("div");try{document.createEvent("WebKitTransitionEvent");a=true;f=d()}catch(m){if(typeof n.style.MozTransition!=="undefined"){a=true}}n=null})();if(!a){return}Prototype.BrowserFeatures.CSSTransitions=true;S2.Extensions.CSSTransitions=true;S2.Extensions.HardwareAcceleratedCSSTransitions=f;if(f){Object.extend(k.DefaultOptions,{accelerate:true})}function l(m){return S2.CSS.vendorizeProperty(m)}var h=$w("border-top-left-radius border-top-right-radius border-bottom-left-radius border-bottom-right-radius background-size transform").map(function(m){return l(m).camelize()});h.each(function(m){S2.CSS.PROPERTIES.push(m)});S2.CSS.NUMERIC_PROPERTIES=S2.CSS.PROPERTIES.findAll(function(m){return !m.endsWith("olor")});CSS_TRANSITIONS_HARDWARE_ACCELERATED_PROPERTIES=S2.Extensions.HardwareAcceleratedCSSTransitions?$w("top left bottom right opacity"):[];var i=new Template("translate(#{0}px, #{1}px)");var g=k.Operators;g.CssTransition=Class.create(g.Base,{initialize:function($super,p,n,m){$super(p,n,m);this.element=$(this.object);var o=this.options.style;this.style=Object.isString(o)?S2.CSS.normalize(this.element,o):o;this.style=$H(this.style);this.targetStyle=S2.CSS.serialize(this.style);this.running=false},_canHardwareAccelerate:function(){if(this.effect.options.accelerate===false){return false}var o=this.style.toObject(),q=this.style.keys();var n=this.element;if(q.length===0){return false}var r=q.any(function(s){return !CSS_TRANSITIONS_HARDWARE_ACCELERATED_PROPERTIES.include(s)});if(r){return false}var p={left:n.getStyle("left"),right:n.getStyle("right"),top:n.getStyle("top"),bottom:n.getStyle("bottom")};function m(s){if(s.top&&s.bottom){return true}if(s.left&&s.right){return true}return false}if(m(p)){return false}if(m(o)){return false}return true},_adjustForHardwareAcceleration:function(o){var n=0,m=0;$w("top bottom left right").each(function(t){if(!o.hasKey(t)){return}var s=window.parseInt(this.element.getStyle(t),10);var r=window.parseInt(o.get(t),10);if(t==="top"){m+=(r-s)}else{if(t==="bottom"){m+=(s-r)}else{if(t==="left"){n+=(r-s)}else{if(t==="right"){n+=(s-r)}}}}o.unset(t)},this);var p=l("transform");if(n!==0||m!==0){var q=i.evaluate([n,m]);o.set(p,q)}this.targetStyle+=p+": translate(0px, 0px);";return o},render:function(){if(this.running===true){return}var p=this.style.clone(),o=this.effect;if(this._canHardwareAccelerate()){o.accelerated=true;p=this._adjustForHardwareAcceleration(p)}else{o.accelerated=false}var n=this.element.style;var m={};$w("transition-property transition-duration transition-timing-function").each(function(q){q=l(q).camelize();m[q]=n[q]});this.element.store("s2.targetStyle",this.targetStyle);this.element.store("s2.originalTransitionStyle",m);n[l("transition-property").camelize()]=p.keys().join(",");n[l("transition-duration").camelize()]=(o.duration/1000).toFixed(3)+"s";n[l("transition-timing-function").camelize()]=c(o.options.transition);this.element.setStyle(p.toObject());this.running=true;this.render=Prototype.emptyFunction}});g.CssTransition.TIMING_MAP={linear:"linear",sinusoidal:"ease-in-out"};function c(p){var o=null,n=k.Operators.CssTransition.TIMING_MAP;for(var m in n){if(k.Transitions[m]===p){o=n[m];break}}return o}function j(n){if(!S2.Extensions.CSSTransitions){return false}var m=n.options;if((m.engine||"")==="javascript"){return false}if(!c(m.transition)){return false}if(m.propertyTransitions){return false}return true}k.Morph=Class.create(k.Morph,{setup:function(){if(this.options.change){this.setupWrappers()}else{if(this.options.style){this.engine="javascript";var n="style";var p=Object.isString(this.options.style)?S2.CSS.parseStyle(this.options.style):p;var o=S2.CSS.normalize(this.destinationElement||this.element,p);var m=Object.keys(o).length>0;if(m&&j(this)){this.engine="css-transition";n="CssTransition";this.update=function(q){this.element.store("s2.effect",this);S2.FX.setReady(this.element,false);for(var s=0,r;r=this.operators[s];s++){r.render(q)}this.render=Prototype.emptyFunction}}this.animate(n,this.destinationElement||this.element,{style:this.options.style,propertyTransitions:this.options.propertyTransitions||{}})}}}});var b={webkit:"webkitTransitionEnd",moz:"transitionend"};var e=b[S2.CSS.VENDOR_PREFIX.toLowerCase()];document.observe(e,function(o){var m=o.element();if(!m){return}var n=m.retrieve("s2.effect");if(n){function p(s,t){var r=s.retrieve("s2.targetStyle");if(!r){return}s.setStyle(r);var u=s.retrieve("s2.originalTransitionStyle");var v=s.getStorage();v.unset("s2.targetStyle");v.unset("s2.originalTransitionStyle");v.unset("s2.effect");(function(){if(u){s.setStyle(u)}S2.FX.setReady(s)}).defer()}(function(s,t){var r=l("transition-duration").camelize();s.style[r]="";p(s,t)}).defer(m,n);n.state="finished";var q=n.options.after;if(q){q(n)}}})})(S2.FX);Element.__scrollTo=Element.scrollTo;Element.addMethods({scrollTo:function(b,c,a){if(arguments.length==1){return Element.__scrollTo(b)}new S2.FX.Scroll(b,Object.extend(a||{},{to:c})).play();return b}});Element.addMethods({effect:function(b,c,a){if(Object.isFunction(c)){c=new c(b,a)}else{if(Object.isString(c)){c=new S2.FX[c.charAt(0).toUpperCase()+c.substring(1)](b,a)}}c.play(b,a);return b},morph:function(b,c,a){a=S2.FX.parseOptions(a);if(!a.queue){a.queue=b.retrieve("S2.FX.Queue");if(!a.queue){b.store("S2.FX.Queue",a.queue=new S2.FX.Queue())}}if(!a.position){a.position="end"}return b.effect("morph",Object.extend(a,{style:c}))}.optionize(),appear:function(b,a){return b.setStyle("opacity: 0;").show().morph("opacity: 1",a)},fade:function(b,a){a=Object.extend({after:Element.hide.curry(b)},a||{});return b.morph("opacity: 0",a)},cloneWithoutIDs:function(a){a=$(a);var b=a.cloneNode(true);b.id="";$(b).select("*[id]").each(function(c){c.id=""});return b}});(function(){var a;if(window.CSSMatrix){a=function(c,b){c.style.transform="scale("+(b.scale||1)+") rotate("+(b.rotation||0)+"rad)";return c}}else{if(window.WebKitCSSMatrix){a=function(c,b){c.style.webkitTransform="scale("+(b.scale||1)+") rotate("+(b.rotation||0)+"rad)";return c}}else{if(Prototype.Browser.Gecko){a=function(c,b){c.style.MozTransform="scale("+(b.scale||1)+") rotate("+(b.rotation||0)+"rad)";return c}}else{if(Prototype.Browser.IE){a=function(d,b){if(!d._oDims){d._oDims=[d.offsetWidth,d.offsetHeight]}var g=Math.cos(b.rotation||0)*1,f=Math.sin(b.rotation||0)*1,e="progid:DXImageTransform.Microsoft.Matrix(sizingMethod='auto expand',M11="+g+",M12="+(-f)+",M21="+f+",M22="+g+")";d.style.filter=e;d.style.marginLeft=(d._oDims[0]-d.offsetWidth)/2+"px";d.style.marginTop=(d._oDims[1]-d.offsetHeight)/2+"px";return d}}else{a=function(b){return b}}}}}Element.addMethods({transform:a})})();S2.viewportOverlay=function(){var a=document.viewport.getDimensions(),b=document.viewport.getScrollOffsets();return new Element("div").setStyle({position:"absolute",left:b.left+"px",top:b.top+"px",width:a.width+"px",height:a.height+"px"})};S2.FX.Helpers={fitIntoRectangle:function(a,d,g,b){var e=a/d,c=g/b;return e<c?[(g-(a*(b/d)))/2,0,a*(b/d),b]:[0,(b-(d*(g/a)))/2,g,d*(g/a)]}};S2.FX.Operators.Zoom=Class.create(S2.FX.Operators.Style,{initialize:function($super,d,c,b){var a=document.viewport.getDimensions(),e=document.viewport.getScrollOffsets(),h=c.getDimensions(),g=S2.FX.Helpers.fitIntoRectangle(h.width,h.height,a.width-(b.borderWidth||0)*2,a.height-(b.borderWidth||0)*2);Object.extend(b,{style:{left:g[0]+(b.borderWidth||0)+e.left+"px",top:g[1]+(b.borderWidth||0)+e.top+"px",width:g[2]+"px",height:g[3]+"px"}});$super(d,c,b)}});S2.FX.Zoom=Class.create(S2.FX.Element,{setup:function(){this.clone=this.element.cloneWithoutIDs();this.element.insert({before:this.clone});this.clone.absolutize().setStyle({zIndex:9999});this.overlay=S2.viewportOverlay();if(this.options.overlayClassName){this.overlay.addClassName(this.options.overlayClassName)}else{this.overlay.setStyle({backgroundColor:"#000",opacity:"0.9"})}$$("body")[0].insert(this.overlay);this.animate("zoom",this.clone,{borderWidth:this.options.borderWidth,propertyTransitions:this.options.propertyTransitions||{}})},teardown:function(){this.clone.observe("click",function(){this.overlay.remove();this.clone.morph("opacity:0",{duration:0.2,after:function(){this.clone.remove()}.bind(this)})}.bind(this))}});
\ No newline at end of file
diff --git a/common/src/web/touch/s2.js b/common/src/web/touch/s2.js
new file mode 100644
index 00000000..62b9829d
--- /dev/null
+++ b/common/src/web/touch/s2.js
@@ -0,0 +1,4646 @@
+/*!
+ *  script.aculo.us version 2.0.0_b1
+ *  (c) 2005-2010 Thomas Fuchs
+ *
+ *  script.aculo.us is freely distributable under the terms of an MIT-style license.
+ *----------------------------------------------------------------------------------*/
+
+
+
+var S2 = {
+  Version: '2.0.0_b1',
+
+  Extensions: {}
+};
+
+
+Function.prototype.optionize = function(){
+  var self = this, argumentNames = self.argumentNames(), optionIndex = this.length - 1;
+
+  var method = function() {
+    var args = $A(arguments);
+
+    var options = (typeof args.last() === 'object') ? args.pop() : {};
+    var prefilledArgs = [];
+    if (optionIndex > 0) {
+      prefilledArgs = ((args.length > 0 ? args : [null]).inGroupsOf(
+       optionIndex).flatten()).concat(options);
+    }
+
+    return self.apply(this, prefilledArgs);
+  };
+  method.argumentNames = function() { return argumentNames; };
+  return method;
+};
+
+Function.ABSTRACT = function() {
+  throw "Abstract method. Implement in subclass.";
+};
+
+Object.extend(Number.prototype, {
+  constrain: function(n1, n2) {
+    var min = (n1 < n2) ? n1 : n2;
+    var max = (n1 < n2) ? n2 : n1;
+
+    var num = Number(this);
+
+    if (num < min) num = min;
+    if (num > max) num = max;
+
+    return num;
+  },
+
+  nearer: function(n1, n2) {
+    var num = Number(this);
+
+    var diff1 = Math.abs(num - n1);
+    var diff2 = Math.abs(num - n2);
+
+    return (diff1 < diff2) ? n1 : n2;
+  },
+
+  tween: function(target, position) {
+    return this + (target-this) * position;
+  }
+});
+
+
+Object.propertize = function(property, object){
+  return Object.isString(property) ? object[property] : property;
+};
+
+S2.CSS = {
+  PROPERTY_MAP: {
+    backgroundColor: 'color',
+    borderBottomColor: 'color',
+    borderBottomWidth: 'length',
+    borderLeftColor: 'color',
+    borderLeftWidth: 'length',
+    borderRightColor: 'color',
+    borderRightWidth: 'length',
+    borderSpacing: 'length',
+    borderTopColor: 'color',
+    borderTopWidth: 'length',
+    bottom: 'length',
+    color: 'color',
+    fontSize: 'length',
+    fontWeight: 'integer',
+    height: 'length',
+    left: 'length',
+    letterSpacing: 'length',
+    lineHeight: 'length',
+    marginBottom: 'length',
+    marginLeft: 'length',
+    marginRight: 'length',
+    marginTop: 'length',
+    maxHeight: 'length',
+    maxWidth: 'length',
+    minHeight: 'length',
+    minWidth: 'length',
+    opacity: 'number',
+    outlineColor: 'color',
+    outlineOffset: 'length',
+    outlineWidth: 'length',
+    paddingBottom: 'length',
+    paddingLeft: 'length',
+    paddingRight: 'length',
+    paddingTop: 'length',
+    right: 'length',
+    textIndent: 'length',
+    top: 'length',
+    width: 'length',
+    wordSpacing: 'length',
+    zIndex: 'integer',
+    zoom: 'number'
+  },
+
+  VENDOR: {
+    PREFIX: null,
+
+    LOOKUP_PREFIXES: ['webkit', 'Moz', 'O'],
+    LOOKUP_PROPERTIES: $w('BorderRadius BoxShadow Transform Transition ' +
+     'TransitionDuration TransitionTimingFunction TransitionProperty ' +
+     'TransitionDelay ' +
+     'BorderTopLeftRadius BorderTopRightRadius BorderBottomLeftRadius ' +
+     'BorderBottomRightRadius'
+    ),
+    LOOKUP_EDGE_CASES: {
+      'BorderTopLeftRadius': 'BorderRadiusTopleft',
+      'BorderTopRightRadius': 'BorderRadiusTopright',
+      'BorderBottomLeftRadius': 'BorderRadiusBottomleft',
+      'BorderBottomRightRadius': 'BorderRadiusBottomright'
+    },
+
+    PROPERTY_MAP: {}
+  },
+
+  LENGTH: /^(([\+\-]?[0-9\.]+)(em|ex|px|in|cm|mm|pt|pc|\%))|0$/,
+
+  NUMBER: /([\+-]*\d+\.?\d*)/,
+
+  __parseStyleElement: document.createElement('div'),
+
+  parseStyle: function(styleString) {
+    S2.CSS.__parseStyleElement.innerHTML = '<div style="' + styleString + '"></div>';
+    var style = S2.CSS.__parseStyleElement.childNodes[0].style, styleRules = {};
+
+    S2.CSS.NUMERIC_PROPERTIES.each( function(property){
+      if (style[property]) styleRules[property] = style[property];
+    });
+
+    S2.CSS.COLOR_PROPERTIES.each( function(property){
+      if (style[property]) styleRules[property] = S2.CSS.colorFromString(style[property]);
+    });
+
+    if (Prototype.Browser.IE && styleString.include('opacity'))
+      styleRules.opacity = styleString.match(/opacity:\s*((?:0|1)?(?:\.\d*)?)/)[1];
+
+    return styleRules;
+  },
+
+  parse: function(styleString) {
+    return S2.CSS.parseStyle(styleString);
+  },
+
+  normalize: function(element, style) {
+    if (Object.isHash(style)) style = style.toObject();
+    if (typeof style === 'string') style = S2.CSS.parseStyle(style);
+
+    var result = {}, current;
+
+    for (var property in style) {
+      current = element.getStyle(property);
+      if (style[property] !== current) {
+        result[property] = style[property];
+      }
+    }
+
+    return result;
+  },
+
+  serialize: function(object) {
+    if (Object.isHash(object)) object = object.toObject();
+    var output = "", value;
+    for (var property in object) {
+      value = object[property];
+      property = this.vendorizeProperty(property);
+      output += (property + ": " + value + ';');
+    }
+    return output;
+  },
+
+  vendorizeProperty: function(property) {
+    property = property.underscore().dasherize();
+
+    if (property in S2.CSS.VENDOR.PROPERTY_MAP) {
+      property = S2.CSS.VENDOR.PROPERTY_MAP[property];
+    }
+
+    return property;
+  },
+
+  normalizeColor: function(color) {
+    if (!color || color == 'rgba(0, 0, 0, 0)' || color == 'transparent') color = '#ffffff';
+    color = S2.CSS.colorFromString(color);
+    return [
+      parseInt(color.slice(1,3),16), parseInt(color.slice(3,5),16), parseInt(color.slice(5,7),16)
+    ];
+  },
+
+  colorFromString: function(color) {
+    var value = '#', cols, i;
+    if (color.slice(0,4) == 'rgb(') {
+      cols = color.slice(4,color.length-1).split(',');
+      i=3; while(i--) value += parseInt(cols[2-i]).toColorPart();
+    } else if (color.slice(0,1) == '#') {
+        if (color.length==4) for(i=1;i<4;i++) value += (color.charAt(i) + color.charAt(i)).toLowerCase();
+        if (color.length==7) value = color.toLowerCase();
+    } else { value = color; }
+    return (value.length==7 ? value : (arguments[1] || value));
+  },
+
+  interpolateColor: function(from, to, position){
+    from = S2.CSS.normalizeColor(from);
+    to = S2.CSS.normalizeColor(to);
+
+    return '#' + [0,1,2].map(function(index){
+      return Math.max(Math.min(from[index].tween(to[index], position).round(), 255), 0).toColorPart();
+    }).join('');
+  },
+
+  interpolateNumber: function(from, to, position){
+    return 1*((from||0).tween(to, position).toFixed(3));
+  },
+
+  interpolateLength: function(from, to, position){
+    if (!from || parseFloat(from) === 0) {
+      from = '0' + to.gsub(S2.CSS.NUMBER,'');
+    }
+    to.scan(S2.CSS.NUMBER, function(match){ to = 1*(match[1]); });
+    return from.gsub(S2.CSS.NUMBER, function(match){
+      return (1*(parseFloat(match[1]).tween(to, position).toFixed(3))).toString();
+    });
+  },
+
+  interpolateInteger: function(from, to, position){
+    return parseInt(from).tween(to, position).round();
+  },
+
+  interpolate: function(property, from, to, position){
+    return S2.CSS['interpolate'+S2.CSS.PROPERTY_MAP[property.camelize()].capitalize()](from, to, position);
+  },
+
+  ElementMethods: {
+    getStyles: function(element) {
+      var css = document.defaultView.getComputedStyle($(element), null);
+      return S2.CSS.PROPERTIES.inject({ }, function(styles, property) {
+        styles[property] = css[property];
+        return styles;
+      });
+    }
+  }
+};
+
+S2.CSS.PROPERTIES = [];
+for (var property in S2.CSS.PROPERTY_MAP) S2.CSS.PROPERTIES.push(property);
+
+S2.CSS.NUMERIC_PROPERTIES = S2.CSS.PROPERTIES.findAll(function(property){ return !property.endsWith('olor') });
+S2.CSS.COLOR_PROPERTIES   = S2.CSS.PROPERTIES.findAll(function(property){ return property.endsWith('olor') });
+
+if (!(document.defaultView && document.defaultView.getComputedStyle)) {
+  S2.CSS.ElementMethods.getStyles = function(element) {
+    element = $(element);
+    var css = element.currentStyle, styles;
+    styles = S2.CSS.PROPERTIES.inject({ }, function(hash, property) {
+      hash[property] = css[property];
+      return hash;
+    });
+    if (!styles.opacity) styles.opacity = element.getOpacity();
+    return styles;
+  };
+};
+
+Element.addMethods(S2.CSS.ElementMethods);
+
+(function() {
+  var div = document.createElement('div');
+  var style = div.style, prefix = null;
+  var edgeCases = S2.CSS.VENDOR.LOOKUP_EDGE_CASES;
+  var uncamelize = function(prop, prefix) {
+    if (prefix) {
+      prop = '-' + prefix.toLowerCase() + '-' + uncamelize(prop);
+    }
+    return prop.underscore().dasherize();
+  }
+
+  S2.CSS.VENDOR.LOOKUP_PROPERTIES.each(function(prop) {
+    if (!prefix) { // We attempt to detect a prefix
+      prefix = S2.CSS.VENDOR.LOOKUP_PREFIXES.detect( function(p) {
+        return !Object.isUndefined(style[p + prop]);
+      });
+    }
+    if (prefix) { // If we detected a prefix
+      if ((prefix + prop) in style) {
+        S2.CSS.VENDOR.PROPERTY_MAP[uncamelize(prop)] = uncamelize(prop, prefix);
+      } else if (prop in edgeCases && (prefix + edgeCases[prop]) in style) {
+        S2.CSS.VENDOR.PROPERTY_MAP[uncamelize(prop)] = uncamelize(edgeCases[prop], prefix);
+      }
+    }
+  });
+
+  S2.CSS.VENDOR.PREFIX = prefix;
+
+  div = null;
+})();
+
+S2.FX = (function(){
+  var queues = [], globalQueue,
+    heartbeat, activeEffects = 0;
+
+  function beatOnDemand(dir) {
+    activeEffects += dir;
+    if (activeEffects > 0) heartbeat.start();
+    else heartbeat.stop();
+  }
+
+  function renderQueues() {
+    var timestamp = heartbeat.getTimestamp();
+    for (var i = 0, queue; queue = queues[i]; i++) {
+      queue.render(timestamp);
+    }
+  }
+
+  function initialize(initialHeartbeat){
+    if (globalQueue) return;
+    queues.push(globalQueue = new S2.FX.Queue());
+    S2.FX.DefaultOptions.queue = globalQueue;
+    heartbeat = initialHeartbeat || new S2.FX.Heartbeat();
+
+    document
+      .observe('effect:heartbeat', renderQueues)
+      .observe('effect:queued',    beatOnDemand.curry(1))
+      .observe('effect:dequeued',  beatOnDemand.curry(-1));
+  }
+
+  function formatTimestamp(timestamp) {
+    if (!timestamp) timestamp = (new Date()).valueOf();
+    var d = new Date(timestamp);
+    return d.getSeconds() + '.' + d.getMilliseconds() + 's';
+  }
+
+  return {
+    initialize:   initialize,
+    getQueues:    function() { return queues; },
+    addQueue:     function(queue) { queues.push(queue); },
+    getHeartbeat: function() { return heartbeat; },
+    setHeartbeat: function(newHeartbeat) { heartbeat = newHeartbeat; },
+    formatTimestamp: formatTimestamp
+  }
+})();
+
+Object.extend(S2.FX, {
+  DefaultOptions: {
+    transition: 'sinusoidal',
+    position:   'parallel',
+    fps:        60,
+    duration:   .2
+  },
+
+  elementDoesNotExistError: {
+    name: 'ElementDoesNotExistError',
+    message: 'The specified DOM element does not exist, but is required for this effect to operate'
+  },
+
+  parseOptions: function(options) {
+    if (Object.isNumber(options))
+      options = { duration: options };
+    else if (Object.isFunction(options))
+      options = { after: options };
+    else if (Object.isString(options))
+      options = { duration: options == 'slow' ? 1 : options == 'fast' ? .1 : .2 };
+
+    return options || {};
+  },
+
+  ready: function(element) {
+    if (!element) return;
+    var table = this._ready;
+    var uid = element._prototypeUID;
+    if (!uid) return true;
+
+    bool = table[uid];
+    return Object.isUndefined(bool) ? true : bool;
+  },
+
+  setReady: function(element, bool) {
+    if (!element) return;
+    var table = this._ready, uid = element._prototypeUID;
+    if (!uid) {
+      element.getStorage();
+      uid = element._prototypeUID;
+    }
+
+    table[uid] = bool;
+  },
+
+  _ready: {}
+});
+
+S2.FX.Base = Class.create({
+  initialize: function(options) {
+    S2.FX.initialize();
+    this.updateWithoutWrappers = this.update;
+
+    if(options && options.queue && !S2.FX.getQueues().include(options.queue))
+      S2.FX.addQueue(options.queue);
+
+    this.setOptions(options);
+    this.duration = this.options.duration*1000;
+    this.state = 'idle';
+
+    ['after','before'].each(function(method) {
+      this[method] = function(method) {
+        method(this);
+        return this;
+      }
+    }, this);
+  },
+
+  setOptions: function(options) {
+    options = S2.FX.parseOptions(options);
+
+    this.options = Object.extend(this.options || Object.extend({}, S2.FX.DefaultOptions), options);
+
+    if (options.tween) this.options.transition = options.tween;
+
+    if (this.options.beforeUpdate || this.options.afterUpdate) {
+      this.update = this.updateWithoutWrappers.wrap( function(proceed,position){
+        if (this.options.beforeUpdate) this.options.beforeUpdate(this, position);
+        proceed(position);
+        if (this.options.afterUpdate) this.options.afterUpdate(this, position);
+      }.bind(this));
+    }
+
+    if (this.options.transition === false)
+      this.options.transition = S2.FX.Transitions.linear;
+
+    this.options.transition = Object.propertize(this.options.transition, S2.FX.Transitions);
+  },
+
+  play: function(options) {
+    this.setOptions(options);
+    this.frameCount = 0;
+    this.state = 'idle';
+    this.options.queue.add(this);
+    this.maxFrames = this.options.fps * this.duration / 1000;
+    return this;
+  },
+
+  render: function(timestamp) {
+    if (this.options.debug) {
+    }
+    if (timestamp >= this.startsAt) {
+      if (this.state == 'idle' && S2.FX.ready(this.element)) {
+        this.debug('starting the effect at ' + S2.FX.formatTimestamp(timestamp));
+        this.endsAt = this.startsAt + this.duration;
+        this.start();
+        this.frameCount++;
+        return this;
+      }
+
+      if (timestamp >= this.endsAt && this.state !== 'finished') {
+        this.debug('stopping the effect at ' + S2.FX.formatTimestamp(timestamp));
+        this.finish();
+        return this;
+      }
+
+      if (this.state === 'running') {
+        var position = 1 - (this.endsAt - timestamp) / this.duration;
+        if ((this.maxFrames * position).floor() > this.frameCount) {
+          this.update(this.options.transition(position));
+          this.frameCount++;
+        }
+      }
+    }
+    return this;
+  },
+
+  start: function() {
+    if (this.options.before) this.options.before(this);
+    if (this.setup) this.setup();
+    this.state = 'running';
+    this.update(this.options.transition(0));
+  },
+
+  cancel: function(after) {
+    if (this.state !== 'running') return;
+    if (this.teardown) this.teardown();
+    if (after && this.options.after) this.options.after(this);
+    this.state = 'finished';
+  },
+
+  finish: function() {
+    if (this.state !== 'running') return;
+    this.update(this.options.transition(1));
+    this.cancel(true);
+  },
+
+  inspect: function() {
+    return '#<S2.FX:' + [this.state, this.startsAt, this.endsAt].inspect() + '>';
+  },
+
+  update: Prototype.emptyFunction,
+
+  debug: function(message) {
+    if (!this.options.debug) return;
+    if (window.console && console.log) {
+      console.log(message);
+    }
+  }
+});
+
+S2.FX.Element = Class.create(S2.FX.Base, {
+  initialize: function($super, element, options) {
+    if(!(this.element = $(element)))
+      throw(S2.FX.elementDoesNotExistError);
+    this.operators = [];
+    return $super(options);
+  },
+
+  animate: function() {
+    var args = $A(arguments), operator =  args.shift();
+    operator = operator.charAt(0).toUpperCase() + operator.substring(1);
+    this.operators.push(new S2.FX.Operators[operator](this, args[0], args[1] || {}));
+  },
+
+  play: function($super, element, options) {
+    if (element) this.element = $(element);
+    this.operators = [];
+    return $super(options);
+  },
+
+  update: function(position) {
+    for (var i = 0, operator; operator = this.operators[i]; i++) {
+      operator.render(position);
+    }
+  }
+});
+S2.FX.Heartbeat = Class.create({
+  initialize: function(options) {
+    this.options = Object.extend({
+      framerate: Prototype.Browser.MobileSafari ? 20 : 60
+    }, options);
+    this.beat = this.beat.bind(this);
+  },
+
+  start: function() {
+    if (this.heartbeatInterval) return;
+    this.heartbeatInterval =
+      setInterval(this.beat, 1000/this.options.framerate);
+    this.updateTimestamp();
+  },
+
+  stop: function() {
+    if (!this.heartbeatInterval) return;
+    clearInterval(this.heartbeatInterval);
+    this.heartbeatInterval = null;
+    this.timestamp = null;
+  },
+
+  beat: function() {
+    this.updateTimestamp();
+    document.fire('effect:heartbeat');
+  },
+
+  getTimestamp: function() {
+    return this.timestamp || this.generateTimestamp();
+  },
+
+  generateTimestamp: function() {
+    return new Date().getTime();
+  },
+
+  updateTimestamp: function() {
+    this.timestamp = this.generateTimestamp();
+  }
+});
+S2.FX.Queue = (function(){
+  return function() {
+    var instance = this;
+    var effects = [];
+
+    function getEffects() {
+      return effects;
+    }
+
+    function active() {
+      return effects.length > 0;
+    }
+
+    function add(effect) {
+      calculateTiming(effect);
+      effects.push(effect);
+      document.fire('effect:queued', instance);
+      return instance;
+    }
+
+    function remove(effect) {
+      effects = effects.without(effect);
+      document.fire('effect:dequeued', instance);
+      delete effect;
+      return instance;
+    }
+
+    function render(timestamp) {
+      for (var i = 0, effect; effect = effects[i]; i++) {
+        effect.render(timestamp);
+        if (effect.state === 'finished') remove(effect);
+      }
+
+      return instance;
+    }
+
+    function calculateTiming(effect) {
+      var position = effect.options.position || 'parallel',
+        now = S2.FX.getHeartbeat().getTimestamp();
+
+      var startsAt;
+      if (position === 'end') {
+        startsAt = effects.without(effect).pluck('endsAt').max() || now;
+        if (startsAt < now) startsAt = now;
+      } else {
+        startsAt = now;
+      }
+
+      var delay = (effect.options.delay || 0) * 1000;
+      effect.startsAt = startsAt + delay;
+
+      var duration = (effect.options.duration || 1) * 1000;
+      effect.endsAt = effect.startsAt + duration;
+    }
+
+    Object.extend(instance, {
+      getEffects: getEffects,
+      active: active,
+      add: add,
+      remove: remove,
+      render: render
+    });
+  }
+})();
+
+S2.FX.Attribute = Class.create(S2.FX.Base, {
+  initialize: function($super, object, from, to, options, method) {
+    object = Object.isString(object) ? $(object) : object;
+
+    this.method = Object.isFunction(method) ? method.bind(object) :
+      Object.isFunction(object[method]) ? object[method].bind(object) :
+      function(value) { object[method] = value };
+
+    this.to = to;
+    this.from = from;
+
+    return $super(options);
+  },
+
+  update: function(position) {
+    this.method(this.from.tween(this.to, position));
+  }
+});
+S2.FX.Style = Class.create(S2.FX.Element, {
+  setup: function() {
+    this.animate('style', this.element, { style: this.options.style });
+  }
+});
+S2.FX.Operators = { };
+
+S2.FX.Operators.Base = Class.create({
+  initialize: function(effect, object, options) {
+    this.effect = effect;
+    this.object = object;
+    this.options = Object.extend({
+      transition: Prototype.K
+    }, options);
+  },
+
+  inspect: function() {
+    return "#<S2.FX.Operators.Base:" + this.lastValue + ">";
+  },
+
+  setup: function() {
+  },
+
+  valueAt: function(position) {
+  },
+
+  applyValue: function(value) {
+  },
+
+  render: function(position) {
+    var value = this.valueAt(this.options.transition(position));
+    this.applyValue(value);
+    this.lastValue = value;
+  }
+});
+
+S2.FX.Operators.Style = Class.create(S2.FX.Operators.Base, {
+  initialize: function($super, effect, object, options) {
+    $super(effect, object, options);
+    this.element = $(this.object);
+
+    this.style = Object.isString(this.options.style) ?
+      S2.CSS.parseStyle(this.options.style) : this.options.style;
+
+    var translations = this.options.propertyTransitions || {};
+
+    this.tweens = [];
+
+    for (var item in this.style) {
+      var property = item.underscore().dasherize(),
+       from = this.element.getStyle(property), to = this.style[item];
+
+      if (from != to) {
+        this.tweens.push([
+          property,
+          S2.CSS.interpolate.curry(property, from, to),
+          item in translations ?
+           Object.propertize(translations[item], S2.FX.Transitions) :
+           Prototype.K
+        ]);
+      }
+    }
+  },
+
+  valueAt: function(position) {
+    return this.tweens.map( function(tween){
+      return tween[0] + ':' + tween[1](tween[2](position));
+    }).join(';');
+  },
+
+  applyValue: function(value) {
+    if (this.currentStyle == value) return;
+    this.element.setStyle(value);
+    this.currentStyle = value;
+  }
+});
+
+S2.FX.Morph = Class.create(S2.FX.Element, {
+  setup: function() {
+    if (this.options.change)
+      this.setupWrappers();
+    else if (this.options.style)
+      this.animate('style', this.destinationElement || this.element, {
+        style: this.options.style,
+        propertyTransitions: this.options.propertyTransitions || { }
+      });
+  },
+
+  teardown: function() {
+    if (this.options.change)
+      this.teardownWrappers();
+  },
+
+  setupWrappers: function() {
+    var elementFloat = this.element.getStyle("float"),
+      sourceHeight, sourceWidth,
+      destinationHeight, destinationWidth,
+      maxHeight;
+
+    this.transitionElement = new Element('div').setStyle({ position: "relative", overflow: "hidden", 'float': elementFloat });
+    this.element.setStyle({ 'float': "none" }).insert({ before: this.transitionElement });
+
+    this.sourceElementWrapper = this.element.cloneWithoutIDs().wrap('div');
+    this.destinationElementWrapper = this.element.wrap('div');
+
+    this.transitionElement.insert(this.sourceElementWrapper).insert(this.destinationElementWrapper);
+
+    sourceHeight = this.sourceElementWrapper.getHeight();
+    sourceWidth = this.sourceElementWrapper.getWidth();
+
+    this.options.change();
+
+    destinationHeight = this.destinationElementWrapper.getHeight();
+    destinationWidth  = this.destinationElementWrapper.getWidth();
+
+    this.outerWrapper = new Element("div");
+    this.transitionElement.insert({ before: this.outerWrapper });
+    this.outerWrapper.setStyle({
+      overflow: "hidden", height: sourceHeight + "px", width: sourceWidth + "px"
+    }).appendChild(this.transitionElement);
+
+    maxHeight = Math.max(destinationHeight, sourceHeight), maxWidth = Math.max(destinationWidth, sourceWidth);
+
+    this.transitionElement.setStyle({ height: sourceHeight + "px", width: sourceWidth + "px" });
+    this.sourceElementWrapper.setStyle({ position: "absolute", height: maxHeight + "px", width: maxWidth + "px", top: 0, left: 0 });
+    this.destinationElementWrapper.setStyle({ position: "absolute", height: maxHeight + "px", width: maxWidth + "px", top: 0, left: 0, opacity: 0, zIndex: 2000 });
+
+    this.outerWrapper.insert({ before: this.transitionElement }).remove();
+
+    this.animate('style', this.transitionElement, { style: 'height:' + destinationHeight + 'px; width:' + destinationWidth + 'px' });
+    this.animate('style', this.destinationElementWrapper, { style: 'opacity: 1.0' });
+  },
+
+  teardownWrappers: function() {
+    var destinationElement = this.destinationElementWrapper.down();
+
+    if (destinationElement)
+      this.transitionElement.insert({ before: destinationElement });
+
+    this.transitionElement.remove();
+  }
+});
+S2.FX.Parallel = Class.create(S2.FX.Base, {
+  initialize: function($super, effects, options) {
+    this.effects = effects || [];
+    return $super(options || {});
+  },
+
+  setup: function() {
+    this.effects.invoke('setup');
+  },
+
+  update: function(position) {
+    this.effects.invoke('update', position);
+  }
+});
+
+S2.FX.Operators.Scroll = Class.create(S2.FX.Operators.Base, {
+  initialize: function($super, effect, object, options) {
+    $super(effect, object, options);
+    this.start = object.scrollTop;
+    this.end = this.options.scrollTo;
+  },
+
+  valueAt: function(position) {
+    return this.start + ((this.end - this.start)*position);
+  },
+
+  applyValue: function(value){
+    this.object.scrollTop = value.round();
+  }
+});
+
+S2.FX.Scroll = Class.create(S2.FX.Element, {
+  setup: function() {
+    this.animate('scroll', this.element, { scrollTo: this.options.to });
+  }
+});
+
+S2.FX.SlideDown = Class.create(S2.FX.Element, {
+  setup: function() {
+    var element = this.destinationElement || this.element;
+    var layout = element.getLayout();
+
+    var style = {
+      height:        layout.get('height') + 'px',
+      paddingTop:    layout.get('padding-top') + 'px',
+      paddingBottom: layout.get('padding-bottom') + 'px'
+    };
+
+    element.setStyle({
+      height:         '0',
+      paddingTop:     '0',
+      paddingBottom:  '0',
+      overflow:       'hidden'
+    }).show();
+
+    this.animate('style', element, {
+      style: style,
+      propertyTransitions: {}
+    });
+  },
+
+  teardown: function() {
+    var element = this.destinationElement || this.element;
+    element.setStyle({
+      height:         '',
+      paddingTop:     '',
+      paddingBottom:  '',
+      overflow:       'visible'
+    });
+  }
+});
+
+S2.FX.SlideUp = Class.create(S2.FX.Morph, {
+  setup: function() {
+    var element = this.destinationElement || this.element;
+    var layout = element.getLayout();
+
+    var style = {
+      height:        '0px',
+      paddingTop:    '0px',
+      paddingBottom: '0px'
+    };
+
+    element.setStyle({ overflow: 'hidden' });
+
+    this.animate('style', element, {
+      style: style,
+      propertyTransitions: {}
+    });
+  },
+
+  teardown: function() {
+    var element = this.destinationElement || this.element;
+    element.setStyle({
+      height:         '',
+      paddingTop:     '',
+      paddingBottom:  '',
+      overflow:       'visible'
+    }).hide();
+  }
+});
+
+
+S2.FX.Transitions = {
+
+  linear: Prototype.K,
+
+  sinusoidal: function(pos) {
+    return (-Math.cos(pos*Math.PI)/2) + 0.5;
+  },
+
+  reverse: function(pos) {
+    return 1 - pos;
+  },
+
+  mirror: function(pos, transition) {
+    transition = transition || S2.FX.Transitions.sinusoidal;
+    if(pos<0.5)
+      return transition(pos*2);
+    else
+      return transition(1-(pos-0.5)*2);
+  },
+
+  flicker: function(pos) {
+    var pos = pos + (Math.random()-0.5)/5;
+    return S2.FX.Transitions.sinusoidal(pos < 0 ? 0 : pos > 1 ? 1 : pos);
+  },
+
+  wobble: function(pos) {
+    return (-Math.cos(pos*Math.PI*(9*pos))/2) + 0.5;
+  },
+
+  pulse: function(pos, pulses) {
+    return (-Math.cos((pos*((pulses||5)-.5)*2)*Math.PI)/2) + .5;
+  },
+
+  blink: function(pos, blinks) {
+    return Math.round(pos*(blinks||5)) % 2;
+  },
+
+  spring: function(pos) {
+    return 1 - (Math.cos(pos * 4.5 * Math.PI) * Math.exp(-pos * 6));
+  },
+
+  none: Prototype.K.curry(0),
+
+  full: Prototype.K.curry(1)
+};
+
+/*!
+ *  Copyright (c) 2006 Apple Computer, Inc. All rights reserved.
+ *
+ *  Redistribution and use in source and binary forms, with or without
+ *  modification, are permitted provided that the following conditions are met:
+ *
+ *  1. Redistributions of source code must retain the above copyright notice,
+ *  this list of conditions and the following disclaimer.
+ *
+ *  2. Redistributions in binary form must reproduce the above copyright notice,
+ *  this list of conditions and the following disclaimer in the documentation
+ *  and/or other materials provided with the distribution.
+ *
+ *  3. Neither the name of the copyright holder(s) nor the names of any
+ *  contributors may be used to endorse or promote products derived from
+ *  this software without specific prior written permission.
+ *
+ *  THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ *  "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO,
+ *  THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ *  ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE
+ *  FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+ *  (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+ *  LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON
+ *  ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ *  (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+ *  SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+(function(){
+  function CubicBezierAtTime(t,p1x,p1y,p2x,p2y,duration) {
+    var ax=0,bx=0,cx=0,ay=0,by=0,cy=0;
+    function sampleCurveX(t) {return ((ax*t+bx)*t+cx)*t;};
+    function sampleCurveY(t) {return ((ay*t+by)*t+cy)*t;};
+    function sampleCurveDerivativeX(t) {return (3.0*ax*t+2.0*bx)*t+cx;};
+    function solveEpsilon(duration) {return 1.0/(200.0*duration);};
+    function solve(x,epsilon) {return sampleCurveY(solveCurveX(x,epsilon));};
+    function fabs(n) {if(n>=0) {return n;}else {return 0-n;}};
+    function solveCurveX(x,epsilon) {
+      var t0,t1,t2,x2,d2,i;
+      for(t2=x, i=0; i<8; i++) {x2=sampleCurveX(t2)-x; if(fabs(x2)<epsilon) {return t2;} d2=sampleCurveDerivativeX(t2); if(fabs(d2)<1e-6) {break;} t2=t2-x2/d2;}
+      t0=0.0; t1=1.0; t2=x; if(t2<t0) {return t0;} if(t2>t1) {return t1;}
+      while(t0<t1) {x2=sampleCurveX(t2); if(fabs(x2-x)<epsilon) {return t2;} if(x>x2) {t0=t2;}else {t1=t2;} t2=(t1-t0)*.5+t0;}
+      return t2; // Failure.
+    };
+    cx=3.0*p1x; bx=3.0*(p2x-p1x)-cx; ax=1.0-cx-bx; cy=3.0*p1y; by=3.0*(p2y-p1y)-cy; ay=1.0-cy-by;
+    return solve(t, solveEpsilon(duration));
+  }
+  S2.FX.cubicBezierTransition = function(x1, y1, x2, y2){
+    return (function(pos){
+      return CubicBezierAtTime(pos,x1,y1,x2,y2,1);
+    });
+  }
+})();
+
+S2.FX.Transitions.webkitCubic =
+  S2.FX.cubicBezierTransition(0.25,0.1,0.25,1);
+S2.FX.Transitions.webkitEaseInOut =
+  S2.FX.cubicBezierTransition(0.42,0.0,0.58,1.0);
+
+/*!
+ *  TERMS OF USE - EASING EQUATIONS
+ *  Open source under the BSD License.
+ *  Easing Equations (c) 2003 Robert Penner, all rights reserved.
+ */
+
+Object.extend(S2.FX.Transitions, {
+  easeInQuad: function(pos){
+     return Math.pow(pos, 2);
+  },
+
+  easeOutQuad: function(pos){
+    return -(Math.pow((pos-1), 2) -1);
+  },
+
+  easeInOutQuad: function(pos){
+    if ((pos/=0.5) < 1) return 0.5*Math.pow(pos,2);
+    return -0.5 * ((pos-=2)*pos - 2);
+  },
+
+  easeInCubic: function(pos){
+    return Math.pow(pos, 3);
+  },
+
+  easeOutCubic: function(pos){
+    return (Math.pow((pos-1), 3) +1);
+  },
+
+  easeInOutCubic: function(pos){
+    if ((pos/=0.5) < 1) return 0.5*Math.pow(pos,3);
+    return 0.5 * (Math.pow((pos-2),3) + 2);
+  },
+
+  easeInQuart: function(pos){
+    return Math.pow(pos, 4);
+  },
+
+  easeOutQuart: function(pos){
+    return -(Math.pow((pos-1), 4) -1)
+  },
+
+  easeInOutQuart: function(pos){
+    if ((pos/=0.5) < 1) return 0.5*Math.pow(pos,4);
+    return -0.5 * ((pos-=2)*Math.pow(pos,3) - 2);
+  },
+
+  easeInQuint: function(pos){
+    return Math.pow(pos, 5);
+  },
+
+  easeOutQuint: function(pos){
+    return (Math.pow((pos-1), 5) +1);
+  },
+
+  easeInOutQuint: function(pos){
+    if ((pos/=0.5) < 1) return 0.5*Math.pow(pos,5);
+    return 0.5 * (Math.pow((pos-2),5) + 2);
+  },
+
+  easeInSine: function(pos){
+    return -Math.cos(pos * (Math.PI/2)) + 1;
+  },
+
+  easeOutSine: function(pos){
+    return Math.sin(pos * (Math.PI/2));
+  },
+
+  easeInOutSine: function(pos){
+    return (-.5 * (Math.cos(Math.PI*pos) -1));
+  },
+
+  easeInExpo: function(pos){
+    return (pos==0) ? 0 : Math.pow(2, 10 * (pos - 1));
+  },
+
+  easeOutExpo: function(pos){
+    return (pos==1) ? 1 : -Math.pow(2, -10 * pos) + 1;
+  },
+
+  easeInOutExpo: function(pos){
+    if(pos==0) return 0;
+    if(pos==1) return 1;
+    if((pos/=0.5) < 1) return 0.5 * Math.pow(2,10 * (pos-1));
+    return 0.5 * (-Math.pow(2, -10 * --pos) + 2);
+  },
+
+  easeInCirc: function(pos){
+    return -(Math.sqrt(1 - (pos*pos)) - 1);
+  },
+
+  easeOutCirc: function(pos){
+    return Math.sqrt(1 - Math.pow((pos-1), 2))
+  },
+
+  easeInOutCirc: function(pos){
+    if((pos/=0.5) < 1) return -0.5 * (Math.sqrt(1 - pos*pos) - 1);
+    return 0.5 * (Math.sqrt(1 - (pos-=2)*pos) + 1);
+  },
+
+  easeOutBounce: function(pos){
+    if ((pos) < (1/2.75)) {
+      return (7.5625*pos*pos);
+    } else if (pos < (2/2.75)) {
+      return (7.5625*(pos-=(1.5/2.75))*pos + .75);
+    } else if (pos < (2.5/2.75)) {
+      return (7.5625*(pos-=(2.25/2.75))*pos + .9375);
+    } else {
+      return (7.5625*(pos-=(2.625/2.75))*pos + .984375);
+    }
+  },
+
+  easeInBack: function(pos){
+    var s = 1.70158;
+    return (pos)*pos*((s+1)*pos - s);
+  },
+
+  easeOutBack: function(pos){
+    var s = 1.70158;
+    return (pos=pos-1)*pos*((s+1)*pos + s) + 1;
+  },
+
+  easeInOutBack: function(pos){
+    var s = 1.70158;
+    if((pos/=0.5) < 1) return 0.5*(pos*pos*(((s*=(1.525))+1)*pos -s));
+    return 0.5*((pos-=2)*pos*(((s*=(1.525))+1)*pos +s) +2);
+  },
+
+  elastic: function(pos) {
+    return -1 * Math.pow(4,-8*pos) * Math.sin((pos*6-1)*(2*Math.PI)/2) + 1;
+  },
+
+  swingFromTo: function(pos) {
+    var s = 1.70158;
+    return ((pos/=0.5) < 1) ? 0.5*(pos*pos*(((s*=(1.525))+1)*pos - s)) :
+      0.5*((pos-=2)*pos*(((s*=(1.525))+1)*pos + s) + 2);
+  },
+
+  swingFrom: function(pos) {
+    var s = 1.70158;
+    return pos*pos*((s+1)*pos - s);
+  },
+
+  swingTo: function(pos) {
+    var s = 1.70158;
+    return (pos-=1)*pos*((s+1)*pos + s) + 1;
+  },
+
+  bounce: function(pos) {
+    if (pos < (1/2.75)) {
+        return (7.5625*pos*pos);
+    } else if (pos < (2/2.75)) {
+        return (7.5625*(pos-=(1.5/2.75))*pos + .75);
+    } else if (pos < (2.5/2.75)) {
+        return (7.5625*(pos-=(2.25/2.75))*pos + .9375);
+    } else {
+        return (7.5625*(pos-=(2.625/2.75))*pos + .984375);
+    }
+  },
+
+  bouncePast: function(pos) {
+    if (pos < (1/2.75)) {
+        return (7.5625*pos*pos);
+    } else if (pos < (2/2.75)) {
+        return 2 - (7.5625*(pos-=(1.5/2.75))*pos + .75);
+    } else if (pos < (2.5/2.75)) {
+        return 2 - (7.5625*(pos-=(2.25/2.75))*pos + .9375);
+    } else {
+        return 2 - (7.5625*(pos-=(2.625/2.75))*pos + .984375);
+    }
+  },
+
+  easeFromTo: function(pos) {
+    if ((pos/=0.5) < 1) return 0.5*Math.pow(pos,4);
+    return -0.5 * ((pos-=2)*Math.pow(pos,3) - 2);
+  },
+
+  easeFrom: function(pos) {
+    return Math.pow(pos,4);
+  },
+
+  easeTo: function(pos) {
+    return Math.pow(pos,0.25);
+  }
+});
+(function(FX) {
+
+  Hash.addMethods({
+    hasKey: function(key) {
+      return (key in this._object);
+    }
+  });
+
+  var supported = false;
+  var hardwareAccelerationSupported = false;
+  var transitionEndEventName = null;
+
+  function isHWAcceleratedSafari() {
+    var ua = navigator.userAgent, av = navigator.appVersion;
+    return (!ua.include('Chrome') && av.include('10_6')) ||
+     Prototype.Browser.MobileSafari;
+  }
+
+  (function() {
+    var eventNames = {
+      'WebKitTransitionEvent': 'webkitTransitionEnd',
+      'TransitionEvent': 'transitionend'
+    };
+    if (S2.CSS.VENDOR.PREFIX) {
+      var p = S2.CSS.VENDOR.PREFIX;
+      eventNames[p + 'TransitionEvent'] = p + 'TransitionEnd';
+    }
+
+    for (var e in eventNames) {
+      try {
+        document.createEvent(e);
+        transitionEndEventName = eventNames[e];
+        supported = true;
+        if (e == 'WebKitTransitionEvent') {
+          hardwareAccelerationSupported = isHWAcceleratedSafari();
+        }
+        return;
+      } catch (ex) { }
+    }
+  })();
+
+  if (!supported) return;
+
+
+  Prototype.BrowserFeatures.CSSTransitions = true;
+  S2.Extensions.CSSTransitions = true;
+  S2.Extensions.HardwareAcceleratedCSSTransitions = hardwareAccelerationSupported;
+
+  if (hardwareAccelerationSupported) {
+    Object.extend(FX.DefaultOptions, { accelerate: true });
+  }
+
+  function v(prop) {
+    return S2.CSS.vendorizeProperty(prop);
+  }
+
+  var CSS_TRANSITIONS_PROPERTIES = $w(
+   'border-top-left-radius border-top-right-radius ' +
+   'border-bottom-left-radius border-bottom-right-radius ' +
+   'background-size transform'
+  ).map( function(prop) {
+    return v(prop).camelize();
+  });
+
+  CSS_TRANSITIONS_PROPERTIES.each(function(property) {
+    S2.CSS.PROPERTIES.push(property);
+  });
+
+  S2.CSS.NUMERIC_PROPERTIES = S2.CSS.PROPERTIES.findAll(function(property) {
+    return !property.endsWith('olor')
+  });
+
+  CSS_TRANSITIONS_HARDWARE_ACCELERATED_PROPERTIES =
+   S2.Extensions.HardwareAcceleratedCSSTransitions ?
+    $w('top left bottom right opacity') : [];
+
+  var TRANSLATE_TEMPLATE = new Template("translate(#{0}px, #{1}px)");
+
+
+  var Operators = FX.Operators;
+
+  Operators.CssTransition = Class.create(Operators.Base, {
+    initialize: function($super, effect, object, options) {
+      $super(effect, object, options);
+      this.element = $(this.object);
+
+      var style = this.options.style;
+
+      this.style = Object.isString(style) ?
+       S2.CSS.normalize(this.element, style) : style;
+
+      this.style = $H(this.style);
+
+      this.targetStyle = S2.CSS.serialize(this.style);
+      this.running = false;
+    },
+
+    _canHardwareAccelerate: function() {
+      if (this.effect.options.accelerate === false) return false;
+
+      var style = this.style.toObject(), keys = this.style.keys();
+      var element = this.element;
+
+      if (keys.length === 0) return false;
+
+      var otherPropertyExists = keys.any( function(key) {
+        return !CSS_TRANSITIONS_HARDWARE_ACCELERATED_PROPERTIES.include(key);
+      });
+
+      if (otherPropertyExists) return false;
+
+      var currentStyles = {
+        left:   element.getStyle('left'),
+        right:  element.getStyle('right'),
+        top:    element.getStyle('top'),
+        bottom: element.getStyle('bottom')
+      };
+
+      function hasTwoPropertiesOnSameAxis(obj) {
+        if (obj.top && obj.bottom) return true;
+        if (obj.left && obj.right) return true;
+        return false;
+      }
+
+      if (hasTwoPropertiesOnSameAxis(currentStyles)) return false;
+      if (hasTwoPropertiesOnSameAxis(style))         return false;
+
+      return true;
+    },
+
+    _adjustForHardwareAcceleration: function(style) {
+      var dx = 0, dy = 0;
+
+      $w('top bottom left right').each( function(prop) {
+        if (!style.hasKey(prop)) return;
+        var current = window.parseInt(this.element.getStyle(prop), 10);
+        var target  = window.parseInt(style.get(prop), 10);
+
+        if (prop === 'top') {
+          dy += (target - current);
+        } else if (prop === 'bottom') {
+          dy += (current - target);
+        } else if (prop === 'left') {
+          dx += (target - current);
+        } else if (prop === 'right') {
+          dx += (current - target);
+        }
+
+        style.unset(prop);
+      }, this);
+
+      var transformProperty = v('transform');
+
+      if (dx !== 0 || dy !== 0) {
+        var translation = TRANSLATE_TEMPLATE.evaluate([dx, dy]);
+        style.set(transformProperty, translation);
+      }
+
+      this.targetStyle += transformProperty + ': translate(0px, 0px);';
+      return style;
+    },
+
+    render: function() {
+      if (this.running === true) return;
+      var style = this.style.clone(), effect = this.effect;
+      if (this._canHardwareAccelerate()) {
+        effect.accelerated = true;
+        style = this._adjustForHardwareAcceleration(style);
+      } else {
+        effect.accelerated = false;
+      }
+
+      var s = this.element.style;
+
+      var original = {};
+      $w('transition-property transition-duration transition-timing-function').each( function(prop) {
+        prop = v(prop).camelize();
+        original[prop] = s[prop];
+      });
+
+      this.element.store('s2.targetStyle', this.targetStyle);
+
+      this.element.store('s2.originalTransitionStyle', original);
+
+      s[v('transition-property').camelize()] = style.keys().join(',');
+      s[v('transition-duration').camelize()] = (effect.duration / 1000).toFixed(3) + 's';
+      s[v('transition-timing-function').camelize()] = timingFunctionForTransition(effect.options.transition);
+
+      if (Prototype.Browser.Opera) {
+        this._setStyle.bind(this).defer(style.toObject());
+      } else this._setStyle(style.toObject());
+      this.running = true;
+
+      this.render = Prototype.emptyFunction;
+    },
+
+    _setStyle: function(style) {
+      this.element.setStyle(style);
+    }
+  });
+
+  Operators.CssTransition.TIMING_MAP = {
+    linear:     'linear',
+    sinusoidal: 'ease-in-out'
+  };
+
+  function timingFunctionForTransition(transition) {
+    var timing = null, MAP = FX.Operators.CssTransition.TIMING_MAP;
+
+    for (var t in MAP) {
+      if (FX.Transitions[t] === transition) {
+        timing = MAP[t];
+        break;
+      }
+    }
+    return timing;
+  }
+
+  function isCSSTransitionCompatible(effect) {
+    if (!S2.Extensions.CSSTransitions) return false;
+    var opt = effect.options;
+
+    if ((opt.engine || '') === 'javascript') return false;
+
+    if (!timingFunctionForTransition(opt.transition)) return false;
+
+    if (opt.propertyTransitions) return false;
+
+    return true;
+  };
+
+  FX.Morph = Class.create(FX.Morph, {
+    setup: function() {
+      if (this.options.change) {
+        this.setupWrappers();
+      } else if (this.options.style) {
+        this.engine  = 'javascript';
+        var operator = 'style';
+
+        var style = Object.isString(this.options.style) ?
+         S2.CSS.parseStyle(this.options.style) : style;
+
+        var normalizedStyle = S2.CSS.normalize(
+         this.destinationElement || this.element, style);
+
+        var changesStyle = Object.keys(normalizedStyle).length > 0;
+
+        if (changesStyle && isCSSTransitionCompatible(this)) {
+          this.engine = 'css-transition';
+          operator    = 'CssTransition';
+
+          this.update = function(position) {
+            this.element.store('s2.effect', this);
+
+            S2.FX.setReady(this.element, false);
+
+            for (var i = 0, operator; operator = this.operators[i]; i++) {
+              operator.render(position);
+            }
+
+            this.render = Prototype.emptyFunction;
+          }
+        }
+
+        this.animate(operator, this.destinationElement || this.element, {
+          style: this.options.style,
+          propertyTransitions: this.options.propertyTransitions || { }
+        });
+      }
+    }
+  });
+
+  document.observe(transitionEndEventName, function(event) {
+    var element = event.element();
+    if (!element) return;
+
+    var effect = element.retrieve('s2.effect');
+
+    if (!effect || effect.state === 'finished') return;
+
+    function adjust(element, effect){
+      var targetStyle = element.retrieve('s2.targetStyle');
+      if (!targetStyle) return;
+
+      element.setStyle(targetStyle);
+
+      var originalTransitionStyle = element.retrieve('s2.originalTransitionStyle');
+
+      var storage = element.getStorage();
+      storage.unset('s2.targetStyle');
+      storage.unset('s2.originalTransitionStyle');
+      storage.unset('s2.effect');
+
+      if (originalTransitionStyle) {
+        element.setStyle(originalTransitionStyle);
+      }
+      S2.FX.setReady(element);
+    }
+
+    var durationProperty = v('transition-duration').camelize();
+    element.style[durationProperty] = '';
+    adjust(element, effect);
+
+    effect.state = 'finished';
+
+    var after = effect.options.after;
+    if (after) after(effect);
+  });
+})(S2.FX);
+
+Element.__scrollTo = Element.scrollTo;
+Element.addMethods({
+  scrollTo: function(element, to, options){
+    if(arguments.length == 1) return Element.__scrollTo(element);
+    new S2.FX.Scroll(element, Object.extend(options || {}, { to: to })).play();
+    return element;
+  }
+});
+
+Element.addMethods({
+  effect: function(element, effect, options){
+    if (Object.isFunction(effect))
+      effect = new effect(element, options);
+    else if (Object.isString(effect))
+      effect = new S2.FX[effect.charAt(0).toUpperCase() + effect.substring(1)](element, options);
+    effect.play(element, options);
+    return element;
+  },
+
+  morph: function(element, style, options) {
+    options = S2.FX.parseOptions(options);
+    if (!options.queue) {
+      options.queue = element.retrieve('S2.FX.Queue');
+      if (!options.queue) {
+        element.store('S2.FX.Queue', options.queue = new S2.FX.Queue());
+      }
+    }
+    if (!options.position) options.position = 'end';
+    return element.effect('morph', Object.extend(options, { style: style }));
+  }.optionize(),
+
+  appear: function(element, options){
+    return element.setStyle('opacity: 0;').show().morph('opacity: 1', options);
+  },
+
+  fade: function(element, options){
+    options = Object.extend({
+      after: Element.hide.curry(element)
+    }, options || {});
+    return element.morph('opacity: 0', options);
+  },
+
+  cloneWithoutIDs: function(element) {
+    element = $(element);
+    var clone = element.cloneNode(true);
+    clone.id = '';
+    $(clone).select('*[id]').each(function(e) { e.id = ''; });
+    return clone;
+  }
+});
+
+(function(){
+  var transform;
+
+  if(window.CSSMatrix) transform = function(element, transform){
+    element.style.transform = 'scale('+(transform.scale||1)+') rotate('+(transform.rotation||0)+'rad)';
+    return element;
+  };
+  else if(window.WebKitCSSMatrix) transform = function(element, transform){
+    element.style.webkitTransform = 'scale('+(transform.scale||1)+') rotate('+(transform.rotation||0)+'rad)';
+    return element;
+  };
+  else if(Prototype.Browser.Gecko) transform = function(element, transform){
+    element.style.MozTransform = 'scale('+(transform.scale||1)+') rotate('+(transform.rotation||0)+'rad)';
+    return element;
+  };
+  else if(Prototype.Browser.IE) transform = function(element, transform){
+    if(!element._oDims)
+      element._oDims = [element.offsetWidth, element.offsetHeight];
+    var c = Math.cos(transform.rotation||0) * 1, s = Math.sin(transform.rotation||0) * 1,
+        filter = "progid:DXImageTransform.Microsoft.Matrix(sizingMethod='auto expand',M11="+c+",M12="+(-s)+",M21="+s+",M22="+c+")";
+    element.style.filter = filter;
+    element.style.marginLeft = (element._oDims[0]-element.offsetWidth)/2+'px';
+    element.style.marginTop = (element._oDims[1]-element.offsetHeight)/2+'px';
+    return element;
+  };
+  else transform = function(element){ return element; }
+
+  Element.addMethods({ transform: transform });
+})();
+
+S2.viewportOverlay = function(){
+  var viewport = document.viewport.getDimensions(),
+    offsets = document.viewport.getScrollOffsets();
+  return new Element('div').setStyle({
+    position: 'absolute',
+    left: offsets.left + 'px', top: offsets.top + 'px',
+    width: viewport.width + 'px', height: viewport.height + 'px'
+  });
+};
+S2.FX.Helpers = {
+  fitIntoRectangle: function(w, h, rw, rh){
+    var f = w/h, rf = rw/rh; return f < rf ?
+      [(rw - (w*(rh/h)))/2, 0, w*(rh/h), rh] :
+      [0, (rh - (h*(rw/w)))/2, rw, h*(rw/w)];
+  }
+};
+
+S2.FX.Operators.Zoom = Class.create(S2.FX.Operators.Style, {
+  initialize: function($super, effect, object, options) {
+    var viewport = document.viewport.getDimensions(),
+      offsets = document.viewport.getScrollOffsets(),
+      dims = object.getDimensions(),
+      f = S2.FX.Helpers.fitIntoRectangle(dims.width, dims.height,
+      viewport.width - (options.borderWidth || 0)*2,
+      viewport.height - (options.borderWidth || 0)*2);
+
+    Object.extend(options, { style: {
+      left: f[0] + (options.borderWidth || 0) + offsets.left + 'px',
+      top: f[1] + (options.borderWidth || 0) + offsets.top + 'px',
+      width: f[2] + 'px', height: f[3] + 'px'
+    }});
+    $super(effect, object, options);
+  }
+});
+
+S2.FX.Zoom = Class.create(S2.FX.Element, {
+  setup: function() {
+    this.clone = this.element.cloneWithoutIDs();
+    this.element.insert({before:this.clone});
+    this.clone.absolutize().setStyle({zIndex:9999});
+
+    this.overlay = S2.viewportOverlay();
+    if (this.options.overlayClassName)
+      this.overlay.addClassName(this.options.overlayClassName)
+    else
+      this.overlay.setStyle({backgroundColor: '#000', opacity: '0.9'});
+    $$('body')[0].insert(this.overlay);
+
+    this.animate('zoom', this.clone, {
+      borderWidth: this.options.borderWidth,
+      propertyTransitions: this.options.propertyTransitions || { }
+    });
+  },
+  teardown: function() {
+    this.clone.observe('click', function() {
+      this.overlay.remove();
+      this.clone.morph('opacity:0', {
+        duration: 0.2,
+        after: function() {
+          this.clone.remove();
+        }.bind(this)
+      })
+    }.bind(this));
+  }
+});
+
+
+S2.UI = {};
+
+S2.UI.Mixin = {};
+
+
+Object.deepExtend = function(destination, source) {
+  for (var property in source) {
+    if (source[property] && source[property].constructor &&
+     source[property].constructor === Object) {
+      destination[property] = destination[property] || {};
+      arguments.callee(destination[property], source[property]);
+    } else {
+      destination[property] = source[property];
+    }
+  }
+  return destination;
+};
+
+S2.UI.Mixin.Configurable = {
+  setOptions: function(options) {
+    if (!this.options) {
+      this.options = {};
+      var constructor = this.constructor;
+      if (constructor.superclass) {
+        var chain = [], klass = constructor;
+        while (klass = klass.superclass)
+          chain.push(klass);
+        chain = chain.reverse();
+
+        for (var i = 0, l = chain.length; i < l; i++)
+          Object.deepExtend(this.options, chain[i].DEFAULT_OPTIONS || {});
+      }
+
+      Object.deepExtend(this.options, constructor.DEFAULT_OPTIONS || {});
+    }
+    return Object.deepExtend(this.options, options || {});
+  }
+};
+
+S2.UI.Mixin.Trackable = {
+  register: function() {
+    var klass = this.constructor;
+    if (!klass.instances) {
+      klass.instances = [];
+    }
+    if (!klass.instances.include(this)) {
+      klass.instances.push(this);
+    }
+
+    if (Object.isFunction(klass.onRegister)) {
+      klass.onRegister.call(klass, this);
+    }
+  },
+
+  unregister: function() {
+    var klass = this.constructor;
+    klass.instances = klass.instances.without(this);
+    if (Object.isFunction(klass.onRegister)) {
+      klass.onUnregister.call(klass, this);
+    }
+  }
+};
+
+(function() {
+  var METHODS = $w('observe stopObserving show hide ' +
+   'addClassName removeClassName hasClassName setStyle getStyle' +
+   'writeAttribute readAttribute fire');
+
+  var E = {};
+
+  METHODS.each( function(name) {
+    E[name] = function() {
+      var element = this.toElement();
+      return element[name].apply(element, arguments);
+    };
+  });
+
+  E.on = function() {
+    if (!this.__observers) this.__observers = [];
+    var element = this.toElement();
+    var result = element.on.apply(element, arguments);
+    this.__observers.push(result);
+  };
+
+  window.S2.UI.Mixin.Element = E;
+})();
+
+
+S2.UI.Mixin.Shim = {
+  __SHIM_TEMPLATE: new Template(
+    "<iframe frameborder='0' tabindex='-1' src='javascript:false;' " +
+      "style='display:block;position:absolute;z-index:-1;overflow:hidden; " +
+      "filter:Alpha(Opacity=\"0\");" +
+      "top:expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\');" +
+       "left:expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\');" +
+       "width:expression(this.parentNode.offsetWidth+\'px\');" +
+       "height:expression(this.parentNode.offsetHeight+\'px\');" +
+    "' id='#{0}'></iframe>"
+  ),
+
+  createShim: function(element) {
+    this.__shim_isie6 = (Prototype.Browser.IE &&
+     (/6.0/).test(navigator.userAgent));
+    if (!this.__shim_isie6) return;
+
+    element = $(element || this.element);
+    if (!element) return;
+
+    this.__shimmed = element;
+
+    var id = element.identify() + '_iframeshim', shim = $(id);
+
+    if (shim) shim.remove();
+
+    element.insert({
+      top: this.__SHIM_TEMPLATE.evaluate([id])
+    });
+
+    this.__shim_id = id;
+  },
+
+  adjustShim: function() {
+    if (!this.__shim_isie6) return;
+    var shim = this.__shimmed.down('iframe#' + this.__shim_id);
+    var element = this.__shimmed;
+    if (!shim) return;
+
+    shim.setStyle({
+      width:  element.offsetWidth  + 'px',
+      height: element.offsetHeight + 'px'
+    });
+  },
+
+  destroyShim: function() {
+    if (!this.__shim_isie6) return;
+    var shim = this.__shimmed.down('iframe#' + this.__shim_id);
+    if (shim) {
+      shim.remove();
+    }
+
+    this.__shimmed = null;
+  }
+};
+
+Object.extend(S2.UI, {
+  addClassNames: function(elements, classNames) {
+    if (Object.isElement(elements)) {
+      elements = [elements];
+    }
+
+    if (Object.isString(classNames)) {
+      classNames = classNames.split(' ');
+    }
+
+    var j, className;
+    for (var i = 0, element; element = elements[i]; i++) {
+      for (j = 0; className = classNames[j]; j++) {
+        Element.addClassName(element, className);
+      }
+    }
+
+    return elements;
+  },
+
+  removeClassNames: function(elements, classNames) {
+    if (Object.isElement(elements)) {
+      elements = [elements];
+    }
+
+    if (Object.isString(classNames)) {
+      classNames = classNames.split(' ');
+    }
+
+    var j, className;
+    for (var i = 0, element; element = elements[i]; i++) {
+      for (j = 0; className = classNames[j]; j++) {
+        Element.removeClassName(element, className);
+      }
+    }
+  },
+
+  FOCUSABLE_ELEMENTS: $w('input select textarea button object'),
+
+  isFocusable: function(element) {
+    var name = element.nodeName.toLowerCase(),
+     tabIndex = element.readAttribute('tabIndex'),
+     isFocusable = false;
+
+    if (S2.UI.FOCUSABLE_ELEMENTS.include(name)) {
+      isFocusable = !element.disabled;
+    } else if (name === 'a' || name === 'area') {
+      isFocusable = element.href || (tabIndex && !isNaN(tabIndex));
+    } else {
+      isFocusable = tabIndex && !isNaN(tabIndex);
+    }
+    return !!isFocusable && S2.UI.isVisible(element);
+  },
+
+
+  makeFocusable: function(elements, shouldBeFocusable) {
+    if (Object.isElement(elements)) {
+      elements = [elements];
+    }
+
+    var value = shouldBeFocusable ? '0' : '-1';
+    for (var i = 0, element; element = elements[i]; i++) {
+      $(element).writeAttribute('tabIndex', value);
+    }
+  },
+
+  findFocusables: function(element) {
+    return $(element).descendants().select(S2.UI.isFocusable);
+  },
+
+  isVisible: function(element) {
+    element = $(element);
+    var originalElement = element;
+
+    while (element && element.parentNode) {
+      var display = element.getStyle('display'),
+       visibility = element.getStyle('visibility');
+
+      if (display === 'none' || visibility === 'hidden') {
+        return false;
+      }
+      element = $(element.parentNode);
+    }
+    return true;
+  },
+
+  makeVisible: function(elements, shouldBeVisible) {
+    if (Object.isElement(elements)) {
+      elements = [elements];
+    }
+
+    var newValue = shouldBeVisible ? "visible": "hidden";
+    for (var i = 0, element; element = elements[i]; i++) {
+      element.setStyle({ 'visibility': newValue });
+    }
+
+    return elements;
+  },
+
+  modifierUsed: function(event) {
+    return event.metaKey || event.ctrlKey || event.altKey;
+  },
+
+  getText: function(element) {
+    element = $(element);
+    return element.innerText && !window.opera ? element.innerText :
+     element.innerHTML.stripScripts().unescapeHTML().replace(/[\n\r\s]+/g, ' ');
+  }
+});
+
+(function() {
+  var IGNORED_ELEMENTS = [];
+  function _textSelectionHandler(event) {
+    var element = Event.element(event);
+    if (!element) return;
+    for (var i = 0, node; node = IGNORED_ELEMENTS[i]; i++) {
+      if (element === node || element.descendantOf(node)) {
+        Event.stop(event);
+        break;
+      }
+    }
+  }
+
+  if (document.attachEvent) {
+    document.onselectstart = _textSelectionHandler.bindAsEventListener(window);
+  } else {
+  }
+
+  Object.extend(S2.UI, {
+    enableTextSelection: function(element) {
+      element.setStyle({
+        '-moz-user-select': '',
+        '-webkit-user-select': '',
+        'user-select': ''
+      });
+      IGNORED_ELEMENTS = IGNORED_ELEMENTS.without(element);
+      return element;
+    },
+
+    disableTextSelection: function(element) {
+      element.setStyle({
+        '-moz-user-select': 'none',
+        '-webkit-user-select': 'none',
+        'user-select': ''
+      });
+      if (!IGNORED_ELEMENTS.include(element)) {
+        IGNORED_ELEMENTS.push(element);
+      }
+      return element;
+    }
+  });
+})();
+S2.UI.Behavior = Class.create(S2.UI.Mixin.Configurable, {
+  initialize: function(element, options) {
+    this.element = element;
+    this.setOptions(options);
+
+    Object.extend(this, options);
+
+    this._observers = {};
+
+    function isEventHandler(eventName) {
+      return eventName.startsWith('on') || eventName.include('/on');
+    }
+
+    var parts, element, name, handler;
+    for (var eventName in this) {
+      if (!isEventHandler(eventName)) continue;
+
+      parts = eventName.split('/');
+      if (parts.length === 2) {
+        element = this[parts.first()] || this.element;
+      } else {
+        element = this.element;
+      }
+      name = parts.last();
+
+      handler = this._observers[name] = this[eventName].bind(this);
+      element.observe(name.substring(2), handler);
+    }
+  },
+
+  destroy: function() {
+    var element = this.options.proxy || this.element;
+    var handler;
+    for (var eventName in this._observers) {
+      handler = this._observers[eventName];
+      element.stopObserving(eventName.substring(2), handler);
+    }
+  }
+});
+
+
+Object.extend(S2.UI, {
+  addBehavior: function(element, behaviorClass, options) {
+    var self = arguments.callee;
+    if (Object.isArray(element)) {
+      element.each( function(el) { self(el, behaviorClass, options); });
+      return;
+    }
+
+    if (Object.isArray(behaviorClass)) {
+      behaviorClass.each( function(klass) { self(element, klass, options ); });
+      return;
+    }
+
+    var instance = new behaviorClass(element, options || {});
+    var behaviors = $(element).retrieve('ui.behaviors', []);
+    behaviors.push(instance);
+  },
+
+  removeBehavior: function(element, behaviorClass) {
+    var self = arguments.callee;
+    if (Object.isArray(element)) {
+      element.each( function(el) { self(el, behaviorClass); });
+      return;
+    }
+
+    if (Object.isArray(behaviorClass)) {
+      behaviorClass.each( function(klass) { self(element, klass); });
+      return;
+    }
+
+    var behaviors = $(element).retrieve('ui.behaviors', []);
+    var shouldBeRemoved = [];
+    for (var i = 0, behavior; behavior = behaviors[i]; i++) {
+      if (!behavior instanceof behaviorClass) continue;
+      behavior.destroy();
+      shouldBeRemoved.push(behavior);
+    }
+    $(element).store('ui.behaviors', behaviors.without(shouldBeRemoved));
+  },
+
+
+  getBehavior: function(element, behaviorClass) {
+    element = $(element);
+
+    var behaviors = element.retrieve('ui.behaviors', []);
+    for (var i = 0, l = behaviors.length, b; i < l; i++) {
+      b = behaviors[i];
+      if (b.constructor === behaviorClass) return b;
+    }
+
+    return null;
+  }
+});
+
+S2.UI.Behavior.Drag = Class.create(S2.UI.Behavior, {
+  initialize: function($super, element, options) {
+    this.__onmousemove = this._onmousemove.bind(this);
+    $super(element, options);
+    this.element.addClassName('ui-draggable');
+  },
+
+  destroy: function($super) {
+    this.element.removeClassName('ui-draggable');
+    $super();
+  },
+
+  "handle/onmousedown": function(event) {
+    var element = this.element;
+    this._startPointer  = event.pointer();
+    this._startPosition = {
+      left: window.parseInt(element.getStyle('left'), 10),
+      top:  window.parseInt(element.getStyle('top'),  10)
+    };
+    document.observe('mousemove', this.__onmousemove);
+  },
+
+  "handle/onmouseup": function(event) {
+    this._startPointer  = null;
+    this._startPosition = null;
+    document.stopObserving('mousemove', this.__onmousemove);
+  },
+
+  _onmousemove: function(event) {
+    var pointer = event.pointer();
+
+    if (!this._startPointer) return;
+
+    var delta = {
+      x: pointer.x - this._startPointer.x,
+      y: pointer.y - this._startPointer.y
+    };
+
+    var newPosition = {
+      left: (this._startPosition.left + delta.x) + 'px',
+      top:  (this._startPosition.top  + delta.y) + 'px'
+    };
+
+    this.element.setStyle(newPosition);
+  }
+});
+S2.UI.Behavior.Focus = Class.create(S2.UI.Behavior, {
+  onfocus: function(event) {
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.addClassName('ui-state-focus');
+  },
+
+  onblur: function(event) {
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.removeClassName('ui-state-focus');
+  }
+});
+S2.UI.Behavior.Hover = Class.create(S2.UI.Behavior, {
+  onmouseenter: function(event) {
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.addClassName('ui-state-hover');
+  },
+
+  onmouseleave: function(event) {
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.removeClassName('ui-state-hover');
+  }
+});
+S2.UI.Behavior.Resize = Class.create(S2.UI.Behavior, {
+  initialize: function(element, options) {
+  }
+});
+S2.UI.Behavior.Down = Class.create(S2.UI.Behavior, {
+  _isRelevantKey: function(event) {
+    var code = event.keyCode;
+    return (code === Event.KEY_RETURN || code === Event.KEY_SPACE);
+  },
+
+  onkeydown: function(event) {
+    if (!this._isRelevantKey(event)) return;
+    this.onmousedown(event);
+  },
+
+  onkeyup: function(event) {
+    if (!this._isRelevantKey(event)) return;
+    this.onmouseup(event);
+  },
+
+  onmousedown: function(event) {
+    this._down = true;
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.addClassName('ui-state-down');
+  },
+
+  onmouseup: function(event) {
+    this._down = false;
+    if (this.element.hasClassName('ui-state-disabled')) return;
+    this.element.removeClassName('ui-state-down');
+  },
+
+  onmouseleave: function(event) {
+    return this.onmouseup(event);
+  },
+
+  onmouseenter: function(event) {
+    if (this._down) {
+      return this.onmousedown(event);
+    }
+  }
+});
+
+
+
+(function(UI) {
+
+  UI.Base = Class.create(UI.Mixin.Configurable, {
+    NAME: "S2.UI.Base",
+
+    initialize:      Function.ABSTRACT,
+
+    addObservers:    Function.ABSTRACT,
+
+    removeObservers: function() {
+      if (this.__observers) {
+        this.__observers.invoke('stop');
+        this.__observers = null;
+      }
+    },
+
+    destroy: function() {
+      this.removeObservers();
+    },
+
+    toElement: function() {
+      return this.element || null;
+    },
+
+    inspect: function() {
+      return "#<#{NAME}>".interpolate(this);
+    }
+  });
+
+})(S2.UI);
+
+Object.extend(Event, {
+  KEY_SPACE: 32
+});
+
+(function(UI) {
+
+  UI.Accordion = Class.create(UI.Base, {
+    NAME: "S2.UI.Accordion",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      var opt = this.setOptions(options);
+
+      UI.addClassNames(this.element, 'ui-accordion ui-widget ui-helper-reset');
+
+      if (this.element.nodeName.toUpperCase() === "UL") {
+        var lis = this.element.childElements().grep(new Selector('li'));
+        UI.addClassNames(lis, 'ui-accordion-li-fix');
+      }
+
+      this.headers = this.element.select(opt.headerSelector);
+      if (!this.headers || this.headers.length === 0) return;
+
+      UI.addClassNames(this.headers, 'ui-accordion-header ui-helper-reset ' +
+       'ui-state-default ui-corner-all');
+      UI.addBehavior(this.headers, [UI.Behavior.Hover, UI.Behavior.Focus]);
+
+      this.content = this.headers.map( function(h) { return h.next(); });
+
+      UI.addClassNames(this.content, 'ui-accordion-content ui-helper-reset ' +
+       'ui-widget-content ui-corner-bottom');
+
+      this.headers.each( function(header) {
+        var icon = new Element('span');
+        UI.addClassNames(icon, 'ui-icon ' + opt.icons.header);
+        header.insert({ top: icon });
+      });
+
+      this._markActive(opt.active || this.headers.first(), false);
+
+      this.element.writeAttribute({
+        'role': 'tablist',
+        'aria-multiselectable': opt.multiple.toString()
+      });
+      this.headers.invoke('writeAttribute', 'role', 'tab');
+      this.content.invoke('writeAttribute', 'role', 'tabpanel');
+
+      var links = this.headers.map( function(h) { return h.down('a'); });
+      links.invoke('observe', 'click', function(event) {
+        event.preventDefault();
+      });
+
+      this.observers = {
+        click: this.click.bind(this),
+        keypress: this.keypress.bind(this)
+      };
+
+      this.addObservers();
+    },
+
+    addObservers: function() {
+      this.headers.invoke('observe', 'click', this.observers.click);
+      if (Prototype.Browser.WebKit) {
+        this.headers.invoke('observe', 'keydown', this.observers.keypress);
+      } else {
+        this.headers.invoke('observe', 'keypress', this.observers.keypress);
+      }
+    },
+
+    click: function(event) {
+      var header = event.findElement(this.options.headerSelector);
+      if (!header || !this.headers.include(header)) return;
+      this._toggleActive(header);
+    },
+
+    keypress: function(event) {
+      if (event.shiftKey || event.metaKey || event.altKey || event.ctrlKey) {
+        return;
+      }
+      var header = event.findElement(this.options.headerSelector);
+      var keyCode = (event.keyCode === 0) ? event.charCode : event.keyCode;
+      switch (keyCode) {
+      case Event.KEY_SPACE:
+        this._toggleActive(header);
+        event.stop();
+        return;
+      case Event.KEY_DOWN: // fallthrough
+      case Event.KEY_RIGHT:
+        this._focusHeader(header, 1);
+        event.stop();
+        return;
+      case Event.KEY_UP: // fallthrough
+      case Event.KEY_LEFT:
+        this._focusHeader(header, -1);
+        event.stop();
+        return;
+      case Event.KEY_HOME:
+        this._focusHeader(this.headers.first());
+        event.stop();
+        return;
+      case Event.KEY_END:
+        this._focusHeader(this.headers.last());
+        event.stop();
+        return;
+      }
+    },
+
+    _focusHeader: function(header, delta) {
+      if (Object.isNumber(delta)) {
+        var index = this.headers.indexOf(header);
+        index = index + delta;
+        if (index > (this.headers.length - 1)) {
+          index = this.headers.length - 1;
+        } else if (index < 0) {
+          index = 0;
+        }
+        header = this.headers[index];
+      }
+      (function() { header.down('a').focus(); }).defer();
+    },
+
+    _toggleActive: function(header) {
+      if (header.hasClassName('ui-state-active')) {
+        if (!this.options.multiple) return;
+        this._removeActive(header);
+        this._activatePanel(null, header.next(), true);
+      } else {
+        this._markActive(header);
+      }
+    },
+
+    _removeActive: function(active) {
+      var opt = this.options;
+      UI.removeClassNames(active, 'ui-state-active ui-corner-top');
+      UI.addClassNames(active, 'ui-state-default ui-corner-all');
+      active.writeAttribute('aria-expanded', 'false');
+
+      var icon = active.down('.ui-icon');
+      icon.removeClassName(opt.icons.headerSelected);
+      icon.addClassName(opt.icons.header);
+    },
+
+    _markActive: function(active, shouldAnimate) {
+      if (Object.isUndefined(shouldAnimate)) {
+        shouldAnimate = true;
+      }
+      var opt = this.options;
+
+      var activePanel = null;
+      if (!opt.multiple) {
+        activePanel = this.element.down('.ui-accordion-content-active');
+        this.headers.each(this._removeActive.bind(this));
+      }
+
+      if (!active) return;
+
+      UI.removeClassNames(active, 'ui-state-default ui-corner-all');
+      UI.addClassNames(active, 'ui-state-active ui-corner-top');
+
+      active.writeAttribute('aria-expanded', 'true');
+
+      this._activatePanel(active.next(), activePanel, shouldAnimate);
+
+      var icon = active.down('.ui-icon');
+      icon.removeClassName(opt.icons.header);
+      icon.addClassName(opt.icons.headerSelected);
+
+      return active;
+    },
+
+    _activatePanel: function(panel, previousPanel, shouldAnimate) {
+      if (shouldAnimate) {
+        this.options.transition(panel, previousPanel);
+      } else {
+        if (previousPanel) {
+          previousPanel.removeClassName('ui-accordion-content-active');
+        }
+        if (panel) {
+          panel.addClassName('ui-accordion-content-active');
+        }
+      }
+    }
+  });
+
+  Object.extend(UI.Accordion, {
+    DEFAULT_OPTIONS: {
+      multiple: false,  /* whether more than one pane can be open at once */
+      headerSelector: 'h3',
+
+      icons: {
+        header:         'ui-icon-triangle-1-e',
+        headerSelected: 'ui-icon-triangle-1-s'
+      },
+
+      transition: function(panel, previousPanel) {
+        var effects = [], effect;
+
+        if (previousPanel) {
+          effect = new S2.FX.SlideUp(previousPanel, {
+            duration: 0.2,
+            after: function() {
+              previousPanel.removeClassName('ui-accordion-content-active');
+            }
+          });
+          effects.push(effect);
+        }
+
+        if (panel) {
+          effect = new S2.FX.SlideDown(panel, {
+            duration: 0.2,
+            before: function() {
+              panel.addClassName('ui-accordion-content-active');
+            }
+          });
+          effects.push(effect);
+        }
+
+        effects.invoke('play');
+      }
+    }
+  });
+
+})(S2.UI);
+
+
+(function(UI) {
+  UI.Button = Class.create(UI.Base, UI.Mixin.Element, {
+    NAME: "S2.UI.Button",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+
+      var name = this.element.nodeName.toUpperCase(), type;
+
+      if (name === 'INPUT') {
+        type = this.element.type;
+        if (type === 'checkbox' || type === 'radio') {
+          this.type = this.element.type;
+        } else {
+          this.type = 'input';
+        }
+      } else {
+        this.type = 'button';
+      }
+
+      var opt = this.setOptions(options);
+
+      if (this._isCheckboxOrRadio()) {
+        this._handleFormWidget();
+      } else {
+        this._makeButtonElement(this.element);
+      }
+
+      this.element.store('ui.button', this);
+      if (this._buttonElement !== this.element) {
+        this._buttonElement.store('ui.button', this);
+      }
+
+      this.enabled = true;
+
+      var disabled = (this.element.disabled === true)
+       this.element.hasClassName('ui-state-disabled');
+
+      this.setEnabled(!disabled);
+
+      this.observers = {
+        click: this._click.bind(this),
+        keyup: this._keyup.bind(this)
+      };
+      this.addObservers();
+    },
+
+    addObservers: function() {
+      this.observe('click', this.observers.click);
+      this.observe('keyup', this.observers.keyup);
+    },
+
+    removeObservers: function() {
+      this.stopObserving('click', this.observers.click);
+      this.stopObserving('keydown', this.observers.keydown);
+    },
+
+    isActive: function() {
+      if (!this._isToggleButton()) return false;
+      return this.hasClassName('ui-state-active');
+    },
+
+    _setActive: function(bool) {
+      this[bool ? 'addClassName' : 'removeClassName']('ui-state-active');
+    },
+
+    toggle: function(bool) {
+      if (!this._isToggleButton()) return this;
+
+      var isActive = this.isActive();
+      if (Object.isUndefined(bool)) bool = !isActive;
+
+      var willChange = (bool !== isActive);
+      if (willChange) {
+        var result = this.toElement().fire('ui:button:toggle');
+        if (result.stopped) return;
+      }
+      this._buttonElement[bool ? 'addClassName' : 'removeClassName']('ui-state-active');
+
+      return this;
+    },
+
+    _click: function(event) {
+      this.toggle(!this.isActive());
+      this.element.checked = this.isActive();
+    },
+
+    _keyup: function(event) {
+      var code = event.keyCode;
+      if (code !== Event.KEY_SPACE && code !== Event.KEY_RETURN)
+        return;
+
+      var isActive = this.isActive();
+
+      (function() {
+        if (isActive !== this.isActive()) return;
+        this.toggle(isActive);
+        this.element.checked = isActive;
+      }).bind(this).defer();
+    },
+
+    _isCheckboxOrRadio: function() {
+      return this.type === 'checkbox' || this.type === 'radio';
+    },
+
+    _isToggleButton: function() {
+      return this._isCheckboxOrRadio() || this.options.toggle;
+    },
+
+    _makeButtonElement: function(element) {
+      this._buttonElement = element;
+
+      var opt = this.options;
+      UI.addClassNames(element,
+       'ui-button ui-widget ui-state-default ui-corner-all');
+
+      var B = UI.Behavior, behaviors = [B.Hover, B.Focus, B.Down];
+      UI.addBehavior(element, behaviors);
+
+      if (opt.primary) {
+        element.addClassName('ui-priority-primary');
+      }
+
+      if (opt.text === null) {
+        opt.text = element.innerHTML || element.value;
+      }
+
+      this._interpretContent(element);
+
+      element.writeAttribute('role', 'button');
+    },
+
+    _makeIconElement: function(name, type) {
+      var classNames = 'ui-button-icon-' + type + ' ui-icon ' + name;
+      return new Element('span', { 'class': classNames });
+    },
+
+    _interpretContent: function(element) {
+      if (!this._isContainer()) return;
+
+      var opt = this.options;
+      var buttonClassName, primaryIcon, secondaryIcon;
+      var hasIcon     = !!opt.icons.primary || !!opt.icons.secondary;
+      var hasTwoIcons = !!opt.icons.primary && !!opt.icons.secondary;
+
+      if (opt.icons.primary) {
+        primaryIcon = this._makeIconElement(opt.icons.primary, 'primary');
+      }
+
+      if (opt.icons.secondary) {
+        secondaryIcon = this._makeIconElement(opt.icons.secondary, 'secondary');
+      }
+
+      if (hasIcon) {
+        if (this._hasText()) {
+          buttonClassName = hasTwoIcons ? 'ui-button-text-icons' :
+           'ui-button-text-icon';
+        } else {
+          buttonClassName = hasTwoIcons ? 'ui-button-icons-only' :
+           'ui-button-icon-only';
+        }
+      } else {
+        buttonClassName = 'ui-button-text-only';
+      }
+
+      this._wrapContentsInTextSpan(element);
+      element.addClassName(buttonClassName);
+
+      if (primaryIcon) {
+        element.insert({ top: primaryIcon });
+      }
+
+      if (secondaryIcon) {
+        element.insert({ bottom: secondaryIcon });
+      }
+    },
+
+    _wrapContentsInTextSpan: function(element) {
+      var text = new Element('span', { 'class': 'ui-button-text' });
+      for (var i = 0, node; node = element.childNodes[i]; i++) {
+        text.appendChild(node);
+      }
+      element.appendChild(text);
+    },
+
+    _hasText: function() {
+      return !!this.options.text;
+    },
+
+    _isContainer: function() {
+      var element = this.toElement(), tag = element.nodeName.toUpperCase();
+      return (tag !== 'INPUT');
+    },
+
+    _handleFormWidget: function() {
+      var opt = this.options;
+      var id = this.element.id, label;
+      if (id) {
+        label = $$('label[for="' + id + '"]')[0];
+      }
+      if (!label) {
+        label = this.element.up('label');
+      }
+
+      if (!label) {
+        opt.text = null;
+        return;
+      }
+
+
+      this.element.addClassName('ui-helper-hidden-accessible');
+      this._makeButtonElement(label);
+      UI.makeFocusable(label, true);
+      this.label = label;
+    },
+
+    setEnabled: function(isEnabled) {
+      var element = this._buttonElement;
+      if (this.enabled === isEnabled) return;
+      this.enabled = isEnabled;
+      if (isEnabled) {
+        element.removeClassName('ui-state-disabled');
+      } else {
+        element.addClassName('ui-state-disabled');
+      }
+      this.element.disabled = !isEnabled;
+    },
+
+    toElement: function() {
+      return this._buttonElement;
+    },
+
+    inspect: function() {
+      return this.toElement().inspect();
+    }
+  });
+
+  Object.extend(UI.Button, {
+    DEFAULT_OPTIONS: {
+      primary: false,
+      text:    true,
+      toggle:  false,
+      icons: {
+        primary:   null,
+        secondary: null
+      }
+    }
+  });
+
+})(S2.UI);
+(function(UI) {
+
+  UI.ButtonSet = Class.create(UI.Base, {
+    NAME: "S2.UI.ButtonSet",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      this.element.store('ui.buttonset', this);
+      var opt = this.setOptions(options);
+
+      this.element.addClassName('ui-buttonset');
+      this.refresh();
+
+      this.observers = {
+        toggle: this._toggle.bind(this)
+      };
+      this.addObservers();
+    },
+
+    addObservers: function() {
+      this.element.observe('ui:button:toggle', this.observers.toggle);
+    },
+
+    removeObservers: function() {
+      this.element.stopObserving('ui:button:toggle', this.observers.toggle);
+    },
+
+    destroy: function() {
+      this.removeObservers();
+      this.element.removeClassName('ui-buttonset');
+      UI.removeClassNames(this.buttons, 'ui-corner-left ui-corner-right');
+
+      this.element.getStorage().unset('ui.buttonset');
+    },
+
+    _destroyButton: function(el) {
+      var instance = el.retrieve('ui.button');
+      if (instance) instance.destroy();
+    },
+
+    _toggle: function(event) {
+      var element = event.element(), instance = element.retrieve('ui.button');
+      if (!instance || instance.type !== 'radio') return;
+
+      if (instance.isActive()) {
+        event.stop();
+        return;
+      }
+
+      this.instances.each( function(b) {
+        b._setActive(false);
+      });
+    },
+
+    refresh: function() {
+      this.element.cleanWhitespace();
+
+      this.buttons = [];
+
+      this.element.descendants().each( function(el) {
+        var isButton = false;
+        if ($w('SELECT BUTTON A').include(el.nodeName.toUpperCase()))
+          isButton = true;
+        if (el.match('input') && el.type !== 'hidden') isButton = true;
+        if (el.hasClassName('ui-button')) isButton = true;
+
+        if (isButton) this.buttons.push(el);
+      }, this);
+
+      this.instances = this.buttons.map( function(el) {
+        var instance = el.retrieve('ui.button');
+        if (!instance) instance = new UI.Button(el);
+        return instance;
+      });
+
+      this.instances.each( function(b) {
+        UI.removeClassNames(b.toElement(),
+         'ui-corner-all ui-corner-left ui-corner-right');
+      });
+
+      if (this.instances.length > 0) {
+        this.instances.first().toElement().addClassName('ui-corner-left');
+        this.instances.last().toElement().addClassName('ui-corner-right');
+      }
+    }
+  });
+
+})(S2.UI);
+(function(UI) {
+
+  UI.ButtonWithMenu = Class.create(UI.Button, {
+    initialize: function($super, element, options) {
+      var opt = this.setOptions(options);
+      $super(element, options);
+
+      this.menu = new UI.Menu();
+      this.element.insert({ after: this.menu });
+
+      if (opt.choices) {
+        opt.choices.each(this.menu.addChoice, this.menu);
+      }
+
+      (function() {
+        var iLayout = this.element.getLayout();
+
+        this.menu.setStyle({
+          left: iLayout.get('left') + 'px',
+          top:  (iLayout.get('top') + iLayout.get('margin-box-height')) + 'px'
+        });
+      }).bind(this).defer();
+
+      Object.extend(this.observers, {
+        clickForMenu:  this._clickForMenu.bind(this),
+        onMenuOpen:    this._onMenuOpen.bind(this),
+        onMenuClose:   this._onMenuClose.bind(this),
+        onMenuSelect:  this._onMenuSelect.bind(this)
+      });
+
+      this.observe('mousedown', this.observers.clickForMenu);
+
+      this.menu.observe('ui:menu:after:open',  this.observers.onMenuOpen );
+      this.menu.observe('ui:menu:after:close', this.observers.onMenuClose);
+      this.menu.observe('ui:menu:selected',    this.observers.onMenuSelect);
+    },
+
+    _clickForMenu: function(event) {
+      if (this.menu.isOpen()) {
+        this.menu.close();
+      } else {
+        this.menu.open();
+      }
+    },
+
+    _onMenuOpen: function() {
+      var menuElement = this.menu.element, buttonElement = this.toElement();
+      if (!this._clickOutsideMenuObserver) {
+        this._clickOutsideMenuObserver = $(document.body).on('click', function(event) {
+          var el = event.element();
+          if (el !== menuElement && !el.descendantOf(menuElement) &&
+           el !== buttonElement && !el.descendantOf(buttonElement)) {
+            this.menu.close();
+          }
+        }.bind(this));
+      } else {
+        this._clickOutsideMenuObserver.start();
+      }
+    },
+
+    _onMenuClose: function() {
+      if (this._clickOutsideMenuObserver)
+        this._clickOutsideMenuObserver.stop();
+    },
+
+    _onMenuSelect: function(event) {
+      var element = event.element();
+      this.fire('ui:button:menu:selected', {
+        instance: this,
+        element:  event.memo.element
+      });
+    }
+  });
+
+
+  Object.extend(UI.ButtonWithMenu, {
+    DEFAULT_OPTIONS: {
+      icons: { primary: 'ui-icon-bullet', secondary: 'ui-icon-triangle-1-s' }
+    }
+  });
+
+})(S2.UI);
+
+(function(UI) {
+  UI.Tabs = Class.create(UI.Base, {
+    NAME: "S2.UI.Tabs",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      UI.addClassNames(this.element,
+       'ui-widget ui-widget-content ui-tabs ui-corner-all');
+
+      this.setOptions(options);
+      var opt = this.options;
+
+      this.anchors = [];
+      this.panels  = [];
+
+      this.list = this.element.down('ul');
+      this.list.cleanWhitespace();
+      this.nav  = this.list;
+      UI.addClassNames(this.nav,
+       'ui-tabs-nav ui-helper-reset ui-helper-clearfix ' +
+       'ui-widget-header ui-corner-all');
+
+      this.tabs = this.list.select('li');
+      UI.addClassNames(this.tabs, 'ui-state-default ui-corner-top');
+      UI.addBehavior(this.tabs, [UI.Behavior.Hover, UI.Behavior.Down]);
+
+      this.element.writeAttribute({
+        'role': 'tablist',
+        'aria-multiselectable': 'false'
+      });
+
+      this.tabs.each( function(li) {
+        var anchor = li.down('a');
+        if (!anchor) return;
+
+        var href = anchor.readAttribute('href');
+        if (!href.include('#')) return;
+
+        var hash = href.split('#').last(), panel = $(hash);
+
+        li.writeAttribute('tabIndex', '0');
+
+        if (panel) {
+          panel.store('ui.tab', li);
+          li.store('ui.panel', panel);
+
+          this.anchors.push(anchor);
+          this.panels.push(panel);
+        }
+      }, this);
+
+      this.anchors.invoke('writeAttribute', 'role', 'tab');
+      this.panels.invoke('writeAttribute', 'role', 'tabpanel');
+
+      this.tabs.first().addClassName('ui-position-first');
+      this.tabs.last().addClassName('ui-position-last');
+
+      UI.addClassNames(this.panels,
+       'ui-tabs-panel ui-tabs-hide ui-widget-content ui-corner-bottom');
+
+      this.observers = {
+        onKeyPress: this.onKeyPress.bind(this),
+        onTabClick: this.onTabClick.bind(this)
+      };
+      this.addObservers();
+
+      var selectedTab;
+
+      var urlHash = window.location.hash.substring(1), activePanel;
+      if (!urlHash.empty()) {
+        activePanel = $(urlHash);
+      }
+      if (activePanel && this.panels.include(activePanel)) {
+        selectedTab = activePanel.retrieve('ui.tab');
+      } else {
+        selectedTab = opt.selectedTab ? $(opt.selectedTab) :
+         this.tabs.first();
+      }
+
+      this.setSelectedTab(selectedTab);
+    },
+
+    addObservers: function() {
+      this.anchors.invoke('observe', 'click', this.observers.onTabClick);
+      this.tabs.invoke('observe', 'keypress', this.observers.onKeyPress);
+    },
+
+    _setSelected: function(id) {
+      var panel = $(id), tab = panel.retrieve('ui.tab');
+
+      var oldTab = this.list.down('.ui-tabs-selected');
+      var oldPanel = oldTab ? oldTab.retrieve('ui.panel') : null;
+
+      UI.removeClassNames(this.tabs, 'ui-tabs-selected ui-state-active');
+      UI.addClassNames(this.tabs, 'ui-state-default');
+
+      tab.removeClassName('ui-state-default').addClassName(
+       'ui-tabs-selected ui-state-active');
+
+      this.element.fire('ui:tabs:change', {
+        from: { tab: oldTab, panel: oldPanel },
+        to:   { tab: tab,    panel: panel    }
+      });
+      this.options.panel.transition(oldPanel, panel);
+    },
+
+    setSelectedTab: function(tab) {
+      this.setSelectedPanel(tab.retrieve('ui.panel'));
+    },
+
+    setSelectedPanel: function(panel) {
+      this._setSelected(panel.readAttribute('id'));
+    },
+
+    onTabClick: function(event) {
+      event.stop();
+      var anchor = event.findElement('a'), tab = event.findElement('li');
+
+      this.setSelectedTab(tab);
+    },
+
+    onKeyPress: function(event) {
+      if (UI.modifierUsed(event)) return;
+      var tab = event.findElement('li');
+      var keyCode = event.keyCode || event.charCode;
+
+      switch (keyCode) {
+      case Event.KEY_SPACE:  // fallthrough
+      case Event.KEY_RETURN:
+        this.setSelectedTab(tab);
+        event.stop();
+        return;
+      case Event.KEY_UP: // fallthrough
+      case Event.KEY_LEFT:
+        this._focusTab(tab, -1);
+        return;
+      case Event.KEY_DOWN: // fallthrough
+      case Event.KEY_RIGHT:
+        this._focusTab(tab, 1);
+        return;
+      }
+    },
+
+    _focusTab: function(tab, delta) {
+      if (Object.isNumber(delta)) {
+        var index = this.tabs.indexOf(tab);
+        index = index + delta;
+        if (index > (this.tabs.length - 1)) {
+          index = this.tabs.length - 1;
+        } else if (index < 0) {
+          index = 0;
+        }
+        tab = this.tabs[index];
+      }
+      (function() { tab.focus(); }).defer();
+    }
+  });
+
+  Object.extend(UI.Tabs, {
+    DEFAULT_OPTIONS: {
+      panel: {
+        transition: function(from, to) {
+          if (from) {
+            from.addClassName('ui-tabs-hide');
+          }
+          to.removeClassName('ui-tabs-hide');
+        }
+      }
+    }
+  });
+})(S2.UI);
+(function(UI) {
+
+
+  UI.Overlay = Class.create(
+   UI.Base,
+   UI.Mixin.Trackable,
+   UI.Mixin.Shim, {
+    NAME: "S2.UI.Overlay",
+
+    initialize: function(options) {
+      this.setOptions(options);
+      this.element = new Element('div', {
+        'class': 'ui-widget-overlay'
+      });
+
+      this.register();
+      this.createShim();
+      this.adjustShim();
+      this.constructor.onResize();
+    },
+
+    destroy: function() {
+      this.element.remove();
+      this.unregister();
+    },
+
+    toElement: function() {
+      return this.element;
+    }
+  });
+
+  Object.extend(UI.Overlay, {
+    onRegister: function() {
+      if (this.instances.length !== 1) return;
+
+      this._resizeObserver = this._resizeObserver || this.onResize.bind(this);
+      Event.observe(window, 'resize', this._resizeObserver);
+      Event.observe(window, 'scroll', this._resizeObserver);
+    },
+
+    onUnregister: function() {
+      if (this.instances.length !== 0) return;
+      Event.stopObserving(window, 'resize', this._resizeObserver);
+      Event.stopObserving(window, 'scroll', this._resizeObserver);
+    },
+
+    onResize: function() {
+      var vSize   = document.viewport.getDimensions();
+      var offsets = document.viewport.getScrollOffsets();
+      this.instances.each( function(instance) {
+        var element = instance.element;
+        element.setStyle({
+          width:  vSize.width  + 'px',
+          height: vSize.height + 'px',
+          left:   offsets.left + 'px',
+          top:    offsets.top  + 'px'
+        });
+      });
+      (function() {
+        this.instances.invoke('adjustShim');
+      }).bind(this).defer();
+    }
+  });
+
+})(S2.UI);
+(function(UI) {
+
+  UI.Dialog = Class.create(UI.Base, UI.Mixin.Element, {
+    NAME: "S2.UI.Dialog",
+
+    initialize: function(element, options) {
+      if (!Object.isElement(element)) {
+        options = element;
+        element = null;
+      } else {
+        element = $(element);
+      }
+
+      var opt = this.setOptions(options);
+
+      this.element = element || new Element('div');
+      UI.addClassNames(this.element, 'ui-dialog ui-widget ' +
+       'ui-widget-content ui-corner-all');
+
+      this.element.hide().setStyle({
+        position: 'absolute',
+        overflow: 'hidden',
+        zIndex:   opt.zIndex,
+        outline:  '0'
+      });
+
+      this.element.writeAttribute({
+        tabIndex: '-1',
+        role: 'dialog'
+      });
+
+      if (opt.content) {
+        this.content = Object.isElement(opt.content) ? opt.content :
+         new Element('div').update(opt.content);
+      } else {
+        this.content = new Element('div');
+      }
+
+      UI.addClassNames(this.content, 'ui-dialog-content ui-widget-content');
+      this.element.insert(this.content);
+
+      this.titleBar = this.options.titleBar || new Element('div');
+      UI.addClassNames(this.titleBar, 'ui-dialog-titlebar ui-widget-header ' +
+  		 'ui-corner-all ui-helper-clearfix');
+  		this.element.insert({ top: this.titleBar });
+
+  	  this.closeButton = new Element('a', { 'href': '#' });
+  	  UI.addClassNames(this.closeButton, 'ui-dialog-titlebar-close ' +
+  	   'ui-corner-all');
+  	  new UI.Button(this.closeButton, {
+  	    text: false,
+  	    icons: { primary: 'ui-icon-closethick' }
+  	  });
+  	  this.closeButton.observe('mousedown', Event.stop);
+  	  this.closeButton.observe('click', function(event) {
+  	    event.stop();
+  	    this.close(false);
+  	  }.bind(this));
+
+  	  this.titleBar.insert(this.closeButton);
+
+
+  	  this.titleText = new Element('span', { 'class': 'ui-dialog-title' });
+  	  this.titleText.update(this.options.title).identify();
+  	  this.element.writeAttribute('aria-labelledby',
+  	   this.titleText.readAttribute('id'));
+  	  this.titleBar.insert({ top: this.titleText }) ;
+
+      UI.disableTextSelection(this.element);
+
+      if (this.options.draggable) {
+        UI.addBehavior(this.element, UI.Behavior.Drag,
+         { handle: this.titleBar });
+      }
+
+
+      var buttons = this.options.buttons;
+
+      if (buttons && buttons.length) {
+        this._createButtons();
+      }
+
+      this.observers = {
+        keypress: this.keypress.bind(this)
+      };
+
+    },
+
+    toElement: function() {
+      return this.element;
+    },
+
+    _createButtons: function() {
+      var buttons = this.options.buttons;
+      if (this.buttonPane) {
+        this.buttonPane.remove();
+      }
+
+      this.buttonPane = new Element('div');
+      UI.addClassNames(this.buttonPane,
+       'ui-dialog-buttonpane ui-widget-content ui-helper-clearfix');
+
+      buttons.each( function(button) {
+        var element = new Element('button', { type: 'button' });
+        UI.addClassNames(element, 'ui-state-default ui-corner-all');
+
+        if (button.primary) {
+          element.addClassName('ui-priority-primary');
+        }
+
+        if (button.secondary) {
+          element.addClassName('ui-priority-secondary');
+        }
+
+        element.update(button.label);
+        new UI.Button(element);
+        element.observe('click', button.action.bind(this, this));
+
+        this.buttonPane.insert(element);
+      }, this);
+
+      this.element.insert(this.buttonPane);
+    },
+
+    _position: function() {
+      var vSize = document.viewport.getDimensions();
+      var dialog = this.element, layout = dialog.getLayout();
+
+      var position = {
+        left: ((vSize.width  / 2) - (layout.get('width')  / 2)).round(),
+        top:  ((vSize.height / 2) - (layout.get('height') / 2)).round()
+      };
+
+      var offsets = document.viewport.getScrollOffsets();
+
+      position.left += offsets.left;
+      position.top  += offsets.top;
+
+      this.element.setStyle({
+        left: position.left + 'px',
+        top:  position.top  + 'px'
+      });
+    },
+
+    open: function() {
+      if (this._isOpen) return;
+
+      var result = this.element.fire("ui:dialog:before:open",
+       { dialog: this });
+      if (result.stopped) return;
+
+      var opt = this.options;
+
+      this.overlay = opt.modal ? new UI.Overlay() : null;
+      $(document.body).insert(this.overlay);
+      $(document.body).insert(this);
+
+      this.element.show();
+      this._position();
+
+      this.focusables = UI.findFocusables(this.element);
+
+      var forms = this.content.select('form');
+      if (this.content.match('form')) {
+        forms.push(this.content);
+      }
+
+      if (!opt.submitForms) {
+        forms.invoke('observe', 'submit', Event.stop);
+      }
+
+      var f = this.focusables.without(this.closeButton);
+      var focus = opt.focus, foundFocusable = false;
+      if (focus === 'auto' && forms.length > 0) {
+        Form.focusFirstElement(forms.first());
+        foundFocusable = true;
+      } else if (focus === 'first') {
+        f.first().focus();
+        foundFocusable = true;
+      } else if (focus === 'last') {
+        f.last().focus();
+        foundFocusable = true;
+      } else if (Object.isElement(focus)) {
+        focus.focus();
+        foundFocusable = true;
+      } else {
+        if (this.buttonPane) {
+          var primary = this.buttonPane.down('.ui-priority-primary');
+          if (primary) {
+            primary.focus();
+            foundFocusable = true;
+          }
+        }
+      }
+
+      if (!foundFocusable && f.length > 0) {
+        f.first().focus();
+      }
+
+      Event.observe(window, 'keydown', this.observers.keypress);
+      this._isOpen = true;
+
+      this.element.fire("ui:dialog:after:open", { dialog: this });
+      return this;
+    },
+
+    close: function(success) {
+      success = !!success; // Coerce to a boolean.
+      var result = this.element.fire("ui:dialog:before:close",
+       { dialog: this });
+      if (result.stopped) return;
+
+      if (this.overlay) {
+        this.overlay.destroy();
+      }
+
+      this.element.hide();
+      this._isOpen = false;
+      Event.stopObserving(window, 'keydown', this.observers.keypress);
+
+      var memo = { dialog: this, success: success };
+
+      var form = this.content.match('form') ? this.content : this.content.down('form');
+      if (form) {
+        Object.extend(memo, { form: form.serialize({ hash: true }) });
+      }
+
+      this.element.fire("ui:dialog:after:close", memo);
+      UI.enableTextSelection(this.element, true);
+      return this;
+    },
+
+    keypress: function(event) {
+      if (UI.modifierUsed(event)) return;
+
+      var f = this.focusables, opt = this.options;
+      if (event.keyCode === Event.KEY_ESC) {
+        if (opt.closeOnEscape) this.close(false);
+        return;
+      }
+
+      if (event.keyCode === Event.KEY_RETURN) {
+        this.close(true);
+        return;
+      }
+
+      if (event.keyCode === Event.KEY_TAB) {
+        if (!this.options.modal) return;
+        if (!f) return;
+        var next, current = event.findElement();
+        var index = f.indexOf(current);
+        if (index === -1) {
+          next = f.first();
+        } else {
+          if (event.shiftKey) {
+            next = index === 0 ? f.last() : f[index - 1];
+          } else {
+            next = (index === (f.length - 1)) ? f.first() : f[index + 1];
+          }
+        }
+
+        if (next) {
+          event.stop();
+          (function() { next.focus(); }).defer();
+        }
+      }
+    }
+  });
+
+  Object.extend(UI.Dialog, {
+    DEFAULT_OPTIONS: {
+      zIndex: 1000,
+
+      title: "Dialog",
+
+      content: null,
+      modal:   true,
+      focus:   'auto',
+
+      submitForms: false,
+
+      closeOnEscape: true,
+
+      draggable: true,
+      resizable: false,
+
+      buttons: [
+        {
+          label: "OK",
+          primary: true,
+          action: function(instance) {
+            instance.close(true);
+          }
+        }
+      ]
+    }
+  });
+
+})(S2.UI);
+
+
+(function(UI) {
+  UI.Slider = Class.create(UI.Base, {
+    NAME: "S2.UI.Slider",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      var opt = this.setOptions(options);
+
+      UI.addClassNames(this.element, 'ui-slider ui-widget ' +
+       'ui-widget-content ui-corner-all');
+
+      this.orientation = opt.orientation;
+
+      this.element.addClassName('ui-slider-' + this.orientation);
+
+      this._computeTrackLength();
+
+      var initialValues = opt.value.initial;
+      if (!Object.isArray(initialValues)) {
+        initialValues = [initialValues];
+      }
+
+      this.values  = initialValues;
+      this.handles = [];
+      this.values.each( function(value, index) {
+        var handle = new Element('a', { href: '#' });
+        handle.store('ui.slider.handle', index);
+        this.handles.push(handle);
+        this.element.insert(handle);
+      }, this);
+
+      UI.addClassNames(this.handles, 'ui-slider-handle ui-state-default ' +
+       'ui-corner-all');
+      this.handles.invoke('writeAttribute', 'tabIndex', '0');
+
+      this.activeHandle = this.handles.first();
+
+      this.handles.invoke('observe', 'click', Event.stop);
+      UI.addBehavior(this.handles, [UI.Behavior.Hover, UI.Behavior.Focus]);
+
+      this.observers = {
+        focus:          this.focus.bind(this),
+        blur:           this.blur.bind(this),
+        keydown:        this.keydown.bind(this),
+        keyup:          this.keyup.bind(this),
+        mousedown:      this.mousedown.bind(this),
+        mouseup:        this.mouseup.bind(this),
+        mousemove:      this.mousemove.bind(this),
+        rangeMouseDown: this.rangeMouseDown.bind(this),
+        rangeMouseMove: this.rangeMouseMove.bind(this),
+        rangeMouseUp:   this.rangeMouseUp.bind(this)
+      };
+
+      var v = opt.value;
+      if (v.step !== null) {
+        this._possibleValues = [];
+        for (var val = v.min; val < v.max; val += v.step) {
+          this._possibleValues.push(val);
+        }
+        this._possibleValues.push(v.max);
+
+        this.keyboardStep = v.step;
+      } else if (opt.possibleValues) {
+        this._possibleValues = opt.possibleValues.clone();
+        this.keyboardStep = null;
+      } else {
+        this.keyboardStep = (v.max - v.min) / 100;
+      }
+
+      this.range = null;
+      if (opt.range && this.values.length === 2) {
+        this.restricted = true;
+        this.range = new Element('div', { 'class': 'ui-slider-range' });
+        this.element.insert(this.range);
+
+        this.range.addClassName('ui-widget-header');
+      }
+
+      this._computeTrackLength();
+      this._computeHandleLength();
+
+      this.active   = false;
+      this.dragging = false;
+      this.disabled = false;
+
+      this.addObservers();
+
+      this.values.each(this.setValue, this);
+
+      this.initialized = true;
+    },
+
+    addObservers: function() {
+      this.element.observe('mousedown', this.observers.mousedown);
+      if (this.range) {
+        this.range.observe('mousedown', this.observers.rangeMouseDown);
+      }
+      this.handles.invoke('observe', 'keydown', this.observers.keydown);
+      this.handles.invoke('observe', 'keyup',   this.observers.keyup);
+    },
+
+    _computeTrackLength: function() {
+      var length, dim;
+      if (this.orientation === 'vertical') {
+        dim = this.element.offsetHeight;
+        length = (dim !== 0) ? dim :
+         window.parseInt(this.element.getStyle('height'), 10);
+      } else {
+        dim = this.element.offsetWidth;
+        length = (dim !== 0) ? dim :
+         window.parseInt(this.element.getStyle('width'), 10);
+      }
+
+      this._trackLength = length;
+      return length;
+    },
+
+    _computeHandleLength: function() {
+      var handle = this.handles.first(), length, dim;
+
+      if (!handle) return;
+
+      if (this.orientation === 'vertical') {
+        dim = handle.offsetHeight;
+        length = (dim !== 0) ? dim :
+         window.parseInt(handle.getStyle('height'), 10);
+        this._trackMargin = handle.getLayout().get('margin-top');
+        this._trackLength -= 2 * this._trackMargin;
+      } else {
+        dim = handle.offsetWidth;
+        length = (dim !== 0) ? dim :
+         window.parseInt(handle.getStyle('width'), 10);
+         this._trackMargin = handle.getLayout().get('margin-left');
+         this._trackLength -= 2 * this._trackMargin;
+      }
+
+      this._handleLength = length;
+      return length;
+    },
+
+    _nextValue: function(currentValue, direction) {
+      if (this.options.possibleValues) {
+        var index = this._possibleValues.indexOf(currentValue);
+        return this._possibleValues[index + direction];
+      } else {
+        return currentValue + (this.keyboardStep * direction);
+      }
+    },
+
+    keydown: function(event) {
+      if (this.options.disabled) return;
+
+      var handle = event.findElement();
+      var index  = handle.retrieve('ui.slider.handle');
+      var allow = true, opt = this.options;
+
+      if (!Object.isNumber(index)) return;
+
+      var interceptKeys = [Event.KEY_HOME, Event.KEY_END, Event.KEY_UP,
+       Event.KEY_DOWN, Event.KEY_LEFT, Event.KEY_RIGHT];
+
+      if (!interceptKeys.include(event.keyCode)) {
+        return;
+      }
+
+      handle.addClassName('ui-state-active');
+
+      var currentValue, newValue, step = this.keyboardStep;
+      currentValue = newValue = this.values[index];
+
+      switch (event.keyCode) {
+      case Event.KEY_HOME:
+        newValue = opt.value.min; break;
+      case Event.KEY_END:
+        newValue = opt.value.max; break;
+      case Event.KEY_UP: // fallthrough
+      case Event.KEY_RIGHT:
+        if (currentValue === opt.value.max) return;
+        newValue = this._nextValue(currentValue, 1);
+        break;
+      case Event.KEY_DOWN: // fallthrough
+      case Event.KEY_LEFT:
+        if (currentValue === opt.value.min) return;
+        newValue = this._nextValue(currentValue, -1);
+        break;
+      }
+
+      this.dragging = true;
+      this.setValue(newValue, index);
+
+      if (!Prototype.Browser.WebKit) {
+        var interval = this._timer ? 0.1 : 1;
+        this._timer = arguments.callee.bind(this).delay(interval, event);
+      }
+
+      if (!allow) {
+        event.stop();
+      }
+    },
+
+    keyup: function(event) {
+      this.dragging = false;
+      if (this._timer) {
+        window.clearTimeout(this._timer);
+        this._timer = null;
+      }
+      this._updateFinished();
+
+      var handle = event.findElement();
+      handle.removeClassName('ui-state-active');
+    },
+
+    setValue: function(sliderValue, handleIndex) {
+      if (!this.activeHandle) {
+        this.activeHandle = this.handles[handleIndex || 0];
+        this._updateStyles();
+      }
+
+      handleIndex = handleIndex ||
+       this.activeHandle.retrieve('ui.slider.handle') || 0;
+
+      if (this.initialized && this.restricted) {
+        if (handleIndex > 0 && sliderValue < this.values[handleIndex - 1]) {
+          sliderValue = this.values[handleIndex - 1];
+        }
+        if (handleIndex < (this.handles.length - 1) &&
+         (sliderValue > this.values[handleIndex + 1])) {
+          sliderValue = this.values[handleIndex + 1];
+        }
+      }
+
+      sliderValue = this._getNearestValue(sliderValue);
+
+      this.values[handleIndex] = sliderValue;
+
+      var prop = (this.orientation === 'vertical') ? 'top' : 'left';
+      var css = {};
+
+      css[prop] = this._valueToPx(sliderValue) + 'px';
+      this.handles[handleIndex].setStyle(css);
+
+      this._drawRange();
+
+      if (!this.dragging && !this.undoing && !this.initialized)  {
+        this._updateFinished();
+      }
+
+      if (this.initialized) {
+        this.element.fire("ui:slider:value:changing", {
+          slider: this,
+          values: this.values
+        });
+        this.options.onSlide(this.values, this);
+      }
+
+      return this;
+    },
+
+    _getNearestValue: function(value) {
+      var range = this.options.value;
+
+      if (value < range.min) value = range.min;
+      if (value > range.max) value = range.max;
+
+      if (this._possibleValues) {
+        var left, right;
+        for (var i = 0; i < this._possibleValues.length; i++) {
+          right = this._possibleValues[i];
+          if (right === value)  return value;
+          if (right > value)    break;
+        }
+        left = this._possibleValues[i - 1];
+        value = value.nearer(left, right);
+      }
+
+      return value;
+    },
+
+    _valueToPx: function(value) {
+      var range = this.options.value;
+      var pixels = (this._trackLength - this._handleLength ) /
+       (range.max - range.min);
+      pixels *= (value - range.min);
+
+      if (this.orientation === 'vertical') {
+        pixels = (this._trackLength - pixels) - this._handleLength;
+      } else {
+      }
+
+      return Math.round(pixels);
+    },
+
+    mousedown: function(event) {
+      var opt = this.options;
+      if (!event.isLeftClick() || opt.disabled) return;
+      event.stop();
+
+      this._oldValues = this.values.clone();
+
+      this.active = true;
+      var target  = event.findElement();
+      var pointer = event.pointer();
+
+      if (target === this.element) {
+        var trackOffset = this.element.cumulativeOffset();
+
+        var newPosition = {
+          x: Math.round(pointer.x - trackOffset.left - this._handleLength / 2 - this._trackMargin),
+          y: Math.round(pointer.y - trackOffset.top - this._handleLength / 2 - this._trackMargin)
+        };
+
+        this.setValue(this._pxToValue(newPosition));
+
+        this.activeHandle = this.activeHandle || this.handles.first();
+        handle = this.activeHandle;
+        this._updateStyles();
+        this._offsets = {x: 0, y: 0};
+      } else {
+        handle = event.findElement('.ui-slider-handle');
+        if (!handle) return;
+
+        this.activeHandle = handle;
+        this._updateStyles();
+        var handleOffset = handle.cumulativeOffset();
+        this._offsets = {
+          x: pointer.x - (handleOffset.left + this._handleLength / 2),
+          y: pointer.y - (handleOffset.top + this._handleLength / 2)
+        };
+      }
+
+      document.observe('mousemove', this.observers.mousemove);
+      document.observe('mouseup',   this.observers.mouseup);
+    },
+
+    mouseup: function(event) {
+      if (this.active && this.dragging) {
+        this._updateFinished();
+        event.stop();
+      }
+
+      this.active = this.dragging = false;
+
+      this.activeHandle = null;
+      this._updateStyles();
+
+      document.stopObserving('mousemove', this.observers.mousemove);
+      document.stopObserving('mouseup',   this.observers.mouseup);
+    },
+
+
+    mousemove: function(event) {
+      if (!this.active) return;
+      event.stop();
+
+      this.dragging = true;
+      this._draw(event);
+
+      if (Prototype.Browser.WebKit) window.scrollBy(0, 0);
+    },
+
+    rangeMouseDown: function(event) {
+      var pointer = event.pointer();
+
+      var trackOffset = this.element.cumulativeOffset();
+
+      var newPosition = {
+        x: Math.round(pointer.x - trackOffset.left),
+        y: Math.round(pointer.y - trackOffset.top)
+      };
+
+      this._rangeInitialValues = this.values.clone();
+      this._rangePseudoValue = this._pxToValue(newPosition);
+
+      document.observe('mousemove', this.observers.rangeMouseMove);
+      document.observe('mouseup',   this.observers.rangeMouseUp);
+    },
+
+    rangeMouseMove: function(event) {
+      this.dragging = true;
+      event.stop();
+
+      var opt = this.options;
+
+      var pointer = event.pointer();
+      var trackOffset = this.element.cumulativeOffset();
+
+      var newPosition = {
+        x: Math.round(pointer.x - trackOffset.left),
+        y: Math.round(pointer.y - trackOffset.top)
+      };
+
+      var value = this._pxToValue(newPosition);
+      var valueDelta = value - this._rangePseudoValue;
+      var newValues = this._rangeInitialValues.map(
+       function(v) { return v + valueDelta; });
+
+      if (newValues[0] < opt.value.min) {
+        valueDelta = opt.value.min - this._rangeInitialValues[0];
+        newValues = this._rangeInitialValues.map(
+         function(v) { return v + valueDelta; });
+      } else if (newValues[1] > opt.value.max) {
+        valueDelta = opt.value.max - this._rangeInitialValues[1];
+        newValues = this._rangeInitialValues.map(
+         function(v) { return v + valueDelta; });
+      }
+
+      newValues.each(this.setValue, this);
+    },
+
+    rangeMouseUp: function(event) {
+      this.dragging = false;
+
+      document.stopObserving('mousemove', this.observers.rangeMouseMove);
+      document.stopObserving('mouseup',   this.observers.rangeMouseUp);
+
+      this._updateFinished();
+    },
+
+
+    _draw: function(event) {
+      var pointer = event.pointer();
+      var trackOffset = this.element.cumulativeOffset();
+
+      pointer.x -= (this._offsets.x + trackOffset.left + this._handleLength / 2 + this._trackMargin);
+      pointer.y -= (this._offsets.y + trackOffset.top + this._handleLength / 2 + this._trackMargin);
+
+      this.setValue(this._pxToValue(pointer));
+    },
+
+    _pxToValue: function(offsets) {
+      var opt = this.options;
+      var offset = (this.orientation === 'horizontal') ?
+       offsets.x : offsets.y;
+
+      var value = ((offset / (this._trackLength - this._handleLength) *
+       (opt.value.max - opt.value.min)) + opt.value.min);
+
+      if (this.orientation === 'vertical') {
+        value = opt.value.max - (value - opt.value.min);
+      }
+
+      return value;
+    },
+
+    undo: function() {
+      if (!this._oldValues) return;
+      this.values = this._oldValues.clone();
+
+      this.undoing = true;
+      this._oldValues.each(this.setValue, this);
+      this.undoing = false;
+    },
+
+    _updateFinished: function() {
+      var result = this.element.fire("ui:slider:value:changed", {
+        slider: this,
+        values: this.values
+      });
+
+      if (result.stopped) {
+        this.undo();
+        return;
+      }
+
+      this.activeHandle = null;
+      this._updateStyles();
+
+      this.options.onChange(this.values, this);
+    },
+
+    _updateStyles: function() {
+      UI.removeClassNames(this.handles, 'ui-state-active');
+      if (this.activeHandle) {
+        this.activeHandle.addClassName('ui-state-active');
+      }
+    },
+
+    _drawRange: function() {
+      if (!this.range) return;
+      var values = this.values, pixels = values.map(this._valueToPx, this);
+
+      if (this.orientation === 'vertical') {
+        this.range.setStyle({
+          top: pixels[1] + 'px',
+          height: (pixels[0] - pixels[1]) + 'px'
+        });
+      } else {
+        this.range.setStyle({
+          left:   pixels[0] + 'px',
+          width:  (pixels[1] - pixels[0]) + 'px'
+        });
+      }
+    },
+
+    focus: function(event) {
+      if (this.options.disabled) return;
+
+      var handle = event.findElement();
+
+      this.element.select('.ui-state-focus').invoke(
+       'removeClassName', 'ui-state-focus');
+
+      handle.addClassName('ui-state-focus');
+    },
+
+    blur: function(event) {
+      event.findElement().removeClassName('ui-state-focus');
+    }
+  });
+
+  Object.extend(UI.Slider, {
+    DEFAULT_OPTIONS: {
+      range: false,
+      disabled: false,
+      value: { min: 0, max: 100, initial: 0, step: null },
+      possibleValues: null,
+      orientation: 'horizontal',
+
+      onSlide:  Prototype.emptyFunction,
+      onChange: Prototype.emptyFunction
+    }
+  });
+})(S2.UI);
+
+(function(UI) {
+  UI.ProgressBar = Class.create(UI.Base, {
+    NAME: "S2.UI.ProgressBar",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      var opt = this.setOptions(options);
+
+      UI.addClassNames(this.element, 'ui-progressbar ui-widget ' +
+       'ui-widget-content ui-corner-all');
+
+      this.element.writeAttribute({
+        'role': 'progressbar',
+        'aria-valuemin': 0,
+        'aria-valuemax': 100,
+        'aria-valuenow': 0
+      });
+
+      this.valueElement = new Element('div', {
+        'class': 'ui-progressbar-value ui-widget-header ui-corner-left'
+      });
+
+      this.value = opt.value.initial;
+      this._refreshValue();
+
+      this.element.insert(this.valueElement);
+      this.element.store(this.NAME, this);
+    },
+
+    destroy: function() {
+      UI.removeClassNames(this.element, 'ui-progressbar ui-widget ' +
+       'ui-widget-content ui-corner-all');
+      UI.removeAttributes(this.element, 'role aria-valuemin aria-valuemax ' +
+       'aria-valuenow');
+      this.element.getData().unset(this.NAME);
+    },
+
+    getValue: function() {
+      var value = this.value, v = this.options.value;
+      if (value < v.min) value = v.min;
+      if (value > v.max) value = v.max;
+      return value;
+    },
+
+    setValue: function(value) {
+      this._oldValue = this.getValue();
+      this.value = value;
+      this._refreshValue();
+      return this;
+    },
+
+    undo: function() {
+      this.undoing = true;
+      this.setValue(this._oldValue);
+      this.undoing = false;
+      return this;
+    },
+
+    _refreshValue: function() {
+      var value = this.getValue();
+      if (!this.undoing) {
+        var result = this.element.fire('ui:progressbar:value:changed', {
+          progressBar: this,
+          value: value
+        });
+        if (result.stopped) {
+          this.undo();
+          return;
+        }
+      }
+      if (value === this.options.value.max) {
+        this.valueElement.addClassName('ui-corner-right');
+      } else {
+        this.valueElement.removeClassName('ui-corner-right');
+      }
+
+
+      var width    = window.parseInt(this.element.getStyle('width'), 10);
+      var newWidth = (width * value) / 100;
+      var css      = "width: #{0}px".interpolate([newWidth]);
+
+      UI.makeVisible(this.valueElement, (value > this.options.value.min));
+      this.valueElement.morph(css, { duration: 0.7, transition: 'linear' });
+      this.element.writeAttribute('aria-valuenow', value);
+    }
+  });
+
+  Object.extend(UI.ProgressBar, {
+    DEFAULT_OPTIONS: {
+      value: { min: 0, max: 100, initial: 0 }
+    }
+  });
+
+})(S2.UI);
+
+(function(UI) {
+  UI.Menu = Class.create(UI.Base, UI.Mixin.Shim, UI.Mixin.Element, {
+    NAME: "S2.UI.Menu",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      if (!this.element) {
+        var options = element;
+        this.element = new Element('ul');
+      }
+
+      this.activeId = this.element.identify() + '_active';
+      var opt = this.setOptions();
+
+      UI.addClassNames(this.element, 'ui-helper-hidden ui-widget ' +
+       'ui-widget-content ui-menu ui-corner-' + opt.corner);
+
+      this.choices = this.element.select('li');
+
+      this._highlightedIndex = -1;
+
+      this.element.writeAttribute({
+        'role': 'menu',
+        'aria-activedescendant': this.activeId
+      });
+
+      this.choices.invoke('writeAttribute', 'role', 'menuitem');
+
+      this.observers = {
+        mouseover: this._mouseover.bind(this),
+        click: this._click.bind(this)
+      };
+      this.addObservers();
+
+      this._shown = false;
+
+      this.createShim();
+
+    },
+
+    addObservers: function() {
+      this.observe('mouseover', this.observers.mouseover);
+      this.observe('mousedown', this.observers.click);
+    },
+
+    removeObservers: function() {
+      this.stopObserving('mouseover', this.observers.mouseover);
+      this.stopObserving('mousedown', this.observers.click);
+    },
+
+    clear: function() {
+      this.element.select('li').invoke('remove');
+      this.choices = [];
+      return this;
+    },
+
+    addChoice: function(choice) {
+      var li;
+      if (Object.isElement(choice)) {
+        if (choice.tagName.toUpperCase() === 'LI') {
+          li = choice;
+        } else {
+          li = new Element('li');
+          li.insert(choice);
+        }
+      } else {
+        li = new Element('li');
+        li.update(choice);
+      }
+
+      li.addClassName('ui-menu-item');
+      li.writeAttribute('role', 'menuitem');
+
+      this.element.insert(li);
+      this.choices = this.element.select('li');
+
+      return li;
+    },
+
+    _mouseover: function(event) {
+      var li = event.findElement('li');
+      if (!li) return;
+
+      this.highlightChoice(li);
+    },
+
+    _click: function(event) {
+      var li = event.findElement('li');
+      if (!li) return;
+
+      this.selectChoice(li);
+    },
+
+    moveHighlight: function(delta) {
+      this._highlightedIndex = (this._highlightedIndex + delta).constrain(
+       -1, this.choices.length - 1);
+
+      this.highlightChoice();
+      return this;
+    },
+
+    highlightChoice: function(element) {
+      var choices = this.choices, index;
+
+      if (Object.isElement(element)) {
+        index = choices.indexOf(element);
+      } else if (Object.isNumber(element)) {
+        index = element;
+      } else {
+        index = this._highlightedIndex;
+      }
+
+      UI.removeClassNames(this.choices, 'ui-state-active');
+      if (index === -1) return;
+      this.choices[index].addClassName('ui-state-active');
+      this._highlightedIndex = index;
+
+      var active = this.element.down('#' + this.activeId);
+      if (active) active.writeAttribute('id', '');
+      this.choices[index].writeAttribute('id', this.activeId);
+    },
+
+    selectChoice: function(element) {
+      var element;
+      if (Object.isNumber(element)) {
+        element = this.choices[element];
+      } else if (!element) {
+        element = this.choices[this._highlightedIndex];
+      }
+
+      var result = this.element.fire('ui:menu:selected', {
+        instance: this,
+        element: element
+      });
+
+      if (!result.stopped) {
+        this.close();
+      }
+
+      return this;
+    },
+
+    open: function() {
+
+      var result = this.element.fire('ui:menu:before:open', { instance: this });
+        this.element.removeClassName('ui-helper-hidden');
+        this._highlightedIndex = -1;
+
+      if (Prototype.Browser.IE) {
+        this.adjustShim();
+      }
+
+      if (this.options.closeOnOutsideClick) {
+        this._outsideClickObserver = $(this.element.ownerDocument).on('click', function(event) {
+          var element = event.element();
+          if (element !== this.element && !element.descendantOf(this.element)) {
+            this.close();
+          }
+        }.bind(this));
+      }
+
+      this.element.fire('ui:menu:after:open', { instance: this });
+    },
+
+    close: function() {
+      var result = this.element.fire('ui:menu:before:close', { instance: this });
+        this.element.addClassName('ui-helper-hidden');
+
+      this.element.fire('ui:menu:after:close', { instance: this });
+
+      if (this._outsideClickObserver) {
+        this._outsideClickObserver.stop();
+        this._outsideClickObserver = null;
+      }
+
+      return this;
+    },
+
+    isOpen: function() {
+      return !this.element.hasClassName('ui-helper-hidden');
+    }
+  });
+
+  Object.extend(UI.Menu, {
+    DEFAULT_OPTIONS: {
+      corner: 'all',
+      closeOnOutsideClick: true
+    }
+  });
+
+})(S2.UI);
+
+
+(function(UI) {
+
+  UI.Autocompleter = Class.create(UI.Base, {
+    NAME: "S2.UI.Autocompleter",
+
+    initialize: function(element, options) {
+      this.element = $(element);
+      var opt = this.setOptions(options);
+
+      UI.addClassNames(this.element, 'ui-widget ui-autocompleter');
+
+      this.input = this.element.down('input[type="text"]');
+
+      if (!this.input) {
+        this.input = new Element('input', { type: 'text' });
+        this.element.insert(this.input);
+      }
+
+      this.input.insert({ before: this.button });
+      this.input.setAttribute('autocomplete', 'off');
+
+      this.name = opt.parameterName || this.input.readAttribute('name');
+
+      if (opt.choices) {
+        this.choices = opt.choices.clone();
+      }
+
+      this.menu = new UI.Menu();
+      this.element.insert(this.menu.element);
+
+      (function() {
+        var iLayout = this.input.getLayout();
+        this.menu.element.setStyle({
+          left: iLayout.get('left') + 'px',
+          top:  (iLayout.get('top') + iLayout.get('margin-box-height')) + 'px'
+        });
+      }).bind(this).defer();
+
+      this.observers = {
+        blur: this._blur.bind(this),
+        keyup: this._keyup.bind(this),
+        keydown: this._keydown.bind(this),
+        selected: this._selected.bind(this)
+      };
+
+      this.addObservers();
+    },
+
+    addObservers: function() {
+      this.input.observe('blur',    this.observers.blur);
+      this.input.observe('keyup',   this.observers.keyup);
+      this.input.observe('keydown', this.observers.keydown);
+
+      this.menu.observe('ui:menu:selected',
+       this.observers.selected);
+    },
+
+    _schedule: function() {
+      this._unschedule();
+      this._timeout = this._change.bind(this).delay(this.options.frequency);
+    },
+
+    _unschedule: function() {
+      if (this._timeout) window.clearTimeout(this._timeout);
+    },
+
+    _keyup: function(event) {
+      var value = this.input.getValue();
+
+      if (value) {
+        if (value.blank() || value.length < this.options.minCharacters) {
+          this.menu.close();
+          this._unschedule();
+          return;
+        }
+        if (value !== this._value) {
+          this._schedule();
+        }
+      } else {
+        this.menu.close();
+        this._unschedule();
+      }
+
+      this._value = value;
+    },
+
+    _keydown: function(event) {
+      if (UI.modifierUsed(event)) return;
+      if (!this.menu.isOpen()) return;
+
+      var keyCode = event.keyCode || event.charCode;
+
+      switch (event.keyCode) {
+        case Event.KEY_UP:
+          this.menu.moveHighlight(-1);
+          event.stop();
+          break;
+        case Event.KEY_DOWN:
+          this.menu.moveHighlight(1);
+          event.stop();
+          break;
+        case Event.KEY_TAB:
+          this.menu.selectChoice();
+          break;
+        case Event.KEY_RETURN:
+          this.menu.selectChoice();
+          this.input.blur();
+          event.stop();
+          break;
+        case Event.KEY_ESC:
+          this.input.setValue('');
+          this.input.blur();
+          break;
+      }
+    },
+
+    _getInput: function() {
+      return this.input.getValue();
+    },
+
+    _setInput: function(value) {
+      this.input.setValue(value);
+    },
+
+    _change: function() {
+      this.findChoices();
+    },
+
+    findChoices: function() {
+      var value = this._getInput();
+      var choices = this.choices || [];
+      var results = choices.inject([], function(memo, choice) {
+        if (choice.toLowerCase().include(value.toLowerCase())) {
+          memo.push(choice);
+        }
+        return memo;
+      });
+
+      this.setChoices(results);
+    },
+
+    setChoices: function(results) {
+      this.results = results;
+      this._updateMenu(results);
+    },
+
+    _updateMenu: function(results) {
+      var opt = this.options;
+
+      this.menu.clear();
+
+      var needle = new RegExp(RegExp.escape(this._value), 'i');
+      for (var i = 0, result, li, text; result = results[i]; i++) {
+        text = opt.highlightSubstring ?
+         result.replace(needle, "<b>$&</b>") :
+         result;
+
+        li = new Element('li').update(text);
+        li.store('ui.autocompleter.value', result);
+        this.menu.addChoice(li);
+      }
+
+      if (results.length === 0) {
+        this.menu.close();
+      } else {
+        this.menu.open();
+      }
+    },
+
+    _moveMenuChoice: function(delta) {
+      var choices = this.list.down('li');
+      this._selectedIndex = (this._selectedIndex + delta).constrain(
+       -1, this.results.length - 1);
+
+      this._highlightMenuChoice();
+    },
+
+    _highlightMenuChoice: function(element) {
+      var choices = this.list.select('li'), index;
+
+      if (Object.isElement(element)) {
+        index = choices.indexOf(element);
+      } else if (Object.isNumber(element)) {
+        index = element;
+      } else {
+        index = this._selectedIndex;
+      }
+
+      UI.removeClassNames(choices, 'ui-state-active');
+      if (index === -1 || index === null) return;
+      choices[index].addClassName('ui-state-active');
+
+      this._selectedIndex = index;
+    },
+
+    _selected: function(event) {
+      var memo = event.memo, li = memo.element;
+
+      if (li) {
+        var value = li.retrieve('ui.autocompleter.value');
+        var result = this.element.fire('ui:autocompleter:selected', {
+          instance: this,
+          value:    value
+        });
+        if (result.stopped) return;
+        this._setInput(value);
+      }
+      this.menu.close();
+    },
+
+    _blur: function(event) {
+      this._unschedule();
+      this.menu.close();
+    }
+  });
+
+  Object.extend(UI.Autocompleter, {
+    DEFAULT_OPTIONS: {
+      tokens: [],
+      frequency: 0.4,
+      minCharacters: 1,
+
+      highlightSubstring: true,
+
+      onShow: Prototype.K,
+      onHide: Prototype.K
+    }
+  });
+
+})(S2.UI);
+
+
+document.observe('dom:loaded',function(){
+  if(!S2.enableMultitouchSupport) return;
+
+  var b = $(document.body), sequenceId = 0;
+
+  function initElementData(element){
+    element._rotation = element._rotation || 0;
+    element._scale = element._scale || 1;
+    element._panX = element._panX || 0;
+    element._panY = element._panY || 0;
+    element._pans = [[0,0],[0,0],[0,0]];
+    element._panidx = 1;
+  }
+
+  function setElementData(element, rotation, scale, panX, panY){
+    element._rotation = rotation;
+    element._scale = scale;
+    element._panX = panX;
+    element._panY = panY;
+  }
+
+  function fireEvent(element, data){
+    element.fire('manipulate:update',
+      Object.extend(data, { id: sequenceId }));
+  }
+
+  function setupIPhoneEvent(){
+    var element, rotation, scale,
+      touches = {}, t1 = null, t2 = null, state = 0, oX, oY,
+      offsetX, offsetY, initialDistance, initialRotation;
+    function updateTouches(touchlist){
+      var i = touchlist.length;
+      while(i--) touches[touchlist[i].identifier] = touchlist[i];
+      var l = []; for(k in touches) l.push(k); l = l.sort();
+      t1 = l.length > 0 ? l[0] : null;
+      element = t1 ? touches[t1].target : null;
+      if(element && element.nodeType==3) element = element.parentNode;
+      t2 = l.length > 1 ? l[1] : null;
+      if(state==0 && (t1&&t2)) {
+        offsetX = (touches[t1].pageX-touches[t2].pageX).abs();
+        offsetY = (touches[t1].pageY-touches[t2].pageY).abs();
+        if(element) initElementData(element);
+        initialDistance = Math.sqrt(offsetX*offsetX + offsetY*offsetY);
+        initialRotation = Math.atan2(touches[t2].pageY-touches[t1].pageY,touches[t2].pageX-touches[t1].pageX);
+        state = 1;
+        return;
+      }
+      if(state==1 && !(t1&&t2)) {
+        if(element) setElementData(element, rotation, scale);
+        state = 0;
+      }
+    }
+    function touchCount(){
+      var c=0; for(k in touches) c++; return c;
+    }
+
+    b.observe('touchstart', function(event){
+      var t = t1, o;
+      updateTouches(event.changedTouches);
+      if(t==null && t1) {
+        o = element.viewportOffset();
+        oX = o.left+(touches[t1].pageX-o.left), oY = o.top+(touches[t1].pageY-o.top);
+      }
+      event.stop();
+    });
+    b.observe('touchmove', function(event){
+      updateTouches(event.changedTouches);
+      if(t1&&!t2) {
+        fireEvent(element, {
+          panX: (element._panX||0)+touches[t1].pageX-oX,
+          panY: (element._panY||0)+touches[t1].pageY-oY,
+          scale: element._scale,
+          rotation: element._rotation
+        });
+        event.stop();
+        return;
+      }
+      if(!(t1&&t2)) return;
+      var a = touches[t2].pageX-touches[t1].pageX,
+        b = touches[t2].pageY-touches[t1].pageY,
+        cX = (element._panX||0) + touches[t2].pageX - a/2 - oX,
+        cY = (element._panY||0) + touches[t2].pageY - b/2 - oY,
+        distance = Math.sqrt(a*a + b*b);
+
+      scale = element._scale * distance/initialDistance;
+      rotation = element._rotation + Math.atan2(b,a) - initialRotation;
+
+      fireEvent(element, { rotation: rotation, scale: scale, panX: cX, panY: cY });
+      event.stop();
+    });
+    ['touchcancel','touchend'].each(function(eventName){
+      b.observe(eventName, function(event){
+        var i = event.changedTouches.length;
+        while(i--) delete(touches[event.changedTouches[i].identifier]);
+        updateTouches([]);
+        if(element) setElementData(element, rotation, scale);
+      });
+    });
+  }
+
+  function setupBridgedEvent(){
+    var element, rotation, scale, panX, panY, active = false;
+
+    b.observe('touchstart', function(event){
+      event.preventDefault();
+    });
+
+    b.observe('transformactionstart', function(event){
+      event.stop();
+
+      element = event.element();
+      initElementData(element);
+      active = true;
+    });
+    b.observe('transformactionupdate', function(event){
+      element = event.element();
+      rotation = element._rotation + event.rotate;
+      scale = element._scale * event.scale;
+      panX = element._panX + event.translateX;
+      panY = element._panY + event.translateY;
+
+      fireEvent(element, {
+        rotation: rotation, scale: scale,
+        panX: panX, panY: panY,
+        clientX: event.clientX, clientY: event.clientY
+      });
+      event.stop();
+    }, false);
+    b.observe('transformactionend', function(event){
+      element = event.element();
+      if(element) setElementData(element, rotation, scale, panX, panY);
+      active = false;
+
+      var speed = Math.sqrt(event.translateSpeedX*event.translateSpeedX +
+          event.translateSpeedY*event.translateSpeedY);
+
+      if(speed>25){
+        element.fire('manipulate:flick', {
+          speed: speed,
+          direction: Math.atan2(event.translateSpeedY,event.translateSpeedX)
+        });
+      }
+    });
+    b.on('mousemove', function(event){
+      event.stop();
+    });
+    b.on('mousedown', function(event){
+      event.stop();
+    });
+    b.on('mouseup', function(event){
+      event.stop();
+    });
+  }
+
+  function setupGenericEvent(){
+    var mX, mY, active = false, listen = true, element, mode,
+      initialDistance, initialRotation, oX, oY, rotation, scale, distance;
+    function objectForScaleEvent(event){
+      var o = element.viewportOffset(),
+        a = (event.pageX-o.left)-mX,
+        b = (event.pageY-o.top)-mY;
+      distance = Math.sqrt(a*a + b*b);
+      scale = element._scale * distance/initialDistance;
+      rotation = element._rotation + Math.atan2(b,a) - initialRotation;
+      return {
+        rotation: rotation, scale: scale,
+        panX: element._panX, panY: element._panY };
+    }
+    function objectForPanEvent(event){
+      return {
+        rotation: element._rotation, scale: element._scale,
+        panX: element._panX+event.pageX-oX, panY: element._panY+event.pageY-oY };
+    }
+    b.observe('mousedown', function(event){
+      mode = event.shiftKey ? 'scale' : 'pan';
+      element = event.element();
+      if(!(element && element.fire)) return;
+      sequenceId++;
+      active = true;
+      initElementData(element);
+      var o =  element.viewportOffset();
+      mX = element.offsetWidth/2;
+      mY = element.offsetHeight/2;
+      var a = event.pageX-o.left-mX, b = event.pageY-o.top-mY;
+      initialDistance = Math.sqrt(a*a+b*b);
+      initialRotation = Math.atan2(b,a);
+      oX = o.left+(event.pageX-o.left), oY = o.top+(event.pageY-o.top);
+      event.stop();
+    });
+    b.observe('mousemove', function(event){
+      if(!active) return;
+      fireEvent(element, mode == 'scale' ? objectForScaleEvent(event) : objectForPanEvent(event));
+    });
+    b.observe('mouseup', function(event){
+      if(!active) return;
+      active = false;
+      if(mode=='scale'){
+        var o = objectForScaleEvent(event);
+        fireEvent(element, o);
+        element._rotation = o.rotation;
+        element._scale = o.scale;
+      } else {
+        fireEvent(element, objectForPanEvent(event));
+        element._panX = element._panX+event.pageX-oX;
+        element._panY = element._panY+event.pageY-oY;
+      }
+    });
+    b.observe('dragstart', function(event){ event.stop(); });
+  }
+
+  try {
+    document.createEvent("TransformActionEvent");
+    return setupBridgedEvent();
+  } catch(e) {}
+
+  try {
+    document.createEvent("TouchEvent");
+    return setupIPhoneEvent();
+  } catch(e) {}
+
+  return setupGenericEvent();
+});
diff --git a/common/src/web/visualizer.html b/common/src/web/visualizer.html
new file mode 100644
index 00000000..140612ad
--- /dev/null
+++ b/common/src/web/visualizer.html
@@ -0,0 +1,17 @@
+<html xmlns="http://www.w3.org/1999/xhtml">
+<head>
+  <link rel="stylesheet" type="text/css" href="screen/screen.css"/>
+  <script type="text/javascript">console.log('Script to remove!');</script>
+  <style type="text/css">
+  #bg {
+  	background: url('beach.jpg')
+  }
+  </style>
+</head>
+<body>
+  <img src="beach.jpg"/>
+  <textarea></textarea>
+  <div id="bg"/>
+  <div style="background: url('beach.jpg')"/>
+</body>
+</html>
\ No newline at end of file
diff --git a/common/src/web/webdriverjs/keypress.html b/common/src/web/webdriverjs/keypress.html
new file mode 100644
index 00000000..e69175ca
--- /dev/null
+++ b/common/src/web/webdriverjs/keypress.html
@@ -0,0 +1,72 @@
+<html>
+<script>
+function handle(event) {
+  var names = {
+    8: 'Bksp',
+    9: '\u21e5 Tab',
+    13: 'Enter',
+    16: 'Shift',
+    27: 'Esc',
+    37: '\u21d0', // left
+    38: '\u21d1', // up
+    39: '\u21d2', // right
+    40: '\u21d3', // down
+    173: '-', // DOM_VK_HYPHEN_MINUS
+    186: ';',
+    187: '=',
+    188: ',',
+    189: '-', // minus
+    190: '.',
+    191: '/',
+    192: '`', // DOM_VK_BACK_QUOTE
+    219: '[',
+    220: '\\',
+    221: ']',
+    222: '\'',
+  };
+
+  var names_shift = {
+    48 : ')',
+    49: '!',
+    50: '@',
+    51 : '#',
+    52 : '$',
+    53 : '%',
+    54 : '^',
+    55 : '&',
+    56 : '*',
+    57 : '(',
+    187 : '+',
+    188 : '<',
+    189 : '_',
+    190 : '>',
+    191 : '?',
+    192: '~',
+    219 : '{',
+    220 : '|',
+    221 : '}',
+  };
+
+  var key;
+
+  if (event.shiftKey) {
+    key = names_shift[event.keyCode];
+  } else {
+    key = names[event.keyCode];
+  }
+
+  if (key === undefined) {
+    key = String.fromCharCode(event.keyCode);
+
+    if (event.shiftKey) {
+      key = key.toUpperCase();
+    } else {
+      key = key.toLowerCase();
+    }
+  }
+
+  document.body.innerHTML = key;
+}
+</script>
+<body onkeyup="handle(event)"></body>
+</html>
\ No newline at end of file
diff --git a/go b/go
index cf156ee8..0846ecea 100755
--- a/go
+++ b/go
@@ -6,5 +6,5 @@ unset GEM_PATH
 
 JAVA_OPTS="-client"
 
-java $JAVA_OPTS -Xmx2048m -XX:MaxPermSize=1024m -XX:ReservedCodeCacheSize=256m -jar third_party/jruby/jruby-complete.jar -X-C -S rake $*
+java $JAVA_OPTS -Xmx900m -XX:MaxPermSize=384m -XX:ReservedCodeCacheSize=128m -jar third_party/jruby/jruby-complete.jar -X-C -S rake $*
 
diff --git a/java/.idea/.name b/java/.idea/.name
new file mode 100644
index 00000000..85863977
--- /dev/null
+++ b/java/.idea/.name
@@ -0,0 +1 @@
+java
\ No newline at end of file
diff --git a/java/.idea/compiler.xml b/java/.idea/compiler.xml
new file mode 100644
index 00000000..a1b41c52
--- /dev/null
+++ b/java/.idea/compiler.xml
@@ -0,0 +1,21 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="CompilerConfiguration">
+    <option name="DEFAULT_COMPILER" value="Javac" />
+    <resourceExtensions />
+    <wildcardResourcePatterns>
+      <entry name="?*.properties" />
+      <entry name="?*.xml" />
+      <entry name="?*.gif" />
+      <entry name="?*.png" />
+      <entry name="?*.jpeg" />
+      <entry name="?*.jpg" />
+      <entry name="?*.html" />
+      <entry name="?*.dtd" />
+      <entry name="?*.tld" />
+      <entry name="?*.ftl" />
+    </wildcardResourcePatterns>
+    <annotationProcessing enabled="false" useClasspath="true" />
+  </component>
+</project>
+
diff --git a/java/.idea/copyright/profiles_settings.xml b/java/.idea/copyright/profiles_settings.xml
new file mode 100644
index 00000000..3572571a
--- /dev/null
+++ b/java/.idea/copyright/profiles_settings.xml
@@ -0,0 +1,5 @@
+<component name="CopyrightManager">
+  <settings default="">
+    <module2copyright />
+  </settings>
+</component>
\ No newline at end of file
diff --git a/java/.idea/encodings.xml b/java/.idea/encodings.xml
new file mode 100644
index 00000000..e206d70d
--- /dev/null
+++ b/java/.idea/encodings.xml
@@ -0,0 +1,5 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="Encoding" useUTFGuessing="true" native2AsciiForPropertiesFiles="false" />
+</project>
+
diff --git a/java/.idea/libraries/internal.xml b/java/.idea/libraries/internal.xml
new file mode 100644
index 00000000..56fc7d39
--- /dev/null
+++ b/java/.idea/libraries/internal.xml
@@ -0,0 +1,10 @@
+<component name="libraryTable">
+  <library name="internal">
+    <CLASSES>
+      <root url="jar://$PROJECT_DIR$/client/test/org/openqa/selenium/internal/subfolders.zip!/" />
+      <root url="jar://$PROJECT_DIR$/client/test/org/openqa/selenium/internal/single-file.zip!/" />
+    </CLASSES>
+    <JAVADOC />
+    <SOURCES />
+  </library>
+</component>
\ No newline at end of file
diff --git a/java/.idea/misc.xml b/java/.idea/misc.xml
new file mode 100644
index 00000000..97320410
--- /dev/null
+++ b/java/.idea/misc.xml
@@ -0,0 +1,10 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="EntryPointsManager">
+    <entry_points version="2.0" />
+  </component>
+  <component name="ProjectRootManager" version="2" languageLevel="JDK_1_6" assert-keyword="true" jdk-15="true" project-jdk-name="1.6" project-jdk-type="JavaSDK">
+    <output url="file://$PROJECT_DIR$/out" />
+  </component>
+</project>
+
diff --git a/java/.idea/modules.xml b/java/.idea/modules.xml
new file mode 100644
index 00000000..3e87497d
--- /dev/null
+++ b/java/.idea/modules.xml
@@ -0,0 +1,10 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="ProjectModuleManager">
+    <modules>
+      <module fileurl="file://$PROJECT_DIR$/client/Client.iml" filepath="$PROJECT_DIR$/client/Client.iml" />
+      <module fileurl="file://$PROJECT_DIR$/server/Server.iml" filepath="$PROJECT_DIR$/server/Server.iml" />
+    </modules>
+  </component>
+</project>
+
diff --git a/java/.idea/scopes/scope_settings.xml b/java/.idea/scopes/scope_settings.xml
new file mode 100644
index 00000000..922003b8
--- /dev/null
+++ b/java/.idea/scopes/scope_settings.xml
@@ -0,0 +1,5 @@
+<component name="DependencyValidationManager">
+  <state>
+    <option name="SKIP_IMPORT_STATEMENTS" value="false" />
+  </state>
+</component>
\ No newline at end of file
diff --git a/java/.idea/uiDesigner.xml b/java/.idea/uiDesigner.xml
new file mode 100644
index 00000000..3b000203
--- /dev/null
+++ b/java/.idea/uiDesigner.xml
@@ -0,0 +1,125 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="Palette2">
+    <group name="Swing">
+      <item class="com.intellij.uiDesigner.HSpacer" tooltip-text="Horizontal Spacer" icon="/com/intellij/uiDesigner/icons/hspacer.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="1" hsize-policy="6" anchor="0" fill="1" />
+      </item>
+      <item class="com.intellij.uiDesigner.VSpacer" tooltip-text="Vertical Spacer" icon="/com/intellij/uiDesigner/icons/vspacer.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="1" anchor="0" fill="2" />
+      </item>
+      <item class="javax.swing.JPanel" icon="/com/intellij/uiDesigner/icons/panel.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="3" hsize-policy="3" anchor="0" fill="3" />
+      </item>
+      <item class="javax.swing.JScrollPane" icon="/com/intellij/uiDesigner/icons/scrollPane.png" removable="false" auto-create-binding="false" can-attach-label="true">
+        <default-constraints vsize-policy="7" hsize-policy="7" anchor="0" fill="3" />
+      </item>
+      <item class="javax.swing.JButton" icon="/com/intellij/uiDesigner/icons/button.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="3" anchor="0" fill="1" />
+        <initial-values>
+          <property name="text" value="Button" />
+        </initial-values>
+      </item>
+      <item class="javax.swing.JRadioButton" icon="/com/intellij/uiDesigner/icons/radioButton.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="3" anchor="8" fill="0" />
+        <initial-values>
+          <property name="text" value="RadioButton" />
+        </initial-values>
+      </item>
+      <item class="javax.swing.JCheckBox" icon="/com/intellij/uiDesigner/icons/checkBox.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="3" anchor="8" fill="0" />
+        <initial-values>
+          <property name="text" value="CheckBox" />
+        </initial-values>
+      </item>
+      <item class="javax.swing.JLabel" icon="/com/intellij/uiDesigner/icons/label.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="0" anchor="8" fill="0" />
+        <initial-values>
+          <property name="text" value="Label" />
+        </initial-values>
+      </item>
+      <item class="javax.swing.JTextField" icon="/com/intellij/uiDesigner/icons/textField.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="8" fill="1">
+          <preferred-size width="150" height="-1" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JPasswordField" icon="/com/intellij/uiDesigner/icons/passwordField.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="8" fill="1">
+          <preferred-size width="150" height="-1" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JFormattedTextField" icon="/com/intellij/uiDesigner/icons/formattedTextField.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="8" fill="1">
+          <preferred-size width="150" height="-1" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JTextArea" icon="/com/intellij/uiDesigner/icons/textArea.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JTextPane" icon="/com/intellij/uiDesigner/icons/textPane.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JEditorPane" icon="/com/intellij/uiDesigner/icons/editorPane.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JComboBox" icon="/com/intellij/uiDesigner/icons/comboBox.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="0" hsize-policy="2" anchor="8" fill="1" />
+      </item>
+      <item class="javax.swing.JTable" icon="/com/intellij/uiDesigner/icons/table.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JList" icon="/com/intellij/uiDesigner/icons/list.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="2" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JTree" icon="/com/intellij/uiDesigner/icons/tree.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3">
+          <preferred-size width="150" height="50" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JTabbedPane" icon="/com/intellij/uiDesigner/icons/tabbedPane.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="3" hsize-policy="3" anchor="0" fill="3">
+          <preferred-size width="200" height="200" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JSplitPane" icon="/com/intellij/uiDesigner/icons/splitPane.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="3" hsize-policy="3" anchor="0" fill="3">
+          <preferred-size width="200" height="200" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JSpinner" icon="/com/intellij/uiDesigner/icons/spinner.png" removable="false" auto-create-binding="true" can-attach-label="true">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="8" fill="1" />
+      </item>
+      <item class="javax.swing.JSlider" icon="/com/intellij/uiDesigner/icons/slider.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="8" fill="1" />
+      </item>
+      <item class="javax.swing.JSeparator" icon="/com/intellij/uiDesigner/icons/separator.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="6" anchor="0" fill="3" />
+      </item>
+      <item class="javax.swing.JProgressBar" icon="/com/intellij/uiDesigner/icons/progressbar.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="0" fill="1" />
+      </item>
+      <item class="javax.swing.JToolBar" icon="/com/intellij/uiDesigner/icons/toolbar.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="6" anchor="0" fill="1">
+          <preferred-size width="-1" height="20" />
+        </default-constraints>
+      </item>
+      <item class="javax.swing.JToolBar$Separator" icon="/com/intellij/uiDesigner/icons/toolbarSeparator.png" removable="false" auto-create-binding="false" can-attach-label="false">
+        <default-constraints vsize-policy="0" hsize-policy="0" anchor="0" fill="1" />
+      </item>
+      <item class="javax.swing.JScrollBar" icon="/com/intellij/uiDesigner/icons/scrollbar.png" removable="false" auto-create-binding="true" can-attach-label="false">
+        <default-constraints vsize-policy="6" hsize-policy="0" anchor="0" fill="2" />
+      </item>
+    </group>
+  </component>
+</project>
+
diff --git a/java/.idea/vcs.xml b/java/.idea/vcs.xml
new file mode 100644
index 00000000..def6a6a1
--- /dev/null
+++ b/java/.idea/vcs.xml
@@ -0,0 +1,7 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="VcsDirectoryMappings">
+    <mapping directory="" vcs="" />
+  </component>
+</project>
+
diff --git a/java/.idea/workspace.xml b/java/.idea/workspace.xml
new file mode 100644
index 00000000..7d46f7df
--- /dev/null
+++ b/java/.idea/workspace.xml
@@ -0,0 +1,695 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project version="4">
+  <component name="ChangeListManager">
+    <list default="true" id="fff40e8c-c379-439a-8c23-f304e031a6e4" name="Default" comment="" />
+    <ignored path="java.iws" />
+    <ignored path=".idea/workspace.xml" />
+    <option name="TRACKING_ENABLED" value="true" />
+    <option name="SHOW_DIALOG" value="false" />
+    <option name="HIGHLIGHT_CONFLICTS" value="true" />
+    <option name="HIGHLIGHT_NON_ACTIVE_CHANGELIST" value="false" />
+    <option name="LAST_RESOLUTION" value="IGNORE" />
+  </component>
+  <component name="ChangesViewManager" flattened_view="true" show_ignored="false" />
+  <component name="CreatePatchCommitExecutor">
+    <option name="PATCH_PATH" value="" />
+  </component>
+  <component name="DaemonCodeAnalyzer">
+    <disable_hints />
+  </component>
+  <component name="DebuggerManager">
+    <breakpoint_any>
+      <breakpoint>
+        <option name="NOTIFY_CAUGHT" value="true" />
+        <option name="NOTIFY_UNCAUGHT" value="true" />
+        <option name="ENABLED" value="false" />
+        <option name="LOG_ENABLED" value="false" />
+        <option name="LOG_EXPRESSION_ENABLED" value="false" />
+        <option name="SUSPEND_POLICY" value="SuspendAll" />
+        <option name="COUNT_FILTER_ENABLED" value="false" />
+        <option name="COUNT_FILTER" value="0" />
+        <option name="CONDITION_ENABLED" value="false" />
+        <option name="CLASS_FILTERS_ENABLED" value="false" />
+        <option name="INSTANCE_FILTERS_ENABLED" value="false" />
+        <option name="CONDITION" value="" />
+        <option name="LOG_MESSAGE" value="" />
+      </breakpoint>
+      <breakpoint>
+        <option name="NOTIFY_CAUGHT" value="true" />
+        <option name="NOTIFY_UNCAUGHT" value="true" />
+        <option name="ENABLED" value="false" />
+        <option name="LOG_ENABLED" value="false" />
+        <option name="LOG_EXPRESSION_ENABLED" value="false" />
+        <option name="SUSPEND_POLICY" value="SuspendAll" />
+        <option name="COUNT_FILTER_ENABLED" value="false" />
+        <option name="COUNT_FILTER" value="0" />
+        <option name="CONDITION_ENABLED" value="false" />
+        <option name="CLASS_FILTERS_ENABLED" value="false" />
+        <option name="INSTANCE_FILTERS_ENABLED" value="false" />
+        <option name="CONDITION" value="" />
+        <option name="LOG_MESSAGE" value="" />
+      </breakpoint>
+    </breakpoint_any>
+    <breakpoint_rules />
+    <ui_properties />
+  </component>
+  <component name="FavoritesManager">
+    <favorites_list name="java" />
+  </component>
+  <component name="FileEditorManager">
+    <leaf>
+      <file leaf-file-name="ImplicitWaitTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/ImplicitWaitTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="29" column="64" selection-start="1280" selection-end="1280" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="PageLoadingTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/PageLoadingTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="54" column="64" selection-start="2529" selection-end="2529" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="ProxySettingTest.java" pinned="false" current="true" current-in-tab="true">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/ProxySettingTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="46" column="30" selection-start="1987" selection-end="1987" vertical-scroll-proportion="0.028680688">
+              <folding>
+                <element signature="imports" expanded="true" />
+              </folding>
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="RenderedWebElementTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/RenderedWebElementTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="49" column="64" selection-start="2288" selection-end="2288" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="SessionHandlingTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/SessionHandlingTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="37" column="64" selection-start="1700" selection-end="1700" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="TextPagesTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/TextPagesTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="31" column="64" selection-start="1446" selection-end="1446" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="WindowSwitchingTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/WindowSwitchingTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="51" column="64" selection-start="2235" selection-end="2235" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="BasicKeyboardInterfaceTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="49" column="97" selection-start="1951" selection-end="1951" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="BasicMouseInterfaceTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="51" column="64" selection-start="2335" selection-end="2335" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+      <file leaf-file-name="PerformanceLoggingTest.java" pinned="false" current="false" current-in-tab="false">
+        <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java">
+          <provider selected="true" editor-type-id="text-editor">
+            <state line="64" column="69" selection-start="2584" selection-end="2584" vertical-scroll-proportion="0.0">
+              <folding />
+            </state>
+          </provider>
+        </entry>
+      </file>
+    </leaf>
+  </component>
+  <component name="FindManager">
+    <FindUsagesManager>
+      <setting name="OPEN_NEW_TAB" value="false" />
+    </FindUsagesManager>
+  </component>
+  <component name="IdeDocumentHistory">
+    <option name="changedFiles">
+      <list>
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/InteractionTests.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/CombinedInputActionsTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/StandardSeleniumTests.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/ClickScrollingTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/CorrectEventFiringTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/I18nTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/DragAndDropTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/ImplicitWaitTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/PageLoadingTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/ProxySettingTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/RenderedWebElementTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/SessionHandlingTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/TextPagesTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/WindowSwitchingTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java" />
+        <option value="$PROJECT_DIR$/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java" />
+      </list>
+    </option>
+  </component>
+  <component name="ProjectFrameBounds">
+    <option name="x" value="66" />
+    <option name="y" value="130" />
+    <option name="width" value="1064" />
+    <option name="height" value="744" />
+  </component>
+  <component name="ProjectLevelVcsManager" settingsEditedManually="false">
+    <OptionsSetting value="true" id="Add" />
+    <OptionsSetting value="true" id="Remove" />
+    <OptionsSetting value="true" id="Checkout" />
+    <OptionsSetting value="true" id="Update" />
+    <OptionsSetting value="true" id="Status" />
+    <OptionsSetting value="true" id="Edit" />
+    <ConfirmationsSetting value="0" id="Add" />
+    <ConfirmationsSetting value="0" id="Remove" />
+  </component>
+  <component name="ProjectReloadState">
+    <option name="STATE" value="0" />
+  </component>
+  <component name="ProjectView">
+    <navigator currentView="ProjectPane" proportions="" version="1" splitterProportion="0.5">
+      <flattenPackages />
+      <showMembers />
+      <showModules />
+      <showLibraryContents />
+      <hideEmptyPackages />
+      <abbreviatePackageNames />
+      <autoscrollToSource />
+      <autoscrollFromSource />
+      <sortByType />
+    </navigator>
+    <panes>
+      <pane id="ProjectPane">
+        <subPane>
+          <PATH>
+            <PATH_ELEMENT>
+              <option name="myItemId" value="java" />
+              <option name="myItemType" value="com.intellij.ide.projectView.impl.nodes.ProjectViewProjectNode" />
+            </PATH_ELEMENT>
+          </PATH>
+        </subPane>
+      </pane>
+      <pane id="Scope">
+        <subPane subId="Project Files" />
+      </pane>
+      <pane id="PackagesPane">
+        <subPane />
+      </pane>
+    </panes>
+  </component>
+  <component name="PropertiesComponent">
+    <property name="GoToFile.includeJavaFiles" value="false" />
+    <property name="project.structure.last.edited" value="Modules" />
+    <property name="project.structure.proportion" value="0.15" />
+    <property name="options.splitter.main.proportions" value="0.3" />
+    <property name="MemberChooser.sorted" value="false" />
+    <property name="options.lastSelected" value="project.propVCSSupport.Mappings" />
+    <property name="project.structure.side.proportion" value="0.2" />
+    <property name="MemberChooser.copyJavadoc" value="false" />
+    <property name="GoToClass.toSaveIncludeLibraries" value="false" />
+    <property name="MemberChooser.showClasses" value="true" />
+    <property name="GoToClass.includeLibraries" value="false" />
+    <property name="options.splitter.details.proportions" value="0.2" />
+    <property name="options.searchVisible" value="true" />
+  </component>
+  <component name="RunManager">
+    <configuration default="true" type="#org.jetbrains.idea.devkit.run.PluginConfigurationType" factoryName="Plugin">
+      <module name="" />
+      <option name="VM_PARAMETERS" value="-Xmx512m -Xms256m -XX:MaxPermSize=250m" />
+      <option name="PROGRAM_PARAMETERS" />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Make" enabled="true" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <configuration default="true" type="Remote" factoryName="Remote">
+      <option name="USE_SOCKET_TRANSPORT" value="true" />
+      <option name="SERVER_MODE" value="false" />
+      <option name="SHMEM_ADDRESS" value="javadebug" />
+      <option name="HOST" value="localhost" />
+      <option name="PORT" value="5005" />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <configuration default="true" type="TestNG" factoryName="TestNG">
+      <module name="" />
+      <option name="ALTERNATIVE_JRE_PATH_ENABLED" value="false" />
+      <option name="ALTERNATIVE_JRE_PATH" />
+      <option name="SUITE_NAME" />
+      <option name="PACKAGE_NAME" />
+      <option name="MAIN_CLASS_NAME" />
+      <option name="METHOD_NAME" />
+      <option name="GROUP_NAME" />
+      <option name="TEST_OBJECT" value="CLASS" />
+      <option name="VM_PARAMETERS" value="-ea" />
+      <option name="PARAMETERS" />
+      <option name="WORKING_DIRECTORY" value="$PROJECT_DIR$" />
+      <option name="OUTPUT_DIRECTORY" />
+      <option name="ANNOTATION_TYPE" />
+      <option name="ENV_VARIABLES" />
+      <option name="PASS_PARENT_ENVS" value="true" />
+      <option name="TEST_SEARCH_SCOPE">
+        <value defaultName="moduleWithDependencies" />
+      </option>
+      <option name="USE_DEFAULT_REPORTERS" value="false" />
+      <option name="PROPERTIES_FILE" />
+      <envs />
+      <properties />
+      <listeners />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Make" enabled="true" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <configuration default="true" type="Applet" factoryName="Applet">
+      <module name="" />
+      <option name="MAIN_CLASS_NAME" />
+      <option name="HTML_FILE_NAME" />
+      <option name="HTML_USED" value="false" />
+      <option name="WIDTH" value="400" />
+      <option name="HEIGHT" value="300" />
+      <option name="POLICY_FILE" value="$APPLICATION_HOME_DIR$/bin/appletviewer.policy" />
+      <option name="VM_PARAMETERS" />
+      <option name="ALTERNATIVE_JRE_PATH_ENABLED" value="false" />
+      <option name="ALTERNATIVE_JRE_PATH" />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Make" enabled="true" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <configuration default="true" type="Application" factoryName="Application">
+      <option name="MAIN_CLASS_NAME" />
+      <option name="VM_PARAMETERS" />
+      <option name="PROGRAM_PARAMETERS" />
+      <option name="WORKING_DIRECTORY" value="$PROJECT_DIR$" />
+      <option name="ALTERNATIVE_JRE_PATH_ENABLED" value="false" />
+      <option name="ALTERNATIVE_JRE_PATH" />
+      <option name="ENABLE_SWING_INSPECTOR" value="false" />
+      <option name="ENV_VARIABLES" />
+      <option name="PASS_PARENT_ENVS" value="true" />
+      <module name="" />
+      <envs />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Make" enabled="true" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <configuration default="true" type="JUnit" factoryName="JUnit">
+      <module name="" />
+      <option name="ALTERNATIVE_JRE_PATH_ENABLED" value="false" />
+      <option name="ALTERNATIVE_JRE_PATH" />
+      <option name="PACKAGE_NAME" />
+      <option name="MAIN_CLASS_NAME" />
+      <option name="METHOD_NAME" />
+      <option name="TEST_OBJECT" value="class" />
+      <option name="VM_PARAMETERS" value="-ea" />
+      <option name="PARAMETERS" />
+      <option name="WORKING_DIRECTORY" value="$PROJECT_DIR$" />
+      <option name="ENV_VARIABLES" />
+      <option name="PASS_PARENT_ENVS" value="true" />
+      <option name="TEST_SEARCH_SCOPE">
+        <value defaultName="moduleWithDependencies" />
+      </option>
+      <envs />
+      <patterns />
+      <method>
+        <option name="AntTarget" enabled="false" />
+        <option name="BuildArtifacts" enabled="false" />
+        <option name="Make" enabled="true" />
+        <option name="Maven.BeforeRunTask" enabled="false" />
+      </method>
+    </configuration>
+    <list size="0" />
+    <configuration name="&lt;template&gt;" type="WebApp" default="true" selected="false">
+      <Host>localhost</Host>
+      <Port>5050</Port>
+    </configuration>
+  </component>
+  <component name="ShelveChangesManager" show_recycled="false" />
+  <component name="SvnConfiguration" maxAnnotateRevisions="500" myUseAcceleration="nothing" myAutoUpdateAfterCommit="false" cleanupOnStartRun="false">
+    <option name="USER" value="" />
+    <option name="PASSWORD" value="" />
+    <option name="mySSHConnectionTimeout" value="30000" />
+    <option name="mySSHReadTimeout" value="30000" />
+    <option name="LAST_MERGED_REVISION" />
+    <option name="MERGE_DRY_RUN" value="false" />
+    <option name="MERGE_DIFF_USE_ANCESTRY" value="true" />
+    <option name="UPDATE_LOCK_ON_DEMAND" value="false" />
+    <option name="IGNORE_SPACES_IN_MERGE" value="false" />
+    <option name="DETECT_NESTED_COPIES" value="true" />
+    <option name="CHECK_NESTED_FOR_QUICK_MERGE" value="false" />
+    <option name="IGNORE_SPACES_IN_ANNOTATE" value="true" />
+    <option name="SHOW_MERGE_SOURCES_IN_ANNOTATE" value="true" />
+    <option name="FORCE_UPDATE" value="false" />
+    <option name="IGNORE_EXTERNALS" value="false" />
+    <myIsUseDefaultProxy>false</myIsUseDefaultProxy>
+  </component>
+  <component name="TaskManager">
+    <task active="true" id="Default" summary="Default task">
+      <changelist id="fff40e8c-c379-439a-8c23-f304e031a6e4" name="Default" comment="" />
+      <created>1364302406230</created>
+      <updated>1364302406230</updated>
+    </task>
+    <servers />
+  </component>
+  <component name="ToolWindowManager">
+    <frame x="66" y="130" width="1064" height="744" extended-state="0" />
+    <editor active="false" />
+    <layout>
+      <window_info id="Changes" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="7" side_tool="false" content_ui="tabs" />
+      <window_info id="JetGradle" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="3" side_tool="false" content_ui="tabs" />
+      <window_info id="Palette" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="3" side_tool="false" content_ui="tabs" />
+      <window_info id="Ant Build" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.25" sideWeight="0.5" order="1" side_tool="false" content_ui="tabs" />
+      <window_info id="Debug" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.4" sideWeight="0.5" order="3" side_tool="false" content_ui="tabs" />
+      <window_info id="Event Log" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="7" side_tool="true" content_ui="tabs" />
+      <window_info id="Favorites" active="false" anchor="left" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.32971373" sideWeight="0.5" order="2" side_tool="true" content_ui="tabs" />
+      <window_info id="Version Control" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="7" side_tool="false" content_ui="tabs" />
+      <window_info id="TODO" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="6" side_tool="false" content_ui="tabs" />
+      <window_info id="Structure" active="false" anchor="left" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="true" weight="0.22704837" sideWeight="0.35108152" order="1" side_tool="true" content_ui="tabs" />
+      <window_info id="Maven Projects" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="3" side_tool="false" content_ui="tabs" />
+      <window_info id="Commander" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.4" sideWeight="0.5" order="0" side_tool="false" content_ui="tabs" />
+      <window_info id="Project" active="true" anchor="left" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="true" weight="0.22704837" sideWeight="0.6372712" order="0" side_tool="false" content_ui="combo" />
+      <window_info id="Run" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="2" side_tool="false" content_ui="tabs" />
+      <window_info id="Cvs" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.25" sideWeight="0.5" order="4" side_tool="false" content_ui="tabs" />
+      <window_info id="Message" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.33" sideWeight="0.5" order="0" side_tool="false" content_ui="tabs" />
+      <window_info id="Find" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.32881355" sideWeight="0.5" order="1" side_tool="false" content_ui="tabs" />
+      <window_info id="Hierarchy" active="false" anchor="right" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.25" sideWeight="0.5" order="2" side_tool="false" content_ui="combo" />
+      <window_info id="Inspection" active="false" anchor="bottom" auto_hide="false" internal_type="DOCKED" type="DOCKED" visible="false" weight="0.4" sideWeight="0.5" order="5" side_tool="false" content_ui="tabs" />
+    </layout>
+  </component>
+  <component name="VcsContentAnnotationSettings">
+    <option name="myLimit" value="2678400000" />
+  </component>
+  <component name="VcsManagerConfiguration">
+    <option name="OFFER_MOVE_TO_ANOTHER_CHANGELIST_ON_PARTIAL_COMMIT" value="true" />
+    <option name="CHECK_CODE_SMELLS_BEFORE_PROJECT_COMMIT" value="true" />
+    <option name="CHECK_NEW_TODO" value="true" />
+    <option name="myTodoPanelSettings">
+      <value>
+        <are-packages-shown value="false" />
+        <are-modules-shown value="false" />
+        <flatten-packages value="false" />
+        <is-autoscroll-to-source value="false" />
+      </value>
+    </option>
+    <option name="PERFORM_UPDATE_IN_BACKGROUND" value="true" />
+    <option name="PERFORM_COMMIT_IN_BACKGROUND" value="true" />
+    <option name="PERFORM_EDIT_IN_BACKGROUND" value="true" />
+    <option name="PERFORM_CHECKOUT_IN_BACKGROUND" value="true" />
+    <option name="PERFORM_ADD_REMOVE_IN_BACKGROUND" value="true" />
+    <option name="PERFORM_ROLLBACK_IN_BACKGROUND" value="false" />
+    <option name="CHECK_LOCALLY_CHANGED_CONFLICTS_IN_BACKGROUND" value="false" />
+    <option name="ENABLE_BACKGROUND_PROCESSES" value="false" />
+    <option name="CHANGED_ON_SERVER_INTERVAL" value="60" />
+    <option name="SHOW_ONLY_CHANGED_IN_SELECTION_DIFF" value="true" />
+    <option name="CHECK_COMMIT_MESSAGE_SPELLING" value="true" />
+    <option name="DEFAULT_PATCH_EXTENSION" value="patch" />
+    <option name="SHORT_DIFF_HORISONTALLY" value="true" />
+    <option name="SHORT_DIFF_EXTRA_LINES" value="2" />
+    <option name="SOFT_WRAPS_IN_SHORT_DIFF" value="true" />
+    <option name="INCLUDE_TEXT_INTO_PATCH" value="false" />
+    <option name="INCLUDE_TEXT_INTO_SHELF" value="false" />
+    <option name="CREATE_PATCH_EXPAND_DETAILS_DEFAULT" value="true" />
+    <option name="SHOW_FILE_HISTORY_DETAILS" value="true" />
+    <option name="SHOW_VCS_ERROR_NOTIFICATIONS" value="true" />
+    <option name="FORCE_NON_EMPTY_COMMENT" value="false" />
+    <option name="CLEAR_INITIAL_COMMIT_MESSAGE" value="false" />
+    <option name="LAST_COMMIT_MESSAGE" />
+    <option name="MAKE_NEW_CHANGELIST_ACTIVE" value="false" />
+    <option name="OPTIMIZE_IMPORTS_BEFORE_PROJECT_COMMIT" value="false" />
+    <option name="CHECK_FILES_UP_TO_DATE_BEFORE_COMMIT" value="false" />
+    <option name="REFORMAT_BEFORE_PROJECT_COMMIT" value="false" />
+    <option name="REFORMAT_BEFORE_FILE_COMMIT" value="false" />
+    <option name="FILE_HISTORY_DIALOG_COMMENTS_SPLITTER_PROPORTION" value="0.8" />
+    <option name="FILE_HISTORY_DIALOG_SPLITTER_PROPORTION" value="0.5" />
+    <option name="ACTIVE_VCS_NAME" />
+    <option name="UPDATE_GROUP_BY_PACKAGES" value="false" />
+    <option name="UPDATE_GROUP_BY_CHANGELIST" value="false" />
+    <option name="SHOW_FILE_HISTORY_AS_TREE" value="false" />
+    <option name="FILE_HISTORY_SPLITTER_PROPORTION" value="0.6" />
+  </component>
+  <component name="XDebuggerManager">
+    <breakpoint-manager />
+  </component>
+  <component name="editorHistoryManager">
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/InteractionTests.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="25" column="47" selection-start="859" selection-end="859" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/IndividualMouseActionsTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="32" column="13" selection-start="1012" selection-end="1012" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/ClickScrollingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="33" column="66" selection-start="1272" selection-end="1272" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/CorrectEventFiringTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="51" column="64" selection-start="2301" selection-end="2301" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/I18nTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="26" column="73" selection-start="1119" selection-end="1119" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/DragAndDropTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="31" column="22" selection-start="1130" selection-end="1130" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/ImplicitWaitTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="29" column="64" selection-start="1280" selection-end="1280" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/PageLoadingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="54" column="64" selection-start="2529" selection-end="2529" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/RenderedWebElementTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="49" column="64" selection-start="2288" selection-end="2288" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/SessionHandlingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="37" column="64" selection-start="1700" selection-end="1700" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/TextPagesTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="31" column="64" selection-start="1446" selection-end="1446" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/WindowSwitchingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="51" column="64" selection-start="2235" selection-end="2235" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="49" column="97" selection-start="1951" selection-end="1951" vertical-scroll-proportion="0.0">
+          <folding />
+        </state>
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="51" column="64" selection-start="2335" selection-end="2335" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="64" column="69" selection-start="2584" selection-end="2584" vertical-scroll-proportion="0.0" />
+      </provider>
+    </entry>
+    <entry file="file://$PROJECT_DIR$/client/test/org/openqa/selenium/ProxySettingTest.java">
+      <provider selected="true" editor-type-id="text-editor">
+        <state line="46" column="30" selection-start="1987" selection-end="1987" vertical-scroll-proportion="0.028680688">
+          <folding>
+            <element signature="imports" expanded="true" />
+          </folding>
+        </state>
+      </provider>
+    </entry>
+  </component>
+  <component name="ideajad">
+    <property name="annotate" value="false" />
+    <property name="annotateFully" value="false" />
+    <property name="braces" value="false" />
+    <property name="clear" value="false" />
+    <property name="confirmNavigationTriggeredDecompile" value="true" />
+    <property name="dead" value="true" />
+    <property name="defaultInitializers" value="false" />
+    <property name="dissassemblerOnly" value="false" />
+    <property name="fieldsFirst" value="true" />
+    <property name="fileExtension" value="java" />
+    <property name="fullyQualifiedNames" value="false" />
+    <property name="indentation" value="4" />
+    <property name="intRadix" value="10" />
+    <property name="lineNumbersAsComments" value="true" />
+    <property name="longRadix" value="10" />
+    <property name="maxStringLength" value="64" />
+    <property name="nocast" value="false" />
+    <property name="noclass" value="false" />
+    <property name="nocode" value="false" />
+    <property name="noconv" value="false" />
+    <property name="noctor" value="false" />
+    <property name="nodos" value="false" />
+    <property name="nofd" value="false" />
+    <property name="noinner" value="false" />
+    <property name="nolvt" value="false" />
+    <property name="nonlb" value="false" />
+    <property name="outputDirectory" value="" />
+    <property name="packFields" value="3" />
+    <property name="packImports" value="7" />
+    <property name="prefixNumericalClasses" value="_cls" />
+    <property name="prefixNumericalFields" value="_fld" />
+    <property name="prefixNumericalLocals" value="_lcl" />
+    <property name="prefixNumericalMethods" value="_mth" />
+    <property name="prefixNumericalParameters" value="_prm" />
+    <property name="prefixUnusedExceptions" value="_ex" />
+    <property name="readonly" value="false" />
+    <property name="safe" value="false" />
+    <property name="sort" value="false" />
+    <property name="spaceAfterKeyword" value="false" />
+    <property name="splitStringsAtNewline" value="false" />
+    <property name="useTabs" value="false" />
+  </component>
+  <component name="masterDetails">
+    <states>
+      <state key="ArtifactsStructureConfigurable.UI">
+        <settings>
+          <artifact-editor />
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="FacetStructureConfigurable.UI">
+        <settings>
+          <last-edited>No facets are configured</last-edited>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="GlobalLibrariesConfigurable.UI">
+        <settings>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="JdkListConfigurable.UI">
+        <settings>
+          <last-edited>1.7</last-edited>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="ModuleStructureConfigurable.UI">
+        <settings>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="ProjectJDKs.UI">
+        <settings>
+          <last-edited>1.6</last-edited>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.20000002" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+      <state key="ProjectLibrariesConfigurable.UI">
+        <settings>
+          <last-edited>internal</last-edited>
+          <splitter-proportions>
+            <option name="proportions">
+              <list>
+                <option value="0.2" />
+              </list>
+            </option>
+          </splitter-proportions>
+        </settings>
+      </state>
+    </states>
+  </component>
+</project>
+
diff --git a/java/client/.classpath b/java/client/.classpath
index 904e2926..d33bc92d 100644
--- a/java/client/.classpath
+++ b/java/client/.classpath
@@ -33,7 +33,7 @@
 	<classpathentry kind="lib" path="/third-party/java/xml/xalan-2.7.1.jar"/>
 	<classpathentry kind="lib" path="/third-party/java/commons-fileupload/commons-fileupload-1.2.2.jar" sourcepath="/third-party/java/commons-fileupload/commons-fileupload-1.2.2-src.jar"/>
 	<classpathentry kind="lib" path="/third-party/java/webbit/webbit-0.4.15.jar" sourcepath="/third-party/java/webbit/webbit-0.4.15-sources.jar"/>
-	<classpathentry kind="lib" path="/third-party/java/little_proxy/littleproxy-0.5.3.jar" sourcepath="/third-party/java/little_proxy/littleproxy-0.5.3-sources.jar"/>
+	<classpathentry kind="lib" path="/third-party/java/little_proxy/littleproxy-0.5-SNAPSHOT.jar" sourcepath="/third-party/java/little_proxy/littleproxy-0.5-SNAPSHOT-sources.jar"/>
 	<classpathentry kind="lib" path="/third-party/java/nekohtml/nekohtml-1.9.21.jar"/>
 	<classpathentry kind="lib" path="/third-party/java/netty/netty-3.5.7.Final.jar"/>
 	<classpathentry kind="lib" path="/third-party/java/google-protobuffers/protobuf-java-2.4.1.jar"/>
diff --git a/java/client/Client.iml b/java/client/Client.iml
new file mode 100644
index 00000000..06922e89
--- /dev/null
+++ b/java/client/Client.iml
@@ -0,0 +1,13 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<module type="JAVA_MODULE" version="4">
+  <component name="NewModuleRootManager" inherit-compiler-output="true">
+    <exclude-output />
+    <content url="file://$MODULE_DIR$">
+      <sourceFolder url="file://$MODULE_DIR$/src" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/test" isTestSource="true" />
+    </content>
+    <orderEntry type="inheritedJdk" />
+    <orderEntry type="sourceFolder" forTests="false" />
+  </component>
+</module>
+
diff --git a/java/client/src/com/thoughtworks/selenium/webdriven/injectableSelenium.js b/java/client/src/com/thoughtworks/selenium/webdriven/injectableSelenium.js
index ce445d5c..6c431d25 100644
--- a/java/client/src/com/thoughtworks/selenium/webdriven/injectableSelenium.js
+++ b/java/client/src/com/thoughtworks/selenium/webdriven/injectableSelenium.js
@@ -102,16 +102,14 @@ var browserbot = {
                 evt = document.createEvent('KeyEvents');
                 evt.initKeyEvent(eventType, true, true, window, controlKeyDown, altKeyDown, shiftKeyDown, metaKeyDown, keycode, keycode);
             } else {
-                evt = document.createEvent('UIEvents');
-
+                evt = document.createEvent('Events');
                 evt.shiftKey = shiftKeyDown;
                 evt.metaKey = metaKeyDown;
                 evt.altKey = altKeyDown;
                 evt.ctrlKey = controlKeyDown;
 
-                evt.initUIEvent(eventType, true, true, window, 1);
-                evt.keyCode = keycode;
-                evt.which = keycode;
+                evt.initEvent(eventType, true, true);
+                evt.keyCode = parseInt(keycode);
             }
 
             element.dispatchEvent(evt);
diff --git a/java/client/src/org/openqa/selenium/build.desc b/java/client/src/org/openqa/selenium/build.desc
index df99fc88..8ec8c1d3 100644
--- a/java/client/src/org/openqa/selenium/build.desc
+++ b/java/client/src/org/openqa/selenium/build.desc
@@ -100,6 +100,7 @@ java_library(name = "client-combined",
     "//java/client/src/com/thoughtworks/selenium:api",
     "//java/client/src/org/openqa/selenium/support",
     "//java/client/src/org/openqa/selenium/remote:augmenter",
+    "//java/client/src/org/openqa/selenium/qtwebkit",
     "//third_party/java/opera-driver",
     "//third_party/java/phantomjs-driver"
   ])
diff --git a/java/client/src/org/openqa/selenium/interactions/HasMultiTouchScreen.java b/java/client/src/org/openqa/selenium/interactions/HasMultiTouchScreen.java
new file mode 100644
index 00000000..0ea881c6
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/HasMultiTouchScreen.java
@@ -0,0 +1,9 @@
+package org.openqa.selenium.interactions;
+
+/**
+ * Interface implemented by each driver that allows access to multitouch screen capabilities.
+ */
+public interface HasMultiTouchScreen extends HasTouchScreen{
+
+    MultiTouchScreen getMultiTouch();
+}
diff --git a/java/client/src/org/openqa/selenium/interactions/MultiTouchScreen.java b/java/client/src/org/openqa/selenium/interactions/MultiTouchScreen.java
new file mode 100644
index 00000000..db083f1b
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/MultiTouchScreen.java
@@ -0,0 +1,45 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.interactions;
+
+import org.openqa.selenium.interactions.internal.Coordinates;
+
+/**
+ * Interface to use for testing multitouch event
+ *
+ */
+public interface MultiTouchScreen extends TouchScreen {
+    /**
+     * Allows the execution of pinch zoom action.
+     *
+     * @param where The coordinate of the element to pinchZoom on
+     * @param scale scale factor
+     */
+    void pinchZoom(Coordinates where, double scale)   ;
+    /**
+     *Allows the execution of pinch rotate action.
+     *
+     * @param where The coordinate of the element to pinchRotate on
+     * @param angle angle to rotate
+     */
+    void pinchRotate(Coordinates where, int angle);
+}
diff --git a/java/client/src/org/openqa/selenium/interactions/build.desc b/java/client/src/org/openqa/selenium/interactions/build.desc
index 794828c9..a9241c53 100644
--- a/java/client/src/org/openqa/selenium/interactions/build.desc
+++ b/java/client/src/org/openqa/selenium/interactions/build.desc
@@ -3,11 +3,13 @@ java_library(name = "api",
   srcs = [
     "Action.java",
     "HasInputDevices.java",
+    "HasMultiTouchScreen.java",
     "HasTouchScreen.java",
     "InvalidCoordinatesException.java",
     "Keyboard.java",
     "Mouse.java",
     "MoveTargetOutOfBoundsException.java",
+    "MultiTouchScreen.java",
     "TouchScreen.java",
     "internal/Coordinates.java",
   ],
@@ -20,6 +22,7 @@ java_library(name = "interactions",
     "*.java",
     "internal/*.java",
     "touch/*.java",
+    "multitouch/*.java"
   ],
   deps = [
     "//java/client/src/org/openqa/selenium:base",
diff --git a/java/client/src/org/openqa/selenium/interactions/internal/MultiTouchAction.java b/java/client/src/org/openqa/selenium/interactions/internal/MultiTouchAction.java
new file mode 100644
index 00000000..bf5a636f
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/internal/MultiTouchAction.java
@@ -0,0 +1,39 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.interactions.internal;
+
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.interactions.internal.DisplayAction;
+import org.openqa.selenium.internal.Locatable;
+
+/**
+ * Base class for all multitouch screen-related actions
+ */
+public class MultiTouchAction extends DisplayAction {
+
+    protected final MultiTouchScreen multiTouchScreen;
+
+    public MultiTouchAction(MultiTouchScreen touchScreen, Locatable locationProvider) {
+        super(locationProvider);
+        this.multiTouchScreen = touchScreen;
+    }
+}
\ No newline at end of file
diff --git a/java/client/src/org/openqa/selenium/interactions/multitouch/MultiTouchActions.java b/java/client/src/org/openqa/selenium/interactions/multitouch/MultiTouchActions.java
new file mode 100644
index 00000000..202493d4
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/multitouch/MultiTouchActions.java
@@ -0,0 +1,61 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.interactions.multitouch;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.HasInputDevices;
+import org.openqa.selenium.interactions.HasMultiTouchScreen;
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.interactions.Keyboard;
+import org.openqa.selenium.interactions.touch.TouchActions;
+import org.openqa.selenium.internal.Locatable;
+
+/**
+ * Implements actions for multitouch enabled devices, reusing the available composite and builder design
+ * patterns from Actions.
+ */
+public class MultiTouchActions extends TouchActions {
+    protected MultiTouchScreen multiTouchScreen;
+
+    public MultiTouchActions(WebDriver driver) {
+        this(((HasInputDevices) driver).getKeyboard(),
+                ((HasMultiTouchScreen) driver).getMultiTouch());
+    }
+
+    public MultiTouchActions(Keyboard keyboard, MultiTouchScreen multiTouchScreen) {
+        super(keyboard, multiTouchScreen);
+        this.multiTouchScreen = multiTouchScreen;
+    }
+
+    public MultiTouchActions pinchZoom(WebElement onElement, double scale) {
+        action.addAction(new PinchZoomAction(multiTouchScreen, (Locatable) onElement, scale));
+        return this;
+    }
+
+    public MultiTouchActions pinchRotate(WebElement onElement, int angle) {
+        action.addAction(new PinchRotateAction(multiTouchScreen, (Locatable) onElement, angle));
+        return this;
+    }
+
+
+}
diff --git a/java/client/src/org/openqa/selenium/interactions/multitouch/PinchRotateAction.java b/java/client/src/org/openqa/selenium/interactions/multitouch/PinchRotateAction.java
new file mode 100644
index 00000000..f7887648
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/multitouch/PinchRotateAction.java
@@ -0,0 +1,44 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.interactions.multitouch;
+
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.interactions.internal.MultiTouchAction;
+import org.openqa.selenium.internal.Locatable;
+
+/**
+ * Creates a pinch rotate gesture.
+ */
+public class PinchRotateAction extends MultiTouchAction implements Action {
+
+    private int angle;
+
+    public PinchRotateAction(MultiTouchScreen multiTouchScreen, Locatable locationProvider, int angle) {
+        super(multiTouchScreen, locationProvider);
+        this.angle = angle;
+    }
+
+    public void perform() {
+        multiTouchScreen.pinchRotate(getActionLocation(), angle);
+    }
+}
\ No newline at end of file
diff --git a/java/client/src/org/openqa/selenium/interactions/multitouch/PinchZoomAction.java b/java/client/src/org/openqa/selenium/interactions/multitouch/PinchZoomAction.java
new file mode 100644
index 00000000..139e7270
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/interactions/multitouch/PinchZoomAction.java
@@ -0,0 +1,44 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.interactions.multitouch;
+
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.interactions.internal.MultiTouchAction;
+import org.openqa.selenium.internal.Locatable;
+
+/**
+ * Creates a pinch zoom gesture.
+ */
+public class PinchZoomAction extends MultiTouchAction implements Action {
+
+    private double scale;
+
+    public PinchZoomAction(MultiTouchScreen multiTouchScreen, Locatable locationProvider, double scale) {
+        super(multiTouchScreen, locationProvider);
+        this.scale = scale;
+    }
+
+    public void perform() {
+        multiTouchScreen.pinchZoom(getActionLocation(), scale);
+    }
+}
\ No newline at end of file
diff --git a/java/client/src/org/openqa/selenium/logging/profiler/HttpProfilerLogEntry.java b/java/client/src/org/openqa/selenium/logging/profiler/HttpProfilerLogEntry.java
index eb9d8cb5..99c0206c 100644
--- a/java/client/src/org/openqa/selenium/logging/profiler/HttpProfilerLogEntry.java
+++ b/java/client/src/org/openqa/selenium/logging/profiler/HttpProfilerLogEntry.java
@@ -27,6 +27,10 @@ public class HttpProfilerLogEntry extends ProfilerLogEntry {
   public HttpProfilerLogEntry(String commandName, boolean isStart) {
     super(EventType.HTTP_COMMAND, constructMessage(EventType.HTTP_COMMAND, commandName, isStart));
   }
+
+  public HttpProfilerLogEntry(String commandName, String url, String method, boolean isStart) {
+    super(EventType.HTTP_COMMAND, constructMessage(EventType.HTTP_COMMAND, commandName, url, method, isStart));
+  }
   
   private static String constructMessage(EventType eventType, String commandName, boolean isStart) {
     Map<String, ?> map = ImmutableMap.of(
@@ -36,4 +40,15 @@ private static String constructMessage(EventType eventType, String commandName,
     return new JSONObject(map).toString();
   }
 
+  private static String constructMessage(EventType eventType, String commandName, String url, String method, boolean isStart) {
+    Map<String, ?> map = ImmutableMap.of(
+        "event", eventType.toString(),
+        "command", commandName,
+        "url", url,
+        "method", method,
+        "startorend", isStart ? "start" : "end");
+    return new JSONObject(map).toString();
+  }
+
+
 }
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/Player.java b/java/client/src/org/openqa/selenium/qtwebkit/Player.java
new file mode 100644
index 00000000..85915f2a
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/Player.java
@@ -0,0 +1,124 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.openqa.selenium.WebElement;
+
+/**
+ * Interface to use for testing different players - HTML5 video/audio players,
+ * Widgets QVideoWidget and QML video tag.
+ *
+ */
+public interface Player {
+
+
+  /**
+   * @enum PlayerState used for representing players state,
+   */
+  public enum PlayerState {
+    stopped,
+    playing,
+    paused;
+  }
+  /**
+   * Start playing player's media content.
+   * If it's already playing nothing will be done.
+   *
+   */
+  void play();
+  /**
+   * Pause player's media content.
+   * If it's already paused/stopped nothing will be done.
+   *
+   */
+  void pause();
+  /**
+   * Stop player's media content(pause + seek to start).
+   * If it's already paused/stopped nothing will be done.
+   *
+   */
+  void stop();
+  /**
+   * Sets player's volume
+   * @param volume player's volume in range from 0 to 1.0.
+   *
+   */
+  void setVolume(double volume);
+  /**
+   * Sets player's volume
+   * @param position player's current playing time, to set. Parameter is
+   *                 in range from 0 to video length, where integral part
+   *                 is seconds.
+   *
+   */
+  void seek(double position);
+  /**
+   * Gets player's state
+   * @return {@link PlayerState}
+   *
+   */
+  PlayerState getState();
+  /**
+   * Sets player's state
+   * @param state {@link PlayerState}
+   *
+   */
+  void setState(PlayerState state);
+  /**
+   * Gets player's volume
+   * @return player's volume in range from 0 to 1.0.
+   *
+   */
+  double getVolume();
+  /**
+   * Gets player's current playing position
+   * @return player's current playing position. Position is
+   *                 in range from 0 to video length, where integral part
+   *                 is seconds.
+   *
+   */
+  double getCurrentPlayingPosition();
+  /**
+   * Gets player's muted status
+   * @return either player is muted or not.
+   *
+   */
+  boolean isMuted();
+  /**
+   * Sets player's muted status
+   * @param mute specify either player is muted or not.
+   *
+   */
+  void setMute(boolean mute);
+  /**
+   * Gets player's playback speed
+   * @return current playing speed
+   *
+   */
+  double getSpeed();
+  /**
+   * Sets player's playback speed
+   * @param speed playing speed to set
+   *
+   */
+  void setSpeed(double speed);
+}
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverExecutor.java b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverExecutor.java
new file mode 100644
index 00000000..abb07124
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverExecutor.java
@@ -0,0 +1,74 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import com.google.common.collect.ImmutableMap;
+
+import org.openqa.selenium.remote.Command;
+import org.openqa.selenium.remote.CommandInfo;
+import org.openqa.selenium.remote.HttpCommandExecutor;
+import org.openqa.selenium.remote.HttpVerb;
+import org.openqa.selenium.remote.Response;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Map;
+
+import static org.openqa.selenium.qtwebkit.QtWebKitDriverCommand.*;
+
+public class QtWebDriverExecutor extends HttpCommandExecutor {
+
+    private static final Map<String, CommandInfo> additionalCommands;
+    static {
+        ImmutableMap.Builder<String, CommandInfo> builder = ImmutableMap.builder();
+        builder.put(GET_PLAYER_STATE,
+                  new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/state", HttpVerb.GET))
+        .put(SET_PLAYER_STATE, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/state", HttpVerb.POST))
+        .put(GET_PLAYER_VOLUME, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/volume", HttpVerb.GET))
+        .put(SET_PLAYER_VOLUME, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/volume", HttpVerb.POST))
+        .put(GET_CURRENT_PLAYING_POSITION,
+             new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/seek", HttpVerb.GET))
+        .put(SET_CURRENT_PLAYING_POSITION,
+             new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/seek", HttpVerb.POST))
+        .put(SET_PLAYER_MUTE, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/mute", HttpVerb.POST))
+        .put(GET_PLAYER_MUTE, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/mute", HttpVerb.GET))
+        .put(SET_PLAYBACK_SPEED, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/speed", HttpVerb.POST))
+        .put(GET_PLAYBACK_SPEED, new CommandInfo("/session/:sessionId/element/:id/-cisco-player-element/speed", HttpVerb.GET))
+        .put(TOUCH_PINCH_ZOOM, new CommandInfo("/session/:sessionId/touch/-cisco-pinch-zoom", HttpVerb.POST))
+        .put(TOUCH_PINCH_ROTATE, new CommandInfo("/session/:sessionId/touch/-cisco-pinch-rotate", HttpVerb.POST))
+        .put(GET_VISUALIZER_SOURCE, new CommandInfo("/session/:sessionId/-cisco-visualizer-source", HttpVerb.GET))
+        .put(GET_VISUALIZER_SHOW_POINT, new CommandInfo("/session/:sessionId/-cisco-visualizer-show-point", HttpVerb.GET));
+
+        additionalCommands = builder.build();
+    }
+
+    public QtWebDriverExecutor(URL addressOfRemoteServer)
+    {
+        super(additionalCommands, addressOfRemoteServer);
+    }
+
+    public Response execute(Command command) throws IOException {
+        Response response = super.execute(command);
+        return response;
+    }
+
+}
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverService.java b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverService.java
new file mode 100644
index 00000000..23f3a3da
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverService.java
@@ -0,0 +1,215 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+/*
+Copyright 2011-2012 Selenium committers
+Copyright 2011-2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit;
+
+import static com.google.common.base.Preconditions.checkArgument;
+import static com.google.common.base.Preconditions.checkNotNull;
+import static com.google.common.base.Preconditions.checkState;
+
+import com.google.common.collect.ImmutableList;
+import com.google.common.collect.ImmutableMap;
+
+
+import org.openqa.selenium.Beta;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.net.PortProber;
+import org.openqa.selenium.remote.service.DriverService;
+
+import java.io.File;
+import java.io.IOException;
+import java.util.Map;
+import java.net.URL;
+import java.net.MalformedURLException;
+
+/**
+* A specialized {@link org.openqa.selenium.remote.HttpCommandExecutor} that will use a {@link org.openqa.selenium.qtwebkit.QtWebDriverService} that lives
+* and dies with a single WebDriver session. The service will be restarted upon each new session
+* request and shutdown after each quit command.
+*/
+
+public class QtWebDriverService extends DriverService {
+
+    /**
+    * System property that defines the location of the QtWebDriver executable that will be used by
+    * the {@link #createDefaultService() default service}.
+            */
+    public static final String QT_DRIVER_EXE_PROPERTY = "webdriver.qtwebdriver.driver";
+
+    public static final String QT_DRIVER_COMMAND_LINE_ARGS = "webdriver.qtwebdriver.args";
+
+    /**
+     *
+     * @param executable The QtWebDriver executable.
+     * @param port Which port to start the QtWebDriver on.
+     * @param args The arguments to the launched server.
+     * @param environment The environment for the launched server.
+     * @throws java.io.IOException If an I/O error occurs.
+     */
+    private QtWebDriverService(File executable, int port, ImmutableList<String> args,
+                                ImmutableMap<String, String> environment) throws IOException {
+        super(executable, port, args, environment);
+    }
+
+    /**
+     * Configures and returns a new {@link QtWebDriverService} using the default configuration. In
+     * this configuration, the service will use the QtWebDrvier executable identified by the
+     * {@link #QT_DRIVER_EXE_PROPERTY} system property. Each service created by this method will
+     * be configured to use a free port on the current system.
+     *
+     * @return A new QtWebDriverService using the default configuration.
+     */
+    public static QtWebDriverService createDefaultService() {
+
+        File exe = findExecutable("QtWebDriver", QT_DRIVER_EXE_PROPERTY,
+                "http://code.google.com/p/selenium/wiki/ChromeDriver",
+                "http://code.google.com/p/chromedriver/downloads/list");
+        return new Builder().usingDriverExecutable(exe).usingAnyFreePort().build();
+    }
+
+    /**
+     * Configures and returns a new {@link QtWebDriverService} using the specified environment. In
+     * this configuration, the service will use the QtWebDrvier executable identified by the
+     * {@link #QT_DRIVER_EXE_PROPERTY} system property. Each service created by this method will
+     * be configured to use a free port on the current system.
+     *
+     * @return A new QtWebDriverService using the default configuration.
+     */
+    public static QtWebDriverService createService(Map<String, String> environment) {
+
+        File exe = findExecutable("QtWebDriver", QT_DRIVER_EXE_PROPERTY,
+                                  "http://code.google.com/p/selenium/wiki/ChromeDriver",
+                                  "http://code.google.com/p/chromedriver/downloads/list");
+      return new Builder().usingDriverExecutable(exe).usingAnyFreePort().withEnvironment(environment).build();
+    }
+
+    /**
+     * Builder used to configure new {@link QtWebDriverService} instances.
+     */
+    public static class Builder {
+
+        private int port = 0;
+        private File exe = null;
+        private ImmutableMap<String, String> environment = ImmutableMap.of();
+
+        /**
+         * Sets which driver executable the builder will use.
+         *
+         * @param file The executable to use.
+         * @return A self reference.
+         */
+        public Builder usingDriverExecutable(File file) {
+            checkNotNull(file);
+            checkExecutable(file);
+            this.exe = file;
+            return this;
+        }
+
+        /**
+         * Sets which port the driver server should be started on. A value of 0 indicates that any
+         * free port may be used.
+         *
+         * @param port The port to use; must be non-negative.
+         * @return A self reference.
+         */
+        public Builder usingPort(int port) {
+            checkArgument(port >= 0, "Invalid port number: %d", port);
+            this.port = port;
+            return this;
+        }
+
+        /**
+         * Configures the driver server to start on any available port.
+         *
+         * @return A self reference.
+         */
+        public Builder usingAnyFreePort() {
+            this.port = 0;
+            return this;
+        }
+
+        /**
+         * Defines the environment for the launched driver server. These
+         * settings will be inherited by every browser session launched by the
+         * server.
+         *
+         * @param environment A map of the environment variables to launch the
+         *     server with.
+         * @return A self reference.
+         */
+        @Beta
+        public Builder withEnvironment(Map<String, String> environment) {
+            this.environment = ImmutableMap.copyOf(environment);
+            return this;
+        }
+
+        /**
+         * Creates a new service to manage the driver server. Before creating a new service, the
+         * builder will find a port for the server to listen to.
+         *
+         * @return The new service object.
+         */
+        public QtWebDriverService build() {
+            if (port == 0) {
+                port = PortProber.findFreePort();
+            }
+
+
+
+            checkState(exe != null, "Path to the driver executable not specified");
+
+            try {
+                ImmutableList.Builder<String> argsBuilder = ImmutableList.builder();
+                argsBuilder.add(String.format("--port=%d", port));
+
+                String args = System.getProperty(QtWebDriverService.QT_DRIVER_COMMAND_LINE_ARGS);
+                if (args != null) {
+                    for(String substring: args.split(" ")){
+                        argsBuilder.add(substring);
+                    }
+                }
+
+                return new QtWebDriverService(exe, port, argsBuilder.build(), environment);
+
+            } catch (IOException e) {
+                throw new WebDriverException(e);
+            }
+        }
+    }
+
+}
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverServiceExecutor.java b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverServiceExecutor.java
new file mode 100644
index 00000000..ff3049d3
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/QtWebDriverServiceExecutor.java
@@ -0,0 +1,78 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import com.google.common.base.Throwables;
+
+import org.openqa.selenium.remote.service.DriverService;
+import org.openqa.selenium.remote.Command;
+import org.openqa.selenium.remote.Response;
+import org.openqa.selenium.remote.DriverCommand;
+import org.openqa.selenium.WebDriverException;
+
+
+import java.io.IOException;
+import java.net.ConnectException;
+import java.net.URL;
+
+
+public class QtWebDriverServiceExecutor extends QtWebDriverExecutor {
+    private DriverService service;
+
+    public QtWebDriverServiceExecutor(DriverService service){
+        super(service.getUrl());
+        this.service = service;
+    }
+    /**
+   * Sends the {@code command} to the driver server for execution. The server will be started
+   * if requesting a new session. Likewise, if terminating a session, the server will be shutdown
+   * once a response is received.
+   *
+   * @param command The command to execute.
+   * @return The command response.
+   * @throws IOException If an I/O error occurs while sending the command.
+   */
+  @Override
+  public Response execute(Command command) throws IOException {
+    if (DriverCommand.NEW_SESSION.equals(command.getName())) {
+      service.start();
+    }
+
+    try {
+      return super.execute(command);
+    } catch (Throwable t) {
+      Throwable rootCause = Throwables.getRootCause(t);
+      if (rootCause instanceof ConnectException &&
+          "Connection refused".equals(rootCause.getMessage()) &&
+          !service.isRunning()) {
+        throw new WebDriverException("The driver server has unexpectedly died!", t);
+      }
+      Throwables.propagateIfPossible(t);
+      throw new WebDriverException(t);
+    } finally {
+      if (DriverCommand.QUIT.equals(command.getName())) {
+        service.stop();
+      }
+    }
+  }
+
+}
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriver.java b/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriver.java
new file mode 100644
index 00000000..e43a6b86
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriver.java
@@ -0,0 +1,186 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import java.util.Map;
+
+import com.google.common.collect.ImmutableMap;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.html5.AppCacheStatus;
+import org.openqa.selenium.html5.ApplicationCache;
+import org.openqa.selenium.html5.LocalStorage;
+import org.openqa.selenium.html5.SessionStorage;
+import org.openqa.selenium.html5.WebStorage;
+import org.openqa.selenium.interactions.HasTouchScreen;
+import org.openqa.selenium.interactions.HasMultiTouchScreen;
+import org.openqa.selenium.interactions.TouchScreen;
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.remote.*;
+import org.openqa.selenium.remote.RemoteMultiTouchScreen;
+import org.openqa.selenium.remote.html5.RemoteLocalStorage;
+import org.openqa.selenium.remote.html5.RemoteSessionStorage;
+
+/**
+ * QtWebKitDriver implements BrowserConnection with some limitation - setOnline() can change
+ * connection state only for currently opened windows. If new view will be open now, it sets online
+ * by default (while doesn't receive a command explicitly).
+ */
+
+public class QtWebKitDriver extends RemoteWebDriver
+
+    implements TakesScreenshot, WebStorage, Rotatable, ApplicationCache,
+               HasMultiTouchScreen, Visualizer {
+
+    private RemoteLocalStorage localStorage;
+    private RemoteSessionStorage sessionStorage;
+    private MultiTouchScreen multiTouchScreen;
+
+    /**
+     * Custom capability that defines support different view and qtVersion.
+     * <p>In qtVersion important only first digit .
+     */
+    public final static String HYBRID = "hybrid";
+
+    /**
+     * Custom capability.
+     * WD checks this caps, if it is not specified,
+     * in case of attempt to create second session we get exception of "one session only",
+     * otherwise prev session will be terminated without closing windows
+     * and new session can reuse those windows
+     */
+    public final static String REUSE_UI = "reuseUI";
+
+    public QtWebKitDriver(CommandExecutor executor, Capabilities desiredCapabilities,
+                          Capabilities requiredCapabilities) {
+        super(executor, desiredCapabilities, requiredCapabilities);
+        localStorage = new RemoteLocalStorage(getExecuteMethod());
+        sessionStorage = new RemoteSessionStorage(getExecuteMethod());
+        multiTouchScreen = new RemoteMultiTouchScreen(getExecuteMethod());
+    }
+
+    public QtWebKitDriver(CommandExecutor executor, Capabilities desiredCapabilities) {
+        this(executor, desiredCapabilities, null);
+    }
+
+    public QtWebKitDriver(Capabilities desiredCapabilities) {
+        this(createDefaultExecutor(), desiredCapabilities);
+    }
+
+    public QtWebKitDriver(URL remoteAddress, Capabilities desiredCapabilities,
+                          Capabilities requiredCapabilities) {
+        this(new QtWebDriverExecutor(remoteAddress), desiredCapabilities, requiredCapabilities);
+    }
+
+    public QtWebKitDriver(URL remoteAddress, Capabilities desiredCapabilities) {
+        this(new QtWebDriverExecutor(remoteAddress), desiredCapabilities, null);
+    }
+
+    public <X> X getScreenshotAs(OutputType<X> target) {
+        // Get the screenshot as base64.
+        String base64 = (String) execute(DriverCommand.SCREENSHOT).getValue();
+        // ... and convert it.
+        return target.convertFromBase64Png(base64);
+    }
+
+    @Override
+    public LocalStorage getLocalStorage() {
+        return localStorage;
+    }
+
+    @Override
+    public SessionStorage getSessionStorage() {
+        return sessionStorage;
+    }
+
+    @Override
+    public void rotate(ScreenOrientation orientation) {
+        execute(DriverCommand.SET_SCREEN_ORIENTATION, ImmutableMap.of("orientation", orientation));
+    }
+
+    @Override
+    public ScreenOrientation getOrientation() {
+        return ScreenOrientation.valueOf(
+            (String) execute(DriverCommand.GET_SCREEN_ORIENTATION).getValue());
+    }
+
+    @Override
+    public AppCacheStatus getStatus() {
+        Long status = (Long) execute(DriverCommand.GET_APP_CACHE_STATUS).getValue();
+        long st = status;
+        return AppCacheStatus.getEnum((int)st);
+    }
+
+    @Override
+    public MultiTouchScreen getMultiTouch() {
+        return multiTouchScreen;
+    }
+
+    @Override
+    public TouchScreen getTouch() {
+        return multiTouchScreen;
+    }
+
+    @Override
+    public String getVisualizerSource() {
+        return (String) execute(QtWebKitDriverCommand.GET_VISUALIZER_SOURCE).getValue();
+    }
+
+    public static QtWebDriverExecutor createDefaultExecutor() {
+        try{
+            String ip = System.getProperty(QtWebDriverService.QT_DRIVER_EXE_PROPERTY);
+            if (ip == null) {
+              ip = "http://localhost:9517";
+              System.setProperty(QtWebDriverService.QT_DRIVER_EXE_PROPERTY, ip);
+            }
+            URL url = new URL(ip);
+            return new QtWebDriverExecutor(url);
+        }
+        catch (MalformedURLException e) {
+            return new QtWebDriverServiceExecutor(QtWebDriverService.createDefaultService());
+        }
+    }
+
+    public static QtWebDriverExecutor createExecutor(Map<String, String> environment) {
+        return new QtWebDriverServiceExecutor(QtWebDriverService.createService(environment));
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriverCommand.java b/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriverCommand.java
new file mode 100644
index 00000000..ea81dd8d
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/QtWebKitDriverCommand.java
@@ -0,0 +1,40 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.openqa.selenium.remote.DriverCommand;
+
+public interface QtWebKitDriverCommand extends DriverCommand {
+  //CISCO Player API
+  String GET_PLAYER_STATE = "getPlayerState";
+  String SET_PLAYER_STATE = "setPlayerState";
+  String GET_PLAYER_VOLUME = "getPlayerVolume";
+  String SET_PLAYER_VOLUME = "setPlayerVolume";
+  String SET_PLAYER_MUTE = "setPlayerMute";
+  String GET_PLAYER_MUTE = "getPlayerMute";
+  String GET_CURRENT_PLAYING_POSITION = "getCurrentPlayingPosition";
+  String SET_CURRENT_PLAYING_POSITION = "setCurrentPlayingPosition";
+  String GET_PLAYBACK_SPEED = "getPlaybackSpeed";
+  String SET_PLAYBACK_SPEED = "setPlaybackSpeed";
+  String GET_VISUALIZER_SOURCE = "getVisualizerSource";
+  String  GET_VISUALIZER_SHOW_POINT = "getVisualizerShowPoint";
+}
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/Visualizer.java b/java/client/src/org/openqa/selenium/qtwebkit/Visualizer.java
new file mode 100644
index 00000000..496df319
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/Visualizer.java
@@ -0,0 +1,35 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+public interface Visualizer {
+    /**
+     * Similar to {@link org.openqa.selenium.WebDriver#getPageSource()} but
+     * result of this one is usable for independant visualization in borwser.
+     * It means that:
+     * <ul>
+     * <li>Images are downloaded and placed using data URL scheme
+     * <li>Stylesheets are assembled with HTML
+     * </ul>
+     */
+    public String getVisualizerSource();
+}
\ No newline at end of file
diff --git a/java/client/src/org/openqa/selenium/qtwebkit/build.desc b/java/client/src/org/openqa/selenium/qtwebkit/build.desc
new file mode 100644
index 00000000..d6e22685
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/qtwebkit/build.desc
@@ -0,0 +1,9 @@
+java_library(name = "qtwebkit",
+  srcs = [ "*.java" ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/net",
+    "//java/client/src/org/openqa/selenium/remote",
+    "//java/client/src/org/openqa/selenium/chrome",
+    "//third_party/java/guava-libraries",
+    "//third_party/java/json",
+  ])
diff --git a/java/client/src/org/openqa/selenium/remote/AddRemotePlayerApi.java b/java/client/src/org/openqa/selenium/remote/AddRemotePlayerApi.java
new file mode 100644
index 00000000..3aba9024
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/remote/AddRemotePlayerApi.java
@@ -0,0 +1,145 @@
+/*
+Copyright 2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+
+package org.openqa.selenium.remote;
+
+import com.google.common.collect.ImmutableMap;
+
+import org.openqa.selenium.qtwebkit.Player;
+import org.openqa.selenium.qtwebkit.QtWebKitDriverCommand;
+
+import java.lang.reflect.Method;
+
+public class AddRemotePlayerApi implements AugmenterProvider {
+    public Class<?> getDescribedInterface() {
+        return Player.class;
+    }
+
+    private class PlayerInterfaceImplementation implements InterfaceImplementation, Player{
+
+        private ExecuteMethod driverExecuteMethod;
+        private Object id;
+
+        @Override
+        public Object invoke(ExecuteMethod executeMethod, Object self, Method method, Object... args) {
+            id = ((RemoteWebElement) self).getId();
+            driverExecuteMethod = executeMethod;
+            Method[] methods = this.getClass().getMethods();
+            for(Method tmpMethod: methods){
+                if(tmpMethod.getName() == method.getName()){
+                    try{
+                        return tmpMethod.invoke(this, args);
+                    } catch (Exception e){
+                        e.printStackTrace();
+                    }
+                }
+            }
+            return null;
+        }
+
+        @Override
+        public void play() {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_STATE,
+                    ImmutableMap.of("id", id, "state", PlayerState.playing.ordinal()));
+        }
+
+        @Override
+        public void pause() {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_STATE,
+                    ImmutableMap.of("id", id, "state", PlayerState.paused.ordinal()));
+        }
+
+        @Override
+        public void stop() {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_STATE,
+                    ImmutableMap.of("id", id, "state", PlayerState.stopped.ordinal()));
+        }
+
+        @Override
+        public PlayerState getState() {
+            Number response = (Number)driverExecuteMethod
+                    .execute(QtWebKitDriverCommand.GET_PLAYER_STATE, ImmutableMap.of("id", id));
+            PlayerState state = PlayerState.values()[response.intValue()];
+            return state;
+        }
+
+        @Override
+        public void setVolume(double volume) throws IllegalArgumentException{
+            if(volume > 1 || volume < 0){
+                throw new IllegalArgumentException("Volume should be between 1 and 0");
+            }
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_VOLUME,
+                    ImmutableMap.of("id", id, "volume", volume));
+        }
+
+        @Override
+        public void seek(double position) {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_CURRENT_PLAYING_POSITION,
+                    ImmutableMap.of("id", id, "position", position));
+        }
+
+        @Override
+        public void setState(PlayerState state) {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_STATE,
+                    ImmutableMap.of("id", id, "state", state.ordinal()));
+        }
+
+        @Override
+        public double getVolume() {
+            return  ((Number)driverExecuteMethod.
+                    execute(QtWebKitDriverCommand.GET_PLAYER_VOLUME, ImmutableMap.of("id", id)))
+            .doubleValue();
+        }
+
+        @Override
+        public double getCurrentPlayingPosition() {
+            return  ((Number)driverExecuteMethod
+                    .execute(QtWebKitDriverCommand.GET_CURRENT_PLAYING_POSITION, ImmutableMap.of("id", id)))
+                    .doubleValue();
+        }
+
+        @Override
+        public boolean isMuted(){
+            return  (Boolean)driverExecuteMethod
+                    .execute(QtWebKitDriverCommand.GET_PLAYER_MUTE, ImmutableMap.of("id", id));
+        }
+
+        @Override
+        public void setMute(boolean mute){
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYER_MUTE,
+                    ImmutableMap.of("id", id, "mute", mute));
+        }
+
+        @Override
+        public double getSpeed() {
+            return ((Number)driverExecuteMethod
+                    .execute(QtWebKitDriverCommand.GET_PLAYBACK_SPEED, ImmutableMap.of("id", id)))
+                    .doubleValue();
+        }
+
+        @Override
+        public void setSpeed(double speed) {
+            driverExecuteMethod.execute(QtWebKitDriverCommand.SET_PLAYBACK_SPEED,
+                    ImmutableMap.of("id", id, "speed", speed));
+        }
+
+    }
+
+    public InterfaceImplementation getImplementation(Object value) {
+        return new PlayerInterfaceImplementation();
+    }
+}
diff --git a/java/client/src/org/openqa/selenium/remote/AddRemoteTouchScreen.java b/java/client/src/org/openqa/selenium/remote/AddRemoteTouchScreen.java
index 04d90f8f..2cb13962 100644
--- a/java/client/src/org/openqa/selenium/remote/AddRemoteTouchScreen.java
+++ b/java/client/src/org/openqa/selenium/remote/AddRemoteTouchScreen.java
@@ -1,3 +1,24 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
 package org.openqa.selenium.remote;
 
 import org.openqa.selenium.interactions.HasTouchScreen;
diff --git a/java/client/src/org/openqa/selenium/remote/AddTakesElementScreenshot.java b/java/client/src/org/openqa/selenium/remote/AddTakesElementScreenshot.java
new file mode 100644
index 00000000..d88e37bb
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/remote/AddTakesElementScreenshot.java
@@ -0,0 +1,55 @@
+/*
+Copyright 2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+
+package org.openqa.selenium.remote;
+
+import com.google.common.collect.ImmutableMap;
+
+import org.openqa.selenium.OutputType;
+import org.openqa.selenium.TakesScreenshot;
+
+import java.lang.reflect.Method;
+import java.util.Map;
+
+public class AddTakesElementScreenshot implements AugmenterProvider {
+    public Class<?> getDescribedInterface() {
+        return TakesScreenshot.class;
+    }
+
+    public InterfaceImplementation getImplementation(Object value) {
+        return new InterfaceImplementation() {
+            public Object invoke(ExecuteMethod executeMethod, Object self, Method method, Object... args) {
+                Object id = ((RemoteWebElement) self).getId();
+                OutputType<?> outputType = ((OutputType<?>) args[0]);
+
+                Map<String, ?> commandArgs = ImmutableMap.of("id", id);
+
+                Object result = executeMethod.execute(DriverCommand.ELEMENT_SCREENSHOT, commandArgs);
+                if (result instanceof String) {
+                    String base64EncodedPng = (String) result;
+                    return outputType.convertFromBase64Png(base64EncodedPng);
+                } else if (result instanceof byte[]) {
+                    String base64EncodedPng = new String((byte[]) result);
+                    return outputType.convertFromBase64Png(base64EncodedPng);
+                } else {
+                    throw new RuntimeException("Unexpected result for " + DriverCommand.ELEMENT_SCREENSHOT +
+                                               " command: " + (result == null ? "null" : result.getClass().getName() + " instance"));
+                }
+            }
+        };
+    }
+}
diff --git a/java/client/src/org/openqa/selenium/remote/CapabilityType.java b/java/client/src/org/openqa/selenium/remote/CapabilityType.java
index 72931709..93635e88 100644
--- a/java/client/src/org/openqa/selenium/remote/CapabilityType.java
+++ b/java/client/src/org/openqa/selenium/remote/CapabilityType.java
@@ -24,6 +24,8 @@ public interface CapabilityType {
   String PLATFORM = "platform";
   String SUPPORTS_JAVASCRIPT = "javascriptEnabled";
   String TAKES_SCREENSHOT = "takesScreenshot";
+  String TAKES_ELEMENT_SCREENSHOT = "takesElementScreenshot";
+  String SUPPORTS_PLAYER_API = "remotePlayerEnabled";
   String VERSION = "version";
   String SUPPORTS_ALERTS = "handlesAlerts";
   String SUPPORTS_SQL_DATABASE = "databaseEnabled";
diff --git a/java/client/src/org/openqa/selenium/remote/DesiredCapabilities.java b/java/client/src/org/openqa/selenium/remote/DesiredCapabilities.java
index bf1500e0..20395543 100644
--- a/java/client/src/org/openqa/selenium/remote/DesiredCapabilities.java
+++ b/java/client/src/org/openqa/selenium/remote/DesiredCapabilities.java
@@ -229,6 +229,10 @@ public static DesiredCapabilities phantomjs() {
     return new DesiredCapabilities(BrowserType.PHANTOMJS, "", Platform.ANY);
   }
 
+    public static DesiredCapabilities qtwebkit() {
+        return new DesiredCapabilities("qtwebkit", "", Platform.ANY);
+    }
+
   @Override
   public String toString() {
     Map<String, String> map = Maps.newHashMap();
diff --git a/java/client/src/org/openqa/selenium/remote/DriverCommand.java b/java/client/src/org/openqa/selenium/remote/DriverCommand.java
index d8ac4af1..795be8f0 100644
--- a/java/client/src/org/openqa/selenium/remote/DriverCommand.java
+++ b/java/client/src/org/openqa/selenium/remote/DriverCommand.java
@@ -86,6 +86,7 @@ public interface DriverCommand {
   String ELEMENT_EQUALS = "elementEquals";
 
   String SCREENSHOT = "screenshot";
+  String ELEMENT_SCREENSHOT = "elementScreenshot";
 
   String ACCEPT_ALERT = "acceptAlert";
   String DISMISS_ALERT = "dismissAlert";
@@ -127,6 +128,7 @@ public interface DriverCommand {
   String CLICK = "mouseClick";
   String DOUBLE_CLICK = "mouseDoubleClick";
   String MOUSE_DOWN = "mouseButtonDown";
+  String WHEEL = "mouseWheel";
   String MOUSE_UP = "mouseButtonUp";
   String MOVE_TO = "mouseMoveTo";
 
@@ -147,6 +149,8 @@ public interface DriverCommand {
   String TOUCH_DOUBLE_TAP = "touchDoubleTap";
   String TOUCH_LONG_PRESS = "touchLongPress";
   String TOUCH_FLICK = "touchFlick";
+  String TOUCH_PINCH_ZOOM = "pinchZoom";
+  String TOUCH_PINCH_ROTATE = "pinchRotate";
 
   // Window API (beta)
   String SET_WINDOW_SIZE = "setWindowSize";
diff --git a/java/client/src/org/openqa/selenium/remote/HttpCommandExecutor.java b/java/client/src/org/openqa/selenium/remote/HttpCommandExecutor.java
index 26473762..129ffeee 100644
--- a/java/client/src/org/openqa/selenium/remote/HttpCommandExecutor.java
+++ b/java/client/src/org/openqa/selenium/remote/HttpCommandExecutor.java
@@ -180,9 +180,9 @@ public Response execute(Command command) throws IOException {
     }
 
     try {
-      log(LogType.PROFILER, new HttpProfilerLogEntry(command.getName(), true));
+      log(LogType.PROFILER, new HttpProfilerLogEntry(command.getName(), request.getUri(), request.getMethod().toString(), true));
       HttpResponse response = fallBackExecute(context, httpMethod);
-      log(LogType.PROFILER, new HttpProfilerLogEntry(command.getName(), false));
+      log(LogType.PROFILER, new HttpProfilerLogEntry(command.getName(), request.getUri(), request.getMethod().toString(), false));
 
       response = followRedirects(client, context, response, /* redirect count */0);
 
diff --git a/java/client/src/org/openqa/selenium/remote/QtWebkitAugmenter.java b/java/client/src/org/openqa/selenium/remote/QtWebkitAugmenter.java
new file mode 100644
index 00000000..4ed33a5d
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/remote/QtWebkitAugmenter.java
@@ -0,0 +1,38 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.remote;
+
+import org.openqa.selenium.WebElement;
+
+import java.util.Map;
+
+import static org.openqa.selenium.remote.CapabilityType.TAKES_ELEMENT_SCREENSHOT;
+import static org.openqa.selenium.remote.CapabilityType.SUPPORTS_PLAYER_API;
+
+public class QtWebkitAugmenter extends Augmenter {
+
+  public QtWebkitAugmenter() {
+    super();
+    addElementAugmentation(TAKES_ELEMENT_SCREENSHOT, new AddTakesElementScreenshot());
+    addElementAugmentation(SUPPORTS_PLAYER_API, new AddRemotePlayerApi());
+  }
+}
diff --git a/java/client/src/org/openqa/selenium/remote/RemoteLogs.java b/java/client/src/org/openqa/selenium/remote/RemoteLogs.java
index 6dc90be3..09661871 100644
--- a/java/client/src/org/openqa/selenium/remote/RemoteLogs.java
+++ b/java/client/src/org/openqa/selenium/remote/RemoteLogs.java
@@ -53,7 +53,9 @@ public RemoteLogs(ExecuteMethod executeMethod, LocalLogs localLogs) {
 
   public LogEntries get(String logType) {
     if (LogType.PROFILER.equals(logType)) {
-      return LogCombiner.combine(getRemoteEntries(logType), getLocalEntries(logType));
+      if (getAvailableDriverLogs().contains("profiler"))
+        return LogCombiner.combine(getRemoteEntries(logType), getLocalEntries(logType));
+      return getLocalEntries(logType);
     }
     if (LogType.CLIENT.equals(logType)) {
       return getLocalEntries(logType);
@@ -83,7 +85,7 @@ private Set<String> getAvailableLocalLogs() {
     return localLogs.getAvailableLogTypes();
   }
 
-  public Set<String> getAvailableLogTypes() {
+  private Set<String> getAvailableDriverLogs() {
     Object raw = executeMethod.execute(DriverCommand.GET_AVAILABLE_LOG_TYPES, null);
     @SuppressWarnings("unchecked")
     List<String> rawList = (List<String>) raw;
@@ -91,6 +93,12 @@ public Set<String> getAvailableLogTypes() {
     for (String logType : rawList) {
       builder.add(logType);
     }
+    return builder.build();
+  }
+
+  public Set<String> getAvailableLogTypes() {
+    ImmutableSet.Builder<String> builder = new ImmutableSet.Builder<String>();
+    builder.addAll(getAvailableDriverLogs());
     builder.addAll(getAvailableLocalLogs());
     return builder.build();
   }
diff --git a/java/client/src/org/openqa/selenium/remote/RemoteMouse.java b/java/client/src/org/openqa/selenium/remote/RemoteMouse.java
index 1bcf53c5..60e982c3 100644
--- a/java/client/src/org/openqa/selenium/remote/RemoteMouse.java
+++ b/java/client/src/org/openqa/selenium/remote/RemoteMouse.java
@@ -82,6 +82,10 @@ public void mouseUp(Coordinates where) {
     executor.execute(DriverCommand.MOUSE_UP, ImmutableMap.<String, Object>of());
   }
 
+  public void mouseWheel(int ticks) {
+    executor.execute(DriverCommand.WHEEL, ImmutableMap.of("ticks", ticks));
+  }
+
   public void mouseMove(Coordinates where) {
     Map<String, Object> moveParams = paramsFromCoordinates(where);
 
diff --git a/java/client/src/org/openqa/selenium/remote/RemoteMultiTouchScreen.java b/java/client/src/org/openqa/selenium/remote/RemoteMultiTouchScreen.java
new file mode 100644
index 00000000..489b99a0
--- /dev/null
+++ b/java/client/src/org/openqa/selenium/remote/RemoteMultiTouchScreen.java
@@ -0,0 +1,53 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.remote;
+
+import org.openqa.selenium.interactions.MultiTouchScreen;
+import org.openqa.selenium.interactions.internal.Coordinates;
+import org.openqa.selenium.remote.ExecuteMethod;
+import org.openqa.selenium.remote.CoordinatesUtils;
+
+import java.util.Map;
+
+public class RemoteMultiTouchScreen extends RemoteTouchScreen implements MultiTouchScreen {
+
+    private final ExecuteMethod executeMethod;
+
+    public RemoteMultiTouchScreen(ExecuteMethod executeMethod) {
+        super(executeMethod);
+        this.executeMethod = executeMethod;
+    }
+
+    @Override
+    public void pinchZoom(Coordinates where, double scale) {
+        Map<String, Object> zoomParams = CoordinatesUtils.paramsFromCoordinates(where);
+        zoomParams.put("scale", scale);
+        executeMethod.execute(DriverCommand.TOUCH_PINCH_ZOOM, zoomParams);
+    }
+
+    @Override
+    public void pinchRotate(Coordinates where, int angle) {
+        Map<String, Object> rotateParams = CoordinatesUtils.paramsFromCoordinates(where);
+        rotateParams.put("angle", angle);
+        executeMethod.execute(DriverCommand.TOUCH_PINCH_ROTATE, rotateParams);
+    }
+}
diff --git a/java/client/src/org/openqa/selenium/remote/RemoteWebElement.java b/java/client/src/org/openqa/selenium/remote/RemoteWebElement.java
index d887c324..5483b91f 100644
--- a/java/client/src/org/openqa/selenium/remote/RemoteWebElement.java
+++ b/java/client/src/org/openqa/selenium/remote/RemoteWebElement.java
@@ -349,7 +349,7 @@ public Coordinates getCoordinates() {
     return new Coordinates() {
 
       public Point onScreen() {
-        throw new UnsupportedOperationException("Not supported yet.");
+        return getCoordinates().inViewPort();
       }
 
       public Point inViewPort() {
diff --git a/java/client/src/org/openqa/selenium/remote/build.desc b/java/client/src/org/openqa/selenium/remote/build.desc
index 8d9b77f7..584f07c5 100644
--- a/java/client/src/org/openqa/selenium/remote/build.desc
+++ b/java/client/src/org/openqa/selenium/remote/build.desc
@@ -54,11 +54,14 @@ java_library(name = "augmenter",
     "AddRemoteTouchScreen.java",
     "AddRotatable.java",
     "AddTakesScreenshot.java",
+    "AddTakesElementScreenshot.java",
+    "AddRemotePlayerApi.java",
     "Augmenter.java",
     "AugmenterProvider.java",
     "BaseAugmenter.java",
     "InterfaceImplementation.java",
     "JdkAugmenter.java",
+    "QtWebkitAugmenter.java",
     "html5/AddApplicationCache.java",
     "html5/AddDatabaseStorage.java",
     "html5/AddLocationContext.java",
@@ -70,6 +73,7 @@ java_library(name = "augmenter",
     ":remote",
     "//third_party/java/cglib",
     "//third_party/java/guava-libraries",
+    "//java/client/src/org/openqa/selenium/qtwebkit",
   ])
 
 java_library(name = "remote",
@@ -86,6 +90,7 @@ java_library(name = "remote",
     "RemoteKeyboard.java",
     "RemoteLogs.java",
     "RemoteMouse.java",
+    "RemoteMultiTouchScreen.java",
     "RemoteStatus.java",
     "RemoteWebDriver.java",
     "RemoteWebElement.java",
diff --git a/java/client/src/org/openqa/selenium/remote/http/JsonHttpCommandCodec.java b/java/client/src/org/openqa/selenium/remote/http/JsonHttpCommandCodec.java
index 2c36c480..f405d5ff 100644
--- a/java/client/src/org/openqa/selenium/remote/http/JsonHttpCommandCodec.java
+++ b/java/client/src/org/openqa/selenium/remote/http/JsonHttpCommandCodec.java
@@ -95,6 +95,7 @@ public JsonHttpCommandCodec() {
     defineCommand(FIND_ELEMENTS, post("/session/:sessionId/elements"));
     defineCommand(GET_ACTIVE_ELEMENT, post("/session/:sessionId/element/active"));
     defineCommand(GET_ELEMENT_ATTRIBUTE, get("/session/:sessionId/element/:id/attribute/:name"));
+    defineCommand(ELEMENT_SCREENSHOT, get("/session/:sessionId/element/:id/screenshot"));
     defineCommand(CLICK_ELEMENT, post("/session/:sessionId/element/:id/click"));
     defineCommand(CLEAR_ELEMENT, post("/session/:sessionId/element/:id/clear"));
     defineCommand(
@@ -151,6 +152,7 @@ public JsonHttpCommandCodec() {
 
     // Interactions-related commands.
     defineCommand(MOUSE_DOWN, post("/session/:sessionId/buttondown"));
+    defineCommand(WHEEL, post("/session/:sessionId/wheel"));
     defineCommand(MOUSE_UP, post("/session/:sessionId/buttonup"));
     defineCommand(CLICK, post("/session/:sessionId/click"));
     defineCommand(DOUBLE_CLICK, post("/session/:sessionId/doubleclick"));
diff --git a/java/client/src/org/openqa/selenium/remote/internal/JsonToWebElementConverter.java b/java/client/src/org/openqa/selenium/remote/internal/JsonToWebElementConverter.java
index f1edbee5..3d202849 100644
--- a/java/client/src/org/openqa/selenium/remote/internal/JsonToWebElementConverter.java
+++ b/java/client/src/org/openqa/selenium/remote/internal/JsonToWebElementConverter.java
@@ -33,7 +33,7 @@
  * and Maps to catch nested references. All other values pass through the converter unchanged.
  */
 public class JsonToWebElementConverter implements Function<Object, Object> {
-  private final RemoteWebDriver driver;
+  protected final RemoteWebDriver driver;
 
   public JsonToWebElementConverter(RemoteWebDriver driver) {
     this.driver = driver;
diff --git a/java/client/test/org/openqa/selenium/AlertsTest.java b/java/client/test/org/openqa/selenium/AlertsTest.java
index 8d572a3c..7ea4c7d3 100644
--- a/java/client/test/org/openqa/selenium/AlertsTest.java
+++ b/java/client/test/org/openqa/selenium/AlertsTest.java
@@ -38,6 +38,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
 import static org.openqa.selenium.testing.TestUtilities.isNativeEventsEnabled;
 import static org.openqa.selenium.testing.TestUtilities.getEffectivePlatform;
@@ -98,7 +99,8 @@ public void testShouldAllowUsersToAcceptAnAlertWithNoTextManually() {
     assertEquals("Testing Alerts", driver.getTitle());
   }
 
-  @Ignore(CHROME)
+    //QtWebkit doesn't perform wait for loading
+  @Ignore({CHROME, QTWEBKIT})
   @JavascriptEnabled
   @NeedsLocalEnvironment(reason = "Carefully timing based")
   @Test
@@ -262,6 +264,7 @@ public void testSwitchingToMissingAlertThrows() throws Exception {
   }
 
   @JavascriptEnabled
+  @Ignore(value = {CHROME, QTWEBKIT}, issues = {2764})
   @Test
   public void testSwitchingToMissingAlertInAClosedWindowThrows() throws Exception {
     assumeFalse("This test does not fail on itself, but it causes the subsequent tests to fail",
@@ -342,9 +345,10 @@ public void testShouldHandleAlertOnPageLoad() {
     wait.until(textInElementLocated(By.tagName("p"), "Page with onload event handler"));
   }
 
+  // Andrii Moroz : test stuck due to synchronous downloading
   @JavascriptEnabled
   @Test
-  @Ignore(CHROME)
+  @Ignore({CHROME, QTWEBKIT})
   public void testShouldHandleAlertOnPageLoadUsingGet() {
     driver.get(appServer.whereIs("pageWithOnLoad.html"));
 
@@ -356,8 +360,9 @@ public void testShouldHandleAlertOnPageLoadUsingGet() {
     wait.until(textInElementLocated(By.tagName("p"), "Page with onload event handler"));
   }
 
+  // Andrii Moroz : new windows doesn't supported
   @JavascriptEnabled
-  @Ignore(value = {CHROME, FIREFOX, IE}, reason = "IE: fails in versions 6 and 7")
+  @Ignore(value = {CHROME, FIREFOX, IE, QTWEBKIT}, reason = "IE: fails in versions 6 and 7")
   @Test
   public void testShouldNotHandleAlertInAnotherWindow() {
     String mainWindow = driver.getWindowHandle();
@@ -385,8 +390,9 @@ public void testShouldNotHandleAlertInAnotherWindow() {
     }
   }
 
+  // Andrii Moroz : stuck on synchronous loading
   @JavascriptEnabled
-  @Ignore(value = {CHROME})
+  @Ignore(value = {CHROME, QTWEBKIT})
   @Test
   public void testShouldHandleAlertOnPageUnload() {
     assumeFalse("Firefox 27 does not trigger alerts on unload",
@@ -404,6 +410,8 @@ public void testShouldHandleAlertOnPageUnload() {
 
   @JavascriptEnabled
   @Test
+  @Ignore( value = {QTWEBKIT},
+           reason = "WebKit bug https://bugs.webkit.org/show_bug.cgi?id=19324")
   public void testShouldHandleAlertOnPageBeforeUnload() {
     driver.get(appServer.whereIs("pageWithOnBeforeUnloadMessage.html"));
 
@@ -422,6 +430,9 @@ public void testShouldHandleAlertOnPageBeforeUnload() {
 
   @NoDriverAfterTest
   @Test
+  @Ignore( value = {QTWEBKIT},
+           reason = "QtWebKit bug https://bugreports.qt-project.org/browse/QTBUG-33250",
+           issues = 746)
   public void testShouldHandleAlertOnPageBeforeUnloadAtQuit() {
     driver.get(appServer.whereIs("pageWithOnBeforeUnloadMessage.html"));
 
@@ -434,7 +445,7 @@ public void testShouldHandleAlertOnPageBeforeUnloadAtQuit() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {ANDROID, CHROME}, reason = "On Android, alerts do not pop up" +
+  @Ignore(value = {ANDROID, CHROME, QTWEBKIT}, reason = "On Android, alerts do not pop up" +
       " when a window is closed.")
   @Test
   public void testShouldHandleAlertOnWindowClose() {
@@ -465,8 +476,9 @@ public void testShouldHandleAlertOnWindowClose() {
     }
   }
 
+  // Andrii Moroz : our webdriver returns title even alert present
   @JavascriptEnabled
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IPHONE, OPERA, QTWEBKIT})
   @Test
   public void testIncludesAlertTextInUnhandledAlertException() {
     driver.findElement(By.id("alert")).click();
@@ -482,6 +494,9 @@ public void testIncludesAlertTextInUnhandledAlertException() {
 
   @NoDriverAfterTest
   @Test
+  @Ignore( value = {QTWEBKIT},
+           reason = "QtWebKit bug https://bugreports.qt-project.org/browse/QTBUG-33250",
+            issues = 746)
   public void testCanQuitWhenAnAlertIsPresent() {
     driver.get(pages.alertsPage);
     driver.findElement(By.id("alert")).click();
diff --git a/java/client/test/org/openqa/selenium/ClickScrollingTest.java b/java/client/test/org/openqa/selenium/ClickScrollingTest.java
index e1efdf49..a247364b 100644
--- a/java/client/test/org/openqa/selenium/ClickScrollingTest.java
+++ b/java/client/test/org/openqa/selenium/ClickScrollingTest.java
@@ -34,6 +34,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.Test;
 import org.openqa.selenium.interactions.MoveTargetOutOfBoundsException;
@@ -93,7 +94,7 @@ public void testShouldBeAbleToClickOnAnElementHiddenByOverflow() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {CHROME, IPHONE},
+  @Ignore(value = {CHROME, IPHONE, QTWEBKIT},
           reason = "Chrome: failed, iPhone: untested, Firefox: failed with native events")
   @Test
   public void testShouldBeAbleToClickOnAnElementHiddenByDoubleOverflow() {
@@ -127,7 +128,7 @@ public void testShouldNotScrollOverflowElementsWhichAreVisible() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {CHROME, IPHONE, PHANTOMJS, SAFARI, MARIONETTE},
+  @Ignore(value = {CHROME, IPHONE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT},
       reason = "Safari: button1 is scrolled to the bottom edge of the view, " +
           "so additonal scrolling is still required for button2")
   @Test
diff --git a/java/client/test/org/openqa/selenium/ClickTest.java b/java/client/test/org/openqa/selenium/ClickTest.java
index a3376932..d72a0219 100644
--- a/java/client/test/org/openqa/selenium/ClickTest.java
+++ b/java/client/test/org/openqa/selenium/ClickTest.java
@@ -32,6 +32,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
 import static org.openqa.selenium.testing.TestUtilities.isNativeEventsEnabled;
@@ -209,8 +210,8 @@ public void testClickingLabelShouldSetCheckbox() {
     driver.findElement(By.id("label-for-checkbox-with-label")).click();
 
     assertTrue(
-        "Should be selected",
-        driver.findElement(By.id("checkbox-with-label")).isSelected());
+            "Should be selected",
+            driver.findElement(By.id("checkbox-with-label")).isSelected());
   }
 
   @Test
@@ -270,8 +271,8 @@ public void testClicksASurroundingStrongTag() {
   }
 
   @Test
-  @Ignore(value = {IE, OPERA, OPERA_MOBILE, ANDROID, IPHONE, MARIONETTE}, reason
-      = "Opera, IE: failed, others: not tested")
+  @Ignore(value = {IE, OPERA, OPERA_MOBILE, ANDROID, IPHONE, MARIONETTE, QTWEBKIT}, reason
+      = "QtWebkit: element is not clickable, Opera, IE: failed, others: not tested")
   public void testCanClickAnImageMapArea() {
     driver.get(appServer.whereIs("click_tests/google_map.html"));
     driver.findElement(By.id("rectG")).click();
diff --git a/java/client/test/org/openqa/selenium/CookieImplementationTest.java b/java/client/test/org/openqa/selenium/CookieImplementationTest.java
index bfe0367f..b62926af 100644
--- a/java/client/test/org/openqa/selenium/CookieImplementationTest.java
+++ b/java/client/test/org/openqa/selenium/CookieImplementationTest.java
@@ -47,6 +47,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 
@@ -236,6 +237,7 @@ public void testCannotGetCookiesWithPathDifferingOnlyInCase() {
   }
 
   @Test
+  //TODO: Fails because of secon hostname isn't tranformed from domain name to ipv4 adrres,
   public void testShouldNotGetCookieOnDifferentDomain() {
     assumeTrue(domainHelper.checkHasValidAlternateHostname());
 
@@ -425,7 +427,8 @@ public void testRetainsHttpOnlyFlag() {
     assertTrue(retrieved.isHttpOnly());
   }
 
-  @Ignore(ANDROID)
+  @Ignore(value = {ANDROID, QTWEBKIT},
+          reason = "QTWEBKIT: looks like browser itself doesn't support setting expired cookie")
   @Test
   public void testSettingACookieThatExpiredInThePast() {
     long expires = System.currentTimeMillis() - 1000;
diff --git a/java/client/test/org/openqa/selenium/CorrectEventFiringTest.java b/java/client/test/org/openqa/selenium/CorrectEventFiringTest.java
index b35fea10..db65c287 100644
--- a/java/client/test/org/openqa/selenium/CorrectEventFiringTest.java
+++ b/java/client/test/org/openqa/selenium/CorrectEventFiringTest.java
@@ -37,6 +37,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.Test;
 import org.openqa.selenium.testing.Ignore;
@@ -110,7 +111,7 @@ public void testShouldFireMouseOverEventWhenClicking() {
   // while doing down, up, click
   @JavascriptEnabled
   @Test
-  @Ignore(MARIONETTE)
+  @Ignore({MARIONETTE, QTWEBKIT})
   public void testShouldFireMouseMoveEventWhenClicking() {
     driver.get(pages.javascriptPage);
 
@@ -381,7 +382,7 @@ public void testSubmittingFormFromFormInputTextElementShouldFireOnSubmitForThatF
   }
 
   @JavascriptEnabled
-  @Ignore(value = {IPHONE, ANDROID, OPERA, SAFARI, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {IPHONE, ANDROID, OPERA, SAFARI, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
       reason = "Does not yet support file uploads", issues = { 4220 })
   @Test
   public void testUploadingFileShouldFireOnChangeEvent() throws IOException {
diff --git a/java/client/test/org/openqa/selenium/ExecutingAsyncJavascriptTest.java b/java/client/test/org/openqa/selenium/ExecutingAsyncJavascriptTest.java
index cb444dd7..23f24c28 100644
--- a/java/client/test/org/openqa/selenium/ExecutingAsyncJavascriptTest.java
+++ b/java/client/test/org/openqa/selenium/ExecutingAsyncJavascriptTest.java
@@ -49,6 +49,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import com.google.common.base.Throwables;
 
@@ -252,7 +253,7 @@ public void shouldNotTimeoutWithMultipleCallsTheFirstOneBeingSynchronous() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, QTWEBKIT})
   public void shouldCatchErrorsWithMessageAndStacktraceWhenExecutingInitialScript() {
     driver.get(pages.ajaxyPage);
     String js = "function functionB() { throw Error('errormessage'); };"
@@ -352,7 +353,7 @@ public void shouldBeAbleToMakeXMLHttpRequestsAndWaitForTheResponse() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, QTWEBKIT})
   @NeedsLocalEnvironment(reason = "Relies on timing")
   public void throwsIfScriptTriggersAlert() {
     driver.get(pages.simpleTestPage);
@@ -370,7 +371,7 @@ public void throwsIfScriptTriggersAlert() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, QTWEBKIT})
   @NeedsLocalEnvironment(reason = "Relies on timing")
   public void throwsIfAlertHappensDuringScript() {
     driver.get(pages.slowLoadingAlertPage);
@@ -386,7 +387,7 @@ public void throwsIfAlertHappensDuringScript() {
   }
 
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, QTWEBKIT})
   @NeedsLocalEnvironment(reason = "Relies on timing")
   public void throwsIfScriptTriggersAlertWhichTimesOut() {
     driver.get(pages.simpleTestPage);
@@ -404,7 +405,7 @@ public void throwsIfScriptTriggersAlertWhichTimesOut() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, QTWEBKIT})
   @NeedsLocalEnvironment(reason = "Relies on timing")
   public void throwsIfAlertHappensDuringScriptWhichTimesOut() {
     driver.get(pages.slowLoadingAlertPage);
@@ -421,7 +422,7 @@ public void throwsIfAlertHappensDuringScriptWhichTimesOut() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, QTWEBKIT})
   @NeedsLocalEnvironment(reason = "Relies on timing")
   public void includesAlertTextInUnhandledAlertException() {
     driver.manage().timeouts().setScriptTimeout(5000, TimeUnit.MILLISECONDS);
diff --git a/java/client/test/org/openqa/selenium/ExecutingJavascriptTest.java b/java/client/test/org/openqa/selenium/ExecutingJavascriptTest.java
index 825028f8..f70a9f41 100644
--- a/java/client/test/org/openqa/selenium/ExecutingJavascriptTest.java
+++ b/java/client/test/org/openqa/selenium/ExecutingJavascriptTest.java
@@ -52,16 +52,7 @@
 import static org.junit.Assert.assertTrue;
 import static org.junit.Assert.fail;
 import static org.junit.Assume.assumeTrue;
-import static org.openqa.selenium.testing.Ignore.Driver.ANDROID;
-import static org.openqa.selenium.testing.Ignore.Driver.IE;
-import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
-import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
-import static org.openqa.selenium.testing.Ignore.Driver.CHROME;
-import static org.openqa.selenium.testing.Ignore.Driver.HTMLUNIT;
-import static org.openqa.selenium.testing.Ignore.Driver.IPHONE;
-import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
-import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
-import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
 
 public class ExecutingJavascriptTest extends JUnit4TestBase {
 
@@ -287,7 +278,7 @@ public void testShouldThrowAnExceptionWhenTheJavascriptIsBad() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT})
   public void testShouldThrowAnExceptionWithMessageAndStacktraceWhenTheJavascriptIsBad() {
     driver.get(pages.xhtmlTestPage);
 
@@ -581,7 +572,7 @@ public void testShouldThrowAnExceptionWhenArgumentsWithStaleElementPassed() {
 
   @JavascriptEnabled
   @Test
-  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore(value = {ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT})
   public void testShouldBeAbleToReturnADateObject() {
     driver.get(pages.simpleTestPage);
 
@@ -596,7 +587,7 @@ public void testShouldBeAbleToReturnADateObject() {
 
   @JavascriptEnabled
   @Test(timeout = 10000)
-  @Ignore(value = {ANDROID, CHROME, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore(value = {ANDROID, CHROME, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, SAFARI, MARIONETTE})
   public void shouldReturnDocumentElementIfDocumentIsReturned() {
     driver.get(pages.simpleTestPage);
 
diff --git a/java/client/test/org/openqa/selenium/FormHandlingTest.java b/java/client/test/org/openqa/selenium/FormHandlingTest.java
index a8a682f7..6e243b4b 100644
--- a/java/client/test/org/openqa/selenium/FormHandlingTest.java
+++ b/java/client/test/org/openqa/selenium/FormHandlingTest.java
@@ -34,6 +34,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.TestUtilities.isIe6;
 import static org.openqa.selenium.testing.TestUtilities.isIe7;
 
@@ -167,7 +168,7 @@ public void testShouldEnterDataIntoFormFields() {
     assertThat(newFormValue, equalTo("some text"));
   }
 
-  @Ignore(value = {IPHONE, ANDROID, SAFARI, OPERA, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {IPHONE, ANDROID, SAFARI, OPERA, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "Does not yet support file uploads", issues = {4220})
   @Test
   public void testShouldBeAbleToAlterTheContentsOfAFileUploadInputElement() throws IOException {
@@ -184,7 +185,7 @@ public void testShouldBeAbleToAlterTheContentsOfAFileUploadInputElement() throws
     assertTrue(uploadPath.endsWith(file.getName()));
   }
 
-  @Ignore(value = {ANDROID, IPHONE, OPERA, SAFARI, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {ANDROID, IPHONE, OPERA, SAFARI, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "Does not yet support file uploads", issues = {4220})
   @Test
   public void testShouldBeAbleToSendKeysToAFileUploadInputElementInAnXhtmlDocument()
@@ -206,7 +207,7 @@ public void testShouldBeAbleToSendKeysToAFileUploadInputElementInAnXhtmlDocument
     assertTrue(uploadPath.endsWith(file.getName()));
   }
 
-  @Ignore(value = {IPHONE, ANDROID, OPERA, SAFARI, MARIONETTE},
+  @Ignore(value = {IPHONE, ANDROID, OPERA, SAFARI, MARIONETTE, QTWEBKIT},
           reason = "Does not yet support file uploads", issues = {4220})
   @Test
   public void testShouldBeAbleToUploadTheSameFileTwice() throws IOException {
@@ -278,7 +279,7 @@ public void testEmptyTextBoxesShouldReturnAnEmptyStringNotNull() {
   }
 
   @Test
-  @Ignore(value = {ANDROID, HTMLUNIT, IPHONE, OPERA, PHANTOMJS, SAFARI, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {ANDROID, HTMLUNIT, IPHONE, OPERA, PHANTOMJS, SAFARI, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "untested")
   public void handleFormWithJavascriptAction() {
     String url = appServer.whereIs("form_handling_js_submit.html");
diff --git a/java/client/test/org/openqa/selenium/FrameSwitchingTest.java b/java/client/test/org/openqa/selenium/FrameSwitchingTest.java
index dcc36458..2af92b24 100644
--- a/java/client/test/org/openqa/selenium/FrameSwitchingTest.java
+++ b/java/client/test/org/openqa/selenium/FrameSwitchingTest.java
@@ -36,6 +36,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 
 import org.junit.After;
@@ -269,7 +270,7 @@ public void testShouldThrowAnExceptionWhenAFrameCannotBeFoundByIndex() {
     }
   }
 
-  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, SAFARI, MARIONETTE})
   @Test
   public void testShouldBeAbleToSwitchToParentFrame() {
     driver.get(pages.framesetPage);
@@ -278,7 +279,7 @@ public void testShouldBeAbleToSwitchToParentFrame() {
     assertThat(driver.findElement(By.id("pageNumber")).getText(), equalTo("1"));
   }
 
-  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, SAFARI, MARIONETTE})
   @Test
   public void testShouldBeAbleToSwitchToParentFrameFromASecondLevelFrame() {
     driver.get(pages.framesetPage);
@@ -288,7 +289,7 @@ public void testShouldBeAbleToSwitchToParentFrameFromASecondLevelFrame() {
     assertThat(driver.findElement(By.id("pageNumber")).getText(), equalTo("11"));
   }
 
-  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, SAFARI, MARIONETTE})
   @Test
   public void testSwitchingToParentFrameFromDefaultContextIsNoOp() {
     driver.get(pages.xhtmlTestPage);
@@ -296,7 +297,7 @@ public void testSwitchingToParentFrameFromDefaultContextIsNoOp() {
     assertEquals(driver.getTitle(), "XHTML Test Page");
   }
 
-  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, CHROME, IE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, SAFARI, MARIONETTE})
   @Test
   public void testShouldBeAbleToSwitchToParentFromAnIframe() {
     driver.get(pages.iframePage);
diff --git a/java/client/test/org/openqa/selenium/I18nTest.java b/java/client/test/org/openqa/selenium/I18nTest.java
index e9ab42fa..5c932836 100644
--- a/java/client/test/org/openqa/selenium/I18nTest.java
+++ b/java/client/test/org/openqa/selenium/I18nTest.java
@@ -29,6 +29,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.IPHONE;
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
 
 import org.junit.Test;
 import org.openqa.selenium.environment.GlobalTestEnvironment;
@@ -90,10 +91,11 @@ public void testEnteringHebrewTextFromRightToLeft() {
 
   @Test
   @Ignore(
-      value = {MARIONETTE, CHROME, OPERA},
+      value = {MARIONETTE, CHROME, OPERA, QTWEBKIT},
       reason = "MAIONETTE: not checked, "
                + "CHROME: ChromeDriver only supports characters in the BMP"
                + "OPERA: doesn't work - see issue 5069"
+               + "QTWEBKIT: WebDriver only supports characters in the BMP"
   )
   public void testEnteringSupplementaryCharacters() {
     assumeFalse("IE: versions less thank 10 have issue 5069",
@@ -133,7 +135,7 @@ public void testShouldBeAbleToReturnTheTextInAPage() {
   }
 
   @NeedsFreshDriver
-  @Ignore(value = {IE, CHROME, HTMLUNIT, FIREFOX, OPERA, ANDROID, IPHONE},
+  @Ignore(value = {IE, CHROME, HTMLUNIT, FIREFOX, OPERA, ANDROID, IPHONE, QTWEBKIT},
       reason = "Not implemented on anything other than"
           + "Firefox/Linux at the moment.")
   @Test
diff --git a/java/client/test/org/openqa/selenium/ImplicitWaitTest.java b/java/client/test/org/openqa/selenium/ImplicitWaitTest.java
index 86b49aa2..b739bfc1 100644
--- a/java/client/test/org/openqa/selenium/ImplicitWaitTest.java
+++ b/java/client/test/org/openqa/selenium/ImplicitWaitTest.java
@@ -26,6 +26,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import static java.util.concurrent.TimeUnit.MILLISECONDS;
 
@@ -139,7 +140,7 @@ public void testShouldReturnAfterFirstAttemptToFindManyAfterDisablingImplicitWai
 
   @Test
   @JavascriptEnabled
-  @Ignore({ANDROID, IE, IPHONE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, IE, IPHONE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT})
   public void testShouldImplicitlyWaitForAnElementToBeVisibleBeforeInteracting() {
     driver.get(pages.dynamicPage);
 
diff --git a/java/client/test/org/openqa/selenium/PageLoadingTest.java b/java/client/test/org/openqa/selenium/PageLoadingTest.java
index ca622cd2..a40c297b 100644
--- a/java/client/test/org/openqa/selenium/PageLoadingTest.java
+++ b/java/client/test/org/openqa/selenium/PageLoadingTest.java
@@ -47,6 +47,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
 import static org.openqa.selenium.testing.TestUtilities.isLocal;
@@ -79,7 +80,8 @@ private void initLocalDriver(String strategy) {
     localDriver = new WebDriverBuilder().setDesiredCapabilities(caps).get();
   }
 
-  @Ignore(value = {CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT})
+  @Ignore(value = {CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT, QTWEBKIT},
+          reason = "QTWEBKIT: only one session is supported.")
   @NeedsLocalEnvironment
   @Test
   public void testNoneStrategyShouldNotWaitForPageToLoad() {
@@ -97,7 +99,8 @@ public void testNoneStrategyShouldNotWaitForPageToLoad() {
     assertTrue("Took too long to load page: " + duration, duration < 1000);
   }
 
-  @Ignore(value = {CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT})
+  @Ignore(value = {CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT, QTWEBKIT},
+          reason = "QTWEBKIT: only one session is supported.")
   @NeedsLocalEnvironment
   @Test
   public void testNoneStrategyShouldNotWaitForPageToRefresh() {
@@ -119,7 +122,8 @@ public void testNoneStrategyShouldNotWaitForPageToRefresh() {
     assertTrue("Took too long to load page: " + duration, duration < 1000);
   }
 
-  @Ignore(value = {FIREFOX, CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT})
+  @Ignore(value = {FIREFOX, CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT, QTWEBKIT},
+          reason = "QTWEBKIT: only one session is supported.")
   @NeedsLocalEnvironment
   @Test
   public void testEagerStrategyShouldNotWaitForResources() {
@@ -140,7 +144,8 @@ public void testEagerStrategyShouldNotWaitForResources() {
     assertTrue("Took too long to load page: " + duration, duration < 5 * 1000);
   }
 
-  @Ignore(value = {FIREFOX, CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT})
+  @Ignore(value = {FIREFOX, CHROME, IE, OPERA, SAFARI, MARIONETTE, PHANTOMJS, HTMLUNIT, QTWEBKIT},
+          reason = "QTWEBKIT: only one session is supported.")
   @NeedsLocalEnvironment
   @Test
   public void testEagerStrategyShouldNotWaitForResourcesOnRefresh() {
@@ -164,6 +169,8 @@ public void testEagerStrategyShouldNotWaitForResourcesOnRefresh() {
     assertTrue("Took too long to refresh page: " + duration, duration < 5 * 1000);
   }
 
+  @Ignore(value = {QTWEBKIT},
+          reason = "QTWEBKIT: only one session is supported.")
   @Test
   public void testEagerStrategyShouldWaitForDocumentToBeLoaded() {
     initLocalDriver("eager");
@@ -312,7 +319,7 @@ public void testShouldBeAbleToNavigateForwardsInTheBrowserHistory() {
     wait.until(titleIs("We Arrive Here"));
   }
 
-  @Ignore(value = {IE, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS},
+  @Ignore(value = {IE, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, QTWEBKIT},
           reason = "Safari: does not support insecure SSL")
   @Test
   public void testShouldBeAbleToAccessPagesWithAnInsecureSslCertificate() {
@@ -322,7 +329,7 @@ public void testShouldBeAbleToAccessPagesWithAnInsecureSslCertificate() {
     assertThat(driver.getTitle(), equalTo("Hello WebDriver"));
   }
 
-  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT})
   @Test
   public void shouldBeAbleToDisableAcceptOfInsecureSslCertsWithRequiredCapability() {
     // TODO: Resolve why this test doesn't work on the remote server
@@ -533,4 +540,4 @@ public void quitDriver() {
     }
   }
 
-}
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/PositionAndSizeTest.java b/java/client/test/org/openqa/selenium/PositionAndSizeTest.java
index e859c470..e58095fd 100644
--- a/java/client/test/org/openqa/selenium/PositionAndSizeTest.java
+++ b/java/client/test/org/openqa/selenium/PositionAndSizeTest.java
@@ -32,6 +32,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.Ignore.Driver.ANDROID;
@@ -152,7 +153,7 @@ public void testShouldCorrectlyIdentifyThatAnElementHasWidthAndHeight() {
   // should handle sub-pixel rendering, and every browser seems to be different anyhow:
   // http://ejohn.org/blog/sub-pixel-problems-in-css/
   @JavascriptEnabled
-  @Ignore({IE, CHROME, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, MARIONETTE})
+  @Ignore({IE, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, MARIONETTE, QTWEBKIT})
   // Reason for Chrome: WebKit bug 28804
   @Test
   public void testShouldHandleNonIntegerPositionAndSize() {
diff --git a/java/client/test/org/openqa/selenium/ProxySettingTest.java b/java/client/test/org/openqa/selenium/ProxySettingTest.java
index 5e941c27..00fb39da 100644
--- a/java/client/test/org/openqa/selenium/ProxySettingTest.java
+++ b/java/client/test/org/openqa/selenium/ProxySettingTest.java
@@ -33,6 +33,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import com.google.common.base.Charsets;
 import com.google.common.base.Joiner;
@@ -88,9 +89,10 @@ public void tearDown() {
     }
   }
 
-  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI},
+  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI, QTWEBKIT},
           reason = "Android/Iphone/PhantomJS - not tested,"
-                   + "Opera mobile/Safari - not implemented")
+                   + "Opera mobile/Safari - not implemented, "
+                   + "test for QTWEBKIT implemented in qtwebkit/hybridtests")
   @NeedsLocalEnvironment
   @Test
   public void canConfigureManualHttpProxy() {
@@ -105,9 +107,10 @@ public void canConfigureManualHttpProxy() {
     assertTrue("Proxy should have been called", proxyServer.hasBeenCalled("simpleTest.html"));
   }
 
-  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI, HTMLUNIT},
+  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI, HTMLUNIT, QTWEBKIT},
           reason = "Android/Iphone/PhantomJS - not tested,"
-                   + "Opera mobile/Safari - not implemented")
+                   + "Opera mobile/Safari - not implemented"
+                   + "QtWebKit: WebDriver doesn't support proxy configuring by PAC")
   @NeedsLocalEnvironment
   @Test
   public void canConfigureProxyThroughPACFile() {
@@ -132,9 +135,10 @@ public void canConfigureProxyThroughPACFile() {
         "Hello, world!", driver.findElement(By.tagName("h3")).getText());
   }
 
-  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI, HTMLUNIT},
+  @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, PHANTOMJS, SAFARI, HTMLUNIT, QTWEBKIT},
           reason = "Android/Iphone/PhantomJS - not tested,"
-                   + "Opera mobile/Safari - not implemented")
+                   + "Opera mobile/Safari - not implemented"
+                   + "QtWebkit: WebDriver doesn't support proxy configuring by PAC")
   @NeedsLocalEnvironment
   @Test
   public void canUsePACThatOnlyProxiesCertainHosts() throws Exception {
@@ -168,7 +172,8 @@ public void canUsePACThatOnlyProxiesCertainHosts() throws Exception {
         "Heading", driver.findElement(By.tagName("h1")).getText());
   }
 
-  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, REMOTE, SAFARI})
+  //Required Capabilities not supported
+  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, REMOTE, SAFARI})
   @NeedsLocalEnvironment
   @Test
   public void canConfigureProxyWithRequiredCapability() {
@@ -183,7 +188,8 @@ public void canConfigureProxyWithRequiredCapability() {
     assertTrue("Proxy should have been called", proxyServer.hasBeenCalled("simpleTest.html"));
   }
 
-  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, REMOTE, SAFARI})
+  //Required Capabilities not supported
+  @Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, QTWEBKIT, REMOTE, SAFARI})
   @NeedsLocalEnvironment
   @Test
   public void requiredProxyCapabilityShouldHavePriority() {
@@ -286,4 +292,4 @@ private static HostAndPort getHostAndPort(WebServer server) {
     String host = Objects.firstNonNull(System.getenv("HOSTNAME"), "localhost");
     return HostAndPort.fromParts(host, server.getPort());
   }
-}
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/ReferrerTest.java b/java/client/test/org/openqa/selenium/ReferrerTest.java
index 159ce2ec..996ac607 100644
--- a/java/client/test/org/openqa/selenium/ReferrerTest.java
+++ b/java/client/test/org/openqa/selenium/ReferrerTest.java
@@ -30,6 +30,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.InProject.locate;
 
@@ -122,6 +123,8 @@ public static void readPages() throws IOException {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "QtWebKit does additional requests upon history.go calls caused by performNavigation")
   public void basicHistoryNavigationWithoutAProxy() {
     testServer1.start();
 
@@ -145,6 +148,8 @@ public void basicHistoryNavigationWithoutAProxy() {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "QtWebKit does additional requests upon history.go calls caused by performNavigation")
   public void crossDomainHistoryNavigationWithoutAProxy() {
 
     testServer1.start();
@@ -175,6 +180,8 @@ public void crossDomainHistoryNavigationWithoutAProxy() {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "Qt issue https://bugreports.qt-project.org/browse/QTBUG-2069")
   public void basicHistoryNavigationWithADirectProxy() {
     testServer1.start();
 
@@ -204,6 +211,8 @@ public void basicHistoryNavigationWithADirectProxy() {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "Qt issue https://bugreports.qt-project.org/browse/QTBUG-2069")
   public void crossDomainHistoryNavigationWithADirectProxy() {
     testServer1.start();
     testServer2.start();
@@ -238,6 +247,8 @@ public void crossDomainHistoryNavigationWithADirectProxy() {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "Qt issue https://bugreports.qt-project.org/browse/QTBUG-2069")
   public void crossDomainHistoryNavigationWithAProxiedHost() {
     testServer1.start();
     testServer2.start();
@@ -278,6 +289,8 @@ public void crossDomainHistoryNavigationWithAProxiedHost() {
    */
   @Test
   @NeedsLocalEnvironment
+  @Ignore(value = {QTWEBKIT},
+          reason = "Qt issue https://bugreports.qt-project.org/browse/QTBUG-2069")
   public void crossDomainHistoryNavigationWhenProxyInterceptsHostRequests() {
     testServer1.start();
     proxyServer.start();
@@ -314,8 +327,9 @@ public void crossDomainHistoryNavigationWhenProxyInterceptsHostRequests() {
    * intercepts requests for page 2.
    */
   @Ignore(
-      value = IE,
-      reason = "IEDriver does not disable automatic proxy caching, causing this test to fail.",
+      value = {IE, QTWEBKIT},
+      reason = " IEDriver: does not disable automatic proxy caching, causing this test to fail." +
+               " QTWEBKIT: Qt issue https://bugreports.qt-project.org/browse/QTBUG-2069.",
       issues = 6629)
   @Test
   @NeedsLocalEnvironment
diff --git a/java/client/test/org/openqa/selenium/SessionHandlingTest.java b/java/client/test/org/openqa/selenium/SessionHandlingTest.java
index 12b1d133..6f0e39bb 100644
--- a/java/client/test/org/openqa/selenium/SessionHandlingTest.java
+++ b/java/client/test/org/openqa/selenium/SessionHandlingTest.java
@@ -33,6 +33,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 @RunWith(SeleniumTestRunner.class)
 @Ignore(value = {ANDROID, IPHONE, OPERA_MOBILE, REMOTE, MARIONETTE},
@@ -40,6 +41,8 @@
 public class SessionHandlingTest {
 
   @Test
+  @Ignore(value = {QTWEBKIT},
+    reason = "QtWebkit: doesn't support multiple sessions")
   public void callingQuitMoreThanOnceOnASessionIsANoOp() {
     WebDriver driver = new WebDriverBuilder().get();
 
@@ -54,7 +57,7 @@ public void callingQuitMoreThanOnceOnASessionIsANoOp() {
   }
 
   @Test
-  @Ignore(value = {PHANTOMJS})
+  @Ignore(value = {PHANTOMJS, QTWEBKIT})
   public void callingQuitAfterClosingTheLastWindowIsANoOp() {
     WebDriver driver = new WebDriverBuilder().get();
 
@@ -69,9 +72,10 @@ public void callingQuitAfterClosingTheLastWindowIsANoOp() {
   }
 
   @Test(expected = SessionNotFoundException.class)
-  @Ignore(value = {OPERA, SAFARI}, reason =
+  @Ignore(value = {OPERA, SAFARI, QTWEBKIT}, reason =
       "Opera: throws Opera-specific exception,"
-      + "Safari: throws UnreachableBrowserException")
+      + "Safari: throws UnreachableBrowserException,"
+      + "QtWebkit: doesn't support multiple sessions")
   public void callingAnyOperationAfterQuitShouldThrowAnException() {
     WebDriver driver = new WebDriverBuilder().get();
     driver.quit();
@@ -79,11 +83,12 @@ public void callingAnyOperationAfterQuitShouldThrowAnException() {
   }
 
   @Test(expected = SessionNotFoundException.class)
-  @Ignore(value = {FIREFOX, OPERA, PHANTOMJS, SAFARI}, reason =
+  @Ignore(value = {FIREFOX, OPERA, PHANTOMJS, SAFARI, QTWEBKIT}, reason =
       "Firefox: can perform an operation after closing the last window,"
       + "Opera: throws Opera-specific exception,"
       + "PhantomJS: throws NoSuchWindowException,"
-      + "Safari: throws NullPointerException")
+      + "Safari: throws NullPointerException,"
+      + "QtWebkit: throws generic WebDriverException")
   public void callingAnyOperationAfterClosingTheLastWindowShouldThrowAnException() {
     WebDriver driver = new WebDriverBuilder().get();
     driver.close();
diff --git a/java/client/test/org/openqa/selenium/TakesScreenshotTest.java b/java/client/test/org/openqa/selenium/TakesScreenshotTest.java
index 6442db70..e6bd0694 100644
--- a/java/client/test/org/openqa/selenium/TakesScreenshotTest.java
+++ b/java/client/test/org/openqa/selenium/TakesScreenshotTest.java
@@ -16,9 +16,12 @@
 
 package org.openqa.selenium;
 
+import org.apache.commons.io.FileUtils;
 import org.junit.After;
 import org.junit.Before;
 import org.junit.Test;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
 import org.openqa.selenium.testing.Ignore;
 import org.openqa.selenium.testing.JUnit4TestBase;
 
@@ -36,6 +39,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import com.google.common.collect.Sets;
 
@@ -135,7 +139,7 @@ public void testShouldCaptureScreenshotOfCurrentViewport() throws Exception {
   }
 
   @Test
-  @Ignore(value = {OPERA, SAFARI, CHROME},
+  @Ignore(value = {OPERA, SAFARI, CHROME, QTWEBKIT},
           reason = " SAFARI: takes only visible viewport." +
                    " CHROME: takes only visible viewport." +
                    " OPERA: takes only visible viewport."
@@ -158,7 +162,19 @@ public void testShouldCaptureScreenshotOfPageWithLongX() throws Exception {
   }
 
   @Test
-  @Ignore(value = {OPERA, SAFARI, CHROME},
+  public void testSaveElementScreenshot() throws Exception {
+    driver.get(appServer.whereIs("longContentPage.html"));
+
+    RemoteWebElement findElement = (RemoteWebElement) driver.findElement(By.id("link3"));
+    TakesScreenshot eltShot = (TakesScreenshot) new QtWebkitAugmenter().augment(findElement);
+    tempFile = eltShot.getScreenshotAs(OutputType.FILE);
+
+    assertTrue(tempFile.exists());
+    assertTrue(tempFile.length() > 0);
+  }
+
+  @Test
+  @Ignore(value = {SAFARI, CHROME, QTWEBKIT},
           reason = " SAFARI: takes only visible viewport." +
                    " CHROME: takes only visible viewport." +
                    " OPERA: takes only visible viewport."
@@ -181,7 +197,7 @@ public void testShouldCaptureScreenshotOfPageWithLongY() throws Exception {
   }
 
   @Test
-  @Ignore(value = {PHANTOMJS, OPERA, SAFARI, CHROME, IE, FIREFOX},
+  @Ignore(value = {IE, FIREFOX, SAFARI, QTWEBKIT},
           reason = " IE: cuts captured image at driver level." +
                    " FF: captured image is cat at driver level." +
                    " SAFARI: takes only visible viewport." +
@@ -207,7 +223,7 @@ public void testShouldCaptureScreenshotOfPageWithTooLongX() throws Exception {
   }
 
   @Test
-  @Ignore(value = {PHANTOMJS, OPERA, SAFARI, CHROME, IE, FIREFOX},
+  @Ignore(value = {IE, FIREFOX, SAFARI, CHROME, QTWEBKIT},
           reason = " IE: cuts captured image at driver level." +
                    " FF: captured image is cat at driver level." +
                    " SAFARI: takes only visible viewport." +
@@ -233,13 +249,14 @@ public void testShouldCaptureScreenshotOfPageWithTooLongY() throws Exception {
   }
 
   @Test
-  @Ignore(value = {PHANTOMJS, OPERA, SAFARI, CHROME, IE, FIREFOX},
+  @Ignore(value = {PHANTOMJS, OPERA, SAFARI, CHROME, IE, FIREFOX, QTWEBKIT},
           reason = " IE: returns null." +
                    " FF: failed due NS_ERROR_FAILURE at context.drawWindow." +
                    " SAFARI: takes only visible viewport." +
                    " CHROME: takes only visible viewport." +
                    " PHANTOMJS: takes empty data of byte[], no errors. " +
-                   " OPERA: takes only visible viewport."
+                   " OPERA: takes only visible viewport." +
+                   " QTWEBKIT: takes only visible viewport."
   )
   public void testShouldCaptureScreenshotOfPageWithTooLongXandY() throws Exception {
     driver.get(appServer.whereIs("screen/screen_too_long.html"));
@@ -288,8 +305,9 @@ public void testShouldCaptureScreenshotAtFramePage() throws Exception {
   }
 
   @Test
-  @Ignore(value = {CHROME},
-          reason = " CHROME: Unknown actual colors are presented at screenshot")
+  @Ignore(value = {CHROME, QTWEBKIT},
+          reason = " CHROME: Unknown actual colors are presented at screenshot" +
+                   " QTWEBKIT: Unknown actual colors are presented at screenshot")
   public void testShouldCaptureScreenshotAtIFramePage() throws Exception {
     driver.get(appServer.whereIs("screen/screen_iframes.html"));
 
@@ -347,10 +365,11 @@ public void testShouldCaptureScreenshotAtFramePageAfterSwitching() throws Except
 
   @Test
   @Ignore(
-      value = {OPERA, IE, CHROME},
+      value = {OPERA, IE, CHROME, QTWEBKIT},
       reason = " OPERA: takes screenshot only of switched-in frame." +
                " IE: v9 takes screesnhot only of switched-in frame area " +
-               " CHROME: Unknown actual colors are presented at screenshot"
+               " CHROME: Unknown actual colors are presented at screenshot" +
+               " QTWEBKIT: Unknown actual colors are presented at screenshot"
   )
   public void testShouldCaptureScreenshotAtIFramePageAfterSwitching() throws Exception {
     driver.get(appServer.whereIs("screen/screen_iframes.html"));
diff --git a/java/client/test/org/openqa/selenium/TextPagesTest.java b/java/client/test/org/openqa/selenium/TextPagesTest.java
index ca48696f..76710f30 100644
--- a/java/client/test/org/openqa/selenium/TextPagesTest.java
+++ b/java/client/test/org/openqa/selenium/TextPagesTest.java
@@ -29,6 +29,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.Before;
 import org.junit.Test;
@@ -45,7 +46,7 @@ public void setUp() throws Exception {
     textPage = GlobalTestEnvironment.get().getAppServer().whereIs("plain.txt");
   }
 
-  @Ignore(value = {IE, FIREFOX, CHROME, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, MARIONETTE},
+  @Ignore(value = {IE, FIREFOX, CHROME, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, MARIONETTE, QTWEBKIT},
       reason = "Android: WebView adds HTML tags to the page, IE, Firefox: adds HTML tags.")
   @Test
   public void testShouldBeAbleToLoadASimplePageOfText() {
@@ -67,7 +68,7 @@ public void testFindingAnElementOnAPlainTextPageWillNeverWork() {
     }
   }
 
-  @Ignore(value = {CHROME, IE, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS}, reason =
+  @Ignore(value = {CHROME, IE, IPHONE, OPERA, ANDROID, SAFARI, OPERA_MOBILE, PHANTOMJS, QTWEBKIT}, reason =
       "Opera, Safari, IE, Firefox: creates DOM for displaying text pages")
   @Test
   public void testShouldThrowExceptionWhenAddingCookieToAPageThatIsNotHtml() {
diff --git a/java/client/test/org/openqa/selenium/TypingTest.java b/java/client/test/org/openqa/selenium/TypingTest.java
index 9dbe0945..de3ee564 100644
--- a/java/client/test/org/openqa/selenium/TypingTest.java
+++ b/java/client/test/org/openqa/selenium/TypingTest.java
@@ -37,6 +37,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.TestUtilities.getEffectivePlatform;
 import static org.openqa.selenium.testing.TestUtilities.getFirefoxVersion;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
@@ -361,7 +362,7 @@ public void testNumericNonShiftKeys() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {HTMLUNIT, ANDROID, OPERA, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, ANDROID, OPERA, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "untested user agent")
   @Test
   public void testNumericShiftKeys() {
@@ -392,7 +393,7 @@ public void testLowerCaseAlphaKeys() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {HTMLUNIT, OPERA, OPERA_MOBILE, ANDROID, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, OPERA, OPERA_MOBILE, ANDROID, MARIONETTE, QTWEBKIT},
           reason = "untested user agents")
   @Test
   public void testUppercaseAlphaKeys() {
@@ -409,7 +410,7 @@ public void testUppercaseAlphaKeys() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {HTMLUNIT, OPERA, ANDROID, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, OPERA, ANDROID, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "untested user agents")
   @Test
   public void testAllPrintableKeys() {
@@ -490,7 +491,7 @@ public void testSpecialSpaceKeys() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {HTMLUNIT, IPHONE, ANDROID, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, IPHONE, ANDROID, MARIONETTE, QTWEBKIT},
           reason = "untested user agents")
   @Test
   public void testNumberpadKeys() {
@@ -597,7 +598,7 @@ public void testChordReveseShiftHomeSelectionDeletes() {
   // and linux, but not on the MAC.
 
   @JavascriptEnabled
-  @Ignore(value = {HTMLUNIT, ANDROID, OPERA, OPERA_MOBILE, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, ANDROID, OPERA, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
           reason = "untested user agents")
   @Test
   public void testChordControlCutAndPaste() {
@@ -673,7 +674,7 @@ public void testShouldNotTypeIntoElementsThatPreventKeyDownEvents() {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {ANDROID, IPHONE, PHANTOMJS, MARIONETTE, HTMLUNIT},
+  @Ignore(value = {ANDROID, IE, IPHONE, SAFARI, OPERA, OPERA_MOBILE, PHANTOMJS, MARIONETTE, QTWEBKIT},
           reason = "HtmlUnit: failure, others: not tested")
   @Test
   public void testGenerateKeyPressEventEvenWhenElementPreventsDefault() {
diff --git a/java/client/test/org/openqa/selenium/UnexpectedAlertBehaviorTest.java b/java/client/test/org/openqa/selenium/UnexpectedAlertBehaviorTest.java
index 1b5ed1b5..ad73a960 100644
--- a/java/client/test/org/openqa/selenium/UnexpectedAlertBehaviorTest.java
+++ b/java/client/test/org/openqa/selenium/UnexpectedAlertBehaviorTest.java
@@ -31,6 +31,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.After;
 import org.junit.Test;
@@ -43,7 +44,8 @@
 import org.openqa.selenium.testing.drivers.WebDriverBuilder;
 
 @NeedsLocalEnvironment(reason = "Requires local browser launching environment")
-@Ignore(value = {ANDROID, CHROME, HTMLUNIT, IPHONE, OPERA, PHANTOMJS, SAFARI, OPERA_MOBILE, MARIONETTE},
+//Not supported in chromedriver, so not supported in qtwebkit
+@Ignore(value = {ANDROID, CHROME, HTMLUNIT, IPHONE, OPERA, PHANTOMJS, SAFARI, OPERA_MOBILE, MARIONETTE, QTWEBKIT},
         issues = {3862})
 public class UnexpectedAlertBehaviorTest extends JUnit4TestBase {
 
diff --git a/java/client/test/org/openqa/selenium/UploadTest.java b/java/client/test/org/openqa/selenium/UploadTest.java
index b72f1c85..60dfac1f 100644
--- a/java/client/test/org/openqa/selenium/UploadTest.java
+++ b/java/client/test/org/openqa/selenium/UploadTest.java
@@ -25,6 +25,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 
 import com.google.common.base.Charsets;
@@ -57,7 +58,7 @@ public void setUp() throws Exception {
   }
 
   @JavascriptEnabled
-  @Ignore(value = {OPERA, OPERA_MOBILE},
+  @Ignore(value = {OPERA, OPERA_MOBILE, QTWEBKIT},
           reason = "Opera/Opera Mobile: File input elements are not supported yet")
   @Test
   public void testFileUploading() throws Exception {
diff --git a/java/client/test/org/openqa/selenium/WindowSwitchingTest.java b/java/client/test/org/openqa/selenium/WindowSwitchingTest.java
index 2d409439..409484f6 100644
--- a/java/client/test/org/openqa/selenium/WindowSwitchingTest.java
+++ b/java/client/test/org/openqa/selenium/WindowSwitchingTest.java
@@ -34,6 +34,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import com.google.common.collect.Sets;
 
@@ -94,7 +95,7 @@ public void testShouldThrowNoSuchWindowException() {
     driver.switchTo().window(current);
   }
 
-  @Ignore({OPERA, OPERA_MOBILE, MARIONETTE})
+  @Ignore({OPERA, OPERA_MOBILE, MARIONETTE, QTWEBKIT})
   @Test
   public void testShouldThrowNoSuchWindowExceptionOnAnAttemptToGetItsHandle() {
     driver.get(pages.xhtmlTestPage);
diff --git a/java/client/test/org/openqa/selenium/build.desc b/java/client/test/org/openqa/selenium/build.desc
index cfdcadf6..88039ff0 100644
--- a/java/client/test/org/openqa/selenium/build.desc
+++ b/java/client/test/org/openqa/selenium/build.desc
@@ -23,7 +23,6 @@ java_library(name = "base",
     "NeedsDriver.java",
     "NeedsFreshDriver.java",
     "NoDriverAfterTest.java",
-    "Pages.java",
     "ParallelTestRunner.java",
     "StubDriver.java",
     "StubElement.java",
diff --git a/java/client/test/org/openqa/selenium/chrome/ChromeOptionsFunctionalTest.java b/java/client/test/org/openqa/selenium/chrome/ChromeOptionsFunctionalTest.java
index e6fea011..7e854b0f 100644
--- a/java/client/test/org/openqa/selenium/chrome/ChromeOptionsFunctionalTest.java
+++ b/java/client/test/org/openqa/selenium/chrome/ChromeOptionsFunctionalTest.java
@@ -26,6 +26,9 @@
 import org.openqa.selenium.testing.JUnit4TestBase;
 import org.openqa.selenium.testing.NeedsLocalEnvironment;
 
+import org.openqa.selenium.testing.Ignore;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
 /**
  * Functional tests for {@link ChromeOptions}.
  */
diff --git a/java/client/test/org/openqa/selenium/environment/InProcessTestEnvironment.java b/java/client/test/org/openqa/selenium/environment/InProcessTestEnvironment.java
index 92de24f7..17d6cbc6 100644
--- a/java/client/test/org/openqa/selenium/environment/InProcessTestEnvironment.java
+++ b/java/client/test/org/openqa/selenium/environment/InProcessTestEnvironment.java
@@ -23,16 +23,28 @@
 public class InProcessTestEnvironment implements TestEnvironment {
 
   private AppServer appServer;
+  private Pages pages;
+  private StatisticCommands statisticCommands = new StatisticCommands();
 
   public InProcessTestEnvironment() {
     appServer = new Jetty7AppServer();
     appServer.start();
+
+    pages = new Pages(appServer);
   }
 
   public AppServer getAppServer() {
     return appServer;
   }
 
+  public Pages getTestContent() {
+    return pages;
+  }
+
+  public void setTestContent(Pages p) {
+      pages = p;
+  }
+
   public void stop() {
     appServer.stop();
   }
@@ -40,4 +52,12 @@ public void stop() {
   public static void main(String[] args) {
     new InProcessTestEnvironment();
   }
+
+  public void addTestToCommand(String command, String url, String method,  String[] test) {
+    statisticCommands.addCommand(command, url, method, test);
+  }
+
+  public StatisticCommands getStatisticCommands() {
+    return statisticCommands;
+  }
 }
diff --git a/java/client/test/org/openqa/selenium/Pages.java b/java/client/test/org/openqa/selenium/environment/Pages.java
similarity index 83%
rename from java/client/test/org/openqa/selenium/Pages.java
rename to java/client/test/org/openqa/selenium/environment/Pages.java
index 9948c620..49297347 100644
--- a/java/client/test/org/openqa/selenium/Pages.java
+++ b/java/client/test/org/openqa/selenium/environment/Pages.java
@@ -14,7 +14,7 @@
 limitations under the License.
  */
 
-package org.openqa.selenium;
+package org.openqa.selenium.environment;
 
 import org.openqa.selenium.environment.webserver.AppServer;
 
@@ -74,8 +74,34 @@ public class Pages {
   public String uploadPage;
   public String userDefinedProperty;
   public String veryLargeCanvas;
+  public String visualizerPage;
   public String xhtmlFormPage;
   public String xhtmlTestPage;
+  public String html5VideoTest;
+  public String html5AudioTest;
+  public String pinchTouchTest;
+  public String webdriverjsKeypressPage;
+
+  public String notExist;
+
+  // native pages
+  public String windowTest;
+  public String findingTest;
+  public String clickTest;
+  public String coordinatesTest;
+  public String elementAttributeTest;
+  public String typingTest;
+  public String formHandlingTest;
+  public String xpathElementFindingTest;
+  public String staleElementReferenceTest;
+  public String visibilityTest;
+  public String javascriptTest;
+  public String basicKeyboardInterfaceTest;
+  public String basicMouseInterfaceTest;
+  public String videoTest;
+  public String touchTest;
+  public String touchScrollTest;
+  public String multiTouchTest;
 
   public Pages(AppServer appServer) {
     ajaxyPage = appServer.whereIs("ajaxy_page.html");
@@ -134,6 +160,12 @@ public Pages(AppServer appServer) {
     uploadPage = appServer.whereIs("upload.html");
     userDefinedProperty = appServer.whereIs("userDefinedProperty.html");
     veryLargeCanvas = appServer.whereIs("veryLargeCanvas.html");
+    visualizerPage = appServer.whereIs("visualizer.html");
     xhtmlTestPage = appServer.whereIs("xhtmlTest.html");
+    notExist = appServer.whereIs("temp.txt");
+    html5VideoTest = appServer.whereIs("HTML5_Video_Test.html");
+    html5AudioTest = appServer.whereIs("HTML5_Audio_Test.html");
+    pinchTouchTest = appServer.whereIs("pinch.html");
+    webdriverjsKeypressPage = appServer.whereIs("webdriverjs/keypress.html");
   }
 }
diff --git a/java/client/test/org/openqa/selenium/environment/StatisticCommands.java b/java/client/test/org/openqa/selenium/environment/StatisticCommands.java
new file mode 100644
index 00000000..7839f2b4
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/environment/StatisticCommands.java
@@ -0,0 +1,178 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.environment;
+
+import org.w3c.dom.Document;
+import org.w3c.dom.Element;
+import org.w3c.dom.ProcessingInstruction;
+
+import java.io.File;
+import java.io.FileNotFoundException;
+import java.io.FileOutputStream;
+import java.io.IOException;
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.Iterator;
+
+import javax.xml.parsers.DocumentBuilderFactory;
+import javax.xml.transform.OutputKeys;
+import javax.xml.transform.Transformer;
+import javax.xml.transform.TransformerConfigurationException;
+import javax.xml.transform.TransformerException;
+import javax.xml.transform.TransformerFactory;
+import javax.xml.transform.dom.DOMSource;
+import javax.xml.transform.stream.StreamResult;
+
+public class StatisticCommands {
+
+  private HashMap<String, CommandData> executedCommandMap;
+
+  public StatisticCommands() {
+    executedCommandMap = new HashMap<String, CommandData>();
+  }
+
+  public void addCommand(String commandName, String url, String method, String[] test) {
+    if (!executedCommandMap.containsKey(commandName)) {
+      executedCommandMap.put(commandName, new CommandData(commandName, url, method, test));
+    } else {
+      CommandData data = executedCommandMap.get(commandName);
+      if (!data.getTestCases().contains(test)) {
+          data.addTestCases(test);
+        }
+    }
+  }
+
+  public void writeToXml(String testsName) {
+    try {
+      File outFile = new File("build/test_logs/" + testsName + "_CommandReport.xml");
+      outFile.mkdirs();
+      if (outFile.exists()) {
+        outFile.delete();
+      }
+
+      if (outFile.createNewFile()) {
+        FileOutputStream outStream = new FileOutputStream(outFile);
+
+        Transformer transformer = TransformerFactory.newInstance().newTransformer();
+        transformer.setOutputProperty(OutputKeys.INDENT, "yes");
+        transformer.transform(new DOMSource(generateXmlReport()), new StreamResult(outStream));
+        outStream.flush();
+        outStream.close();
+      }
+    } catch (FileNotFoundException ex) {
+      System.out.println(ex.getMessage());
+      ex.printStackTrace();
+    } catch (IOException ex) {
+      System.out.println(ex.getMessage());
+      ex.printStackTrace();
+    } catch (TransformerConfigurationException ex) {
+      System.out.println(ex.getMessage());
+      ex.printStackTrace();
+    } catch (TransformerException ex) {
+      System.out.println(ex.getMessage());
+      ex.printStackTrace();
+    }
+  }
+
+
+  private Document generateXmlReport() {
+    try {
+      Document finalReport = DocumentBuilderFactory.newInstance().newDocumentBuilder().newDocument();
+
+      String props = "type=\"text/xsl\" href=\"" + "transform.xsl" + "\"";
+      ProcessingInstruction
+          instruction = finalReport.createProcessingInstruction("xml-stylesheet", props);
+      finalReport.appendChild(instruction);
+
+      Element tableElement = finalReport.createElement("table");
+      finalReport.appendChild(tableElement);
+
+      Iterator it = executedCommandMap.keySet().iterator();
+
+      // process all commands
+      while (it.hasNext()) {
+        String key = (String) it.next();
+        CommandData commandData = executedCommandMap.get(key);
+        Element command = finalReport.createElement("command");
+        command.setAttribute("name", key);
+        command.setAttribute("path", commandData.getUrl());
+        command.setAttribute("method", commandData.getMethod());
+
+        Element tests = finalReport.createElement("tests");
+        // add tests
+        for (String[] testInfo : commandData.getTestCases()) {
+          Element test = finalReport.createElement("testcase");
+          test.setAttribute("classname", testInfo[0]);
+          test.setAttribute("name", testInfo[1]);
+          tests.appendChild(test);
+        }
+        command.appendChild(tests);
+        tableElement.appendChild(command);
+
+      } // while (it.hasNext())
+
+      return finalReport;
+
+    } catch (Exception ex) {
+      ex.printStackTrace();
+      return null;
+    }
+  }
+
+  public HashMap<String, CommandData> getExecutedCommand() {
+    return executedCommandMap;
+  }
+
+  class CommandData {
+
+    String commandName;
+    String url;
+    String method;
+    ArrayList<String[]> testCases;
+
+    CommandData(String commandName, String url, String method, String[] test) {
+      this.commandName = commandName;
+      this.url = url;
+      this.method = method;
+      this.testCases = new ArrayList<String[]>();
+      testCases.add(test);
+    }
+
+    void addTestCases(String[] test) {
+      testCases.add(test);
+    }
+
+    String getUrl() {
+      return url;
+    }
+
+    String getMethod() {
+      return method;
+    }
+
+    ArrayList<String[]> getTestCases() {
+      return testCases;
+    }
+
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/environment/webserver/Jetty7AppServer.java b/java/client/test/org/openqa/selenium/environment/webserver/Jetty7AppServer.java
index 8ac8bdfa..4b7de90c 100644
--- a/java/client/test/org/openqa/selenium/environment/webserver/Jetty7AppServer.java
+++ b/java/client/test/org/openqa/selenium/environment/webserver/Jetty7AppServer.java
@@ -242,6 +242,7 @@ protected ServletContextHandler addResourceHandler(String contextPath, File reso
     context.setContextPath(contextPath);
     context.setResourceBase(resourceBase.getAbsolutePath());
     context.setAliases(true);
+    context.getMimeTypes().addMimeMapping("qml", "text/x-qml");
     context.addServlet(new ServletHolder(new DefaultServlet()), "/*");
 
     handlers.addHandler(context);
diff --git a/java/client/test/org/openqa/selenium/html5/AppCacheTest.java b/java/client/test/org/openqa/selenium/html5/AppCacheTest.java
index a3d6fa99..16870270 100644
--- a/java/client/test/org/openqa/selenium/html5/AppCacheTest.java
+++ b/java/client/test/org/openqa/selenium/html5/AppCacheTest.java
@@ -33,7 +33,7 @@ public void checkIsApplicationCache() {
 
   @Test
   public void testAppCacheStatus() {
-    driver.get(pages.html5Page);
+    driver.get("http://www.google.com");
     driver.manage().timeouts().implicitlyWait(2000, MILLISECONDS);
 
     AppCacheStatus status = ((ApplicationCache) driver).getStatus();
diff --git a/java/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java b/java/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java
index 59bd3dc4..9b067713 100644
--- a/java/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/BasicKeyboardInterfaceTest.java
@@ -27,6 +27,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.MARIONETTE;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 
 import static org.hamcrest.Matchers.is;
@@ -118,7 +119,7 @@ public void testSendingKeyUp() {
   }
 
   @JavascriptEnabled
-  @Ignore({ANDROID, HTMLUNIT, IPHONE, IE, OPERA, OPERA_MOBILE})
+  @Ignore({ANDROID, HTMLUNIT, IPHONE, IE, OPERA, OPERA_MOBILE, QTWEBKIT})
   @Test
   public void testSendingKeysWithShiftPressed() {
     driver.get(pages.javascriptPage);
diff --git a/java/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java b/java/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java
index 3924d8e2..e1c9209f 100644
--- a/java/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/BasicMouseInterfaceTest.java
@@ -38,6 +38,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox30;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox35;
@@ -263,7 +264,7 @@ public void testCannotMoveToANullLocator() {
   }
 
   @JavascriptEnabled
-  @Ignore({ANDROID, CHROME, IE, IPHONE, FIREFOX, OPERA, HTMLUNIT, OPERA_MOBILE})
+  @Ignore({ANDROID, CHROME, IE, IPHONE, FIREFOX, OPERA, HTMLUNIT, OPERA_MOBILE, QTWEBKIT})
   @Test
   public void testMousePositionIsNotPreservedInActionsChain() {
     driver.get(pages.javascriptPage);
@@ -281,7 +282,7 @@ public void testMousePositionIsNotPreservedInActionsChain() {
     }
   }
 
-  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, REMOTE, OPERA},
+  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, REMOTE, OPERA, QTWEBKIT},
           reason = "Behaviour not finalized yet regarding linked images.")
   @Test
   public void testMovingIntoAnImageEnclosedInALink() {
@@ -324,7 +325,7 @@ private int getFieldValue(Map<String, Object> sizeRect, String fieldName) {
     return (int) Double.parseDouble(sizeRect.get(fieldName).toString());
   }
 
-  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, CHROME},
+  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, CHROME, QTWEBKIT},
           reason = "Not implemented yet.")
   @Test
   public void testMovingMousePastViewPort() {
@@ -360,7 +361,7 @@ public void testMovingMousePastViewPort() {
     wait.until(elementTextToContain(resultArea, "parent matches"));
   }
 
-  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, CHROME, OPERA, OPERA_MOBILE},
+  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, CHROME, OPERA, OPERA_MOBILE, QTWEBKIT},
           reason = "Not implemented yet.")
   @Test
   public void testMovingMouseBackAndForthPastViewPort() {
@@ -408,6 +409,7 @@ public void testShouldClickElementInIFrame() {
   }
 
   @JavascriptEnabled
+  @NeedsFreshDriver
   @Ignore(
       value = {HTMLUNIT, IPHONE,  OPERA, SAFARI, MARIONETTE},
       reason = "HtmlUnit: Advanced mouse actions only implemented in rendered browsers.",
@@ -567,7 +569,7 @@ public void testMovingMouseToRelativeZeroElementOffset() {
 
   @JavascriptEnabled
   @NeedsFreshDriver
-  @Ignore(value = {HTMLUNIT, OPERA, SAFARI, MARIONETTE},
+  @Ignore(value = {HTMLUNIT, OPERA, SAFARI, MARIONETTE, QTWEBKIT},
           reason = "Advanced mouse actions only implemented in rendered browsers",
           issues = {4136})
   @Test
diff --git a/java/client/test/org/openqa/selenium/interactions/CombinedInputActionsTest.java b/java/client/test/org/openqa/selenium/interactions/CombinedInputActionsTest.java
index b2726ad4..f2a0f482 100644
--- a/java/client/test/org/openqa/selenium/interactions/CombinedInputActionsTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/CombinedInputActionsTest.java
@@ -35,6 +35,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.TestUtilities.getEffectivePlatform;
 import static org.openqa.selenium.testing.TestUtilities.getIEVersion;
 import static org.openqa.selenium.testing.TestUtilities.isFirefox;
@@ -60,7 +61,7 @@
 /**
  * Tests combined input actions.
  */
-@Ignore(value = {ANDROID, SAFARI, MARIONETTE},
+@Ignore(value = {ANDROID, SAFARI, MARIONETTE, QTWEBKIT},
     reason = "Safari: not implemented (issue 4136)",
     issues = {4136})
 public class CombinedInputActionsTest extends JUnit4TestBase {
diff --git a/java/client/test/org/openqa/selenium/interactions/DragAndDropTest.java b/java/client/test/org/openqa/selenium/interactions/DragAndDropTest.java
index 83433da5..2c5dc6f1 100644
--- a/java/client/test/org/openqa/selenium/interactions/DragAndDropTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/DragAndDropTest.java
@@ -34,6 +34,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.Test;
 import org.openqa.selenium.By;
@@ -152,7 +153,7 @@ public void testElementInDiv() {
   }
 
   @JavascriptEnabled
-  @Ignore({CHROME, IE, OPERA, PHANTOMJS})
+  @Ignore({CHROME, IE, OPERA, PHANTOMJS, QTWEBKIT})
   @Test
   public void testDragTooFar() {
     assumeTrue(TestUtilities.isNativeEventsEnabled(driver));
diff --git a/java/client/test/org/openqa/selenium/interactions/touch/TouchDoubleTapTest.java b/java/client/test/org/openqa/selenium/interactions/touch/TouchDoubleTapTest.java
index 79f06130..49ced7bf 100644
--- a/java/client/test/org/openqa/selenium/interactions/touch/TouchDoubleTapTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/touch/TouchDoubleTapTest.java
@@ -24,10 +24,13 @@
 import org.openqa.selenium.WebElement;
 import org.openqa.selenium.interactions.Action;
 import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.testing.Ignore;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 /**
  * Tests the basic double tap operations.
  */
+@Ignore (QTWEBKIT)
 public class TouchDoubleTapTest extends TouchTestBase {
 
   private TouchActions getBuilder(WebDriver driver) {
diff --git a/java/client/test/org/openqa/selenium/interactions/touch/TouchFlickTest.java b/java/client/test/org/openqa/selenium/interactions/touch/TouchFlickTest.java
index 6b135e40..f56344b2 100644
--- a/java/client/test/org/openqa/selenium/interactions/touch/TouchFlickTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/touch/TouchFlickTest.java
@@ -18,17 +18,12 @@
 package org.openqa.selenium.interactions.touch;
 
 import org.junit.Test;
-import org.openqa.selenium.By;
-import org.openqa.selenium.NeedsFreshDriver;
-import org.openqa.selenium.WebDriver;
-import org.openqa.selenium.WebElement;
+import org.openqa.selenium.*;
 import org.openqa.selenium.interactions.Action;
 import org.openqa.selenium.testing.Ignore;
 
 import static org.junit.Assert.assertTrue;
-import static org.openqa.selenium.testing.Ignore.Driver.ANDROID;
-import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
-import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
 
 /**
  * Tests the basic flick operations on touch enabled devices.
diff --git a/java/client/test/org/openqa/selenium/interactions/touch/TouchScrollTest.java b/java/client/test/org/openqa/selenium/interactions/touch/TouchScrollTest.java
index 2de8b5de..8e75c9a9 100644
--- a/java/client/test/org/openqa/selenium/interactions/touch/TouchScrollTest.java
+++ b/java/client/test/org/openqa/selenium/interactions/touch/TouchScrollTest.java
@@ -18,16 +18,14 @@
 package org.openqa.selenium.interactions.touch;
 
 import org.junit.Test;
-import org.openqa.selenium.By;
-import org.openqa.selenium.NeedsFreshDriver;
-import org.openqa.selenium.WebDriver;
-import org.openqa.selenium.WebElement;
+import org.openqa.selenium.*;
 import org.openqa.selenium.interactions.Action;
 import org.openqa.selenium.testing.Ignore;
 
 import static org.junit.Assert.assertTrue;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 /**
  * Tests the basic scroll operations on touch enabled devices..
@@ -51,12 +49,13 @@ public void testCanScrollVerticallyFromWebElement() {
     assertTrue("Expected y > 4200, but got y = " + y, y > 4200);
 
     WebElement toScroll = driver.findElement(By.id("imagestart"));
-    Action scroll = getBuilder(driver).scroll(toScroll, 0, -800).build();
+    Action scroll = getBuilder(driver).scroll(toScroll, 0, -1000).build();
     scroll.perform();
 
     y = link.getLocation().y;
+    y = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollTop")).intValue();
     // After scrolling, the location of the element should change accordingly.
-    assertTrue("Expected y < 3500, but got y = " + y, y < 3500);
+    assertTrue("Expected y < 3500, but got y = " + y, y == 800);
   }
 
   @NeedsFreshDriver
@@ -75,6 +74,7 @@ public void testCanScrollHorizontallyFromWebElement() {
     scroll.perform();
 
     x = link.getLocation().x;
+    x = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollLeft")).intValue();
     // After scrolling, the location of the element should change accordingly.
     assertTrue("Expected x < 1500, but got x = " + x, x < 1500);
   }
@@ -116,5 +116,4 @@ public void testCanScrollHorizontally() {
     // After scrolling, the location of the element should change accordingly.
     assertTrue("Expected x < 1500, but got x = " + x, x < 1500);
   }
-
 }
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/interactions/touch/TouchTests.java b/java/client/test/org/openqa/selenium/interactions/touch/TouchTests.java
index 3ced511e..cb6ae1a2 100644
--- a/java/client/test/org/openqa/selenium/interactions/touch/TouchTests.java
+++ b/java/client/test/org/openqa/selenium/interactions/touch/TouchTests.java
@@ -18,11 +18,13 @@
 
 import org.junit.runner.RunWith;
 import org.junit.runners.Suite;
+import org.junit.AfterClass;
 import org.openqa.selenium.interactions.touch.TouchDoubleTapTest;
 import org.openqa.selenium.interactions.touch.TouchFlickTest;
 import org.openqa.selenium.interactions.touch.TouchLongPressTest;
 import org.openqa.selenium.interactions.touch.TouchScrollTest;
 import org.openqa.selenium.interactions.touch.TouchSingleTapTest;
+import org.openqa.selenium.testing.JUnit4TestBase;
 
 @RunWith(Suite.class)
 @Suite.SuiteClasses({
@@ -33,4 +35,9 @@
     TouchSingleTapTest.class
 })
 public class TouchTests {
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
 }
+
diff --git a/java/client/test/org/openqa/selenium/logging/AvailableLogsTest.java b/java/client/test/org/openqa/selenium/logging/AvailableLogsTest.java
index e2efc698..615c74ec 100644
--- a/java/client/test/org/openqa/selenium/logging/AvailableLogsTest.java
+++ b/java/client/test/org/openqa/selenium/logging/AvailableLogsTest.java
@@ -44,6 +44,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 @Ignore({ANDROID, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, MARIONETTE})
 public class AvailableLogsTest extends JUnit4TestBase {
@@ -96,6 +97,7 @@ public void driverLogShouldBeEnabledByDefault() {
   }
 
   @Test
+  @Ignore({QTWEBKIT})
   public void profilerLogShouldBeDisabledByDefault() {
     assumeFalse(isOldChromedriver(driver));
     Set<String> logTypes = driver.manage().logs().getAvailableLogTypes();
@@ -104,7 +106,7 @@ public void profilerLogShouldBeDisabledByDefault() {
   }
 
   @Test
-  @Ignore(value = {SAFARI}, reason = "Safari does not support profiler logs")
+  @Ignore(value = {SAFARI, QTWEBKIT}, reason = "Safari does not support profiler logs")
   public void shouldBeAbleToEnableProfilerLog() {
     assumeFalse(isOldChromedriver(driver));
     DesiredCapabilities caps = new DesiredCapabilities();
diff --git a/java/client/test/org/openqa/selenium/logging/GetLogsTest.java b/java/client/test/org/openqa/selenium/logging/GetLogsTest.java
index a7972cd8..f1fcb601 100644
--- a/java/client/test/org/openqa/selenium/logging/GetLogsTest.java
+++ b/java/client/test/org/openqa/selenium/logging/GetLogsTest.java
@@ -29,6 +29,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.After;
 import org.junit.Test;
@@ -98,6 +99,7 @@ public void differentLogsShouldNotContainTheSameLogEntries() {
 
   @Test
   @NeedsLocalEnvironment
+  @Ignore(QTWEBKIT)
   public void turningOffLogShouldMeanNoLogMessages() {
     assumeFalse(TestUtilities.isOldChromedriver(driver));  // Only chromedriver2 supports logging.
     Set<String> logTypes = driver.manage().logs().getAvailableLogTypes();
diff --git a/java/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java b/java/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java
index 604ec0b5..47f10a0d 100644
--- a/java/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java
+++ b/java/client/test/org/openqa/selenium/logging/PerformanceLoggingTest.java
@@ -34,6 +34,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import org.junit.After;
 import org.junit.Test;
@@ -41,6 +42,7 @@
 import org.openqa.selenium.By;
 import org.openqa.selenium.WebDriver;
 import org.openqa.selenium.logging.profiler.EventType;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
 import org.openqa.selenium.remote.DesiredCapabilities;
 import org.openqa.selenium.testing.Ignore;
 import org.openqa.selenium.testing.JUnit4TestBase;
@@ -53,7 +55,7 @@
 
 import java.util.Arrays;
 
-@Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE})
+@Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, PHANTOMJS, SAFARI, MARIONETTE, QTWEBKIT})
 public class PerformanceLoggingTest extends JUnit4TestBase {
 
   private WebDriver localDriver;
@@ -155,4 +157,4 @@ public void testPriorityForProfilerCapability() {
     assertEquals("Start up should render four profiling entries", 4,
         getProfilerEntriesOfType(getProfilerEntries(localDriver), EventType.HTTP_COMMAND).size());
   }
-}
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/GraphicsWebSanityTest.java b/java/client/test/org/openqa/selenium/qtwebkit/GraphicsWebSanityTest.java
new file mode 100644
index 00000000..de1b46ea
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/GraphicsWebSanityTest.java
@@ -0,0 +1,738 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.junit.AfterClass;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.MoveTargetOutOfBoundsException;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.List;
+import java.util.Set;
+import java.util.logging.Logger;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.junit.After;
+import org.openqa.selenium.testing.JavascriptEnabled;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.Browser;
+
+import static org.hamcrest.Matchers.anyOf;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.lessThanOrEqualTo;
+import static org.hamcrest.Matchers.nullValue;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.junit.Assume.assumeFalse;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class GraphicsWebSanityTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(
+        org.openqa.selenium.qtwebkit.GraphicsWebSanityTest.class.getName());
+
+    @Before
+    public void setUp() {
+        driver.get("qtwidget://GraphicsWebViewTestWindows");
+        currentWindow = driver.getWindowHandle();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                break;
+            }
+        }
+        assertTrue(!currentWindow.equals(driver.getWindowHandle()));
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @After
+    public void clean() {
+        driver.switchTo().window(currentWindow);
+        assertTrue(currentWindow.equals(driver.getWindowHandle()));
+    }
+
+    @Test
+    public void testEmbeddedWebViewEnumerated() {
+        Set<String> allWindowHandles = driver.getWindowHandles();
+        assertEquals(2, allWindowHandles.size());
+
+        for (String handle : allWindowHandles) {
+            driver.switchTo().window(handle);
+        }
+    }
+
+    @Test
+    public void testCanClickOnALinkAndFollowIt() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("normal")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatOverflowsAndFollowIt() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("overflowLink")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatUpdatesAnotherFrame() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        driver.findElement(By.id("otherframe")).click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        wait.until(WaitingConditions.pageSourceToContain("Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testElementsFoundByJsCanLoadUpdatesInAnotherFrame() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        WebElement toClick = (WebElement) ((JavascriptExecutor) driver).executeScript(
+            "return document.getElementById('otherframe');"
+        );
+        toClick.click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        assertTrue("Target did not reload",
+                   driver.getPageSource().contains("Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testJsLocatedElementsCanUpdateFramesIfFoundSomehowElse() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        // Prime the cache of elements
+        driver.findElement(By.id("otherframe"));
+
+        // This _should_ return the same element
+        WebElement toClick = (WebElement) ((JavascriptExecutor) driver).executeScript(
+            "return document.getElementById('otherframe');"
+        );
+        toClick.click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        assertTrue("Target did not reload",
+                   driver.getPageSource().contains("Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testCanClickOnAnElementWithTopSetToANegativeNumber() {
+        String page = appServer.whereIs("styledPage.html");
+        driver.get(page);
+        WebElement searchBox = driver.findElement(By.name("searchBox"));
+        searchBox.sendKeys("Cheese");
+        driver.findElement(By.name("btn")).click();
+
+        String log = driver.findElement(By.id("log")).getText();
+        assertEquals("click", log);
+    }
+
+    @Test
+    public void testShouldClickOnFirstBoundingClientRectWithNonZeroSize() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("twoClientRects")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testClickingLabelShouldSetCheckbox() {
+        driver.get(pages.formPage);
+
+        driver.findElement(By.id("label-for-checkbox-with-label")).click();
+
+        assertTrue(
+            "Should be selected",
+            driver.findElement(By.id("checkbox-with-label")).isSelected());
+    }
+
+    @Test
+    public void testCanClickOnALinkWithEnclosedImage() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-image")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnAnImageEnclosedInALink() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-image")).findElement(By.tagName("img"))
+            .click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatContainsTextWrappedInASpan() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-span")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatContainsEmbeddedBlockElements() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("embeddedBlock")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnAnElementEnclosedInALink() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-span")).findElement(By.tagName("span"))
+            .click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    // See http://code.google.com/p/selenium/issues/attachmentText?id=2700
+    @Test
+    public void testShouldBeAbleToClickOnAnElementInTheViewport() {
+        String url = appServer.whereIs("click_out_of_bounds.html");
+
+        driver.get(url);
+        WebElement button = driver.findElement(By.id("button"));
+
+        try {
+            button.click();
+        } catch (MoveTargetOutOfBoundsException e) {
+            fail("Should not be out of bounds: " + e.getMessage());
+        }
+    }
+
+    @Test
+    public void testClicksASurroundingStrongTag() {
+        driver.get(appServer.whereIs("ClickTest_testClicksASurroundingStrongTag.html"));
+        driver.findElement(By.tagName("a")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClickOnAnElementGreaterThanTwoViewports() {
+        String url = appServer.whereIs("click_too_big.html");
+        driver.get(url);
+
+        WebElement element = driver.findElement(By.id("click"));
+
+        element.click();
+
+        wait.until(titleIs("clicks"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClickOnAnElementInFrameGreaterThanTwoViewports() {
+        String url = appServer.whereIs("click_too_big_in_frame.html");
+        driver.get(url);
+
+        WebElement frame = driver.findElement(By.id("iframe1"));
+        driver.switchTo().frame(frame);
+
+        WebElement element = driver.findElement(By.id("click"));
+        element.click();
+
+        wait.until(titleIs("clicks"));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInViewPort() {
+        driver.get(appServer.whereIs("coordinates_tests/simple_page.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnEmptyElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_empty_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfATransparentElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_transparent_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAHiddenElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_hidden_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnInvisibleElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_invisible_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(0, 0)));
+    }
+
+    @Test
+    public void testShouldScrollPageAndGetCoordinatesOfAnElementThatIsOutOfViewPort() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_element_out_of_view.html"));
+        int windowHeight = driver.manage().window().getSize().getHeight();
+        Point location = getLocationInViewPort(By.id("box"));
+        assertThat(location.getX(), is(10));
+        assertThat(location.getY(), greaterThanOrEqualTo(0));
+        assertThat(location.getY(), lessThanOrEqualTo(windowHeight - 100));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInAFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_frame.html"));
+        driver.switchTo().frame("ifr");
+        WebElement box = driver.findElement(By.id("box"));
+        assertThat(box.getLocation(), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesInViewPortOfAnElementInAFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_frame.html"));
+        driver.switchTo().frame("ifr");
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(25, 25)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesInViewPortOfAnElementInANestedFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_nested_frame.html"));
+        driver.switchTo().frame("ifr");
+        driver.switchTo().frame("ifr");
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(40, 40)));
+    }
+
+    private Point getLocationInViewPort(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().inViewPort();
+    }
+
+    @Test
+    public void testShouldReturnNullWhenGettingTheValueOfAnAttributeThatIsNotListed() {
+        driver.get(pages.simpleTestPage);
+        WebElement head = driver.findElement(By.xpath("/html"));
+        String attribute = head.getAttribute("cheese");
+        assertThat(attribute, is(nullValue()));
+    }
+
+    @Test
+    public void testShouldReturnNullWhenGettingSrcAttributeOfInvalidImgTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("invalidImgTag"));
+        String attribute = img.getAttribute("src");
+        assertThat(attribute, is(nullValue()));
+    }
+
+    @Test
+    public void testShouldReturnAnAbsoluteUrlWhenGettingSrcAttributeOfAValidImgTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("validImgTag"));
+        String attribute = img.getAttribute("src");
+        assertThat(attribute, equalTo(appServer.whereIs("icon.gif")));
+    }
+
+    @Test
+    public void testShouldReturnAnAbsoluteUrlWhenGettingHrefAttributeOfAValidAnchorTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("validAnchorTag"));
+        String attribute = img.getAttribute("href");
+        assertThat(attribute, equalTo(appServer.whereIs("icon.gif")));
+    }
+
+    @Test
+    public void testShouldReturnEmptyAttributeValuesWhenPresentAndTheValueIsActuallyEmpty() {
+        driver.get(pages.simpleTestPage);
+        WebElement body = driver.findElement(By.xpath("//body"));
+        assertThat(body.getAttribute("style"), equalTo(""));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfTheDisabledAttributeAsNullIfNotSet() {
+        driver.get(pages.formPage);
+        WebElement inputElement = driver.findElement(By.xpath("//input[@id='working']"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), equalTo(true));
+
+        WebElement pElement = driver.findElement(By.id("peas"));
+        assertThat(pElement.getAttribute("disabled"), equalTo(null));
+        assertThat(pElement.isEnabled(), equalTo(true));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfTheIndexAttrbuteEvenIfItIsMissing() {
+        driver.get(pages.formPage);
+
+        WebElement multiSelect = driver.findElement(By.id("multi"));
+        List<WebElement> options = multiSelect.findElements(By.tagName("option"));
+        assertThat(options.get(1).getAttribute("index"), equalTo("1"));
+    }
+
+    @Test
+    public void testShouldIndicateTheElementsThatAreDisabledAreNotEnabled() {
+        driver.get(pages.formPage);
+        WebElement inputElement = driver.findElement(By.xpath("//input[@id='notWorking']"));
+        assertThat(inputElement.isEnabled(), is(false));
+
+        inputElement = driver.findElement(By.xpath("//input[@id='working']"));
+        assertThat(inputElement.isEnabled(), is(true));
+    }
+
+    @Test
+    public void testElementsShouldBeDisabledIfTheyAreDisabledUsingRandomDisabledStrings() {
+        driver.get(pages.formPage);
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement1"));
+        assertThat(disabledTextElement1.isEnabled(), is(false));
+
+        WebElement disabledTextElement2 = driver.findElement(By.id("disabledTextElement2"));
+        assertThat(disabledTextElement2.isEnabled(), is(false));
+
+        WebElement disabledSubmitElement = driver.findElement(By.id("disabledSubmitElement"));
+        assertThat(disabledSubmitElement.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldThrowExceptionIfSendingKeysToElementDisabledUsingRandomDisabledStrings() {
+        driver.get(pages.formPage);
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement1"));
+        try {
+            disabledTextElement1.sendKeys("foo");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            // Expected
+        }
+        assertThat(disabledTextElement1.getText(), is(""));
+
+        WebElement disabledTextElement2 = driver.findElement(By.id("disabledTextElement2"));
+        try {
+            disabledTextElement2.sendKeys("bar");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            // Expected
+        }
+        assertThat(disabledTextElement2.getText(), is(""));
+    }
+
+    @Test
+    public void testShouldIndicateWhenATextAreaIsDisabled() {
+        driver.get(pages.formPage);
+        WebElement textArea = driver.findElement(By.xpath("//textarea[@id='notWorkingArea']"));
+        assertThat(textArea.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldIndicateWhenASelectIsDisabled() {
+        driver.get(pages.formPage);
+
+        WebElement enabled = driver.findElement(By.name("selectomatic"));
+        WebElement disabled = driver.findElement(By.name("no-select"));
+
+        assertTrue(enabled.isEnabled());
+        assertFalse(disabled.isEnabled());
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfCheckedForACheckboxOnlyIfItIsChecked() {
+        driver.get(pages.formPage);
+        WebElement checkbox = driver.findElement(By.xpath("//input[@id='checky']"));
+        assertThat(checkbox.getAttribute("checked"), equalTo(null));
+        checkbox.click();
+        assertThat(checkbox.getAttribute("checked"), equalTo("true"));
+    }
+
+    @Test
+    public void testShouldOnlyReturnTheValueOfSelectedForRadioButtonsIfItIsSet() {
+        driver.get(pages.formPage);
+        WebElement neverSelected = driver.findElement(By.id("cheese"));
+        WebElement initiallyNotSelected = driver.findElement(By.id("peas"));
+        WebElement initiallySelected = driver.findElement(By.id("cheese_and_peas"));
+
+        assertThat(neverSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallyNotSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallySelected.getAttribute("selected"), equalTo("true"));
+
+        initiallyNotSelected.click();
+        assertThat(neverSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallyNotSelected.getAttribute("selected"), equalTo("true"));
+        assertThat(initiallySelected.getAttribute("selected"), equalTo(null));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfSelectedForOptionsOnlyIfTheyAreSelected() {
+        driver.get(pages.formPage);
+        WebElement selectBox = driver.findElement(By.xpath("//select[@name='selectomatic']"));
+        List<WebElement> options = selectBox.findElements(By.tagName("option"));
+        WebElement one = options.get(0);
+        WebElement two = options.get(1);
+        assertThat(one.isSelected(), is(true));
+        assertThat(two.isSelected(), is(false));
+        assertThat(one.getAttribute("selected"), equalTo("true"));
+        assertThat(two.getAttribute("selected"), equalTo(null));
+    }
+
+    @Test
+    public void testShouldReturnValueOfClassAttributeOfAnElement() {
+        driver.get(pages.xhtmlTestPage);
+
+        WebElement heading = driver.findElement(By.xpath("//h1"));
+        String className = heading.getAttribute("class");
+
+        assertThat(className, equalTo("header"));
+    }
+
+    @Test
+    public void testShouldReturnTheContentsOfATextAreaAsItsValue() {
+        driver.get(pages.formPage);
+
+        String value = driver.findElement(By.id("withText")).getAttribute("value");
+
+        assertThat(value, equalTo("Example text"));
+    }
+
+    @Test
+    public void testShouldTreatReadonlyAsAValue() {
+        driver.get(pages.formPage);
+
+        WebElement element = driver.findElement(By.name("readonly"));
+        String readonly = element.getAttribute("readonly");
+
+        assertNotNull(readonly);
+
+        WebElement textInput = driver.findElement(By.name("x"));
+        String notReadonly = textInput.getAttribute("readonly");
+
+        assertFalse(readonly.equals(notReadonly));
+    }
+
+    @Test
+    public void testShouldGetNumericAtribute() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("withText"));
+        assertThat(element.getAttribute("rows"), is("5"));
+    }
+
+    @Test
+    public void testCanReturnATextApproximationOfTheStyleAttribute() {
+        driver.get(pages.javascriptPage);
+
+        String style = driver.findElement(By.id("red-item")).getAttribute("style");
+
+        assertTrue(style.toLowerCase().contains("background-color"));
+    }
+
+    @Test
+    public void testShouldReturnValueOfOnClickAttribute() {
+        driver.get(pages.javascriptPage);
+
+        WebElement mouseclickDiv = driver.findElement(By.id("mouseclick"));
+
+        String onClickValue = mouseclickDiv.getAttribute("onclick");
+        String expectedOnClickValue = "displayMessage('mouse click');";
+        assertThat("Javascript code expected", onClickValue, anyOf(
+            equalTo("javascript:" + expectedOnClickValue), // Non-IE
+            equalTo("function anonymous()\n{\n" + expectedOnClickValue + "\n}"), // IE
+            equalTo("function onclick()\n{\n" + expectedOnClickValue + "\n}"))); // IE
+
+        WebElement mousedownDiv = driver.findElement(By.id("mousedown"));
+        assertEquals(null, mousedownDiv.getAttribute("onclick"));
+    }
+
+    @Test
+    public void testGetAttributeDoesNotReturnAnObjectForSvgProperties() {
+        driver.get(pages.svgPage);
+        WebElement svgElement = driver.findElement(By.id("rotate"));
+        assertEquals("rotate(30)", svgElement.getAttribute("transform"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_textInput() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("working"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello world");
+        assertEquals("hello world", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_emailInput() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("email"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello@example.com");
+        assertEquals("hello@example.com", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_textArea() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("emptyTextArea"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello world");
+        assertEquals("hello world", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testShouldReturnNullForNonPresentBooleanAttributes() {
+        driver.get(pages.booleanAttributes);
+        WebElement element1 = driver.findElement(By.id("working"));
+        assertNull(element1.getAttribute("required"));
+        WebElement element2 = driver.findElement(By.id("wallace"));
+        assertNull(element2.getAttribute("nowrap"));
+    }
+
+    private Actions getBuilder(WebDriver driver) {
+        return new Actions(driver);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testBasicKeyboardInput() {
+        driver.get(pages.javascriptPage);
+
+        WebElement keyReporter = driver.findElement(By.id("keyReporter"));
+
+        Action sendLowercase = getBuilder(driver).sendKeys(keyReporter, "abc def").build();
+
+        sendLowercase.perform();
+
+        assertThat(keyReporter.getAttribute("value"), is("abc def"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeyDownOnly() {
+        ignoreOnFfWindowsWithNativeEvents(); // Issue 3722
+
+        driver.get(pages.javascriptPage);
+
+        WebElement keysEventInput = driver.findElement(By.id("theworks"));
+
+        Action pressShift = getBuilder(driver).keyDown(keysEventInput, Keys.SHIFT).build();
+
+        pressShift.perform();
+
+        WebElement keyLoggingElement = driver.findElement(By.id("result"));
+        String logText = keyLoggingElement.getText();
+
+        Action releaseShift = getBuilder(driver).keyUp(keysEventInput, Keys.SHIFT).build();
+        releaseShift.perform();
+
+        assertTrue("Key down event not isolated, got: " + logText,
+                   logText.endsWith("keydown"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeyUp() {
+        ignoreOnFfWindowsWithNativeEvents(); // Issue 3722
+
+        driver.get(pages.javascriptPage);
+        WebElement keysEventInput = driver.findElement(By.id("theworks"));
+
+        Action pressShift = getBuilder(driver).keyDown(keysEventInput, Keys.SHIFT).build();
+        pressShift.perform();
+
+        WebElement keyLoggingElement = driver.findElement(By.id("result"));
+
+        String eventsText = keyLoggingElement.getText();
+        assertTrue("Key down should be isolated for this test to be meaningful. " +
+                   "Got events: " + eventsText, eventsText.endsWith("keydown"));
+
+        Action releaseShift = getBuilder(driver).keyUp(keysEventInput, Keys.SHIFT).build();
+
+        releaseShift.perform();
+
+        eventsText = keyLoggingElement.getText();
+        assertTrue("Key up event not isolated. Got events: " + eventsText,
+                   eventsText.endsWith("keyup"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeysToActiveElement() {
+        driver.get(pages.bodyTypingPage);
+
+        Action someKeys = getBuilder(driver).sendKeys("ab").build();
+        someKeys.perform();
+
+        assertThatBodyEventsFiredAreExactly("keypress keypress");
+        assertThatFormEventsFiredAreExactly("");
+    }
+
+    @Test
+    public void testBasicKeyboardInputOnActiveElement() {
+        driver.get(pages.javascriptPage);
+
+        WebElement keyReporter = driver.findElement(By.id("keyReporter"));
+
+        keyReporter.click();
+
+        Action sendLowercase = getBuilder(driver).sendKeys("abc def").build();
+
+        sendLowercase.perform();
+
+        assertThat(keyReporter.getAttribute("value"), is("abc def"));
+    }
+
+    private void assertThatFormEventsFiredAreExactly(String message, String expected) {
+        assertThat(message, getFormEvents(), is(expected.trim()));
+    }
+
+    private String getFormEvents() {
+        return driver.findElement(By.id("result")).getText().trim();
+    }
+
+    private void assertThatFormEventsFiredAreExactly(String expected) {
+        assertThatFormEventsFiredAreExactly("", expected);
+    }
+
+    private void assertThatBodyEventsFiredAreExactly(String expected) {
+        assertThat(driver.findElement(By.id("body_result")).getText().trim(), is(expected.trim()));
+    }
+
+    private void ignoreOnFfWindowsWithNativeEvents() {
+        assumeFalse(Browser.detect() == Browser.ff &&
+                    TestUtilities.getEffectivePlatform().is(Platform.WINDOWS) &&
+                    TestUtilities.isNativeEventsEnabled(driver));
+    }
+
+    private String currentWindow;
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/HTML5AudioTagTest.java b/java/client/test/org/openqa/selenium/qtwebkit/HTML5AudioTagTest.java
new file mode 100644
index 00000000..9276f71c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/HTML5AudioTagTest.java
@@ -0,0 +1,141 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+public class HTML5AudioTagTest extends JUnit4TestBase {
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.html5AudioTest);
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testRemotePlayerState() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setState(Player.PlayerState.playing);
+        Player.PlayerState state = player.getState();
+        assertEquals(Player.PlayerState.playing, state);
+        assertEquals(null, element.getAttribute("paused"));
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        state = player.getState();
+        assertEquals(Player.PlayerState.paused, state);
+        assertEquals("true", element.getAttribute("paused"));
+
+      // TODO HTML5 Audio is not seekable in Qt5.2.0. Issue MHA-905. Check it for next version.
+//        player.setState(Player.PlayerState.stopped);
+//        state = player.getState();
+//        assertEquals("true", element.getAttribute("paused"));
+//        assertEquals(Player.PlayerState.stopped, state);
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerSetMute() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setMute(true);
+        assertEquals("true", element.getAttribute("muted"));
+
+        player.setMute(false);
+        assertEquals(null, element.getAttribute("muted"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerGetMute() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        assertEquals(player.isMuted() ? "true" : null, element.getAttribute("muted"));
+        player.setMute(true);
+        assertEquals(player.isMuted() ? "true" : null, element.getAttribute("muted"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason = "HTML5 Audio isn't seekable: bug 38464, https://bugs.webkit.org/show_bug.cgi?id=38464; bug 37267, https://bugreports.qt-project.org/browse/QTBUG-37267#comment-234581")
+    public void testRemotePlayerSeek() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0.1);
+
+        player.setState(Player.PlayerState.playing);
+        assertNotEquals(player.getCurrentPlayingPosition(), 0);
+    }
+
+    @Test
+    public void testRemotePlayerVolume() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setVolume(0.5);
+        assertEquals(0.5, player.getVolume(), 0);
+        assertEquals("0.5", element.getAttribute("volume"));
+
+        player.setVolume(0);
+        assertEquals(0, player.getVolume(), 0);
+        assertEquals("0", element.getAttribute("volume"));
+
+        player.setVolume(1.0);
+        assertEquals(1.0, player.getVolume(), 0);
+        assertEquals("1", element.getAttribute("volume"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerVolumeAndMute() {
+        WebElement element = driver.findElement(By.id("audioPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setVolume(0.5);
+        player.setMute(true);
+        player.setMute(false);
+        assertEquals(0.5, player.getVolume(), 0.02);
+        assertEquals("0.5", element.getAttribute("volume"));
+    }
+
+    public Player getPlayer(RemoteWebElement element) {
+        return (Player) (new QtWebkitAugmenter().augment(element));
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/HTML5VideoTagTest.java b/java/client/test/org/openqa/selenium/qtwebkit/HTML5VideoTagTest.java
new file mode 100644
index 00000000..55cfa4fb
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/HTML5VideoTagTest.java
@@ -0,0 +1,184 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+public class HTML5VideoTagTest extends JUnit4TestBase {
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.html5VideoTest);
+        try {
+            Thread.sleep(500);
+        } catch (InterruptedException ex) {
+        }
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testRemotePlayerState() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setState(Player.PlayerState.playing);
+        Player.PlayerState state = player.getState();
+        assertEquals(Player.PlayerState.playing, state);
+        assertEquals(null, element.getAttribute("paused"));
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        state = player.getState();
+        assertEquals(Player.PlayerState.paused, state);
+        assertEquals("true", element.getAttribute("paused"));
+
+      // TODO HTML5 Video is not seekable in Qt5.2.0. Issue MHA-905. Check it for next version.
+//        player.setState(Player.PlayerState.stopped);
+//        state = player.getState();
+//        assertEquals("true", element.getAttribute("paused"));
+//        assertEquals(Player.PlayerState.stopped, state);
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerSetMute() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setMute(true);
+        assertEquals("true", element.getAttribute("muted"));
+
+        player.setMute(false);
+        assertEquals(null, element.getAttribute("muted"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerGetMute() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        assertEquals(player.isMuted() ? "true" : null, element.getAttribute("muted"));
+        player.setMute(true);
+        assertEquals(player.isMuted() ? "true" : null, element.getAttribute("muted"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason = "HTML5 Video isn't seekable: bug 38464, https://bugs.webkit.org/show_bug.cgi?id=38464; bug 37267, https://bugreports.qt-project.org/browse/QTBUG-37267#comment-234581")
+    public void testRemotePlayerSeek() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(20000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        player.seek(10.5);
+        assertEquals(10.5, player.getCurrentPlayingPosition(), 0.1);
+        player.setState(Player.PlayerState.playing);
+    }
+
+    @Test
+    public void testRemotePlayerSpeed() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+
+        player.setState(Player.PlayerState.playing);
+        player.setSpeed(10);
+        assertEquals(10, player.getSpeed(), 0.1);
+        player.setState(Player.PlayerState.paused);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+        assertEquals(10, player.getSpeed(), 0.1);
+
+        player.setSpeed(0.1);
+
+        try {
+            Thread.sleep(10000);
+        } catch (InterruptedException ex) {
+        }
+        assertEquals(0.1, player.getSpeed(), 0.01);
+
+        player.setState(Player.PlayerState.paused);
+    }
+
+    @Test
+    public void testRemotePlayerVolume() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setVolume(0.5);
+        assertEquals(0.5, player.getVolume(), 0);
+        assertEquals("0.5", element.getAttribute("volume"));
+
+        player.setVolume(0);
+        assertEquals(0, player.getVolume(), 0);
+        assertEquals("0", element.getAttribute("volume"));
+
+        player.setVolume(1.0);
+        assertEquals(1.0, player.getVolume(), 0);
+        assertEquals("1", element.getAttribute("volume"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT}, reason  = "Segmentation fault GStreamer; bug 997153, https://bugzilla.redhat.com/show_bug.cgi?id=918553")
+    public void testRemotePlayerVolumeAndMute() {
+        WebElement element = driver.findElement(By.id("videoPlayer"));
+        Player player = getPlayer((RemoteWebElement) element);
+        player.setVolume(0.5);
+        player.setMute(true);
+        player.setMute(false);
+        assertEquals(0.5, player.getVolume(), 0.02);
+        assertEquals("0.5", element.getAttribute("volume"));
+    }
+
+    public Player getPlayer(RemoteWebElement element) {
+        return (Player) (new QtWebkitAugmenter().augment(element));
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/PerfLoggingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/PerfLoggingTest.java
new file mode 100644
index 00000000..9ce5c78f
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/PerfLoggingTest.java
@@ -0,0 +1,89 @@
+package org.openqa.selenium.qtwebkit;
+
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.assertTrue;
+import com.google.common.collect.Iterables;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+import org.openqa.selenium.logging.LogEntries;
+import org.openqa.selenium.logging.LogEntry;
+import org.openqa.selenium.logging.LogType;
+import org.openqa.selenium.logging.LoggingPreferences;
+import org.openqa.selenium.remote.CapabilityType;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import java.util.Set;
+import java.util.logging.Level;
+
+
+public class PerfLoggingTest extends JUnit4TestBase {
+
+    @Before
+    public void createDriver() {
+    }
+
+    @After
+    public void cleanUp() {
+        if (null == driver) {
+            return;
+        }
+        driver.quit();
+        driver = null;
+    }
+
+    @BeforeClass
+    public static void cleanUpExistingDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void performanceLogShouldBeDisabledByDefault() {
+        driver = actuallyCreateDriver();
+        Set<String> logTypes = driver.manage().logs().getAvailableLogTypes();
+        assertFalse("Performance log should not be enabled by default",
+                    logTypes.contains(LogType.PERFORMANCE));
+        JUnit4TestBase.removeDriver();
+    }
+
+    private void createDriverWithPerformanceLogType() {
+        DesiredCapabilities caps = DesiredCapabilities.qtwebkit();
+        LoggingPreferences logPrefs = new LoggingPreferences();
+        logPrefs.enable(LogType.PERFORMANCE, Level.INFO);
+        caps.setCapability(CapabilityType.LOGGING_PREFS, logPrefs);
+        QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+        driver = new RemoteWebDriver(executor, caps);
+    }
+
+    @Test
+    public void shouldBeAbleToEnablePerformanceLog() {
+        createDriverWithPerformanceLogType();
+        Set<String> logTypes = driver.manage().logs().getAvailableLogTypes();
+        assertTrue("Profiler log should be enabled", logTypes.contains(LogType.PERFORMANCE));
+    }
+
+    @Test
+    public void pageLoadShouldProducePerformanceLogEntries() {
+        createDriverWithPerformanceLogType();
+        driver.get(pages.simpleTestPage);
+        LogEntries entries = driver.manage().logs().get(LogType.PERFORMANCE);
+        assertNotEquals(0, Iterables.size(entries));
+    }
+
+
+    @Test
+    public void performanceLogEntriesShouldHaveNeededStructure() {
+        createDriverWithPerformanceLogType();
+        driver.get(pages.simpleTestPage);
+        LogEntries entries = driver.manage().logs().get(LogType.PERFORMANCE);
+        for(LogEntry e : entries.getAll())   {
+            assertTrue(e.getMessage().contains("webview"));
+            assertTrue(e.getMessage().contains("message"));
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/QtWebDriverSwitchesTest.java b/java/client/test/org/openqa/selenium/qtwebkit/QtWebDriverSwitchesTest.java
new file mode 100644
index 00000000..690c1d5c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/QtWebDriverSwitchesTest.java
@@ -0,0 +1,229 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.junit.*;
+
+import java.util.Arrays;
+
+import org.openqa.selenium.Dimension;
+import org.openqa.selenium.Point;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.support.ui.WebDriverWait;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.testing.NeedsLocalEnvironment;
+import org.openqa.selenium.testing.Ignore;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import java.util.concurrent.Callable;
+
+import static org.junit.Assert.assertEquals;
+
+public class QtWebDriverSwitchesTest extends JUnit4TestBase {
+
+    @Before
+    public void createDriver() throws Exception {
+    }
+
+    @After
+    public void theerDown() throws Exception {
+        driver.quit();
+    }
+
+    @NeedsLocalEnvironment
+    @Test
+    public void canStartWebDriverWithPos() {
+        URL hostURL;
+        Point point = new Point(80, 60);
+        String arg = "" + point.getX() + ", " + point.getY();
+        DesiredCapabilities capabilities = DesiredCapabilities.qtwebkit();
+        capabilities.setCapability("windowposition", arg);
+
+        driver = new QtWebKitDriver(QtWebKitDriver.createDefaultExecutor(), capabilities);
+        wait = new WebDriverWait(driver, 30);
+
+        driver.get(pages.colorPage);
+        WebDriver.Window window = driver.manage().window();
+        Point pnt = window.getPosition();
+        assertEquals(80, pnt.getX());
+        assertEquals(60, pnt.getY());
+
+
+        wait.until(xEqual(point));
+        wait.until(yEqual(point));
+
+        sleep(2);
+
+    }
+
+    @NeedsLocalEnvironment
+    @Test
+    public void canStartWebDriverWithSize() {
+        URL hostURL;
+        Dimension size = new Dimension(600, 400);
+        String arg = "" + size.getWidth() + ", " + size.getHeight();
+        DesiredCapabilities capabilities = DesiredCapabilities.qtwebkit();
+        capabilities.setCapability("windowsize", arg);
+
+        driver = new QtWebKitDriver(QtWebKitDriver.createDefaultExecutor(), capabilities);
+        wait = new WebDriverWait(driver, 30);
+
+        driver.get(pages.colorPage);
+
+        WebDriver.Window window = driver.manage().window();
+        Dimension sz = window.getSize();
+        assertEquals(400, sz.getHeight());
+        assertEquals(600, sz.getWidth());
+        wait.until(windowHeightToEqual(size));
+        wait.until(windowWidthToEqual(size));
+
+        sleep(2);
+
+    }
+
+    @NeedsLocalEnvironment
+    @Test
+    public void canStartWebDriverWithPosAndSize() {
+        URL hostURL;
+        Point point = new Point(80, 60);
+        String arg_pos = "" + point.getX() + ", " + point.getY();
+        DesiredCapabilities capabilities = DesiredCapabilities.qtwebkit();
+        capabilities.setCapability("windowposition", arg_pos);
+
+        Dimension size = new Dimension(640, 480);
+        String arg_sz = "" + size.getWidth() + ", " + size.getHeight();
+        capabilities.setCapability("windowsize", arg_sz);
+
+        driver = new QtWebKitDriver(QtWebKitDriver.createDefaultExecutor(), capabilities);
+        wait = new WebDriverWait(driver, 30);
+
+        driver.get(pages.colorPage);
+        WebDriver.Window window = driver.manage().window();
+        Point pnt = window.getPosition();
+        assertEquals(80, pnt.getX());
+        assertEquals(60, pnt.getY());
+
+        wait.until(xEqual(point));
+        wait.until(yEqual(point));
+
+        Dimension sz = window.getSize();
+        assertEquals(640, sz.getWidth());
+        assertEquals(480, sz.getHeight());
+        wait.until(windowHeightToEqual(size));
+        wait.until(windowWidthToEqual(size));
+
+        sleep(2);
+
+    }
+
+    @NeedsLocalEnvironment
+    @Test
+    public void canStartWebDriverMaximized() {
+        URL hostURL;
+        DesiredCapabilities capabilities = DesiredCapabilities.qtwebkit();
+        capabilities.setCapability("maximize", true);
+
+        driver = new QtWebKitDriver(QtWebKitDriver.createDefaultExecutor(), capabilities);
+        wait = new WebDriverWait(driver, 30);
+
+        driver.get(pages.colorPage);
+
+        Dimension maximizedSize = driver.manage().window().getSize();
+
+        driver.manage().window().setSize(new Dimension(10, 10));
+        driver.manage().window().maximize();
+
+        wait.until(windowHeightToEqual(maximizedSize));
+        wait.until(windowWidthToEqual(maximizedSize));
+
+        sleep(2);
+
+    }
+
+    private ExpectedCondition<Boolean> windowHeightToEqual(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.height == size.height) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowWidthToEqual(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.width == size.width) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> xEqual(final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.x == targetPosition.x) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+    private ExpectedCondition<Boolean> yEqual(final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.y == targetPosition.y) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private void sleep(int sec) {
+        try {
+            Thread.sleep(sec*1000);
+        } catch (InterruptedException ie) {
+            //Handle exception
+        }
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/QtWebkitDriverTests.java b/java/client/test/org/openqa/selenium/qtwebkit/QtWebkitDriverTests.java
new file mode 100644
index 00000000..c68bdbff
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/QtWebkitDriverTests.java
@@ -0,0 +1,53 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit;
+
+import org.junit.AfterClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.StandardSeleniumTests;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.qtwebkit.touch.TouchTests;
+import java.util.logging.Logger;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        StandardSeleniumTests.class,
+        GraphicsWebSanityTest.class,
+        TouchTests.class,
+        QtWebDriverSwitchesTest.class,
+        HTML5VideoTagTest.class,
+        HTML5AudioTagTest.class,
+        PerfLoggingTest.class
+})
+
+public class QtWebkitDriverTests {
+
+    private static final String testsName = QtWebkitDriverTests.class.getName();
+    private static final Logger logger = Logger.getLogger(testsName);
+
+    @AfterClass
+    public static void flushReport() {
+      GlobalTestEnvironment.get(InProcessTestEnvironment.class).getStatisticCommands().writeToXml(testsName);
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/build.desc b/java/client/test/org/openqa/selenium/qtwebkit/build.desc
new file mode 100644
index 00000000..efca0a4e
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/build.desc
@@ -0,0 +1,13 @@
+
+java_test(name = "test_qtwebkit",
+  srcs = [ "*.java",
+            "touch/*.java"],
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit" },
+  ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/qtwebkit",
+    "//java/client/test/org/openqa/selenium:tests",
+    "//third_party/java/junit",
+  ]
+)
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CapabilitiesTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CapabilitiesTest.java
new file mode 100644
index 00000000..e0010c0a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CapabilitiesTest.java
@@ -0,0 +1,343 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.qtwebkit.QtWebDriverExecutor;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.Set;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.Platform.WINDOWS;
+import static org.openqa.selenium.Platform.LINUX;
+import static org.openqa.selenium.Platform.UNIX;
+import static org.openqa.selenium.Platform.MAC;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+public class CapabilitiesTest extends JUnit4TestBase {
+
+    @Before
+    public void createDriver() {
+        desiredCapabilities = DesiredCapabilities.qtwebkit();
+        requiredCapabilities = null;
+    }
+
+    @After
+    public void cleanUp() {
+        if (null == driver) {
+            return;
+        }
+        driver.quit();
+    }
+
+    @BeforeClass
+    public static void cleanUpExistingDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testCanStartNeededWidgetWithDesiredCapabilities() {
+        desiredCapabilities.setCapability("browserClass", "XPathElementFindingTestWidget");
+        driver = CreateWebDriver();
+        assertEquals(driver.getTitle(), "Application Window");
+    }
+
+    @Test
+    public void testCanStartNeededWidgetWithRequiredCapabilities() {
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability("browserClass", "XPathElementFindingTestWidget");
+        driver = CreateWebDriver();
+        assertEquals(driver.getTitle(), "Application Window");
+    }
+
+
+    @Test
+    public void testCheckNotSetDesiredCapabilities() {
+        desiredCapabilities.setCapability("browserStartWindow", "XPathElementFindingTestWidget");
+        driver = CreateWebDriver();
+        assertNull(desiredCapabilities.getCapability("browserClass"));
+    }
+
+    @Test
+    public void testIgnoreDesiredCapabilitiesBrowserStartWindowIfWindowNotFound() {
+        desiredCapabilities.setCapability("browserStartWindow", "XPathElementFindingTestWidget");
+        driver = CreateWebDriver();
+        assertNotNull(driver.getWindowHandles().size());
+        assertEquals(driver.getTitle(), "");
+    }
+
+    @Test
+    public void testCanNotStartWithRequiredCapabilitiesBrowserStartWindowIfWindowNotFound() {
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability("browserStartWindow", "FindingTestWidget");
+        try {
+            driver = CreateWebDriver();
+            fail("Can't start session if windows not found");
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+        }
+    }
+
+    @Test
+    public void testCanNotStartWithRequiredCapabilitiesBrowserStartWindowIfNotOpenedWindowYet() {
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability("browserStartWindow", "*");
+        try {
+            driver = CreateWebDriver();
+            fail("Can't start session if windows not found");
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+        }
+    }
+
+    @Test
+    public void testMustStartWindowWithRequiredCapabilitiesIfSetDesiredToo() {
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability("browserClass", "XPathElementFindingTestWidget");
+        desiredCapabilities.setCapability("browserClass", "FindingTestWidget");
+        driver = CreateWebDriver();
+        assertEquals(driver.getTitle(), "Application Window");
+    }
+
+    @Test
+    public void testCanNotStartNoExistingWidget() {
+        desiredCapabilities.setCapability("browserClass", "NoExistingWidget");
+        try {
+            driver = CreateWebDriver();
+            fail("Can't start not existing widget");
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+        }
+    }
+
+    @Test
+    public void testRequiredBrowserName() {
+        requiredCapabilities = DesiredCapabilities.qtwebkit();
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Ignore(value = {QTWEBKIT}, platforms = {UNIX, MAC, WINDOWS})
+    @Test
+    public void testRequiredPlatform() {
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setPlatform(LINUX);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testRetainedSize() {
+        desiredCapabilities.setCapability("windowsize", "1000, 600");
+        desiredCapabilities.setCapability("browserClass", "TypingTestWidget");
+        try {
+            driver = CreateWebDriver();
+            assertEquals(driver.manage().window().getSize().getWidth(), 1000);
+            assertEquals(driver.manage().window().getSize().getHeight(), 600);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testRetainedPosition() {
+        desiredCapabilities.setCapability("windowposition", "50, 70");
+        desiredCapabilities.setCapability("browserClass", "TypingTestWidget");
+
+        try {
+            driver = CreateWebDriver();
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testRestoreSize() {
+        desiredCapabilities.setCapability("windowsize", "1000, 600");
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getSize().getWidth(), 1000);
+            assertEquals(driver.manage().window().getSize().getHeight(), 600);
+            driver.get("qtwidget://XPathElementFindingTestWidget");
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getSize().getWidth(), 1000);
+            assertEquals(driver.manage().window().getSize().getHeight(), 600);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testRestorePosition() {
+        desiredCapabilities.setCapability("windowposition", "50, 70");
+
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+            driver.get("qtwidget://XPathElementFindingTestWidget");
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testRestoreSizeAndPosition() {
+        desiredCapabilities.setCapability("windowsize", "1000, 600");
+        desiredCapabilities.setCapability("windowposition", "50, 70");
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getSize().getWidth(), 1000);
+            assertEquals(driver.manage().window().getSize().getHeight(), 600);
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+            driver.get("qtwidget://XPathElementFindingTestWidget");
+            driver.get(pages.colorPage);
+            assertEquals(driver.manage().window().getSize().getWidth(), 1000);
+            assertEquals(driver.manage().window().getSize().getHeight(), 600);
+            assertEquals(driver.manage().window().getPosition().getX(), 50);
+            assertEquals(driver.manage().window().getPosition().getY(), 70);
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testCanUsedOpenWindowFromPrevSessionIfCapReuseUISetToTrue() {
+
+        WebDriver prevDriver = null;
+        try {
+            DesiredCapabilities caps = DesiredCapabilities.qtwebkit();
+            QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+            prevDriver = new RemoteWebDriver(executor, caps);
+            prevDriver.get("qtwidget://XPathElementFindingTestWidget");
+            assertEquals(prevDriver.getTitle(), "Application Window");
+
+            desiredCapabilities.setCapability(QtWebKitDriver.REUSE_UI, true);
+            driver = CreateWebDriver();
+
+            Set<String> allWindowHandles = driver.getWindowHandles();
+            assertEquals(2, allWindowHandles.size());
+
+            for (String handle : allWindowHandles) {
+                driver.switchTo().window(handle);
+                if (driver.getTitle().equals("Application Window")) {
+                    break;
+                }
+            }
+            assertEquals(driver.getTitle(), "Application Window");
+
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        } finally {
+            // if this caps set to 'true' prevDriver will be closed when new driver creates
+        }
+    }
+
+    @Test
+    public void testCanNotStartOtherSessionIfCapReuseUISetToFalse() {
+
+        desiredCapabilities.setCapability(QtWebKitDriver.REUSE_UI, false);
+        WebDriver otherDriver = null;
+        try {
+            driver = CreateWebDriver();
+            driver.get("qtwidget://XPathElementFindingTestWidget");
+            assertEquals(driver.getTitle(), "Application Window");
+            DesiredCapabilities caps = DesiredCapabilities.qtwebkit();
+            QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+            otherDriver = new RemoteWebDriver(executor, caps);
+            fail("Should not have success ...");
+        } catch (RuntimeException e) {
+//            expected
+        } finally {
+            if (otherDriver != null)
+                otherDriver.quit();
+        }
+    }
+
+    @Test
+    public void testCanNotStartOtherSessionIfCapReuseUIDoesNotSet() {
+        WebDriver otherDriver = null;
+        try {
+            driver = CreateWebDriver();
+            driver.get("qtwidget://XPathElementFindingTestWidget");
+            assertEquals(driver.getTitle(), "Application Window");
+            DesiredCapabilities caps = DesiredCapabilities.qtwebkit();
+            QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+            otherDriver = new RemoteWebDriver(executor, caps);
+            fail("Should not have success ...");
+        } catch (RuntimeException e) {
+//            expected
+        } finally {
+            if (otherDriver != null)
+                otherDriver.quit();
+        }
+    }
+
+    private DesiredCapabilities desiredCapabilities;
+    private DesiredCapabilities requiredCapabilities;
+
+    private WebDriver CreateWebDriver() throws RuntimeException {
+        QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+        return new RemoteWebDriver(executor, desiredCapabilities, requiredCapabilities);
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt4Test.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt4Test.java
new file mode 100644
index 00000000..59ab7884
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt4Test.java
@@ -0,0 +1,198 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.qtwebkit.QtWebDriverExecutor;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import java.util.HashMap;
+import java.util.Map;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class CustomCapabilitiesQt4Test extends JUnit4TestBase {
+
+    @Before
+    public void createDriver() {
+        desiredCapabilities = DesiredCapabilities.qtwebkit();
+        requiredCapabilities = null;
+    }
+
+    @After
+    public void cleanUp() {
+        if (null == driver)
+            return;
+        driver.quit();
+    }
+
+    @BeforeClass
+    public static void cleanUpExistingDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithRequiredHybridViewTypesCapabilities() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("widget", true);
+        types.put("qml", true);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.colorPage);
+        } catch (RuntimeException e) {
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithRequiredHybridViewTypesCapabilitiesWhichDidntSet() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("abcxy", true);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+            fail("Should not start session ...");
+        } catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithDesiredHybridCapabilitiesWhichDidntSet() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("abcdx", true);
+        types.put("qtVersion", "4.8.2");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+        } catch (RuntimeException e) {
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithRequiredHybridTypeThatSetFalse() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", false);
+        types.put("qml", false);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            fail("Should not have succeeded");
+        }  catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithDesiredHybridTypeThatSetFalse() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", false);
+        types.put("widget", false);
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    @Test
+    public void testDesiredQtVersion() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qtVersion", "5.1.0");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    @Test
+    public void testRequiredQtVersion() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qtVersion", "4.1.0");
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    @Test
+    public void testRequiredQtVersionShouldHasHighPriority() {
+        Map<String, Object> destypes = new HashMap<String, Object>();
+        destypes.put("html", true);
+        destypes.put("qtVersion", "5.5.0");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, destypes);
+        Map<String, Object> reqtypes = new HashMap<String, Object>();
+        reqtypes.put("html", true);
+        reqtypes.put("qtVersion", "4.8.0");
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, reqtypes);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    private DesiredCapabilities desiredCapabilities;
+    private DesiredCapabilities requiredCapabilities;
+
+    private WebDriver CreateWebDriver() throws RuntimeException {
+        QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+        return new RemoteWebDriver(executor, desiredCapabilities, requiredCapabilities);
+    }
+
+}
+
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt5Test.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt5Test.java
new file mode 100644
index 00000000..91b1c228
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/CustomCapabilitiesQt5Test.java
@@ -0,0 +1,200 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.qtwebkit.QtWebDriverExecutor;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import java.util.HashMap;
+import java.util.Map;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class CustomCapabilitiesQt5Test extends JUnit4TestBase {
+
+    @Before
+    public void createDriver() {
+        desiredCapabilities = DesiredCapabilities.qtwebkit();
+        requiredCapabilities = null;
+    }
+
+    @After
+    public void cleanUp() {
+        if (null == driver)
+            return;
+        driver.quit();
+    }
+
+    @BeforeClass
+    public static void cleanUpExistingDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithRequiredHybridViewTypesCapabilities() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("widget", true);
+        types.put("qml2", true);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.colorPage);
+        } catch (RuntimeException e) {
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithRequiredHybridViewTypesCapabilitiesWhichDidntSet() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("abcxy", true);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+            fail("Should not start session ...");
+        } catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithDesiredHybridCapabilitiesWhichDidntSet() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml2", true);
+        types.put("abcdx", true);
+        types.put("qtVersion", "4.8.2");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            driver.get(pages.rectanglesPage);
+        } catch (RuntimeException e) {
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithRequiredHybridTypeThatSetFalse() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", false);
+        types.put("qml2", false);
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+            fail("Should not have succeeded");
+        }  catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithDesiredHybridTypeThatSetFalse() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", false);
+        types.put("widget", false);
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            // expected
+            fail("Should not to be here ... ");
+        }
+    }
+
+    @Test
+    public void testDesiredQtVersion() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qtVersion", "4.5.0");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+
+    @Test
+    public void testRequiredQtVersion() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qtVersion", "5.1.0");
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    @Test
+    public void testRequiredQtVersionShouldHasHighPriority() {
+        Map<String, Object> destypes = new HashMap<String, Object>();
+        destypes.put("html", true);
+        destypes.put("qtVersion", "4.5.0");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, destypes);
+        Map<String, Object> reqtypes = new HashMap<String, Object>();
+        reqtypes.put("html", true);
+        reqtypes.put("qtVersion", "5.1.0");
+        requiredCapabilities = new DesiredCapabilities();
+        requiredCapabilities.setCapability(QtWebKitDriver.HYBRID, reqtypes);
+        try {
+            driver = CreateWebDriver();
+        }  catch (RuntimeException e) {
+            fail("Should not to be here ... ");
+        }
+    }
+
+    private DesiredCapabilities desiredCapabilities;
+    private DesiredCapabilities requiredCapabilities;
+
+    private WebDriver CreateWebDriver() throws RuntimeException {
+        QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+        return new RemoteWebDriver(executor, desiredCapabilities, requiredCapabilities);
+    }
+
+}
+
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/EmbeddedWebViewTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/EmbeddedWebViewTest.java
new file mode 100644
index 00000000..b3d16c06
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/EmbeddedWebViewTest.java
@@ -0,0 +1,731 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.MoveTargetOutOfBoundsException;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.List;
+import java.util.Set;
+import java.util.logging.Logger;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.junit.After;
+import org.openqa.selenium.testing.JavascriptEnabled;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.Browser;
+
+import static org.hamcrest.Matchers.anyOf;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.lessThanOrEqualTo;
+import static org.hamcrest.Matchers.nullValue;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.junit.Assume.assumeFalse;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class EmbeddedWebViewTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(EmbeddedWebViewTest.class.getName());
+
+    @Before
+    public void setUp() {
+        driver.get(appServer.whereIs("quick1/WebviewTest.qml"));
+        currentWindow = driver.getWindowHandle();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                break;
+            }
+        }
+        assertTrue(!currentWindow.equals(driver.getWindowHandle()));
+    }
+
+    @After
+    public void clean() {
+        driver.switchTo().window(currentWindow);
+        assertTrue(currentWindow.equals(driver.getWindowHandle()));
+    }
+
+    @Test
+    public void testEmbeddedWebViewEnumerated() {
+        Set<String> allWindowHandles = driver.getWindowHandles();
+        assertEquals(2, allWindowHandles.size());
+
+        for (String handle : allWindowHandles) {
+            driver.switchTo().window(handle);
+        }
+    }
+
+    @Test
+    public void testCanClickOnALinkAndFollowIt() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("normal")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatOverflowsAndFollowIt() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("overflowLink")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatUpdatesAnotherFrame() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        driver.findElement(By.id("otherframe")).click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        wait.until(WaitingConditions.pageSourceToContain( "Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testElementsFoundByJsCanLoadUpdatesInAnotherFrame() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        WebElement toClick = (WebElement) ((JavascriptExecutor) driver).executeScript(
+            "return document.getElementById('otherframe');"
+        );
+        toClick.click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        assertTrue("Target did not reload",
+                   driver.getPageSource().contains("Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testJsLocatedElementsCanUpdateFramesIfFoundSomehowElse() {
+        driver.get(pages.clicksPage);
+        driver.switchTo().frame("source");
+
+        // Prime the cache of elements
+        driver.findElement(By.id("otherframe"));
+
+        // This _should_ return the same element
+        WebElement toClick = (WebElement) ((JavascriptExecutor) driver).executeScript(
+            "return document.getElementById('otherframe');"
+        );
+        toClick.click();
+        driver.switchTo().defaultContent().switchTo().frame("target");
+
+        assertTrue("Target did not reload",
+                   driver.getPageSource().contains("Hello WebDriver"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testCanClickOnAnElementWithTopSetToANegativeNumber() {
+        String page = appServer.whereIs("styledPage.html");
+        driver.get(page);
+        WebElement searchBox = driver.findElement(By.name("searchBox"));
+        searchBox.sendKeys("Cheese");
+        driver.findElement(By.name("btn")).click();
+
+        String log = driver.findElement(By.id("log")).getText();
+        assertEquals("click", log);
+    }
+
+    @Test
+    public void testShouldClickOnFirstBoundingClientRectWithNonZeroSize() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("twoClientRects")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testClickingLabelShouldSetCheckbox() {
+        driver.get(pages.formPage);
+
+        driver.findElement(By.id("label-for-checkbox-with-label")).click();
+
+        assertTrue(
+            "Should be selected",
+            driver.findElement(By.id("checkbox-with-label")).isSelected());
+    }
+
+    @Test
+    public void testCanClickOnALinkWithEnclosedImage() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-image")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnAnImageEnclosedInALink() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-image")).findElement(By.tagName("img"))
+            .click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatContainsTextWrappedInASpan() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-span")).click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnALinkThatContainsEmbeddedBlockElements() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("embeddedBlock")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testCanClickOnAnElementEnclosedInALink() {
+        driver.get(pages.clicksPage);
+        driver.findElement(By.id("link-with-enclosed-span")).findElement(By.tagName("span"))
+            .click();
+
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    // See http://code.google.com/p/selenium/issues/attachmentText?id=2700
+    @Test
+    public void testShouldBeAbleToClickOnAnElementInTheViewport() {
+        String url = appServer.whereIs("click_out_of_bounds.html");
+
+        driver.get(url);
+        WebElement button = driver.findElement(By.id("button"));
+
+        try {
+            button.click();
+        } catch (MoveTargetOutOfBoundsException e) {
+            fail("Should not be out of bounds: " + e.getMessage());
+        }
+    }
+
+    @Test
+    public void testClicksASurroundingStrongTag() {
+        driver.get(appServer.whereIs("ClickTest_testClicksASurroundingStrongTag.html"));
+        driver.findElement(By.tagName("a")).click();
+        wait.until(titleIs("XHTML Test Page"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClickOnAnElementGreaterThanTwoViewports() {
+        String url = appServer.whereIs("click_too_big.html");
+        driver.get(url);
+
+        WebElement element = driver.findElement(By.id("click"));
+
+        element.click();
+
+        wait.until(titleIs("clicks"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClickOnAnElementInFrameGreaterThanTwoViewports() {
+        String url = appServer.whereIs("click_too_big_in_frame.html");
+        driver.get(url);
+
+        WebElement frame = driver.findElement(By.id("iframe1"));
+        driver.switchTo().frame(frame);
+
+        WebElement element = driver.findElement(By.id("click"));
+        element.click();
+
+        wait.until(titleIs("clicks"));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInViewPort() {
+        driver.get(appServer.whereIs("coordinates_tests/simple_page.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnEmptyElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_empty_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfATransparentElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_transparent_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAHiddenElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_hidden_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnInvisibleElement() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_invisible_element.html"));
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(0, 0)));
+    }
+
+    @Test
+    public void testShouldScrollPageAndGetCoordinatesOfAnElementThatIsOutOfViewPort() {
+        driver.get(appServer.whereIs("coordinates_tests/page_with_element_out_of_view.html"));
+        int windowHeight = driver.manage().window().getSize().getHeight();
+        Point location = getLocationInViewPort(By.id("box"));
+        assertThat(location.getX(), is(10));
+        assertThat(location.getY(), greaterThanOrEqualTo(0));
+        assertThat(location.getY(), lessThanOrEqualTo(windowHeight - 100));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInAFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_frame.html"));
+        driver.switchTo().frame("ifr");
+        WebElement box = driver.findElement(By.id("box"));
+        assertThat(box.getLocation(), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesInViewPortOfAnElementInAFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_frame.html"));
+        driver.switchTo().frame("ifr");
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(25, 25)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesInViewPortOfAnElementInANestedFrame() {
+        driver.get(appServer.whereIs("coordinates_tests/element_in_nested_frame.html"));
+        driver.switchTo().frame("ifr");
+        driver.switchTo().frame("ifr");
+        assertThat(getLocationInViewPort(By.id("box")), is(new Point(40, 40)));
+    }
+
+    private Point getLocationInViewPort(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().inViewPort();
+    }
+
+    @Test
+    public void testShouldReturnNullWhenGettingTheValueOfAnAttributeThatIsNotListed() {
+        driver.get(pages.simpleTestPage);
+        WebElement head = driver.findElement(By.xpath("/html"));
+        String attribute = head.getAttribute("cheese");
+        assertThat(attribute, is(nullValue()));
+    }
+
+    @Test
+    public void testShouldReturnNullWhenGettingSrcAttributeOfInvalidImgTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("invalidImgTag"));
+        String attribute = img.getAttribute("src");
+        assertThat(attribute, is(nullValue()));
+    }
+
+    @Test
+    public void testShouldReturnAnAbsoluteUrlWhenGettingSrcAttributeOfAValidImgTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("validImgTag"));
+        String attribute = img.getAttribute("src");
+        assertThat(attribute, equalTo(appServer.whereIs("icon.gif")));
+    }
+
+    @Test
+    public void testShouldReturnAnAbsoluteUrlWhenGettingHrefAttributeOfAValidAnchorTag() {
+        driver.get(pages.simpleTestPage);
+        WebElement img = driver.findElement(By.id("validAnchorTag"));
+        String attribute = img.getAttribute("href");
+        assertThat(attribute, equalTo(appServer.whereIs("icon.gif")));
+    }
+
+    @Test
+    public void testShouldReturnEmptyAttributeValuesWhenPresentAndTheValueIsActuallyEmpty() {
+        driver.get(pages.simpleTestPage);
+        WebElement body = driver.findElement(By.xpath("//body"));
+        assertThat(body.getAttribute("style"), equalTo(""));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfTheDisabledAttributeAsNullIfNotSet() {
+        driver.get(pages.formPage);
+        WebElement inputElement = driver.findElement(By.xpath("//input[@id='working']"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), equalTo(true));
+
+        WebElement pElement = driver.findElement(By.id("peas"));
+        assertThat(pElement.getAttribute("disabled"), equalTo(null));
+        assertThat(pElement.isEnabled(), equalTo(true));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfTheIndexAttrbuteEvenIfItIsMissing() {
+        driver.get(pages.formPage);
+
+        WebElement multiSelect = driver.findElement(By.id("multi"));
+        List<WebElement> options = multiSelect.findElements(By.tagName("option"));
+        assertThat(options.get(1).getAttribute("index"), equalTo("1"));
+    }
+
+    @Test
+    public void testShouldIndicateTheElementsThatAreDisabledAreNotEnabled() {
+        driver.get(pages.formPage);
+        WebElement inputElement = driver.findElement(By.xpath("//input[@id='notWorking']"));
+        assertThat(inputElement.isEnabled(), is(false));
+
+        inputElement = driver.findElement(By.xpath("//input[@id='working']"));
+        assertThat(inputElement.isEnabled(), is(true));
+    }
+
+    @Test
+    public void testElementsShouldBeDisabledIfTheyAreDisabledUsingRandomDisabledStrings() {
+        driver.get(pages.formPage);
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement1"));
+        assertThat(disabledTextElement1.isEnabled(), is(false));
+
+        WebElement disabledTextElement2 = driver.findElement(By.id("disabledTextElement2"));
+        assertThat(disabledTextElement2.isEnabled(), is(false));
+
+        WebElement disabledSubmitElement = driver.findElement(By.id("disabledSubmitElement"));
+        assertThat(disabledSubmitElement.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldThrowExceptionIfSendingKeysToElementDisabledUsingRandomDisabledStrings() {
+        driver.get(pages.formPage);
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement1"));
+        try {
+            disabledTextElement1.sendKeys("foo");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            // Expected
+        }
+        assertThat(disabledTextElement1.getText(), is(""));
+
+        WebElement disabledTextElement2 = driver.findElement(By.id("disabledTextElement2"));
+        try {
+            disabledTextElement2.sendKeys("bar");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            // Expected
+        }
+        assertThat(disabledTextElement2.getText(), is(""));
+    }
+
+    @Test
+    public void testShouldIndicateWhenATextAreaIsDisabled() {
+        driver.get(pages.formPage);
+        WebElement textArea = driver.findElement(By.xpath("//textarea[@id='notWorkingArea']"));
+        assertThat(textArea.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldIndicateWhenASelectIsDisabled() {
+        driver.get(pages.formPage);
+
+        WebElement enabled = driver.findElement(By.name("selectomatic"));
+        WebElement disabled = driver.findElement(By.name("no-select"));
+
+        assertTrue(enabled.isEnabled());
+        assertFalse(disabled.isEnabled());
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfCheckedForACheckboxOnlyIfItIsChecked() {
+        driver.get(pages.formPage);
+        WebElement checkbox = driver.findElement(By.xpath("//input[@id='checky']"));
+        assertThat(checkbox.getAttribute("checked"), equalTo(null));
+        checkbox.click();
+        assertThat(checkbox.getAttribute("checked"), equalTo("true"));
+    }
+
+    @Test
+    public void testShouldOnlyReturnTheValueOfSelectedForRadioButtonsIfItIsSet() {
+        driver.get(pages.formPage);
+        WebElement neverSelected = driver.findElement(By.id("cheese"));
+        WebElement initiallyNotSelected = driver.findElement(By.id("peas"));
+        WebElement initiallySelected = driver.findElement(By.id("cheese_and_peas"));
+
+        assertThat(neverSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallyNotSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallySelected.getAttribute("selected"), equalTo("true"));
+
+        initiallyNotSelected.click();
+        assertThat(neverSelected.getAttribute("selected"), equalTo(null));
+        assertThat(initiallyNotSelected.getAttribute("selected"), equalTo("true"));
+        assertThat(initiallySelected.getAttribute("selected"), equalTo(null));
+    }
+
+    @Test
+    public void testShouldReturnTheValueOfSelectedForOptionsOnlyIfTheyAreSelected() {
+        driver.get(pages.formPage);
+        WebElement selectBox = driver.findElement(By.xpath("//select[@name='selectomatic']"));
+        List<WebElement> options = selectBox.findElements(By.tagName("option"));
+        WebElement one = options.get(0);
+        WebElement two = options.get(1);
+        assertThat(one.isSelected(), is(true));
+        assertThat(two.isSelected(), is(false));
+        assertThat(one.getAttribute("selected"), equalTo("true"));
+        assertThat(two.getAttribute("selected"), equalTo(null));
+    }
+
+    @Test
+    public void testShouldReturnValueOfClassAttributeOfAnElement() {
+        driver.get(pages.xhtmlTestPage);
+
+        WebElement heading = driver.findElement(By.xpath("//h1"));
+        String className = heading.getAttribute("class");
+
+        assertThat(className, equalTo("header"));
+    }
+
+    @Test
+    public void testShouldReturnTheContentsOfATextAreaAsItsValue() {
+        driver.get(pages.formPage);
+
+        String value = driver.findElement(By.id("withText")).getAttribute("value");
+
+        assertThat(value, equalTo("Example text"));
+    }
+
+    @Test
+    public void testShouldTreatReadonlyAsAValue() {
+        driver.get(pages.formPage);
+
+        WebElement element = driver.findElement(By.name("readonly"));
+        String readonly = element.getAttribute("readonly");
+
+        assertNotNull(readonly);
+
+        WebElement textInput = driver.findElement(By.name("x"));
+        String notReadonly = textInput.getAttribute("readonly");
+
+        assertFalse(readonly.equals(notReadonly));
+    }
+
+    @Test
+    public void testShouldGetNumericAtribute() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("withText"));
+        assertThat(element.getAttribute("rows"), is("5"));
+    }
+
+    @Test
+    public void testCanReturnATextApproximationOfTheStyleAttribute() {
+        driver.get(pages.javascriptPage);
+
+        String style = driver.findElement(By.id("red-item")).getAttribute("style");
+
+        assertTrue(style.toLowerCase().contains("background-color"));
+    }
+
+    @Test
+    public void testShouldReturnValueOfOnClickAttribute() {
+        driver.get(pages.javascriptPage);
+
+        WebElement mouseclickDiv = driver.findElement(By.id("mouseclick"));
+
+        String onClickValue = mouseclickDiv.getAttribute("onclick");
+        String expectedOnClickValue = "displayMessage('mouse click');";
+        assertThat("Javascript code expected", onClickValue, anyOf(
+            equalTo("javascript:" + expectedOnClickValue), // Non-IE
+            equalTo("function anonymous()\n{\n" + expectedOnClickValue + "\n}"), // IE
+            equalTo("function onclick()\n{\n" + expectedOnClickValue + "\n}"))); // IE
+
+        WebElement mousedownDiv = driver.findElement(By.id("mousedown"));
+        assertEquals(null, mousedownDiv.getAttribute("onclick"));
+    }
+
+    @Test
+    public void testGetAttributeDoesNotReturnAnObjectForSvgProperties() {
+        driver.get(pages.svgPage);
+        WebElement svgElement = driver.findElement(By.id("rotate"));
+        assertEquals("rotate(30)", svgElement.getAttribute("transform"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_textInput() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("working"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello world");
+        assertEquals("hello world", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_emailInput() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("email"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello@example.com");
+        assertEquals("hello@example.com", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormField_textArea() {
+        driver.get(pages.formPage);
+        WebElement element = driver.findElement(By.id("emptyTextArea"));
+        assertEquals("", element.getAttribute("value"));
+        element.sendKeys("hello world");
+        assertEquals("hello world", element.getAttribute("value"));
+    }
+
+    @Test
+    public void testShouldReturnNullForNonPresentBooleanAttributes() {
+        driver.get(pages.booleanAttributes);
+        WebElement element1 = driver.findElement(By.id("working"));
+        assertNull(element1.getAttribute("required"));
+        WebElement element2 = driver.findElement(By.id("wallace"));
+        assertNull(element2.getAttribute("nowrap"));
+    }
+
+    private Actions getBuilder(WebDriver driver) {
+        return new Actions(driver);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testBasicKeyboardInput() {
+        driver.get(pages.javascriptPage);
+
+        WebElement keyReporter = driver.findElement(By.id("keyReporter"));
+
+        Action sendLowercase = getBuilder(driver).sendKeys(keyReporter, "abc def").build();
+
+        sendLowercase.perform();
+
+        assertThat(keyReporter.getAttribute("value"), is("abc def"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeyDownOnly() {
+        ignoreOnFfWindowsWithNativeEvents(); // Issue 3722
+
+        driver.get(pages.javascriptPage);
+
+        WebElement keysEventInput = driver.findElement(By.id("theworks"));
+
+        Action pressShift = getBuilder(driver).keyDown(keysEventInput, Keys.SHIFT).build();
+
+        pressShift.perform();
+
+        WebElement keyLoggingElement = driver.findElement(By.id("result"));
+        String logText = keyLoggingElement.getText();
+
+        Action releaseShift = getBuilder(driver).keyUp(keysEventInput, Keys.SHIFT).build();
+        releaseShift.perform();
+
+        assertTrue("Key down event not isolated, got: " + logText,
+                   logText.endsWith("keydown"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeyUp() {
+        ignoreOnFfWindowsWithNativeEvents(); // Issue 3722
+
+        driver.get(pages.javascriptPage);
+        WebElement keysEventInput = driver.findElement(By.id("theworks"));
+
+        Action pressShift = getBuilder(driver).keyDown(keysEventInput, Keys.SHIFT).build();
+        pressShift.perform();
+
+        WebElement keyLoggingElement = driver.findElement(By.id("result"));
+
+        String eventsText = keyLoggingElement.getText();
+        assertTrue("Key down should be isolated for this test to be meaningful. " +
+                   "Got events: " + eventsText, eventsText.endsWith("keydown"));
+
+        Action releaseShift = getBuilder(driver).keyUp(keysEventInput, Keys.SHIFT).build();
+
+        releaseShift.perform();
+
+        eventsText = keyLoggingElement.getText();
+        assertTrue("Key up event not isolated. Got events: " + eventsText,
+                   eventsText.endsWith("keyup"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testSendingKeysToActiveElement() {
+        driver.get(pages.bodyTypingPage);
+
+        Action someKeys = getBuilder(driver).sendKeys("ab").build();
+        someKeys.perform();
+
+        assertThatBodyEventsFiredAreExactly("keypress keypress");
+        assertThatFormEventsFiredAreExactly("");
+    }
+
+    @Test
+    public void testBasicKeyboardInputOnActiveElement() {
+        driver.get(pages.javascriptPage);
+
+        WebElement keyReporter = driver.findElement(By.id("keyReporter"));
+
+        keyReporter.click();
+
+        Action sendLowercase = getBuilder(driver).sendKeys("abc def").build();
+
+        sendLowercase.perform();
+
+        assertThat(keyReporter.getAttribute("value"), is("abc def"));
+    }
+
+    private void assertThatFormEventsFiredAreExactly(String message, String expected) {
+        assertThat(message, getFormEvents(), is(expected.trim()));
+    }
+
+    private String getFormEvents() {
+        return driver.findElement(By.id("result")).getText().trim();
+    }
+
+    private void assertThatFormEventsFiredAreExactly(String expected) {
+        assertThatFormEventsFiredAreExactly("", expected);
+    }
+
+    private void assertThatBodyEventsFiredAreExactly(String expected) {
+        assertThat(driver.findElement(By.id("body_result")).getText().trim(), is(expected.trim()));
+    }
+
+    private void ignoreOnFfWindowsWithNativeEvents() {
+        assumeFalse(Browser.detect() == Browser.ff &&
+                    TestUtilities.getEffectivePlatform().is(Platform.WINDOWS) &&
+                    TestUtilities.isNativeEventsEnabled(driver));
+    }
+
+    private String currentWindow;
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt4Tests.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt4Tests.java
new file mode 100644
index 00000000..054ebe9f
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt4Tests.java
@@ -0,0 +1,55 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+    CapabilitiesTest.class,
+    ViewTransitionsTest.class,
+    InternalWebViewTest.class,
+    WidgetAndWebViewTest.class,
+    ProxySettingTest.class,
+    WindowWithDeclarativeViewTest.class,
+    WindowWithSeparatedDeclarativeAndWebViewsTest.class,
+    CustomCapabilitiesQt4Test.class,
+    EmbeddedWebViewTest.class
+})
+public class HybridWebDriverQt4Tests {
+
+  @BeforeClass
+  public static void prepareCommonEnvironment() {
+    GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+  }
+
+  @AfterClass
+  public static void cleanUpDriver() {
+    JUnit4TestBase.removeDriver();
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt5Tests.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt5Tests.java
new file mode 100644
index 00000000..d397a4c0
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/HybridWebDriverQt5Tests.java
@@ -0,0 +1,51 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+    CapabilitiesTest.class,
+    InternalWebViewTest.class,
+    WidgetAndWebViewTest.class,
+    ProxySettingTest.class,
+    CustomCapabilitiesQt5Test.class
+})
+public class HybridWebDriverQt5Tests {
+
+  @BeforeClass
+  public static void prepareCommonEnvironment() {
+    GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+  }
+
+  @AfterClass
+  public static void cleanUpDriver() {
+    JUnit4TestBase.removeDriver();
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/InternalWebViewTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/InternalWebViewTest.java
new file mode 100644
index 00000000..0e2031b7
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/InternalWebViewTest.java
@@ -0,0 +1,204 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.Dimension;
+import org.openqa.selenium.Point;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class InternalWebViewTest extends JUnit4TestBase {
+
+  @Before
+  public void setUp() throws Exception {
+    driver.get("qtwidget://WindowWithEmbeddedViewTestWidget");
+    inputUrl = driver.findElement(By.id("inputURL"));
+    btnLoad = driver.findElement(By.id("loadButton"));
+    currentWindow = driver.getWindowHandle();
+  }
+
+  @After
+  public void cleanUp() {
+    driver.switchTo().window(currentWindow);
+  }
+
+  @Test
+  public void testCanGetUrlFromInternalWebView() {
+    inputUrl.sendKeys(pages.colorPage);
+    btnLoad.click();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(windowUrlContains(driver, "colorPage.html"));
+        break;
+      }
+    }
+  }
+
+  @Test
+  public void testCanGetTitleFromInternalWebView() {
+    inputUrl.sendKeys(pages.colorPage);
+    btnLoad.click();
+
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(titleIs("Color Page"));
+        break;
+      }
+    }
+  }
+
+  @Test
+  public void testCanNotLoadNotExistIntoWebView() {
+    inputUrl.sendKeys(pages.notExist);
+    btnLoad.click();
+    WebElement label = driver.findElement(By.id("labelTitle"));
+    wait.until(labelContains(label, "Not Found"));
+  }
+
+  @Test
+  public void testCanNotLoadWidgetIntoWebView() {
+    inputUrl.sendKeys("qtwidget://FindingTestWidget");
+    btnLoad.click();
+    WebElement label = driver.findElement(By.id("labelTitle"));
+    wait.until(labelNoContains(label, "Here Will Be HTML Title"));
+  }
+
+  @Test
+  public void testCanNotResizeInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.setSize(new Dimension(200, 200));
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotCloseInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    try {
+      driver.close();
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotMoveInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.setPosition(new Point(50, 50));
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotMaximizeInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.maximize();
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      // expected
+    }
+  }
+
+  private WebElement inputUrl;
+  private WebElement btnLoad;
+  private String currentWindow;
+
+  private ExpectedCondition<Boolean> windowUrlContains(final WebDriver webdriver, final String url) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver input) {
+        String currentUrl = webdriver.getCurrentUrl();
+        return currentUrl.contains(url);
+      }
+    };
+  }
+
+  private ExpectedCondition<Boolean> labelContains(final WebElement elem, final String text) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver input) {
+        String current = elem.getText();
+        return current.contains(text);
+      }
+    };
+  }
+
+  private ExpectedCondition<Boolean> labelNoContains(final WebElement elem, final String text) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver input) {
+        String current = elem.getText();
+        return !current.contains(text);
+      }
+    };
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ProxySettingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ProxySettingTest.java
new file mode 100644
index 00000000..dae3a7e0
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ProxySettingTest.java
@@ -0,0 +1,162 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.Proxy;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.qtwebkit.QtWebDriverService;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.testing.ProxyServer;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.WebDriverBuilder;
+
+import java.util.HashMap;
+import java.util.Map;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.junit.Assume.assumeTrue;
+import static org.openqa.selenium.remote.CapabilityType.PROXY;
+
+public class ProxySettingTest extends JUnit4TestBase {
+
+  private ProxyServer proxyServer;
+
+
+  @AfterClass
+  public static void cleanUpExistingDriver() {
+    JUnit4TestBase.removeDriver();
+  }
+
+  @Before
+  public void newProxyInstance() {
+    proxyServer = new ProxyServer();
+  }
+
+  @Before
+  public void avoidRemote() {
+    // TODO: Resolve why these tests don't work on the remote server
+    assumeTrue(TestUtilities.isLocal());
+  }
+
+  @Before
+  public void createDriver() throws Exception {  }
+
+  @Before
+  public void setUp() throws Exception {
+      JUnit4TestBase.removeDriver();
+  }
+
+  @After
+  public void deleteProxyInstance() {
+    if (proxyServer != null) {
+      proxyServer.destroy();
+    }
+  }
+
+  @Test
+  public void canConfigureProxyWithRequiredCapability() throws InterruptedException {
+
+    Proxy proxyToUse = proxyServer.asProxy();
+    DesiredCapabilities requiredCaps = new DesiredCapabilities();
+    requiredCaps.setCapability(PROXY, proxyToUse);
+
+    WebDriver driver = new WebDriverBuilder().setRequiredCapabilities(requiredCaps).get();
+
+    driver.get("http://www.diveintopython.net/toc/index.html");
+    driver.quit();
+
+    assertTrue("Proxy should have been called", proxyServer.hasBeenCalled("index.html"));
+  }
+
+  @Test
+  public void requiredProxyCapabilityShouldHavePriority() {
+    ProxyServer desiredProxyServer = new ProxyServer();
+    Proxy desiredProxy = desiredProxyServer.asProxy();
+    Proxy requiredProxy = proxyServer.asProxy();
+
+    DesiredCapabilities desiredCaps = new DesiredCapabilities();
+    desiredCaps.setCapability(PROXY, desiredProxy);
+    DesiredCapabilities requiredCaps = new DesiredCapabilities();
+    requiredCaps.setCapability(PROXY, requiredProxy);
+    WebDriver driver = new WebDriverBuilder().setDesiredCapabilities(desiredCaps).
+        setRequiredCapabilities(requiredCaps).get();
+    driver.get("http://www.diveintopython.net/toc/index.html");
+    driver.quit();
+
+    assertFalse("Desired proxy should not have been called.",
+                desiredProxyServer.hasBeenCalled("index.html"));
+    assertTrue("Required proxy should have been called.",
+               proxyServer.hasBeenCalled("index.html"));
+
+    desiredProxyServer.destroy();
+  }
+
+  @Test
+  public void canConfigureProxyWithDesiredCapability() {
+    Proxy proxyToUse = proxyServer.asProxy();
+    DesiredCapabilities caps = new DesiredCapabilities();
+    caps.setCapability(PROXY, proxyToUse);
+
+    WebDriver driver = new WebDriverBuilder().setDesiredCapabilities(caps).get();
+    driver.get("http://www.diveintopython.net/toc/index.html");
+    driver.quit();
+
+    assertTrue("Proxy should have been called", proxyServer.hasBeenCalled("index.html"));
+  }
+
+
+  @Test
+  public void testSystemProxy() {
+    Proxy proxyToUse = new Proxy();
+    proxyToUse.setProxyType(Proxy.ProxyType.SYSTEM);
+    DesiredCapabilities caps = new DesiredCapabilities();
+    caps.setCapability(PROXY, proxyToUse);
+
+    Map<String, String> environment = new HashMap<String, String>();
+    environment.put("http_proxy", "localhost:8080");
+    String libraryPath = System.getenv("LD_LIBRARY_PATH");
+    if (libraryPath != null) {
+      environment.put("LD_LIBRARY_PATH", libraryPath);
+    }
+    try {
+      QtWebKitDriver driver = new QtWebKitDriver(QtWebKitDriver.createExecutor(environment), caps);
+      driver.get("http://www.diveintopython.net/toc/index.html");
+      driver.quit();
+    } catch (RuntimeException e) {
+      fail("You should not be here...");
+    }
+
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ViewTransitionsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ViewTransitionsTest.java
new file mode 100644
index 00000000..b7862b25
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/ViewTransitionsTest.java
@@ -0,0 +1,79 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.io.IOException;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertTrue;
+
+public class ViewTransitionsTest  extends JUnit4TestBase {
+
+    String[] viewUrls;
+
+    @Before
+    public void setUp() {
+        String current = "";
+        try {
+            current = new java.io.File( "." ).getCanonicalPath();
+        } catch (IOException e) {
+            e.printStackTrace();
+            assertTrue(false);
+        }
+
+        viewUrls = new String[] {
+            "qtwidget://TextHandlingTestWidget",                        // widget
+            pages.colorPage,                                            // remote html
+            "file://"+current+"/common/src/web/banner.gif",             // local html
+            appServer.whereIs("quick1/FindingTest.qml"),                // remote qml
+            "file://"+current+"/common/src/web/quick1/FindingTest.qml"  // local qml
+        };
+    }
+
+    @Test
+    public void testViewTransitions() {
+        int srcLength = viewUrls.length;
+        int firstView = 0;
+        int secondView = 1;
+
+        while(firstView < srcLength) {
+            driver.get(viewUrls[firstView]);
+            assertEquals(viewUrls[firstView], driver.getCurrentUrl());
+
+            driver.get(viewUrls[secondView]);
+            assertEquals(viewUrls[secondView], driver.getCurrentUrl());
+
+            // get next pair
+            secondView++;
+            if (secondView == firstView) secondView++;
+            if (secondView >= srcLength) {
+                firstView++;
+                secondView = 0;
+            }
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WidgetAndWebViewTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WidgetAndWebViewTest.java
new file mode 100644
index 00000000..3d27eb8c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WidgetAndWebViewTest.java
@@ -0,0 +1,159 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+
+import static org.junit.Assert.assertEquals;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class WidgetAndWebViewTest  extends JUnit4TestBase {
+
+  @Before
+  public void setUp() {
+    driver.get("qtwidget://WidgetAndWebViewTestWindows");
+    currentWindow = driver.getWindowHandle();
+    inputURL = driver.findElement(By.id("inputURL"));
+    button = driver.findElement(By.id("openViewButton"));
+  }
+
+  @Test
+  public void testCanSwitchToNeededWebView() {
+    inputURL.sendKeys(pages.colorPage);
+    button.click();
+    String enteredUrl = inputURL.getText();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(titleIs("Color Page"));
+        break;
+      }
+    }
+    assertEquals(enteredUrl, driver.getCurrentUrl());
+    driver.close();
+    driver.switchTo().window(currentWindow);
+  }
+
+  @Test
+  public void testCanGetUrlFromWebView() {
+    inputURL.sendKeys(pages.colorPage);
+    button.click();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(windowUrlContains("colorPage.html"));
+        break;
+      }
+    }
+    driver.close();
+    driver.switchTo().window(currentWindow);
+    assertEquals("qtwidget://WidgetAndWebViewTestWindows", driver.getCurrentUrl());
+  }
+
+  @Test
+  public void testCanGetTitleFromWebView() {
+    inputURL.sendKeys(pages.colorPage);
+    button.click();
+
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(titleIs("Color Page"));
+        break;
+      }
+    }
+    driver.close();
+    driver.switchTo().window(currentWindow);
+    assertEquals("Test Widget", driver.getTitle());
+  }
+
+  @Test
+  public void testCanOpenWebViewNoDownloadPage() {
+    button.click();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+    assertEquals("about:blank", driver.getCurrentUrl());
+    driver.close();
+    driver.switchTo().window(currentWindow);
+  }
+
+  @Test
+  public void testCanDownloadPageIntoNoParentView() {
+    button.click();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+    driver.get(pages.colorPage);
+    assertEquals("Color Page", driver.getTitle());
+    driver.close();
+    driver.switchTo().window(currentWindow);
+  }
+
+  @Test
+  public void testCheckNumberOfWindows()  {
+    assertEquals(1, driver.getWindowHandles().size());
+    inputURL.sendKeys(pages.colorPage);
+    button.click();
+    assertEquals(2, driver.getWindowHandles().size());
+    button.click();
+    button.click();
+    assertEquals(4, driver.getWindowHandles().size());
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        driver.close();
+      }
+    } driver.switchTo().window(currentWindow);
+  }
+
+  private String currentWindow;
+  private WebElement inputURL;
+  private WebElement button;
+
+
+  private ExpectedCondition<Boolean> windowUrlContains(final String url) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver driver) {
+        String currentUrl = driver.getCurrentUrl();
+        return currentUrl.contains(url);
+      }
+    };
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithDeclarativeViewTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithDeclarativeViewTest.java
new file mode 100644
index 00000000..f75bf50a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithDeclarativeViewTest.java
@@ -0,0 +1,178 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.Dimension;
+import org.openqa.selenium.Point;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+
+import static org.junit.Assert.fail;
+
+public class WindowWithDeclarativeViewTest extends JUnit4TestBase {
+
+  @Before
+  public void setUp() throws Exception {
+    driver.get("qtwidget://WindowWithDeclarativeViewTestWidget");
+    inputUrl = driver.findElement(By.id("inputURL"));
+    btnLoad = driver.findElement(By.id("loadButton"));
+    currentWindow = driver.getWindowHandle();
+  }
+
+  @After
+  public void cleanUp() {
+    driver.switchTo().window(currentWindow);
+  }
+
+  @Test
+  public void testCanGetUrlFromInternalDeclarativeView() {
+    inputUrl.sendKeys(appServer.whereIs("quick1/FindingTest.qml"));
+    btnLoad.click();
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        wait.until(windowUrlContains(driver, "FindingTest.qml"));
+        break;
+      }
+    }
+  }
+
+  @Test
+  public void testCanNotLoadNotExistIntoDeclarativeView() {
+    inputUrl.sendKeys(appServer.whereIs("quick1/NoExist.qml"));
+    btnLoad.click();
+    WebElement label = driver.findElement(By.id("labelStatus"));
+    wait.until(labelContains(label, "Error"));
+  }
+
+  @Test
+  public void testCanNotLoadWidgetIntoDeclarativeView() {
+    inputUrl.sendKeys("qtwidget://FindingTestWidget");
+    btnLoad.click();
+    WebElement label = driver.findElement(By.id("labelStatus"));
+    wait.until(labelContains(label, "Error"));
+  }
+
+  @Test
+  public void testCanNotResizeInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.setSize(new Dimension(200, 200));
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotCloseInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    try {
+      driver.close();
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotMoveInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.setPosition(new Point(50, 50));
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      //expected
+    }
+  }
+
+  @Test
+  public void testCanNotMaximizeInternalView() {
+    for (String winHandle : driver.getWindowHandles()) {
+      if (!currentWindow.equals(winHandle)) {
+        driver.switchTo().window(winHandle);
+        break;
+      }
+    }
+
+    WebDriver.Window window = driver.manage().window();
+    try {
+      window.maximize();
+      fail("Should not have succeeded");
+    } catch (RuntimeException e) {
+      // expected
+    }
+  }
+
+  private WebElement inputUrl;
+  private WebElement btnLoad;
+  private String currentWindow;
+
+  private ExpectedCondition<Boolean> windowUrlContains(final WebDriver webdriver, final String url) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver input) {
+        String currentUrl = webdriver.getCurrentUrl();
+        return currentUrl.contains(url);
+      }
+    };
+  }
+
+  private ExpectedCondition<Boolean> labelContains(final WebElement elem, final String text) {
+    return new ExpectedCondition<Boolean>() {
+      @Override
+      public Boolean apply(WebDriver input) {
+        String current = elem.getText();
+        return current.contains(text);
+      }
+    };
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithSeparatedDeclarativeAndWebViewsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithSeparatedDeclarativeAndWebViewsTest.java
new file mode 100644
index 00000000..6d145638
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/WindowWithSeparatedDeclarativeAndWebViewsTest.java
@@ -0,0 +1,288 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.hybridtests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.NoSuchElementException;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class WindowWithSeparatedDeclarativeAndWebViewsTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() {
+        driver.get("qtwidget://WindowWithSeparatedDeclarativeAndWebViewsTestWidget");
+        currentWindow = driver.getWindowHandle();
+        inputWebURL = driver.findElement(By.id("inputWebURL"));
+        buttonToWeb = driver.findElement(By.id("openWebViewButton"));
+        inputQmlURL = driver.findElement(By.id("inputQmlURL"));
+        buttonToQml = driver.findElement(By.id("openQmlViewButton"));
+        assertEquals(1, driver.getWindowHandles().size());
+    }
+
+    @After
+    public void cleanUp() {
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                driver.close();
+            }
+        }
+        driver.switchTo().window(currentWindow);
+    }
+
+    @Test
+    public void testCanGetUrlFromQmlView() {
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/FindingTest.qml"));
+        buttonToQml.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                wait.until(windowUrlContains(driver, "FindingTest.qml"));
+                break;
+            }
+        }
+    }
+
+    @Test
+    public void testCanSwitchToNeededQMLViewAndBack() {
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/FindingTest.qml"));
+        buttonToQml.click();
+        String enteredUrl = inputQmlURL.getText();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                break;
+            }
+        }
+        assertEquals(enteredUrl, driver.getCurrentUrl());
+        driver.close();
+        driver.switchTo().window(currentWindow);
+        assertEquals("qtwidget://WindowWithSeparatedDeclarativeAndWebViewsTestWidget",
+                     driver.getCurrentUrl());
+
+    }
+
+    @Test
+    public void testCanOpenViewsForEmptyPage() {
+        buttonToWeb.click();
+        buttonToQml.click();
+        assertEquals(3, driver.getWindowHandles().size());
+    }
+
+    @Test
+    public void testCanSwitchBetweenQmlViewAndWebView() {
+        inputWebURL.sendKeys(pages.colorPage);
+        buttonToWeb.click();
+        String webWindow = null;
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                webWindow = winHandle;
+                driver.switchTo().window(webWindow);
+                wait.until(windowUrlContains(driver, "colorPage.html"));
+                break;
+            }
+        }
+        assertNotNull(webWindow);
+        driver.switchTo().window(currentWindow);
+        wait.until(titleIs("Test Widget"));
+
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/ClickTest.qml"));
+        buttonToQml.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                if (!webWindow.equals(winHandle)) {
+                    driver.switchTo().window(winHandle);
+                    wait.until(windowUrlContains(driver, "ClickTest.qml"));
+                    break;
+                }
+            }
+        }
+
+        driver.switchTo().window(webWindow);
+        wait.until(windowUrlContains(driver, "colorPage.html"));
+    }
+
+    @Test
+    public void testCanOpenQmlViewAndWebViewTogether() {
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/ClickTest.qml"));
+        buttonToQml.click();
+        String qmlWindow = null;
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                qmlWindow = winHandle;
+                driver.switchTo().window(qmlWindow);
+                wait.until(windowUrlContains(driver, "ClickTest.qml"));
+                break;
+            }
+        }
+
+        assertNotNull(qmlWindow);
+        driver.switchTo().window(currentWindow);
+        inputWebURL.sendKeys(pages.colorPage);
+        buttonToWeb.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                if (!qmlWindow.equals(winHandle)) {
+                    driver.switchTo().window(winHandle);
+                    wait.until(windowUrlContains(driver, "colorPage.html"));
+                    break;
+                }
+            }
+        }
+
+    }
+
+    @Test
+    public void testCanOpenAndCloseQmlViewAndWebView() {
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/ClickTest.qml"));
+        buttonToQml.click();
+        String qmlWindow = null;
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                qmlWindow = winHandle;
+                driver.switchTo().window(qmlWindow);
+                wait.until(windowUrlContains(driver, "ClickTest.qml"));
+                break;
+            }
+        }
+
+        assertNotNull(qmlWindow);
+        driver.switchTo().window(currentWindow);
+        assertFalse(driver.getWindowHandle().equals(qmlWindow));
+
+        inputWebURL.sendKeys(pages.colorPage);
+        buttonToWeb.click();
+        String webWindow = null;
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                if (!qmlWindow.equals(winHandle)) {
+                    webWindow = winHandle;
+                    driver.switchTo().window(webWindow);
+                    wait.until(windowUrlContains(driver, "colorPage.html"));
+                    break;
+                }
+            }
+        }
+        assertNotNull(qmlWindow);
+        assertTrue(driver.getWindowHandles().contains(qmlWindow));
+        assertTrue(driver.getWindowHandles().contains(webWindow));
+
+        driver.switchTo().window(qmlWindow);
+        driver.close();
+        assertFalse(driver.getWindowHandles().contains(qmlWindow));
+
+        driver.switchTo().window(webWindow);
+        driver.close();
+        assertFalse(driver.getWindowHandles().contains(webWindow));
+
+        driver.switchTo().window(currentWindow);
+    }
+
+    @Test
+    public void testCanDownloadQmlIntoNoParentView() {
+        buttonToQml.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                break;
+            }
+        }
+        driver.get(appServer.whereIs("quick1/FindingTest.qml"));
+        wait.until(windowUrlContains(driver, "FindingTest.qml"));
+    }
+
+    @Test
+    public void testCanNotLoadQmlToWebView() {
+        inputWebURL.sendKeys(appServer.whereIs("quick1/FindingTest.qml"));
+        buttonToWeb.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                try {
+                    driver.findElement(By.id("inputElement"));
+                    fail("You don't have to be here...");
+                } catch (NoSuchElementException e) {
+                    //expected
+                }
+                break;
+            }
+        }
+    }
+
+    @Test
+    public void testCanNotLoadWebViewToQmlView() {
+        inputQmlURL.sendKeys(pages.colorPage);
+        buttonToQml.click();
+        for (String winHandle : driver.getWindowHandles()) {
+            if (!currentWindow.equals(winHandle)) {
+                driver.switchTo().window(winHandle);
+                wait.until(windowUrlContains(driver, "colorPage.html"));
+                break;
+            }
+        }
+    }
+
+    @Test
+    public void testCheckNumberOfWindows() {
+        assertEquals(1, driver.getWindowHandles().size());
+        inputWebURL.sendKeys(pages.colorPage);
+        buttonToWeb.click();
+        assertEquals(2, driver.getWindowHandles().size());
+        inputQmlURL.sendKeys(appServer.whereIs("quick1/FindingTest.qml"));
+        buttonToQml.click();
+        buttonToQml.click();
+        assertEquals(4, driver.getWindowHandles().size());
+    }
+
+    private String currentWindow;
+    private WebElement inputWebURL;
+    private WebElement buttonToWeb;
+    private WebElement inputQmlURL;
+    private WebElement buttonToQml;
+
+    private ExpectedCondition<Boolean> windowUrlContains(final WebDriver webdriver, final String url) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                String currentUrl = webdriver.getCurrentUrl();
+                return currentUrl.contains(url);
+            }
+        };
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/build.desc b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/build.desc
new file mode 100644
index 00000000..38166b29
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/hybridtests/build.desc
@@ -0,0 +1,43 @@
+java_test(name = "hybrid_tests_qt4",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit" },
+  ],
+
+  srcs = ["HybridWebDriverQt4Tests.java",
+    "CapabilitiesTest.java",
+    "InternalWebViewTest.java",
+    "ViewTransitionsTest.java",
+    "WidgetAndWebViewTest.java",
+    "ProxySettingTest.java",
+    "WindowWithDeclarativeViewTest.java",
+    "WindowWithSeparatedDeclarativeAndWebViewsTest.java",
+    "CustomCapabilitiesQt4Test.java",
+    "EmbeddedWebViewTest.java",
+  ],
+
+  deps = [
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//java/client/test/org/openqa/selenium/testing:proxy",
+    "//third_party/java/little_proxy",
+    "//third_party/java/netty",
+  ])
+
+java_test(name = "hybrid_tests_qt5",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit" },
+  ],
+
+  srcs = ["HybridWebDriverQt5Tests.java",
+    "CapabilitiesTest.java",
+    "InternalWebViewTest.java",
+    "WidgetAndWebViewTest.java",
+    "ProxySettingTest.java",
+    "CustomCapabilitiesQt5Test.java"
+    ],
+
+  deps = [
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//java/client/test/org/openqa/selenium/testing:proxy",
+    "//third_party/java/little_proxy",
+    "//third_party/java/netty",
+  ])
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickScrollingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickScrollingTest.java
new file mode 100644
index 00000000..ab86dde5
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickScrollingTest.java
@@ -0,0 +1,79 @@
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.MoveTargetOutOfBoundsException;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.testing.Ignore.Driver.ANDROID;
+import static org.openqa.selenium.testing.Ignore.Driver.HTMLUNIT;
+
+@Ignore(value = {ANDROID, HTMLUNIT}, reason = "Android: Race condition when click returns, "
+    + "the UI did not finish scrolling..\nHtmlUnit: Scrolling requires rendering")
+public class ClickScrollingTest extends JUnit4TestBase {
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://ClickScrollingTestWidget");
+    }
+
+  @Test
+  public void testShouldScrollToClickOnAnElementHiddenByOverflow() {
+    WebElement buttonHiddenByOverflow = driver.findElement(By.id("buttonHiddenByOverflow"));
+    try {
+      buttonHiddenByOverflow.click();
+    } catch (MoveTargetOutOfBoundsException e) {
+      fail("Should not be out of bounds: " + e.getMessage());
+    }
+  }
+
+  @Test
+  public void testShouldBeAbleToClickOnAnElementHiddenByOverflow() {
+      WebElement buttonHiddenByOverflow = driver.findElement(By.id("buttonHiddenByOverflow"));
+      buttonHiddenByOverflow.click();
+      assertEquals("clicked", driver.findElement(By.id("buttonHiddenByOverflow")).getText());
+  }
+
+  @Test
+  public void testShouldBeAbleToClickRadioButtonScrolledIntoView() {
+    driver.findElement(By.id("visibleRadioButton")).click();
+    // If we don't throw, we're good
+  }
+  
+  @Test
+  public void testShouldScrollOverflowElementsIfClickPointIsOutOfViewButElementIsInView() {
+    driver.findElement(By.id("partiallyVisibleRadioButton")).click();
+    assertEquals("clicked", driver.findElement(By.id("partiallyVisibleRadioButton")).getText());
+  }
+
+  @Test(expected = MoveTargetOutOfBoundsException.class)
+  public void testShouldNotBeAbleToClickElementThatIsOutOfViewInANonScrollableWidget() {
+      WebElement element = driver.findElement(By.id("outOfViewButton"));
+      element.click();
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickTest.java
new file mode 100644
index 00000000..c8551b0f
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ClickTest.java
@@ -0,0 +1,63 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Test;
+import org.junit.Before;
+
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+public class ClickTest extends JUnit4TestBase {
+
+
+    @Before
+     public void setUp() throws Exception {
+        driver.get("qtwidget://ClickTestWidget");
+    }
+
+    @Test
+    public void testCanClickOnAPushButton() {
+        driver.findElement(By.id("pushBtn")).click();
+
+        wait.until(titleIs("CLick Test Window"));
+    }
+
+    @Test
+    public void testCanClickOnACheckBox() {
+        driver.findElement(By.id("checkBox")).click();
+
+        wait.until(titleIs("CLick Test Window"));
+    }
+
+    @Test
+    public void testClickingOnButtonInScrollArea() {
+        driver.findElement(By.id("btnOnScroll")).click();
+
+        wait.until(titleIs("CLick Test Window"));
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/CoordinatesTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/CoordinatesTest.java
new file mode 100644
index 00000000..925175bb
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/CoordinatesTest.java
@@ -0,0 +1,86 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.Point;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertThat;
+import static org.hamcrest.Matchers.is;
+
+
+public class CoordinatesTest extends JUnit4TestBase {
+
+    @Before
+    public void setUpWebDriver()
+    {
+        driver.get("qtwidget://CoordinatesTestWidget");
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInViewPort() {
+        assertThat(getLocationOnScreen(By.id("scrollArea")), is(new Point(11, 11)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnZeroSizeElement() {
+      Point elementLocation =  getLocationOnScreen(By.id("zeroSizeLabel"));
+      boolean isElementLocatedCorrectly = true;
+        if(elementLocation.x > 22 || elementLocation.x < 20)
+          isElementLocatedCorrectly = false;
+        else if(elementLocation.y > 22 || elementLocation.y < 20)
+          isElementLocatedCorrectly = false;
+        assertThat(isElementLocatedCorrectly, is(true));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfATransparentElement() {
+      Point elementLocation =  getLocationOnScreen(By.id("transparentLabel"));
+      boolean isElementLocatedCorrectly = true;
+      if(elementLocation.x > 22 || elementLocation.x < 20)
+        isElementLocatedCorrectly = false;
+      else if(elementLocation.y > 25 || elementLocation.y < 23)
+        isElementLocatedCorrectly = false;
+      assertThat(isElementLocatedCorrectly, is(true));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAHiddenElement() {
+        assertNotNull(getLocationOnScreen(By.id("hiddenLabel")));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnInvisibleElement() {
+        assertNotNull(getLocationOnScreen(By.id("unvisibleLabel")));
+    }
+
+    private Point getLocationOnScreen(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().onScreen();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementAttributeTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementAttributeTest.java
new file mode 100644
index 00000000..54b14e83
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementAttributeTest.java
@@ -0,0 +1,202 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.By;
+import org.openqa.selenium.InvalidElementStateException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.core.IsEqual.equalTo;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+public class ElementAttributeTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://ElementAttributeTestWidget");
+    }
+
+    @Test
+    public void testElementsDisabledOrEnabled() {
+        WebElement inputElement = driver.findElement(By.id("notWorkingButton"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), is(false));
+
+        inputElement = driver.findElement(By.id("workingButton"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), is(true));
+    }
+
+    @Test
+    public void testElementsDisplayedOrNo() {
+
+        WebElement inputElement = driver.findElement(By.id("notWorkingButton"));
+        assertThat(inputElement.isDisplayed(), is(false));
+
+        inputElement = driver.findElement(By.id("workingButton"));
+        assertThat(inputElement.isDisplayed(), is(true));
+    }
+
+    @Test
+    public void testGetTextFromPushButton()
+    {
+        WebElement element = driver.findElement(By.id("workingButton"));
+        assertThat(element.getAttribute("text"), is("Working Button"));
+        assertThat(element.getText(), is("Working Button"));
+    }
+
+    @Test
+    public void testGetTextFromRadioButton()
+    {
+        WebElement element = driver.findElement(By.id("defaultSelected"));
+        assertThat(element.getAttribute("text"), is("Blue"));
+        assertThat(element.getText(), is("Blue"));
+    }
+
+    @Test
+    public void testShouldThrowExceptionIfSendingKeysToElementDisabled() {
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement1"));
+        assertThat(disabledTextElement1.isEnabled(),is(false));
+        try {
+            disabledTextElement1.sendKeys("foo");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            e.printStackTrace();
+            // Expected
+        }
+        assertThat(disabledTextElement1.getText(), is(""));
+
+        WebElement disabledTextElement2 = driver.findElement(By.id("disabledTextElement2"));
+        assertThat(disabledTextElement2.isEnabled(),is(false));
+        try {
+            disabledTextElement2.sendKeys("bar");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            // Expected
+        }
+        assertThat(disabledTextElement2.getText(), is(""));
+    }
+
+    @Test
+    public void testShouldIndicateWhenRadioButtonSelect() throws InterruptedException {
+
+        WebElement radioBtnSelected = driver.findElement(By.id("defaultSelected"));
+        WebElement radioBtnNoSelected = driver.findElement(By.id("noSelected"));
+
+        assertTrue(radioBtnSelected.isSelected());
+        assertFalse(radioBtnNoSelected.isSelected());
+        radioBtnNoSelected.click();
+        assertTrue(radioBtnNoSelected.isSelected());
+    }
+
+    @Test
+    public void testShouldOnlyReturnTheValueOfCheckedForRadioButtonsIfItIsSet() {
+        WebElement noSelected = driver.findElement(By.id("noSelected"));
+        WebElement initiallySelected = driver.findElement(By.id("defaultSelected"));
+
+        assertThat(noSelected.getAttribute("checked"), equalTo("false"));
+        assertThat(initiallySelected.getAttribute("checked"), equalTo("true"));
+    }
+
+    @Test
+    public void testShouldIndicateWhenCheckButtonSelect() {
+
+        WebElement check1 = driver.findElement(By.id("checkBoxWithText"));
+        assertFalse(check1.isSelected());
+        check1.click();
+        assertTrue(check1.isSelected());
+
+        WebElement check2 = driver.findElement(By.id("checkBoxWithoutText"));
+        assertFalse(check2.isSelected());
+        check2.click();
+        assertTrue(check2.isSelected());
+    }
+
+    @Test
+    public void testShouldIndicateWhenATextAreaIsDisabled() {
+        WebElement textArea= driver.findElement(By.id("areaWithDefaultText"));
+        assertThat(textArea.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldReturnTheContentsOfTextArea() {
+
+        WebElement textArea= driver.findElement(By.id("areaWithDefaultText"));
+        assertThat(textArea.getText(), is("Example text"));
+    }
+
+     @Test
+     public void testCanRetrieveTheCurrentTextFormTextArea() {
+         WebElement textArea = driver.findElement(By.id("workingArea"));
+         assertEquals("", textArea.getText());
+         textArea.sendKeys("hello world");
+         assertEquals("hello world", textArea.getText());
+     }
+
+    @Test
+    public void testCanRetrieveTheCurrentTextFormLineEdit() {
+        WebElement txt = driver.findElement(By.id("enabeledTextElement"));
+        txt.sendKeys("Hello");
+        assertEquals("Hello", txt.getText());
+        assertThat(txt.getText(), is("Hello"));
+        txt.clear();
+        assertEquals("", txt.getText());
+        txt.sendKeys("hello world");
+
+        assertEquals("hello world", txt.getText());
+        assertThat(txt.getText(), is("hello world"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormFieldAsEmailInput() {
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        assertEquals("", element.getText());
+        element.sendKeys("hello@example.com");
+        assertEquals("hello@example.com", element.getText());
+    }
+
+    @Test
+    public void testIsVisibleLabel() {
+        WebElement element = driver.findElement(By.id("displayedLabel"));
+        assertThat(element.isDisplayed(), is(true));
+
+        element = driver.findElement(By.id("notDisplayedLabel"));
+        assertThat(element.isDisplayed(), is(false));
+    }
+
+    @Test
+    public void testReturnTextOfLabel() {
+        WebElement element = driver.findElement(By.id("displayedLabel"));
+        assertThat(element.getAttribute("text"), is("Visible Label"));
+        assertThat(element.getText(), is("Visible Label"));
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementSelectingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementSelectingTest.java
new file mode 100644
index 00000000..ab4ab727
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/ElementSelectingTest.java
@@ -0,0 +1,253 @@
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedConditions;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+
+import static org.hamcrest.Matchers.is;
+
+public class ElementSelectingTest extends JUnit4TestBase {
+  private static final boolean UNSELECTED = false;
+  private static final boolean SELECTED = true;
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://ElementSelectingTestWidget");
+    }
+
+  @Test
+  public void testShouldBeAbleToSelectAnEnabledUnselectedCheckbox() {
+    assertCanSelect(enabledUnselectedCheckbox());
+  }
+
+  @Test
+  public void testShouldBeAbleToSelectAnEnabledUnselectedRadioButton() {
+    assertCanSelect(enabledUnselectedRadioButton());
+  }
+
+  @Test
+  public void testShouldNotBeAbleToSelectADisabledCheckbox() {
+    assertCannotSelect(disabledUnselectedCheckbox());
+  }
+
+  @Test
+  public void testShouldNotBeAbleToSelectADisabledCheckboxDisabledWithRandomString() {
+    assertCannotSelect(randomlyDisabledSelectedCheckbox());
+  }
+
+  @Test
+  public void testShouldNotBeAbleToSelectADisabledRadioButton() {
+    assertCannotSelect(disabledUnselectedRadioButton());
+  }
+
+  @Test
+  public void testShouldNotBeAbleToSelectADisabledRadioButtonDisabledWithRandomString() {
+    assertCannotSelect(randomlyDisabledUnselectedRadioButton());
+  }
+
+  @Test
+  public void testSelectingRadioButtonShouldUnselectItsSibling() {
+    WebElement originallySelected = enabledSelectedRadioButton();
+    assertSelected(originallySelected);
+
+    WebElement toSelect = enabledUnselectedRadioButton();
+    assertNotSelected(toSelect);
+
+    toSelect.click();
+    assertNotSelected(originallySelected);
+    assertSelected(toSelect);
+  }
+
+  @Test
+  public void testShouldBeAbleToToggleAnEnabledUnselectedCheckbox() {
+    assertCanToggle(enabledUnselectedCheckbox());
+  }
+
+  @Test
+  public void testShouldBeAbleToToggleAnEnabledSelectedCheckbox() {
+    assertCanToggle(enabledSelectedCheckbox());
+  }
+
+  @Test
+  public void testClickingOnASelectedRadioButtonShouldLeaveItSelected() {
+    WebElement button = enabledSelectedRadioButton();
+    assertTrue(button.isSelected());
+
+    button.click();
+
+    assertTrue(button.isSelected());
+  }
+
+  @Test
+  public void testShouldBeAbleToToggleSelectableCheckboxByClickingOnIt() {
+    WebElement checkbox = enabledUnselectedCheckbox();
+    assertNotSelected(checkbox);
+
+    checkbox.click();
+    assertSelected(checkbox);
+
+    checkbox.click();
+    assertNotSelected(checkbox);
+  }
+
+  @Test
+  public void testShouldBeAbleToSelectSelectableRadioButtonByClickingOnIt() {
+    WebElement radioButton = enabledUnselectedRadioButton();
+    assertNotSelected(radioButton);
+
+    radioButton.click();
+    assertSelected(radioButton);
+
+    radioButton.click();
+    assertSelected(radioButton);
+  }
+
+  @Test
+  public void testClickingDisabledSelectedCheckboxShouldBeNoop() {
+    assertClickingPreservesCurrentlySelectedStatus(randomlyDisabledSelectedCheckbox());
+  }
+
+  @Test
+  public void testClickingDisabledUnselectedCheckboxShouldBeNoop() {
+    assertClickingPreservesCurrentlySelectedStatus(disabledUnselectedCheckbox());
+  }
+
+  @Test
+  public void testClickingDisabledSelectedRadioButtonShouldBeNoop() {
+    assertClickingPreservesCurrentlySelectedStatus(disabledSelectedRadioButton());
+  }
+
+  @Test
+  public void testClickingDisabledUnselectedRadioButtonShouldBeNoop() {
+    assertClickingPreservesCurrentlySelectedStatus(disabledUnselectedRadioButton());
+  }
+
+
+  private void assertNotSelected(WebElement element) {
+    assertSelected(element, UNSELECTED);
+  }
+
+  private void assertSelected(WebElement element) {
+    assertSelected(element, SELECTED);
+  }
+
+  private void assertSelected(WebElement element, boolean isSelected) {
+    wait.until(ExpectedConditions.elementSelectionStateToBe(element, isSelected));
+    assertThat(
+        String.format("Expected element %s to be %s but was %s",
+            describe(element), selectedToString(isSelected), selectedToString(!isSelected)),
+        element.isSelected(), is(isSelected));
+  }
+
+  private void assertCannotSelect(WebElement element) {
+    boolean previous = element.isSelected();
+    element.click();
+    assertEquals(previous, element.isSelected());
+  }
+
+  private void assertCanSelect(WebElement element) {
+    assertNotSelected(element);
+
+    element.click();
+    assertSelected(element);
+  }
+
+  private void assertClickingPreservesCurrentlySelectedStatus(WebElement element) {
+    boolean currentSelectedStatus = element.isSelected();
+    element.click();
+    assertSelected(element, currentSelectedStatus);
+  }
+
+  private static String selectedToString(boolean isSelected) {
+    return isSelected ? "[selected]" : "[not selected]";
+  }
+
+  private static String describe(WebElement element) {
+    return element.getAttribute("id");
+  }
+
+  private void assertCanToggle(WebElement element) {
+    final boolean originalState = element.isSelected();
+
+    assertSelected(element, originalState);
+
+    assertTogglingSwapsSelectedStateFrom(element, originalState);
+    assertTogglingSwapsSelectedStateFrom(element, !originalState);
+  }
+
+  private void assertTogglingSwapsSelectedStateFrom(WebElement element, boolean originalState) {
+    element.click();
+    boolean isNowSelected = element.isSelected();
+    assertThat(
+        String.format("Expected element %s to have been toggled to %s but was %s",
+            describe(element),
+            selectedToString(!originalState),
+            selectedToString(originalState)),
+        isNowSelected, is(!(originalState)));
+    assertSelected(element, !originalState);
+  }
+
+  // TODO: Test disabled multi-selects
+  // TODO: Test selecting options
+
+
+  private WebElement enabledUnselectedCheckbox() {
+    return driver.findElement(By.id("checky"));
+  }
+
+  private WebElement enabledSelectedCheckbox() {
+    return driver.findElement(By.id("checkedchecky"));
+  }
+
+  private WebElement disabledUnselectedCheckbox() {
+    return driver.findElement(By.id("disabledchecky"));
+  }
+
+  private WebElement randomlyDisabledSelectedCheckbox() {
+    return driver.findElement(By.id("randomly_disabled_checky"));
+  }
+
+  private WebElement enabledUnselectedRadioButton() {
+    return driver.findElement(By.id("peas"));
+  }
+
+  private WebElement enabledSelectedRadioButton() {
+    return driver.findElement(By.id("cheese_and_peas"));
+  }
+
+  private WebElement disabledSelectedRadioButton() {
+    return driver.findElement(By.id("lone_disabled_selected_radio"));
+  }
+
+  private WebElement disabledUnselectedRadioButton() {
+    return driver.findElement(By.id("nothing"));
+  }
+
+  private WebElement randomlyDisabledUnselectedRadioButton() {
+    return driver.findElement(By.id("randomly_disabled_nothing"));
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FindingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FindingTest.java
new file mode 100644
index 00000000..a41f3224
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FindingTest.java
@@ -0,0 +1,85 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.NoSuchElementException;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.logging.Logger;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.*;
+
+
+public class FindingTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(FindingTest.class.getName());
+
+    @Before
+    public void createWebDriver() {
+        driver.get("qtwidget://FindingTestWidget");
+    }
+
+    @Test
+    public void testCanFindSimpleControl() {
+        assertTrue(driver.findElement(By.id("textEdit")).isDisplayed());
+    }
+
+    @Test
+    public void testCanFindHiddenControl() {
+        assertNotNull(driver.findElement(By.id("hiddenLabel")));
+    }
+
+    @Test
+    public void testCanFindControlByClassName() {
+        assertNotNull(driver.findElement(By.className("QTextEdit")));
+    }
+
+    @Test
+    public void testCanFindHiddenControlByClassName() {
+        assertNotNull(driver.findElement(By.className("QLabel")));
+    }
+
+    @Test
+    public void testCanNotFindNonExistElementByClassName() {
+        try {
+            assertNull(driver.findElement(By.className("QRadioButton")));
+        } catch (RuntimeException e) {
+            //  this is expected
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+
+    @Test
+    public void testCanNotFindNonExistElementById() {
+        try {
+            driver.findElement(By.id("unrealId"));
+        } catch (RuntimeException e) {
+            //  this is expected
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FormHandlingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FormHandlingTest.java
new file mode 100644
index 00000000..340d3986
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/FormHandlingTest.java
@@ -0,0 +1,189 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class FormHandlingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://FormHandlingTestWidget");
+    }
+
+    @Test
+    public void testShouldClickOnSubmitInputElements() {
+        WebElement element = driver.findElement(By.id("changeTitleButton"));
+        element.click();
+
+        assertThat(driver.getTitle(), equalTo("We Arrive Here"));
+    }
+
+    @Test
+    public void testClickingOnUnclickableElementsDoesNothing() {
+
+        WebElement element =driver.findElement(By.xpath("//QLabel"));
+        try {
+            element.click();
+        } catch (Exception e) {
+            e.printStackTrace();
+            fail("Clicking on the unclickable should be a no-op");
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToClickImageButtons() {
+        driver.findElement(By.id("imageButton")).click();
+        assertThat(driver.getTitle(), equalTo("We Arrive Here"));
+    }
+
+   @Test
+    public void testShouldNotBeAbleToFindAFormThatDoesNotExist() {
+
+        try {
+            driver.findElement(By.id("there is no spoon")).click();
+            fail("Should not have succeeded");
+        } catch (RuntimeException e) {
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToEnterTextIntoATextAreaBySettingItsValue() {
+        WebElement textarea = driver.findElement(By.id("workingArea"));
+        textarea.clear();
+        String cheesy = "brie and cheddar";
+        textarea.sendKeys(cheesy);
+        assertThat(textarea.getText(), equalTo(cheesy));
+    }
+
+    @Test
+    public void testSendKeysKeepsCapitalization() {
+        WebElement textarea = driver.findElement(By.id("workingArea"));
+        textarea.clear();
+        String cheesey = "BrIe And CheDdar";
+        textarea.sendKeys(cheesey);
+        assertThat(textarea.getText(), equalTo(cheesey));
+    }
+
+    @Test
+    public void testShouldEnterDataIntoFormFields() {
+        WebElement element = driver.findElement(By.xpath("//QLineEdit[@id='inputElement']" ));
+        String originalValue = element.getText();
+        assertThat(originalValue, equalTo("Example text"));
+
+        element.clear();
+        element.sendKeys("some text");
+
+        String newFormValue = element.getText();
+        assertThat(newFormValue, equalTo("some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextInInputs() {
+        WebElement element = driver.findElement(By.id("inputElement"));
+        element.clear();
+        element.sendKeys("some");
+        String value = element.getText();
+        assertThat(value, is("some"));
+
+        element.sendKeys(" text");
+        value = element.getText();
+        assertThat(value, is("some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextInInputsWithExistingValue() {
+        WebElement element = driver.findElement(By.id("inputElement"));
+        element.sendKeys(". Some text");
+        String value = element.getText();
+
+        assertThat(value, is("Example text. Some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextinTextAreas() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        assertThat(element.getText(), is("Example text"));
+
+        element.sendKeys(". Some text");
+        String value = element.getText();
+        // for QTextEdit and QPlainTextEdit cursor set in the begin default text
+        // and sendKeys() insert text before set by default
+        assertThat(value, is(". Some textExample text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextinTextAreasToTextSendBefore() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        element.clear();
+
+        element.sendKeys("Example text");
+        element.sendKeys(". Some text");
+        String value = element.getText();
+        assertThat(value, is("Example text. Some text"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClearTextFromInputElements() {
+        WebElement element = driver.findElement(By.id("emptyInput"));
+        element.sendKeys("Some text");
+        String value = element.getText();
+        assertThat(value.length(), is(greaterThan(0)));
+
+        element.clear();
+        value = element.getText();
+
+        assertThat(value.length(), is(0));
+    }
+
+    @Test
+    public void testEmptyTextBoxesShouldReturnAnEmptyStringNotNull() {
+        WebElement emptyTextBox = driver.findElement(By.id("emptyInput"));
+        assertEquals(emptyTextBox.getText(), "");
+    }
+
+    @Test
+    public void testShouldBeAbleToClearTextFromTextAreas() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        element.sendKeys("Some text");
+        String value = element.getText();
+        assertThat(value.length(), is(greaterThan(0)));
+
+        element.clear();
+        value = element.getText();
+
+        assertThat(value.length(), is(0));
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MenuTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MenuTest.java
new file mode 100644
index 00000000..37b825c5
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MenuTest.java
@@ -0,0 +1,89 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+import java.util.logging.Logger;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.SauceDriver;
+
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+import static org.openqa.selenium.testing.Ignore.Driver.CHROME;
+import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+
+public class MenuTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(MenuTest.class.getName());
+
+    @Before
+    public void setUp()
+    {
+        driver.get("qtwidget://MenuTestWidget");
+    }
+
+    @Test
+    public void testFindMenuItem() {
+        WebElement menuItem = driver.findElement(By.xpath("//QAction[@text='Action_1_1']"));
+
+        assertThat(menuItem.getText(), is(equalTo("Action_1_1")));
+    }
+
+    @Test
+    public void testFindNestedMenuItem() {
+        WebElement menuItem = driver.findElement(By.xpath("//QAction[@text='Action_2_1_1']"));
+
+        assertThat(menuItem.getText(), is(equalTo("Action_2_1_1")));
+    }
+
+    @Test
+    public void testActivateMenuItem() {
+        WebElement menuItem = driver.findElement(By.xpath("//QAction[@text='Action_1_2']"));
+        WebElement statusEl = driver.findElement(By.id("statusLabel"));
+
+        menuItem.click();
+
+        assertThat(statusEl.getText(), is(equalTo("Menu 1, Action 2")));
+    }
+
+    @Test
+    public void testActivateNestedMenuItem() {
+        WebElement menuItem = driver.findElement(By.xpath("//QAction[@text='Action_2_1_1']"));
+        WebElement statusEl = driver.findElement(By.id("statusLabel"));
+
+        menuItem.click();
+
+        assertThat(statusEl.getText(), is(equalTo("Menu 2-1, Action 1")));
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MiscTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MiscTest.java
new file mode 100644
index 00000000..524dbc2f
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/MiscTest.java
@@ -0,0 +1,73 @@
+/*
+Copyright 2012 Software Freedom Conservancy
+Copyright 2007-2012 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Test;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.xml.sax.ErrorHandler;
+import org.xml.sax.InputSource;
+import org.xml.sax.SAXException;
+import org.xml.sax.SAXParseException;
+
+import javax.xml.parsers.DocumentBuilder;
+import javax.xml.parsers.DocumentBuilderFactory;
+
+import java.io.ByteArrayInputStream;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.*;
+
+public class MiscTest extends JUnit4TestBase {
+
+
+    public class SimpleErrorHandler implements ErrorHandler {
+        public void warning(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+
+        public void error(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+
+        public void fatalError(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+    }
+
+  @Test
+  public void testShouldReturnTheSourceOfAPage() {
+      //There is no particular reason to use ClickScrollingTest, we just need QWidget with elements
+    driver.get("qtwidget://ClickScrollingTestWidget");
+
+    String source = driver.getPageSource().toLowerCase();
+
+      DocumentBuilderFactory factory = DocumentBuilderFactory.newInstance();
+      factory.setValidating(false);
+      factory.setNamespaceAware(true);
+
+// the "parse" method also validates XML, will throw an exception if misformatted
+      try{
+        DocumentBuilder builder = factory.newDocumentBuilder();
+        builder.setErrorHandler(new SimpleErrorHandler());
+        org.w3c.dom.Document document = builder.parse(new InputSource(new ByteArrayInputStream(source.getBytes("utf-8"))));
+      } catch(Exception e){
+          fail("Exception " + e + " was throwed, when no exception expected!");
+          e.printStackTrace();
+      }
+  }
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt4Tests.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt4Tests.java
new file mode 100644
index 00000000..57965f34
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt4Tests.java
@@ -0,0 +1,66 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.qtwebkit.nativetests.interactions.InteractionTests;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        WindowTest.class,
+        MenuTest.class,
+        ClickTest.class,
+        FindingTest.class,
+        CoordinatesTest.class,
+        ClickScrollingTest.class,
+        TakesScreenshotTest.class,
+        ElementAttributeTest.class,
+        ElementSelectingTest.class,
+        TypingTest.class,
+        TextHandlingTest.class,
+        FormHandlingTest.class,
+        MiscTest.class,
+        XPathElementFindingTest.class,
+        StaleElementReferenceTest.class,
+        VisibilityTest.class,
+        InteractionTests.class
+})
+public class NativeWebDriverQt4Tests {
+    @BeforeClass
+    public static void prepareCommonEnvironment() {
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+        String testsName = NativeWebDriverQt4Tests.class.getName();
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class).getStatisticCommands().writeToXml(testsName);
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt5Tests.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt5Tests.java
new file mode 100644
index 00000000..7815ab0f
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/NativeWebDriverQt5Tests.java
@@ -0,0 +1,68 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.qtwebkit.nativetests.interactions.InteractionTests;
+import org.openqa.selenium.qtwebkit.nativetests.interactions.touch.TouchTests;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        WindowTest.class,
+        MenuTest.class,
+        ClickTest.class,
+        FindingTest.class,
+        CoordinatesTest.class,
+        ClickScrollingTest.class,
+        TakesScreenshotTest.class,
+        ElementAttributeTest.class,
+        ElementSelectingTest.class,
+        TypingTest.class,
+        TextHandlingTest.class,
+        FormHandlingTest.class,
+        MiscTest.class,
+        XPathElementFindingTest.class,
+        StaleElementReferenceTest.class,
+        VisibilityTest.class,
+        InteractionTests.class,
+        VideoTest.class,
+        TouchTests.class,
+})
+public class NativeWebDriverQt5Tests {
+    @BeforeClass
+    public static void prepareCommonEnvironment() {
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+        String testsName = NativeWebDriverQt5Tests.class.getName();
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class).getStatisticCommands().writeToXml(testsName);
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/StaleElementReferenceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/StaleElementReferenceTest.java
new file mode 100644
index 00000000..7409b774
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/StaleElementReferenceTest.java
@@ -0,0 +1,76 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.StaleElementReferenceException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.fail;
+
+public class StaleElementReferenceTest extends JUnit4TestBase {
+
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://StaleElementReferenceTestWidget");
+    }
+
+    @Test
+    public void testOldPage() {
+        WebElement elem = driver.findElement(By.id("captionLabel"));
+        driver.get("qtwidget://TypingTestWidget");
+        try {
+            elem.click();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+
+    @Test
+    public void testShouldNotCrashWhenCallingGetSizeOnAnObsoleteElement() {
+        WebElement elem = driver.findElement(By.id("captionLabel"));
+        driver.get("qtwidget://TypingTestWidget");
+        try {
+            elem.getSize();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+
+    @Test
+    public void testShouldNotCrashWhenQueryingTheAttributeTextOfAStaleElement() {
+        WebElement elem = driver.findElement(By.xpath("//QLabel"));
+        driver.get("qtwidget://TypingTestWidget");
+        try {
+            elem.getText();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TakesScreenshotTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TakesScreenshotTest.java
new file mode 100644
index 00000000..f1e16df3
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TakesScreenshotTest.java
@@ -0,0 +1,105 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.OutputType;
+import org.openqa.selenium.TakesScreenshot;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.io.File;
+
+import static org.junit.Assert.assertTrue;
+import static org.openqa.selenium.OutputType.BASE64;
+
+public class TakesScreenshotTest extends JUnit4TestBase {
+    @Test
+    public void testSaveScreenshotAsFile() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get("qtwidget://QWidget");
+        File tempFile = getScreenshot().getScreenshotAs(OutputType.FILE);
+        assertTrue(tempFile.exists());
+        assertTrue(tempFile.length() > 0);
+        tempFile.delete();
+    }
+
+    @Test
+    public void testCaptureToBase64() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get("qtwidget://QWidget");
+        String screenshot = getScreenshot().getScreenshotAs(BASE64);
+        assertTrue(screenshot.length() > 0);
+    }
+
+    @Test
+    public void testSaveElementScreenshotAsFile() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get("qtwidget://ClickTestWidget");
+
+        WebElement el = driver.findElement(By.id("pushBtn"));
+
+        File tempFile = getScreenshot((RemoteWebElement) el).getScreenshotAs(OutputType.FILE);
+        assertTrue(tempFile.exists());
+        assertTrue(tempFile.length() > 0);
+        tempFile.delete();
+    }
+
+    @Test
+    public void testCaptureElementScreenshotToBase64() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get("qtwidget://ClickTestWidget");
+
+        WebElement el = driver.findElement(By.id("pushBtn"));
+
+        String screenshot = getScreenshot((RemoteWebElement) el).getScreenshotAs(BASE64);
+        assertTrue(screenshot.length() > 0);
+    }
+
+    public TakesScreenshot getScreenshot() {
+        return (TakesScreenshot) driver;
+    }
+
+    public TakesScreenshot getScreenshot(RemoteWebElement element) {
+        return (TakesScreenshot)(new QtWebkitAugmenter().augment(element));
+    }
+
+    private boolean isAbleToTakeScreenshots(WebDriver driver) throws Exception {
+        return driver instanceof TakesScreenshot;
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TextHandlingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TextHandlingTest.java
new file mode 100644
index 00000000..3da1f234
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TextHandlingTest.java
@@ -0,0 +1,223 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.hamcrest.Description;
+import org.hamcrest.Matcher;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.regex.Pattern;
+
+import org.hamcrest.TypeSafeMatcher;
+
+import static org.junit.Assert.*;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotSame;
+
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.endsWith;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.Matchers.startsWith;
+
+
+public class TextHandlingTest extends JUnit4TestBase {
+
+    private final String newLine = "\n";
+
+    @Before
+    public void setUp() throws Exception
+    {
+        driver.get("qtwidget://TextHandlingTestWidget");
+    }
+
+    @Test
+    public void testShouldReturnTheTextContentOfASingleElementWithNoChildren() {
+
+        String selectText = driver.findElement(By.id("oneline")).getText();
+        assertThat(selectText, equalTo("A single line of text"));
+
+        String getText = driver.findElement(By.id("oneline")).getText();
+        assertThat(getText, equalTo("A single line of text"));
+    }
+
+    @Test
+    public void testShouldReturnTheEntireTextContentOfChildElements() {
+        String text = driver.findElement(By.id("multiline")).getText();
+
+        assertThat(text.contains("A div containing"), is(true));
+        assertThat(text.contains("More than one line of text"), is(true));
+        assertThat(text.contains("and block level elements"), is(true));
+    }
+
+    @Test
+    public void testShouldIgnoreNonInputElements() {
+        try
+        {
+            WebElement groupBox = driver.findElement(By.id("notext"));
+            String text = groupBox.getText();
+
+            System.out.println("#### groupBox text: " + text);
+
+            assertNull(text);
+        }
+        catch (NoSuchElementException ex)
+        {
+            // ok with current WD implementation
+        }
+    }
+
+    @Test
+    public void testShouldRepresentABlockLevelElementAsANewline() {
+        String text = driver.findElement(By.id("multiline")).getText();
+
+        assertThat(text, startsWith("A div containing" + newLine));
+        assertThat(text, containsString("More than one line of text" + newLine));
+        assertThat(text, endsWith("and block level elements"));
+    }
+
+
+    @Test
+    public void testShouldTrimText() {
+        String text = driver.findElement(By.id("multiline")).getText();
+
+        assertThat(text, startsWith("A div containing"));
+        assertThat(text, endsWith("block level elements"));
+    }
+
+    @Test
+    public void testShouldReturnUnvisibleText() {
+        String text = driver.findElement(By.id("unvisibletext")).getText();
+        assertThat(text, containsString("30"));
+    }
+
+    @Test
+    public void testShouldReturnTheEntireTextOfInlineElements() {
+        String text = driver.findElement(By.id("childtext")).getText();
+
+        assertThat(text, equalTo("child text"));
+    }
+
+    @Test
+    public void testShouldRetainTheFormatingOfTextWithinAPreElement() {
+        String text = driver.findElement(By.id("preformatted")).getText();
+
+        assertThat(text, equalTo(" This section has a preformatted\n" +
+                "    text block    \n" +
+                "  split in four lines\n" +
+                "         "));
+    }
+
+    @Test
+    public void testShouldBeAbleToSetMoreThanOneLineOfTextInATextArea() {
+        WebElement textarea = driver.findElement(By.id("emptytext"));
+        textarea.clear();
+
+        wait.until(WaitingConditions.elementTextToEqual(textarea, ""));
+
+        String expectedText = "i like cheese" + newLine + newLine + "it's really nice";
+
+        textarea.sendKeys(expectedText);
+
+        String seenText = textarea.getText();
+        assertThat(seenText, equalTo(expectedText));
+    }
+
+    @Test
+    public void testShouldReturnEmptyStringWhenTextIsOnlySpaces() {
+
+        WebElement spaces = driver.findElement(By.id("lineedit"));
+        spaces.sendKeys("    ");
+
+        String text = driver.findElement(By.id("lineedit")).getText();
+        assertThat(text, equalTo("    "));
+    }
+
+    @Test
+    public void testShouldReturnEmptyStringWhenTextIsEmpty() {
+        WebElement empty = driver.findElement(By.id("lineedit"));
+        empty.clear();
+
+        String text = driver.findElement(By.id("lineedit")).getText();
+        assertThat(text, equalTo(""));
+    }
+
+    @Test
+    public void testShouldHandleSiblingBlockLevelElements() {
+        String text = driver.findElement(By.id("childtext")).getText();
+
+        assertThat(text, is("child text"));
+    }
+
+    @Test
+    public void testReadALargeAmountOfData() {
+        String source = driver.getPageSource().trim().toLowerCase();
+
+        assertThat(source.startsWith("<?xml"), is(true));
+    }
+
+
+    private Matcher<String> matchesPattern(String javaRegex) {
+        final Pattern pattern = Pattern.compile(javaRegex);
+
+        return new TypeSafeMatcher<String>() {
+            @Override
+            public boolean matchesSafely(String s) {
+                return pattern.matcher(s).matches();
+            }
+
+            public void describeTo(Description description) {
+                description.appendText("a string matching the pattern " + pattern);
+            }
+        };
+    }
+
+    @Test
+    public void testShouldOnlyIncludeVisibleText() {
+
+        String empty = driver.findElement(By.id("unvisible")).getText();
+        String explicit = driver.findElement(By.id("oneline")).getText();
+
+        assertEquals("", empty);
+        assertEquals("A single line of text", explicit);
+    }
+
+    @Test
+    public void testShouldGetTextFromListView() {
+
+        WebElement tr = driver.findElement(By.id("listview"));
+        String text = tr.getText();
+
+        assertTrue(text.contains("Some text"));
+        assertFalse(text.contains("Some text again"));
+    }
+
+    @Test
+    public void testTextOfATextAreaShouldBeEqualToItsDefaultText() {
+        WebElement area = driver.findElement(By.id("oneline"));
+        assertEquals("A single line of text", area.getText());
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TypingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TypingTest.java
new file mode 100644
index 00000000..21c6e8c6
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/TypingTest.java
@@ -0,0 +1,403 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.Platform;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.Keys;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+
+public class TypingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://TypingTestWidget");
+    }
+
+    @Test
+    public void testQuoteMarks() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabeledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("\"");
+        assertThat(inputElement.getText(),  is("\""));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("\""));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("\"");
+        assertThat(inputElement.getText(),  is("\""));
+
+    }
+
+    @Test
+    public void testAtCharacter() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabeledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("@");
+        assertThat(inputElement.getText(), is("@"));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("@"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("@");
+        assertThat(inputElement.getText(), is("@"));
+
+    }
+
+    @Test
+    public void testMixCharacter() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabeledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("me@eXample.com");
+        assertThat(inputElement.getText(),  is("me@eXample.com"));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("me@eXample.com"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("me@eXample.com");
+        assertThat(inputElement.getText(),  is("me@eXample.com"));
+        assertThat(result.getText(), is("me@eXample.com"));
+
+    }
+
+    @Test
+    public void testArrowNotPrintable() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabeledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys(Keys.ARROW_LEFT);
+        assertThat(inputElement.getText(), is(""));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys(Keys.ARROW_LEFT);
+        assertThat(inputElement.getText(), is(""));
+
+    }
+
+    @Test
+    public void testMixArrowAndOtherKeys() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabeledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("tet", Keys.ARROW_LEFT, "s");
+        assertThat(inputElement.getText(), is("test"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("tet", Keys.ARROW_LEFT, "s");
+        assertThat(inputElement.getText(), is("test"));
+
+    }
+
+    @Test
+    public void testNumericNonShiftKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        String numericLineCharsNonShifted = "`1234567890-=[]\\;,.'/42";
+        element.sendKeys(numericLineCharsNonShifted);
+
+        assertThat(element.getText(), is(numericLineCharsNonShifted));
+    }
+
+    @Test
+    public void testNumericShiftKeys() {
+
+        WebElement result = driver.findElement(By.id("result"));
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        String numericShiftsEtc = "~!@#$%^&*()_+{}:\"<>?|END~";
+        element.sendKeys(numericShiftsEtc);
+
+        assertThat(element.getText(), is(numericShiftsEtc));
+        assertThat(result.getText(), is(numericShiftsEtc));
+    }
+
+    @Test
+    public void testLowerCaseAlphaKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        String lowerAlphas = "abcdefghijklmnopqrstuvwxyz";
+        element.sendKeys(lowerAlphas);
+
+        assertThat(element.getText(), is(lowerAlphas));
+    }
+
+    @Test
+    public void testUppercaseAlphaKeys() {
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        String upperAlphas = "ABCDEFGHIJKLMNOPQRSTUVWXYZ";
+        element.sendKeys(upperAlphas);
+
+        assertThat(element.getText(), is(upperAlphas));
+    }
+
+    @Test
+    public void testAllPrintableKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        String allPrintable =
+                "!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFGHIJKLMNO" +
+                        "PQRSTUVWXYZ [\\]^_`abcdefghijklmnopqrstuvwxyz{|}~";
+        element.sendKeys(allPrintable);
+
+        assertThat(element.getText(), is(allPrintable));
+    }
+
+    @Test
+    public void testArrowKeysAndPageUpAndDown() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("a" + Keys.LEFT + "b" + Keys.RIGHT +
+                Keys.UP + Keys.DOWN + Keys.PAGE_UP + Keys.PAGE_DOWN + "1");
+        assertThat(element.getText(), is("ba1"));
+    }
+
+    @Test
+    public void testHomeAndEndAndPageUpAndPageDownKeys() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+
+        element.sendKeys("abc" + Keys.HOME + "0" + Keys.LEFT + Keys.RIGHT +
+                Keys.PAGE_UP + Keys.PAGE_DOWN + Keys.END + "1" + Keys.HOME +
+                "0" + Keys.PAGE_UP + Keys.END + "111" + Keys.HOME + "00");
+        assertThat(element.getText(), is("0000abc1111"));
+    }
+
+    @Test
+    public void testDeleteAndBackspaceKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcdefghi");
+        assertThat(element.getText(), is("abcdefghi"));
+
+        element.sendKeys(Keys.LEFT, Keys.LEFT, Keys.DELETE);
+        assertThat(element.getText(), is("abcdefgi"));
+
+        element.sendKeys(Keys.LEFT, Keys.LEFT, Keys.BACK_SPACE);
+        assertThat(element.getText(), is("abcdfgi"));
+    }
+
+    @Test
+    public void testSpecialSpaceKeys() {
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd" + Keys.SPACE + "fgh" + Keys.SPACE + "ij");
+        assertThat(element.getText(), is("abcd fgh ij"));
+    }
+
+    @Test
+    public void testSignsKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd" + Keys.MULTIPLY + Keys.SUBTRACT + Keys.ADD +
+                Keys.DECIMAL + Keys.SEPARATOR +
+                Keys.ADD + Keys.SEMICOLON + Keys.EQUALS + Keys.DIVIDE + "abcd");
+        assertThat(element.getText(), is("abcd*-+.,+;=/abcd"));
+    }
+
+    @Test
+    public void testFunctionKeys() {
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("FUNCTION" + Keys.F4 + "-KEYS" + Keys.F4);
+        element.sendKeys("" + Keys.F4 + "-TOO" + Keys.F4);
+        assertThat(element.getText(), is("FUNCTION-KEYS-TOO"));
+    }
+
+    @Test
+    public void testShiftSelectionDeletes() {
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd efgh");
+        assertThat(element.getText(), is("abcd efgh"));
+
+        element.sendKeys(Keys.SHIFT, Keys.LEFT, Keys.LEFT, Keys.LEFT);
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is("abcd e"));
+    }
+
+    @Test
+    public void testChordControlHomeShiftEndDelete() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFG");
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys("" + Keys.SHIFT + Keys.END);
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    @Test
+    public void testChordReveseShiftHomeSelectionDeletes() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+        element.clear();
+
+        element.sendKeys("done" + Keys.HOME);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.SHIFT + "ALL " + Keys.HOME);
+        assertThat(element.getText(), is("ALL done"));
+
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    // control-x control-v here for cut & paste tests, these work on windows
+    // and linux, but not on the MAC.
+
+    // TO DO:implement identification keys letters
+    // Issue MHA-659
+    @Test
+    public void testChordControlCutAndPaste() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabeledTextElement"));
+
+        String paste = "!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFG";
+        element.sendKeys(paste);
+        assertThat(element.getText(), is(paste));
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys("" + Keys.SHIFT + Keys.END);
+        element.sendKeys("" + Keys.CONTROL + "x");
+        assertThat(element.getText(), is(""));
+
+        element.sendKeys("" + Keys.CONTROL, "v");
+
+        // Cut the last 3 letters.
+        element.sendKeys("" + Keys.LEFT + Keys.LEFT + Keys.LEFT +
+                Keys.SHIFT + Keys.END);
+
+        element.sendKeys(Keys.CONTROL, "x");
+        assertThat(element.getText(), is(paste.substring(0, paste.length() - 3)));
+
+        // Paste the last 3 letters.
+        element.sendKeys(Keys.CONTROL, "v");
+        assertThat(element.getText(), is(paste));
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys(Keys.CONTROL, "v");
+        element.sendKeys(Keys.CONTROL, "v" + "v");
+        element.sendKeys(Keys.CONTROL, "v" + "v" + "v");
+        assertThat(element.getText(), is("EFGEFGEFGEFGEFGEFG" + paste));
+
+        element.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME +
+                Keys.NULL + Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    // control-c control-v here for copy & paste tests, these work on windows
+    // and linux, but not on the MAC
+
+    // TO DO:implement identification keys letters
+    // Issue MHA-659
+    @Test
+    public void testChordControlCopyAndPaste() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement textElement = driver.findElement(By.id("enabeledTextElement"));
+
+        String paste = "!0123 ABCD";
+        textElement.sendKeys(paste);
+        assertThat(textElement.getText(), is(paste));
+
+        textElement.sendKeys(Keys.HOME);
+        textElement.sendKeys("" + Keys.SHIFT + Keys.END);
+        textElement.sendKeys("" + Keys.CONTROL + "c");
+
+        WebElement textArea = driver.findElement(By.id("enabeledTextElement"));
+
+        textArea.sendKeys(Keys.CONTROL, "v");
+        assertThat(textArea.getText(), is("!0123 ABCD"));
+
+        textArea.sendKeys(Keys.CONTROL, "v");
+        assertThat(textArea.getText(), is("!0123 ABCD!0123 ABCD"));
+
+        textArea.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME +
+                Keys.NULL + Keys.DELETE);
+        assertThat(textArea.getText(), is(""));
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VideoTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VideoTest.java
new file mode 100644
index 00000000..d86a9edb
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VideoTest.java
@@ -0,0 +1,163 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.After;
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.qtwebkit.Player;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+
+public class VideoTest extends JUnit4TestBase {
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://VideoTestWidget");
+        element = driver.findElement(By.id("videoPlayer"));
+        player = getPlayer((RemoteWebElement) element);
+    }
+
+    @After
+    public void stopPlayer() {
+        player.stop();
+        try {
+            Thread.sleep(1000);
+        } catch (InterruptedException e) {
+            e.printStackTrace();
+        }
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testRemotePlayerState() {
+        try {
+            Thread.sleep(2000);
+        } catch (InterruptedException ex) {
+        }
+        player.setState(Player.PlayerState.playing);
+        Player.PlayerState state = player.getState();
+        assertEquals(Player.PlayerState.playing, state);
+
+        try {
+            Thread.sleep(2000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        state = player.getState();
+        assertEquals(Player.PlayerState.paused, state);
+
+        player.setState(Player.PlayerState.stopped);
+        state = player.getState();
+        assertEquals(0, player.getCurrentPlayingPosition(), 0.02);
+        assertEquals(Player.PlayerState.stopped, state);
+    }
+
+    @Test
+    public void testRemotePlayerMute() {
+        player.setMute(true);
+        assertEquals(true, player.isMuted());
+
+        player.setMute(false);
+        assertEquals(false, player.isMuted());
+    }
+
+    @Test
+    public void testRemotePlayerSeek() {
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        player.seek(10);
+        assertEquals(10, player.getCurrentPlayingPosition(), 0.1);
+        player.setState(Player.PlayerState.playing);
+    }
+
+    @Test
+    public void testRemotePlayerVolume() {
+        player.setVolume(0.5);
+        assertEquals(0.5, player.getVolume(), 0.02);
+
+        player.setVolume(0);
+        assertEquals(0, player.getVolume(), 0.02);
+
+        player.setVolume(1.0);
+        assertEquals(1.0, player.getVolume(), 0.02);
+    }
+
+    @Test
+    public void testRemotePlayerVolumeAndMute() {
+        player.setVolume(0.5);
+        player.setMute(true);
+        player.setMute(false);
+        assertEquals(0.5, player.getVolume(), 0.02);
+    }
+
+    @Test
+    public void testRemotePlayerSpeed() {
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+
+        player.setState(Player.PlayerState.playing);
+        player.setSpeed(10);
+        assertEquals(10, player.getSpeed(), 0.1);
+        player.setState(Player.PlayerState.paused);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setSpeed(0.1);
+
+        try {
+            Thread.sleep(10000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+    }
+
+    public Player getPlayer(RemoteWebElement element) {
+        return (Player) (new QtWebkitAugmenter().augment(element));
+    }
+
+    private Player player;
+    private WebElement element;
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VisibilityTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VisibilityTest.java
new file mode 100644
index 00000000..18294db5
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/VisibilityTest.java
@@ -0,0 +1,159 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import java.util.concurrent.Callable;
+
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.core.Is.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+public class VisibilityTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://VisibilityTestWidget");
+    }
+
+    @Test
+    public void testShouldAllowTheUserToTellIfAnElementIsDisplayedOrNot() {
+
+        assertThat(driver.findElement(By.id("displayedLabel")).isDisplayed(),
+                is(true));
+        assertThat(driver.findElement(By.id("notDisplayedLabel")).isDisplayed(), is(false));
+
+    }
+
+    @Test
+    public void testVisibilityShouldTakeIntoWidgetParentVisibility() {
+
+        WebElement element = driver.findElement(By.id("hiddenScrollArea"));
+        WebElement externalElement = driver.findElement(By.id("buttonInScrollArea"));
+
+        assertFalse(element.isDisplayed());
+        assertFalse(externalElement.isDisplayed());
+    }
+
+    @Test
+    public void testShouldModifyTheVisibilityOfAnElementDynamically() {
+
+        WebElement element = driver.findElement(By.id("buttonCanHide"));
+        assertTrue(element.isDisplayed());
+
+        element.click();
+        wait.until(elementNotToDisplayed(element));
+        assertFalse(element.isDisplayed());
+    }
+
+    @Test
+    public void testHiddenInputElementsAreNeverVisible() {
+
+        WebElement shown = driver.findElement(By.id("buttonHidden"));
+
+        assertFalse(shown.isDisplayed());
+    }
+
+    @Test
+    public void testShouldNotBeAbleToClickOnAnElementThatIsNotDisplayed() {
+        WebElement element = driver.findElement(By.id("buttonHidden"));
+
+        try {
+            element.click();
+            fail("You should not be able to click on an invisible element");
+        } catch (ElementNotVisibleException e) {
+            // This is expected
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToTypeAnElementThatIsNotDisplayed() {
+        WebElement element = driver.findElement(By.id("inputHidden"));
+
+        try {
+            element.sendKeys("You don't see me");
+            fail("You should not be able to send keyboard input to an invisible element");
+        } catch (ElementNotVisibleException e) {
+            // This is expected
+        }
+
+        assertThat(element.getText(), is(not("You don't see me")));
+    }
+
+    @Test
+    public void testZeroSizedDivIsShownIfDescendantHasSize() {
+
+        WebElement element = driver.findElement(By.id("zeroLabel"));
+        Dimension size = element.getSize();
+
+        assertEquals("Should have 0 width", 0, size.width);
+        assertEquals("Should have 0 height", 0, size.height);
+        assertTrue(element.isDisplayed());
+    }
+
+    private ExpectedCondition<Boolean> elementNotToDisplayed(final WebElement element) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                return !element.isDisplayed();
+            }
+        };
+    }
+
+    @Test
+    public void parentNodeVisibleWhenAllChildrenAreAbsolutelyPositionedAndOverflowIsHidden() {
+        String url = "qtwidget://TypingTestWidget";
+        driver.get(url);
+
+        WebElement element = driver.findElement(By.id("result"));
+        assertTrue(element.isDisplayed());
+    }
+
+    @Test
+    public void tooSmallAWindowWithOverflowHiddenIsNotAProblem() {
+        WebDriver.Window window = driver.manage().window();
+        Dimension originalSize = window.getSize();
+
+        try {
+            // Short in the Y dimension
+            window.setSize(new Dimension(1024, 500));
+
+            String url = "qtwidget://TypingTestWidget";
+            driver.get(url);
+
+            WebElement element = driver.findElement(By.id("result"));
+            assertTrue(element.isDisplayed());
+        } finally {
+            window.setSize(originalSize);
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/WindowTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/WindowTest.java
new file mode 100644
index 00000000..3417165d
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/WindowTest.java
@@ -0,0 +1,221 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+import java.util.logging.Logger;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.SauceDriver;
+
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+import static org.openqa.selenium.testing.Ignore.Driver.CHROME;
+import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+
+public class WindowTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(WindowTest.class.getName());
+
+    @Before
+    public void setUp()
+    {
+        driver.get("qtwidget://WindowTestWidget");
+    }
+
+    @Test
+    public void testGetsTheSizeOfTheCurrentWindow() {
+        Dimension size = driver.manage().window().getSize();
+        if(log != null && log.getLevel() != null)
+            log.log(log.getLevel(), "Driver: " + driver);
+
+        assertThat(size.width, is(greaterThan(0)));
+        assertThat(size.height, is(greaterThan(0)));
+    }
+
+    @Test
+    public void testSetsTheSizeOfTheCurrentWindow() {
+        // resize relative to the initial size, since we don't know what it is
+        changeSizeBy(-20, -20);
+    }
+
+    @Test
+    public void testGetsThePositionOfTheCurrentWindow() {
+        Point position = driver.manage().window().getPosition();
+
+        assertThat(position.x, is(greaterThanOrEqualTo(0)));
+        assertThat(position.y, is(greaterThanOrEqualTo(0)));
+    }
+
+    @Test
+    @Ignore(value = { SAFARI, PHANTOMJS },
+            reason = "Safari: getPosition after setPosition doesn't match up exactly, " +
+                    "as expected - probably due to nuances in Mac OSX window manager.")
+    public void testSetsThePositionOfTheCurrentWindow() throws InterruptedException {
+        WebDriver.Window window = driver.manage().window();
+        Point position = window.getPosition();
+        Dimension originalSize = window.getSize();
+
+        try {
+            // Some Linux window managers start taking liberties wrt window positions when moving the window
+            // off-screen. Therefore, try to stay on-screen. Hopefully you have more than 210 px,
+            // or this may fail.
+            window.setSize(new Dimension(200, 200));
+            Point targetPosition = new Point(position.x + 10, position.y + 10);
+            window.setPosition(targetPosition);
+
+            wait.until(xEqual(driver, targetPosition));
+            wait.until(yEqual(driver, targetPosition));
+        } finally {
+            window.setSize(originalSize);
+        }
+    }
+
+    @Ignore(value = {CHROME, PHANTOMJS}, reason = "Not yet implemented.")
+    @Test
+    public void testCanMaximizeTheWindow() throws InterruptedException {
+        if(SauceDriver.shouldUseSauce() && TestUtilities.getEffectivePlatform().is(Platform.LINUX)) {
+            // This test requires a window manager on Linux, and Sauce currently doesn't have one.
+            return;
+        }
+
+        changeSizeTo(new Dimension(275, 275));
+        maximize();
+    }
+
+    private void changeSizeBy(int deltaX, int deltaY) {
+        WebDriver.Window window = driver.manage().window();
+        Dimension size = window.getSize();
+        changeSizeTo(new Dimension(size.width + deltaX, size.height + deltaY));
+    }
+
+    private void changeSizeTo(Dimension targetSize) {
+        WebDriver.Window window = driver.manage().window();
+
+        window.setSize(targetSize);
+        wait.until(windowHeightToEqual(driver, targetSize));
+        wait.until(windowWidthToEqual(driver, targetSize));
+    }
+
+    private void maximize() {
+        WebDriver.Window window = driver.manage().window();
+
+        Dimension size = window.getSize();
+
+        window.maximize();
+        wait.until(windowWidthToBeGreaterThan(driver, size));
+        wait.until(windowHeightToBeGreaterThan(driver, size));
+    }
+
+    private ExpectedCondition<Boolean> windowWidthToEqual(final WebDriver driver, final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.width == size.width) {
+                    return true;
+                }
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowHeightToEqual(final WebDriver driver, final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.height == size.height) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowWidthToBeGreaterThan(final WebDriver driver, final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                log.info("waiting for width, Current dimensions are " + newSize);
+                if(newSize.width != size.width) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowHeightToBeGreaterThan(final WebDriver driver, final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                log.info("waiting for height, Current dimensions are " + newSize);
+                if(newSize.height != size.height) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+    private ExpectedCondition<Boolean> xEqual(final WebDriver driver, final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.x == targetPosition.x) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+    private ExpectedCondition<Boolean> yEqual(final WebDriver driver, final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.y == targetPosition.y) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/XPathElementFindingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/XPathElementFindingTest.java
new file mode 100644
index 00000000..9512ba35
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/XPathElementFindingTest.java
@@ -0,0 +1,252 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.InvalidSelectorException;
+import org.openqa.selenium.NoSuchElementException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.List;
+
+import static org.hamcrest.Matchers.*;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class XPathElementFindingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://XPathElementFindingTestWidget");
+    }
+
+    @Test
+    public void testShouldFindSingleElementByXPath() {
+        WebElement element = driver.findElement(By.xpath("//QLabel"));
+        assertThat(element.getText(), equalTo("This Is Caption"));
+    }
+
+    @Test
+    public void testShouldThrowAnExceptionWhenThereNotFoundElement() {
+
+        try {
+            WebElement element = driver.findElement(By.xpath("//QLabel[@id='Not here']"));
+            assertThat(element.getText(), equalTo(""));
+            fail("Should not have succeeded");
+        } catch (NoSuchElementException e) {
+            // this is expected
+        }
+    }
+
+    @Test
+    public void testShouldFindSingleElementByXPathAndId() {
+        WebElement element = driver.findElement(By.xpath("//QTextEdit[@id='workingArea']"));
+        assertThat(element.getText(), equalTo("Example text"));
+    }
+
+    @Test
+    public void testShouldFindSingleOfSeveralElementByXPathThroughId() {
+        WebElement element = driver.findElement(By.xpath("//*[@id='noSelected']"));
+        assertThat(element.getText(), equalTo("Second"));
+    }
+
+    @Test
+    public void testShouldThrowAnExceptionWhenIdNotValid() {
+
+        try {
+            WebElement element = driver.findElement(By.xpath("//*[@id='not valid']"));
+            assertThat(element.getText(), equalTo(""));
+            fail("Should not have succeeded");
+        } catch (NoSuchElementException e) {
+            // this is expected
+        }
+    }
+
+    @Test
+    public void testShouldFindSingleElementByWindowTitleXPath() {
+        try {
+            driver.findElement(By.xpath("//*[@name='Application Window']"));
+        } catch (NoSuchElementException e) {
+            fail("Should be able to find element by window title");
+        }
+    }
+
+    @Test
+    public void testShouldThrowAnExceptionWhenWindowTitleNotValid() {
+
+        try {
+            WebElement element = driver.findElement(By.xpath("//*[@name='not valid']"));
+            assertThat(element.getText(), equalTo(""));
+            fail("Should not have succeeded");
+        } catch (NoSuchElementException e) {
+            // this is expected
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToIdentifyElementsByClass() {
+        try {
+            driver.findElement(By.xpath("//XPathElementFindingTestWidget"));
+        } catch (NoSuchElementException e) {
+            fail("Should be able to find element by class name");
+        }
+    }
+
+    @Test
+    public void testShouldFindElementsByXPath() {
+        List<WebElement> listElem = driver.findElements(By.xpath("//QLineEdit"));
+        assertThat(listElem.size(), equalTo(3));
+    }
+
+    @Test
+    public void testShouldBeAbleToFindManyElementsRepeatedlyByXPath() {
+        String xpathString = "//node()[contains(@id,'input')]";
+        assertThat(driver.findElements(By.xpath(xpathString)).size(), equalTo(3));
+
+
+
+        xpathString = "//node()[contains(@id,'nope')]";
+        assertThat(driver.findElements(By.xpath(xpathString)).size(), equalTo(0));
+    }
+
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathIsSyntacticallyInvalidInDriverFindElement() {
+
+        try {
+            driver.findElement(By.xpath("this][is not][valid"));
+            fail("Should not have succeeded because the xpath expression is syntactically not correct");
+        } catch (RuntimeException e) {
+            // We expect an InvalidSelectorException because the xpath expression is syntactically invalid
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathIsSyntacticallyInvalidInDriverFindElements() {
+
+        try {
+            driver.findElements(By.xpath("this][is not][valid"));
+            fail("Should not have succeeded because the xpath expression is syntactically not correct");
+        } catch (RuntimeException e) {
+            // We expect an InvalidSelectorException because the xpath expression is syntactically
+            // invalid
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInDriverFindElement() {
+
+        try {
+            driver.findElement(By.xpath("count(//input)"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInDriverFindElements() {
+
+        try {
+            driver.findElements(By.xpath("count(//input)"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInElementFindElement() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+        try {
+            externalElement.findElement(By.xpath("this][isnot][valid"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInElementFindElements() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElements(By.xpath("this][isnot][valid"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldFindNestedElementByXPath() {
+        WebElement button = driver.findElement(By.xpath("//QPushButton"));
+        assertThat(button.getText(), is("Click here"));
+    }
+
+    @Test
+    public void testShouldDriverFindNestedElementsByXPath() {
+
+        List<WebElement> listElem = driver.findElements(By.xpath("//QPushButton"));
+        assertThat(listElem.size(), greaterThan(0));
+    }
+
+    @Test
+    public void testShouldDriverFindNestedElementByXPathThroughId() {
+        WebElement button = driver.findElement(By.xpath("//*[@id='buttonInScrollArea']"));
+        assertThat(button.getText(), is("Click here"));
+    }
+
+    @Test
+    public void testShouldElementFindNestedElement() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElement(By.xpath("//QPushButton"));
+        } catch (RuntimeException e) {
+            fail("Should have succeeded because the xpath expression select an element");
+        }
+    }
+
+    @Test
+    public void testShouldElementFindNestedElements() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElements(By.xpath("//QPushButton"));
+        } catch (RuntimeException e) {
+            fail("Should have succeeded because the xpath expression select an element");
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/build.desc b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/build.desc
new file mode 100644
index 00000000..19fdb92e
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/build.desc
@@ -0,0 +1,46 @@
+java_test(name = "nativetests_qt4",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit",
+      "webdriver.browserClass" : "QWidget" },
+  ],
+  srcs = ["NativeWebDriverQt4Tests.java"],
+  deps = [
+    ":tests",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//third_party/java/mockito",
+    "//third_party/java/junit"
+  ])
+
+java_test(name = "nativetests_qt5",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit",
+      "webdriver.browserClass" : "QWidget" },
+  ],
+  srcs = ["NativeWebDriverQt5Tests.java"],
+  deps = [
+    ":tests",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//third_party/java/mockito",
+    "//third_party/java/junit"
+  ])
+
+java_library(name = "tests",
+  srcs = [
+    "interactions/InteractionTests.java",
+    "*Test.java",
+    "interactions/*.java",
+    "interactions/touch/*.java",
+  ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/remote:common",
+    "//java/client/src/org/openqa/selenium/interactions",
+    "//java/client/test/org/openqa/selenium/environment",
+    "//java/client/test/org/openqa/selenium/qtwebkit:test_qtwebkit",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//java/client/test/org/openqa/selenium/testing:proxy",
+    "//java/client/test/org/openqa/selenium/testing:util",
+    "//java/client/test/org/openqa/selenium/v1:small_tests",
+    "//third_party/java/commons-io",
+    "//third_party/java/mockito",
+    "//third_party/java/junit",
+  ])
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/ActionsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/ActionsTest.java
new file mode 100644
index 00000000..a87672f8
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/ActionsTest.java
@@ -0,0 +1,182 @@
+/*
+Copyright 2007-2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import static org.junit.Assert.assertEquals;
+
+import static org.mockito.Mockito.inOrder;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.times;
+
+import org.openqa.selenium.Keys;
+import org.openqa.selenium.StubRenderedWebElement;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.Mouse;
+import org.openqa.selenium.interactions.Keyboard;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.CompositeAction;
+import org.openqa.selenium.interactions.internal.Coordinates;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.mockito.InOrder;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+
+/**
+ * Tests the builder for advanced user interaction, the Actions class.
+ */
+public class ActionsTest {
+
+  @Mock private Mouse mockMouse;
+  @Mock private Keyboard mockKeyboard;
+  @Mock private Coordinates mockCoordinates;
+  private WebElement dummyLocatableElement;
+  private WebDriver driver;
+
+  @Before
+  public void setUp() {
+    MockitoAnnotations.initMocks(this);
+
+    dummyLocatableElement = new StubRenderedWebElement() {
+      @Override
+      public Coordinates getCoordinates() {
+        return mockCoordinates;
+      }
+    };
+
+    driver = new StubInputDeviceDriver() {
+      @Override
+      public Keyboard getKeyboard() {
+        return mockKeyboard;
+      }
+
+      @Override
+      public Mouse getMouse() {
+        return mockMouse;
+      }
+
+    };
+  }
+
+  @Test
+  public void creatingAllKeyboardActions() {
+
+    Actions builder = new Actions(driver);
+
+    builder.keyDown(Keys.SHIFT).sendKeys("abc").keyUp(Keys.CONTROL);
+
+    CompositeAction returnedAction = (CompositeAction) builder.build();
+    returnedAction.perform();
+
+    assertEquals("Expected 3 keyboard actions", 3, returnedAction.getNumberOfActions());
+    InOrder order = inOrder(mockMouse, mockKeyboard, mockCoordinates);
+    order.verify(mockKeyboard).pressKey(Keys.SHIFT);
+    order.verify(mockKeyboard).sendKeys("abc");
+    order.verify(mockKeyboard).releaseKey(Keys.CONTROL);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void providingAnElementToKeyboardActions() {
+
+    Actions builder = new Actions(driver);
+
+    builder.keyDown(dummyLocatableElement, Keys.SHIFT);
+
+    CompositeAction returnedAction = (CompositeAction) builder.build();
+    returnedAction.perform();
+
+    assertEquals("Expected 1 keyboard action", 1, returnedAction.getNumberOfActions());
+    InOrder order = inOrder(mockMouse, mockKeyboard, mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockKeyboard).pressKey(Keys.SHIFT);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void supplyingIndividualElementsToKeyboardActions() {
+    final Coordinates dummyCoordinates2 = mock(Coordinates.class, "dummy2");
+    final Coordinates dummyCoordinates3 = mock(Coordinates.class, "dummy3");;
+
+    final WebElement dummyElement2 = new StubRenderedWebElement() {
+      @Override
+      public Coordinates getCoordinates() {
+        return dummyCoordinates2;
+      }
+    };
+
+    final WebElement dummyElement3 = new StubRenderedWebElement() {
+      @Override
+      public Coordinates getCoordinates() {
+        return dummyCoordinates3;
+      }
+    };
+
+    Actions builder = new Actions(driver);
+
+    builder.keyDown(dummyLocatableElement, Keys.SHIFT)
+        .sendKeys(dummyElement2, "abc")
+        .keyUp(dummyElement3, Keys.CONTROL);
+
+    CompositeAction returnedAction = (CompositeAction) builder.build();
+    returnedAction.perform();
+
+    assertEquals("Expected 3 keyboard actions", 3, returnedAction.getNumberOfActions());
+
+    InOrder order = inOrder(mockMouse, mockKeyboard, mockCoordinates, dummyCoordinates2,
+                              dummyCoordinates3);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockKeyboard).pressKey(Keys.SHIFT);
+    order.verify(mockMouse).click(dummyCoordinates2);
+    order.verify(mockKeyboard).sendKeys("abc");
+    order.verify(mockMouse).click(dummyCoordinates3);
+    order.verify(mockKeyboard).releaseKey(Keys.CONTROL);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void creatingAllMouseActions() {
+      CompositeAction returnedAction = (CompositeAction) new Actions(driver)
+        .clickAndHold(dummyLocatableElement)
+        .release(dummyLocatableElement)
+        .click(dummyLocatableElement)
+        .doubleClick(dummyLocatableElement)
+        .moveToElement(dummyLocatableElement)
+        .contextClick(dummyLocatableElement)
+        .build();
+
+    returnedAction.perform();
+
+    assertEquals("Expected 6 mouse actions", 6, returnedAction.getNumberOfActions());
+    InOrder order = inOrder(mockMouse, mockKeyboard, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).mouseDown(mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).mouseUp(mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).doubleClick(mockCoordinates);
+    // Move twice; oce for moveToElement, once for contextClick.
+    order.verify(mockMouse, times(2)).mouseMove(mockCoordinates);
+    order.verify(mockMouse).contextClick(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicKeyboardInterfaceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicKeyboardInterfaceTest.java
new file mode 100644
index 00000000..9dcaeca4
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicKeyboardInterfaceTest.java
@@ -0,0 +1,150 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import static org.junit.Assert.assertThat;
+
+import static org.hamcrest.Matchers.is;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.Keys;
+import org.openqa.selenium.WebElement;
+
+public class BasicKeyboardInterfaceTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get("qtwidget://BasicKeyboardInterfaceTestWidget");
+    }
+
+    @Test
+    public void testBasicKeyboardInput() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+
+        inputElement.sendKeys("abc def");
+        assertThat(inputElement.getText(), is("abc def"));
+    }
+
+    @Test
+    public void testSendingKeyDownOnly() {
+
+        WebElement keysEventInput = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultIsKeyDown"));
+
+        keysEventInput.sendKeys("a");
+        assertThat(resultElement.getText(), is("Key Down"));
+
+    }
+
+    @Test
+    public void testSendingKeyUp() {
+
+       WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+       WebElement resultElement = driver.findElement(By.id("resultIsKeyUp"));
+
+       inputElement.sendKeys("a");
+       assertThat(resultElement.getText(), is("Key Up"));
+    }
+
+    @Test
+    public void testSendingKeysShiftOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.SHIFT);
+        assertThat(resultElement.getText(), is("Shift"));
+        assertThat(inputElement.getText(), is(""));
+
+    }
+
+    @Test
+    public void testSendingKeyCtrlOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.CONTROL);
+        assertThat(resultElement.getText(), is("Ctrl"));
+        assertThat(inputElement.getText(), is(""));
+
+    }
+
+    @Test
+    public void testSendingKeyAltOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.ALT);
+        assertThat(resultElement.getText(), is("Alt"));
+        assertThat(inputElement.getText(), is(""));
+
+    }
+
+    @Test
+    @Ignore(value = {Ignore.Driver.QTWEBKIT},
+            reason = "won't fix in near future(hard to resolve without regressions)",
+            issues = 721)
+    public void testSendingKeysWithShiftPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("ab" + Keys.SHIFT);
+        assertThat(resultElement.getText(), is("Shift"));
+
+        assertThat(inputElement.getText(), is("AB"));
+
+    }
+
+    @Test
+    public void testSendingKeysWithCtrlPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("www" + Keys.CONTROL);
+        assertThat(resultElement.getText(), is("Ctrl"));
+        assertThat(inputElement.getText(), is("www"));
+
+    }
+
+    @Test
+    public void testSendingKeysWithAltPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("nnn" + Keys.ALT);
+        assertThat(resultElement.getText(), is("Alt"));
+        assertThat(inputElement.getText(), is("nnn"));
+
+    }
+
+}
+
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicMouseInterfaceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicMouseInterfaceTest.java
new file mode 100644
index 00000000..43321b55
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/BasicMouseInterfaceTest.java
@@ -0,0 +1,327 @@
+/*
+Copyright 2007-2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.InvalidCoordinatesException;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.testing.JavascriptEnabled;
+
+import java.util.Map;
+import java.util.concurrent.TimeUnit;
+
+import static org.junit.Assert.*;
+import static org.openqa.selenium.WaitingConditions.*;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
+import static org.openqa.selenium.testing.TestUtilities.*;
+
+/**
+ * Tests operations that involve mouse and keyboard.
+ */
+@Ignore(value = {SAFARI},
+    reason = "Safari: not implemented (issue 4136)",
+    issues = {4136})
+public class BasicMouseInterfaceTest extends JUnit4TestBase {
+
+    @Before
+    public void setUpWebDriver()
+    {
+        driver.get("qtwidget://BasicMouseInterfaceTestWidget");
+    }
+
+  private Actions getBuilder(WebDriver driver) {
+    return new Actions(driver);
+  }
+
+  private void performDragAndDropWithMouse() {
+    WebElement dragReporter = driver.findElement(By.id("dragging_reports"));
+
+    WebElement toDrag = driver.findElement(By.id("secondWidget_label_2"));
+    WebElement dragInto = driver.findElement(By.id("firstWidget"));
+
+    Action holdItem = getBuilder(driver).clickAndHold(toDrag).build();
+
+    Action moveToSpecificItem = getBuilder(driver)
+        .moveToElement(driver.findElement(By.id("firstWidget_label_1")))
+        .build();
+
+    Action moveToOtherList = getBuilder(driver).moveToElement(dragInto).build();
+
+    Action drop = getBuilder(driver).release(dragInto).build();
+
+    assertEquals("Nothing happened.", dragReporter.getText());
+
+    try {
+      holdItem.perform();
+      moveToSpecificItem.perform();
+      moveToOtherList.perform();
+
+      String text = dragReporter.getText();
+      assertTrue(text, text.matches("Nothing happened. (?:DragIn *)+"));
+    } finally {
+      drop.perform();
+    }
+
+  }
+
+  @Test
+  public void testDraggingElementWithMouseMovesItToAnotherList() {
+    performDragAndDropWithMouse();
+    WebElement dragInto = driver.findElement(By.id("firstWidget"));
+    assertEquals(4, dragInto.findElements(By.className("RestyledLabel")).size());
+  }
+
+  // This test is very similar to testDraggingElementWithMouse. The only
+  // difference is that this test also verifies the correct events were fired.
+  @Test
+  public void testDraggingElementWithMouseFiresEvents() {
+    performDragAndDropWithMouse();
+    WebElement dragReporter = driver.findElement(By.id("dragging_reports"));
+    String text = dragReporter.getText();
+    assertTrue(text, text.matches("Nothing happened. (?:DragIn *)+DropIn secondWidget_label_2"));
+  }
+
+
+  private boolean isElementAvailable(WebDriver driver, By locator) {
+    try {
+      driver.findElement(locator);
+      return true;
+    } catch (NoSuchElementException e) {
+      return false;
+    }
+  }
+
+//  @Test
+//  public void testDoubleClickThenGet() {
+//    WebElement toClick = driver.findElement(By.id("clickField"));
+//
+//    Action dblClick = getBuilder(driver).doubleClick(toClick).build();
+//    dblClick.perform();
+//
+//    driver.get("qtwidget://WindowTestWidget");
+//  }
+
+//  @JavascriptEnabled
+//  @Ignore({ANDROID, IPHONE, OPERA, SELENESE})
+//  @Test
+//  public void testDoubleClick() {
+//    driver.get(pages.javascriptPage);
+//
+//    WebElement toDoubleClick = driver.findElement(By.id("doubleClickField"));
+//
+//    Action dblClick = getBuilder(driver).doubleClick(toDoubleClick).build();
+//
+//    dblClick.perform();
+//    String testFieldContent = TestWaiter.wait.until(
+//        elementValueToEqual(toDoubleClick, "DoubleClicked"), 5, TimeUnit.SECONDS);
+//    assertEquals("Value should change to DoubleClicked.", "DoubleClicked",
+//                 testFieldContent);
+//  }
+//
+//  @JavascriptEnabled
+//  @Ignore({ANDROID, HTMLUNIT, IPHONE, SELENESE})
+//  @Test
+//  public void testContextClick() {
+//    driver.get(pages.javascriptPage);
+//
+//    WebElement toContextClick = driver.findElement(By.id("doubleClickField"));
+//
+//    Action contextClick = getBuilder(driver).contextClick(toContextClick).build();
+//
+//    contextClick.perform();
+//    assertEquals("Value should change to ContextClicked.", "ContextClicked",
+//                 toContextClick.getAttribute("value"));
+//  }
+//
+//  @JavascriptEnabled
+//  @Ignore({ANDROID, IPHONE, SELENESE})
+//  @Test
+//  public void testMoveAndClick() {
+//    driver.get(pages.javascriptPage);
+//
+//    WebElement toClick = driver.findElement(By.id("clickField"));
+//
+//    Action contextClick = getBuilder(driver).moveToElement(toClick).click().build();
+//
+//    contextClick.perform();
+//
+//    wait.until(elementValueToEqual(toClick, "Clicked"));
+//
+//    assertEquals("Value should change to Clicked.", "Clicked",
+//                 toClick.getAttribute("value"));
+//  }
+//
+//  @JavascriptEnabled
+//  @Ignore({ANDROID, CHROME, IE, IPHONE, SELENESE, FIREFOX})
+//  @Test
+//  public void testCannotMoveToANullLocator() {
+//    driver.get(pages.javascriptPage);
+//
+//    try {
+//      Action contextClick = getBuilder(driver).moveToElement(null).build();
+//
+//      contextClick.perform();
+//      fail("Shouldn't be allowed to click on null element.");
+//    } catch (IllegalArgumentException expected) {
+//      // Expected.
+//    }
+//  }
+//
+//  @JavascriptEnabled
+//  @Ignore({ANDROID, CHROME, IE, IPHONE, SELENESE, FIREFOX, OPERA, HTMLUNIT, OPERA_MOBILE, QTWEBKIT})
+//  @Test
+//  public void testMousePositionIsNotPreservedInActionsChain() {
+//    driver.get(pages.javascriptPage);
+//    WebElement toMoveTo = driver.findElement(By.id("clickField"));
+//
+//    getBuilder(driver).moveToElement(toMoveTo).build().perform();
+//
+//    // TODO(andreastt): Is this correct behaviour?  Should the last known mouse position be
+//    // disregarded if calling click() from a an Actions chain?
+//    try {
+//      getBuilder(driver).click().build().perform();
+//      fail("Shouldn't be allowed to click without a context.");
+//    } catch (InvalidCoordinatesException expected) {
+//      // expected
+//    }
+//  }
+//
+//  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, REMOTE, SELENESE, FIREFOX, OPERA, QTWEBKIT},
+//          reason = "Behaviour not finalized yet regarding linked images.")
+//  @Test
+//  public void testMovingIntoAnImageEnclosedInALink() {
+//    driver.get(pages.linkedImage);
+//
+//    if (isFirefox30(driver) || isFirefox35(driver)) {
+//      System.out.println("Not performing testMovingIntoAnImageEnclosedInALink - no way to " +
+//                         "compensate for accessibility-provided offsets on Firefox 3.0 or 3.5");
+//      return;
+//    }
+//    // Note: For some reason, the Accessibility API in Firefox will not be available before we
+//    // click on something. As a work-around, click on a different element just to get going.
+//    driver.findElement(By.id("linkToAnchorOnThisPage")).click();
+//
+//    WebElement linkElement = driver.findElement(By.id("linkWithEnclosedImage"));
+//
+//    // Image is 644 x 41 - move towards the end.
+//    // Note: The width of the link element itself is correct - 644 pixels. However,
+//    // the height is 17 pixels and the rectangle containing it is *below* the image.
+//    // For this reason, this action will fail.
+//    new Actions(driver).moveToElement(linkElement, 500, 30).click().perform();
+//
+//    wait.until(pageTitleToBe(driver, "We Arrive Here"));
+//  }
+//
+//  private Map<String, Object> getElementSize(WebElement element) {
+//    return (Map<String, Object>) ((JavascriptExecutor) driver).executeScript(
+//        "return arguments[0].getBoundingClientRect()", element);
+//  }
+//
+//  private int getHeight(Map<String, Object> sizeRect) {
+//    if (sizeRect.containsKey("height")) {
+//      return getFieldValue(sizeRect, "height");
+//    } else {
+//      return getFieldValue(sizeRect, "bottom") - getFieldValue(sizeRect, "top");
+//    }
+//  }
+//
+//  private int getFieldValue(Map<String, Object> sizeRect, String fieldName) {
+//    return (int) Double.parseDouble(sizeRect.get(fieldName).toString());
+//  }
+//
+//  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, SELENESE, CHROME, QTWEBKIT},
+//          reason = "Not implemented yet.")
+//  @Test
+//  public void testMovingMousePastViewPort() {
+//    if (!isNativeEventsEnabled(driver)) {
+//      System.out.println("Skipping testMovingMousePastViewPort: Native events are disabled.");
+//      return;
+//    }
+//
+//    driver.get(pages.javascriptPage);
+//
+//    WebElement keyUpArea = driver.findElement(By.id("keyPressArea"));
+//    new Actions(driver).moveToElement(keyUpArea).click().perform();
+//
+//    Map<String, Object> keyUpSize = getElementSize(keyUpArea);
+//
+//    // When moving to an element using the interactions API, the element is not scrolled
+//    // using scrollElementIntoView so the top of the element may not end at 0.
+//    // Estimate the mouse position based on the distance of the element from the top plus
+//    // half its size (the mouse is moved to the middle of the element by default).
+//    int assumedMouseY = getHeight(keyUpSize) / 2 + getFieldValue(keyUpSize, "top");
+//
+//    // Calculate the scroll offset by figuring out the distance of the 'parent' element from
+//    // the top (adding half it's height), then substracting the current mouse position.
+//    // Regarding width, the event attached to this element will only be triggered if the mouse
+//    // hovers over the text in this element. Use a simple negative offset for this.
+//    Map<String, Object> parentSize = getElementSize(driver.findElement(By.id("parent")));
+//
+//    int verticalMove = getFieldValue(parentSize, "top") + getHeight(parentSize) / 2 -
+//                       assumedMouseY;
+//
+//    // Move by verticalMove pixels down and -50 pixels left:
+//    // we should be hitting the element with id 'parent'
+//    new Actions(driver).moveByOffset(-50, verticalMove).perform();
+//
+//    WebElement resultArea = driver.findElement(By.id("result"));
+//    wait.until(elementTextToContain(resultArea, "parent matches"));
+//  }
+//
+//  @Ignore(value = {ANDROID, IE, HTMLUNIT, IPHONE, SELENESE, CHROME, OPERA, OPERA_MOBILE, QTWEBKIT},
+//          reason = "Not implemented yet.")
+//  @Test
+//  public void testMovingMouseBackAndForthPastViewPort() {
+//
+//    if (isFirefox(driver) && !isNativeEventsEnabled(driver)) {
+//      System.out.println("Skipping testMovingMouseBackAndForthPastViewPort: " +
+//                         "Native events are disabled.");
+//      return;
+//    }
+//
+//    driver.get(pages.veryLargeCanvas);
+//
+//    WebElement firstTarget = driver.findElement(By.id("r1"));
+//    new Actions(driver).moveToElement(firstTarget).click().perform();
+//
+//    WebElement resultArea = driver.findElement(By.id("result"));
+//    String expectedEvents = "First";
+//    wait.until(elementTextToEqual(resultArea, expectedEvents));
+//
+//    // Move to element with id 'r2', at (2500, 50) to (2580, 100)
+//    new Actions(driver).moveByOffset(2540 - 150, 75 - 125).click().perform();
+//    expectedEvents += " Second";
+//    wait.until(elementTextToEqual(resultArea, expectedEvents));
+//
+//    // Move to element with id 'r3' at (60, 1500) to (140, 1550)
+//    new Actions(driver).moveByOffset(100 - 2540, 1525 - 75).click().perform();
+//    expectedEvents += " Third";
+//    wait.until(elementTextToEqual(resultArea, expectedEvents));
+//
+//    // Move to element with id 'r4' at (220,180) to (320, 230)
+//    new Actions(driver).moveByOffset(270 - 100, 205 - 1525).click().perform();
+//    expectedEvents += " Fourth";
+//    wait.until(elementTextToEqual(resultArea, expectedEvents));
+//  }
+//
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualKeyboardActionsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualKeyboardActionsTest.java
new file mode 100644
index 00000000..fefaaeb1
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualKeyboardActionsTest.java
@@ -0,0 +1,143 @@
+/*
+Copyright 2007-2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.mockito.InOrder;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.mockito.MockitoAnnotations;
+import org.openqa.selenium.Keys;
+import org.openqa.selenium.interactions.Mouse;
+import org.openqa.selenium.interactions.Keyboard;
+import org.openqa.selenium.interactions.KeyDownAction;
+import org.openqa.selenium.interactions.KeyUpAction;
+import org.openqa.selenium.interactions.SendKeysAction;
+import org.openqa.selenium.interactions.internal.Coordinates;
+import org.openqa.selenium.internal.Locatable;
+
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.mockito.Mockito.when;
+
+/**
+ * Unit test for all simple keyboard actions.
+ * 
+ */
+public class IndividualKeyboardActionsTest {
+
+  @Mock private Keyboard mockKeyboard;
+  @Mock private Mouse mockMouse;
+  @Mock private Coordinates mockCoordinates;
+  @Mock private Locatable stubLocatable;
+  final String keysToSend = "hello";
+
+  @Before
+  public void setUp() {
+    MockitoAnnotations.initMocks(this);
+
+    when(stubLocatable.getCoordinates()).thenReturn(mockCoordinates);
+  }
+
+  @Test
+  public void keyDownActionWithoutProvidedElement() {
+    final Keys keyToPress = Keys.SHIFT;
+
+    KeyDownAction keyDown = new KeyDownAction(mockKeyboard, mockMouse, keyToPress);
+    keyDown.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockKeyboard).pressKey(keyToPress);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void keyDownActionOnAnElement() {
+    final Keys keyToPress = Keys.SHIFT;
+
+    KeyDownAction keyDown = new KeyDownAction(
+        mockKeyboard, mockMouse, stubLocatable, keyToPress);
+
+    keyDown.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockKeyboard).pressKey(keyToPress);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void keyUpActionWithoutProvidedElement() {
+    final Keys keyToRelease = Keys.CONTROL;
+
+    KeyUpAction keyUp = new KeyUpAction(mockKeyboard, mockMouse, keyToRelease);
+    keyUp.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockKeyboard).releaseKey(keyToRelease);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void keyUpOnAnAnElement() {
+    final Keys keyToRelease = Keys.SHIFT;
+
+    KeyUpAction upAction = new KeyUpAction(
+        mockKeyboard, mockMouse, stubLocatable, keyToRelease);
+    upAction.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockKeyboard).releaseKey(keyToRelease);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void sendKeysActionWithoutProvidedElement() {
+    SendKeysAction sendKeys = new SendKeysAction(mockKeyboard, mockMouse, keysToSend);
+    sendKeys.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockKeyboard).sendKeys(keysToSend);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void sendKeysActionOnAnElement() {
+    SendKeysAction sendKeys = new SendKeysAction(
+        mockKeyboard, mockMouse, stubLocatable, keysToSend);
+    sendKeys.perform();
+
+    InOrder order = Mockito.inOrder(mockKeyboard, mockMouse, mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verify(mockKeyboard).sendKeys(keysToSend);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void keyDownActionFailsOnNonModifier() {
+    final Keys keyToPress = Keys.BACK_SPACE;
+
+    try {
+      new KeyDownAction(mockKeyboard, mockMouse, stubLocatable, keyToPress);
+      fail();
+    } catch (IllegalArgumentException e) {
+      assertTrue(e.getMessage().contains("modifier keys"));
+    }
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualMouseActionsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualMouseActionsTest.java
new file mode 100644
index 00000000..9409d9c1
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/IndividualMouseActionsTest.java
@@ -0,0 +1,171 @@
+/*
+Copyright 2007-2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import static org.mockito.Mockito.when;
+
+import org.mockito.InOrder;
+import org.mockito.Mock;
+import org.mockito.Mockito;
+import org.mockito.MockitoAnnotations;
+import org.openqa.selenium.interactions.*;
+import org.openqa.selenium.interactions.internal.Coordinates;
+import org.openqa.selenium.internal.Locatable;
+
+import org.junit.Before;
+import org.junit.Test;
+
+/**
+ * Unit test for all simple keyboard actions.
+ * 
+ */
+public class IndividualMouseActionsTest {      @Mock private Mouse mockMouse;
+  @Mock private Coordinates mockCoordinates;
+  @Mock private Locatable locatableStub;
+
+  @Before
+  public void setUp() {
+    MockitoAnnotations.initMocks(this);
+    when(locatableStub.getCoordinates()).thenReturn(mockCoordinates);
+  }
+
+  @Test
+  public void mouseClickAndHoldAction() {
+    ClickAndHoldAction action = new ClickAndHoldAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).mouseDown(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseClickAndHoldActionOnCurrentLocation() {
+    ClickAndHoldAction action = new ClickAndHoldAction(mockMouse, null);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseDown(null);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseReleaseAction() {
+    ButtonReleaseAction action = new ButtonReleaseAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).mouseUp(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseReleaseActionOnCurrentLocation() {
+    ButtonReleaseAction action = new ButtonReleaseAction(mockMouse, null);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseUp(null);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseClickAction() {
+    ClickAction action = new ClickAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).click(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseClickActionOnCurrentLocation() {
+    ClickAction action = new ClickAction(mockMouse, null);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).click(null);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseDoubleClickAction() {
+    DoubleClickAction action = new DoubleClickAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).doubleClick(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseDoubleClickActionOnCurrentLocation() {
+    DoubleClickAction action = new DoubleClickAction(mockMouse, null);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).doubleClick(null);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseMoveAction() {
+    MoveMouseAction action = new MoveMouseAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseMoveActionToCoordinatesInElement() {
+    MoveToOffsetAction action = new MoveToOffsetAction(mockMouse, locatableStub, 20, 20);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates, 20, 20);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseContextClickAction() {
+    ContextClickAction action = new ContextClickAction(mockMouse, locatableStub);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).mouseMove(mockCoordinates);
+    order.verify(mockMouse).contextClick(mockCoordinates);
+    order.verifyNoMoreInteractions();
+  }
+
+  @Test
+  public void mouseContextClickActionOnCurrentLocation() {
+    ContextClickAction action = new ContextClickAction(mockMouse, null);
+    action.perform();
+
+    InOrder order = Mockito.inOrder(mockMouse, mockCoordinates);
+    order.verify(mockMouse).contextClick(null);
+    order.verifyNoMoreInteractions();
+  }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/InteractionTests.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/InteractionTests.java
new file mode 100644
index 00000000..630ce730
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/InteractionTests.java
@@ -0,0 +1,31 @@
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+    ActionsTest.class,
+    BasicKeyboardInterfaceTest.class,
+    BasicMouseInterfaceTest.class,
+    IndividualKeyboardActionsTest.class,
+    IndividualMouseActionsTest.class,
+})
+public class InteractionTests {
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/StubInputDeviceDriver.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/StubInputDeviceDriver.java
new file mode 100644
index 00000000..97a341c0
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/StubInputDeviceDriver.java
@@ -0,0 +1,30 @@
+/*
+Copyright 2010 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions;
+
+import org.openqa.selenium.JavascriptExecutor;
+import org.openqa.selenium.StubDriver;
+
+public class StubInputDeviceDriver extends StubDriver implements JavascriptExecutor {
+  public Object executeScript(String script, Object... args) {
+    return null;
+  }
+
+  public Object executeAsyncScript(String script, Object... args) {
+    return null;
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchInteractionTests.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchInteractionTests.java
new file mode 100644
index 00000000..453e2a42
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchInteractionTests.java
@@ -0,0 +1,102 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions.touch;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.touch.FlickAction;
+import org.openqa.selenium.interactions.touch.TouchActions;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.qtwebkit.nativetests.interactions.touch.TouchTestBase;
+
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.assertThat;
+import static org.hamcrest.Matchers.is;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.By;
+import org.openqa.selenium.JavascriptExecutor;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+/**
+ * Tests single tap actions on touch enabled devices.
+ */
+public class TouchInteractionTests extends TouchTestBase {
+
+    private TouchActions getBuilder(WebDriver driver) {
+        return new TouchActions(driver);
+    }
+
+    private void singleTapOnElement(String elementId) {
+        WebElement toSingleTap = driver.findElement(By.id(elementId));
+        Action singleTap = getBuilder(driver).singleTap(toSingleTap).build();
+        singleTap.perform();
+    }
+
+    private void doubleTapOnElement(String elementId) {
+        WebElement toDoubleTap = driver.findElement(By.id(elementId));
+        Action doubleTap = getBuilder(driver).doubleTap(toDoubleTap).build();
+        doubleTap.perform();
+    }
+
+    private Point getLocationOnScreen(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().onScreen();
+    }
+
+
+    @Test
+    public void testCanTap() {
+        driver.get("qtwidget://TouchTestWidget");
+        singleTapOnElement("touchArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "PressedReleased"));
+    }
+
+    @Test
+    public void testCanDoubleTap() {
+        driver.get("qtwidget://TouchTestWidget");
+        doubleTapOnElement("touchArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "PressedReleasedPressedReleased"));
+    }
+
+
+    @Test
+    public void testTouchCanDownMoveUp() {
+        driver.get("qtwidget://TouchTestWidget");
+        Action down = getBuilder(driver).down(200, 400).build();
+        down.perform();
+        Action move = getBuilder(driver).move(250, 450).build();
+        move.perform();
+        Action up = getBuilder(driver).up(350, 550).build();
+        up.perform();
+
+        assertThat(getLocationOnScreen(By.id("pressLabel")), is(new Point(200, 400)));
+        assertThat(getLocationOnScreen(By.id("moveLabel")), is(new Point(250, 450)));
+        assertThat(getLocationOnScreen(By.id("releaseLabel")), is(new Point(350, 550)));
+
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTestBase.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTestBase.java
new file mode 100644
index 00000000..34e7763c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTestBase.java
@@ -0,0 +1,36 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions.touch;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.junit.Assume.assumeThat;
+
+import org.junit.Before;
+import org.openqa.selenium.interactions.HasTouchScreen;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+public abstract class TouchTestBase extends JUnit4TestBase {
+    @Before
+    public void checkHasTouchScreen() {
+        assumeThat(driver, instanceOf(HasTouchScreen.class));
+    }
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTests.java b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTests.java
new file mode 100644
index 00000000..c2b16b27
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/nativetests/interactions/touch/TouchTests.java
@@ -0,0 +1,39 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.nativetests.interactions.touch;
+
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.junit.AfterClass;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.qtwebkit.nativetests.interactions.touch.TouchInteractionTests;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        TouchInteractionTests.class,
+})
+public class TouchTests {
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ClickTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ClickTest.java
new file mode 100644
index 00000000..888daf30
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ClickTest.java
@@ -0,0 +1,55 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Test;
+import org.junit.Before;
+
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+public class ClickTest extends JUnit4TestBase {
+
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.clickTest);
+    }
+
+    @Test
+    public void testCanClickOnAPushButton() {
+        driver.findElement(By.id("button1")).click();
+
+        wait.until(WaitingConditions.elementTextToEqual(By.id("clickDisplay"), "clicked button1"));
+    }
+
+    @Test
+    public void testCanClickOnMouseArea() {
+        driver.findElement(By.id("mouseHotSpotArea2")).click();
+
+        wait.until(WaitingConditions.elementTextToEqual(By.id("clickDisplay"), "clicked area 2"));
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/CoordinatesTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/CoordinatesTest.java
new file mode 100644
index 00000000..7a3130dc
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/CoordinatesTest.java
@@ -0,0 +1,74 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.Point;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertThat;
+import static org.hamcrest.Matchers.is;
+
+
+public class CoordinatesTest extends JUnit4TestBase {
+
+    @Before
+    public void setUpWebDriver()
+    {
+        driver.get(pages.coordinatesTest);
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnElementInViewPort() {
+        assertThat(getLocationOnScreen(By.id("mainRectangle")), is(new Point(10, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnZeroSizeElement() {
+        assertThat(getLocationOnScreen(By.id("zeroSizedElement")), is(new Point(8, 8)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfATransparentElement() {
+        assertThat(getLocationOnScreen(By.id("transparentRect")), is(new Point(10, 120)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAHiddenElement() {
+        assertThat(getLocationOnScreen(By.id("hiddenRect")), is(new Point(120, 10)));
+    }
+
+    @Test
+    public void testShouldGetCoordinatesOfAnInvisibleElement() {
+        assertThat(getLocationOnScreen(By.id("invisibleItem")), is(new Point(3, 3)));
+    }
+
+    private Point getLocationOnScreen(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().onScreen();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementAttributeTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementAttributeTest.java
new file mode 100644
index 00000000..a040e827
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementAttributeTest.java
@@ -0,0 +1,155 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.By;
+import org.openqa.selenium.InvalidElementStateException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.core.IsEqual.equalTo;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+public class ElementAttributeTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.elementAttributeTest);
+    }
+
+    @Test
+    public void testElementsDisabledOrEnabled() {
+        WebElement inputElement = driver.findElement(By.id("notWorkingButton"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), is(false));
+
+        inputElement = driver.findElement(By.id("workingButton"));
+        assertThat(inputElement.getAttribute("disabled"), equalTo(null));
+        assertThat(inputElement.isEnabled(), is(true));
+    }
+
+    @Test
+    public void testElementsDisplayedOrNo() {
+
+        WebElement inputElement = driver.findElement(By.id("notWorkingButton"));
+        assertThat(inputElement.isDisplayed(), is(false));
+
+        inputElement = driver.findElement(By.id("workingButton"));
+        assertThat(inputElement.isDisplayed(), is(true));
+    }
+
+    @Test
+    public void testGetTextFromPushButton()
+    {
+        WebElement element = driver.findElement(By.id("workingButton"));
+        assertThat(element.getAttribute("text"), is("Working Button"));
+        assertThat(element.getText(), is("Working Button"));
+    }
+
+    @Test
+    public void testShouldThrowExceptionIfSendingKeysToElementDisabled() {
+        WebElement disabledTextElement1 = driver.findElement(By.id("disabledTextElement"));
+        assertThat(disabledTextElement1.isEnabled(),is(false));
+        try {
+            disabledTextElement1.sendKeys("foo");
+            fail("Should have thrown exception");
+        } catch (InvalidElementStateException e) {
+            e.printStackTrace();
+            // Expected
+        }
+        assertThat(disabledTextElement1.getText(), is(""));
+    }
+
+    @Test
+    public void testShouldIndicateWhenATextAreaIsDisabled() {
+        WebElement textArea= driver.findElement(By.id("areaWithDefaultText"));
+        assertThat(textArea.isEnabled(), is(false));
+    }
+
+    @Test
+    public void testShouldReturnTheContentsOfTextArea() {
+
+        WebElement textArea= driver.findElement(By.id("areaWithDefaultText"));
+        assertThat(textArea.getText(), is("Example text"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentTextFormTextArea() {
+        WebElement textArea = driver.findElement(By.id("workingArea"));
+        assertEquals("", textArea.getText());
+        textArea.sendKeys("hello world");
+        assertEquals("hello world", textArea.getText());
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentTextFormLineEdit() {
+        WebElement txt = driver.findElement(By.id("enabledTextElement"));
+        txt.sendKeys("Hello");
+        assertEquals("Hello", txt.getText());
+        assertThat(txt.getText(), is("Hello"));
+        txt.clear();
+        assertEquals("", txt.getText());
+        txt.sendKeys("hello world");
+
+        assertEquals("hello world", txt.getText());
+        assertThat(txt.getText(), is("hello world"));
+    }
+
+    @Test
+    public void testCanRetrieveTheCurrentValueOfATextFormFieldAsEmailInput() {
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        assertEquals("", element.getText());
+        element.sendKeys("hello@example.com");
+        assertEquals("hello@example.com", element.getText());
+    }
+
+    @Test
+    public void testIsVisibleLabel() {
+        WebElement element = driver.findElement(By.id("displayedLabel"));
+        assertThat(element.isDisplayed(), is(true));
+
+        element = driver.findElement(By.id("notDisplayedLabel"));
+        assertThat(element.isDisplayed(), is(false));
+    }
+
+    @Test
+    public void testGetColorAttr() {
+        WebElement element = driver.findElement(By.id("displayedLabel"));
+        assertThat(element.getAttribute("color"), is("#a9a9a9"));
+    }
+
+    @Test
+    public void testReturnTextOfLabel() {
+        WebElement element = driver.findElement(By.id("displayedLabel"));
+        assertThat(element.getAttribute("text"), is("Visible Label"));
+        assertThat(element.getText(), is("Visible Label"));
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementEqualityTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementEqualityTest.java
new file mode 100644
index 00000000..c312d8e6
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ElementEqualityTest.java
@@ -0,0 +1,79 @@
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.List;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+public class ElementEqualityTest extends JUnit4TestBase {
+
+    @Before
+    public void createWebDriver() {
+        driver.get(pages.findingTest);
+    }
+
+    @Test
+    public void testSameElementLookedUpDifferentWaysShouldBeEqual() {
+
+        WebElement body = driver.findElement(By.tagName("TextInput"));
+        WebElement xbody = driver.findElements(By.xpath("//TextInput")).get(0);
+
+        assertEquals(body, xbody);
+    }
+
+    @Test
+    public void testDifferentElementsShouldNotBeEqual() {
+
+        List<WebElement> ps = driver.findElements(By.tagName("Rectangle"));
+
+        assertFalse(ps.get(0).equals(ps.get(1)));
+    }
+
+    @Test
+    @Ignore(QTWEBKIT)
+    // wont fix. Two different ids can reference same element
+    public void testSameElementLookedUpDifferentWaysUsingFindElementShouldHaveSameHashCode() {
+
+        WebElement body = driver.findElement(By.tagName("TextInput"));
+        WebElement xbody = driver.findElement(By.xpath("//TextInput"));
+
+        assertEquals(body.hashCode(), xbody.hashCode());
+    }
+
+    @Test
+    @Ignore(QTWEBKIT)
+    // wont fix. Two different ids can reference same element
+    public void testSameElementLookedUpDifferentWaysUsingFindElementsShouldHaveSameHashCode() {
+
+        List<WebElement> body = driver.findElements(By.tagName("TextInput"));
+        List<WebElement> xbody = driver.findElements(By.xpath("//TextInput"));
+
+        assertEquals(body.get(0).hashCode(), xbody.get(0).hashCode());
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ExecutingJavascriptTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ExecutingJavascriptTest.java
new file mode 100644
index 00000000..102df763
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/ExecutingJavascriptTest.java
@@ -0,0 +1,289 @@
+/*
+Copyright 2007-2009 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import com.google.common.collect.ImmutableList;
+import com.google.common.collect.ImmutableMap;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.JavascriptExecutor;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.testing.JavascriptEnabled;
+
+import java.util.ArrayList;
+import java.util.Collection;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Map;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+public class ExecutingJavascriptTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.javascriptTest);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToExecuteSimpleJavascriptAndReturnAString() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object result = executeScript("var a = 'Javascript'+' Test Page'; return a;");
+
+        assertTrue(result instanceof String);
+        assertEquals("Javascript Test Page", result);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToExecuteSimpleJavascriptAndReturnALong() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object result = executeScript("var a = 2+2*2; return a;");
+
+        assertTrue(result.getClass().getName(), result instanceof Long);
+        assertTrue((Long) result > 1);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToExecuteSimpleJavascriptAndReturnABoolean() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object result = executeScript("return true;");
+
+        assertNotNull(result);
+        assertTrue(result instanceof Boolean);
+        assertTrue((Boolean) result);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testPassingAndReturningALongShouldReturnAWholeNumber() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Long expectedResult = 1L;
+        Object result = executeScript("return arguments[0];", expectedResult);
+        assertTrue("Expected result to be an Integer or Long but was a " +
+                   result.getClass(), result instanceof Integer || result instanceof Long);
+        assertEquals(expectedResult.longValue(), result);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testPassingAndReturningADoubleShouldReturnADecimal() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Double expectedResult = 1.2;
+        Object result = executeScript("return arguments[0];", expectedResult);
+        assertTrue("Expected result to be a Double or Float but was a " +
+                   result.getClass(), result instanceof Float || result instanceof Double);
+        assertEquals(expectedResult.doubleValue(), result);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldThrowAnExceptionWhenTheJavascriptIsBad() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        try {
+            executeScript("return squiggle();");
+            fail("Expected an exception");
+        } catch (WebDriverException e) {
+            // This is expected
+            assertFalse(e.getMessage(), e.getMessage().startsWith("null "));
+        }
+    }
+
+    @JavascriptEnabled
+    @Test
+    @Ignore(QTWEBKIT)
+    // executeScript command is not fully comply to WD spec. Has different behavior for Quick1 and Quick2
+    public void testShouldBeAbleToCallFunctionsDefinedOnThePage() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object result = executeScript("return sayHello('Selenium');");
+
+        assertTrue(result instanceof String);
+        assertEquals("Hello Selenium !", result);
+    }
+
+    private Object executeScript(String script, Object... args) {
+        return ((JavascriptExecutor) driver).executeScript(script, args);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassAStringAnAsArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        String value =
+            (String) executeScript("return arguments[0] == 'fish' ? 'fish' : 'not fish';", "fish");
+
+        assertEquals("fish", value);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassABooleanAsArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        boolean value = (Boolean) executeScript("return arguments[0] == true;", true);
+
+        assertTrue(value);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassANumberAnAsArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        boolean value = (Boolean) executeScript("return arguments[0] == 1 ? true : false;", 1);
+
+        assertTrue(value);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testPassingArrayAsOnlyArgumentFlattensArray() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object[] array = new Object[]{"zero", 1, true, 3.14159, false};
+        String value = (String) executeScript("return arguments[0]", array);
+        assertEquals(array[0], value);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassAnArrayAsAdditionalArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Object[] array = new Object[]{"zero", 1, true, 3.14159, false};
+        long length = (Long) executeScript("return arguments[1].length", "string", array);
+        assertEquals(array.length, length);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassACollectionAsArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        Collection<Object> collection = new ArrayList<Object>();
+        collection.add("Cheddar");
+        collection.add("Brie");
+        collection.add(7);
+        long length = (Long) executeScript("return arguments[0].length", collection);
+        assertEquals(collection.size(), length);
+
+        collection = new HashSet<Object>();
+        collection.add("Gouda");
+        collection.add("Stilton");
+        collection.add("Stilton");
+        collection.add(true);
+        length = (Long) executeScript("return arguments[0].length", collection);
+        assertEquals(collection.size(), length);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldThrowAnExceptionIfAnArgumentIsNotValid() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        try {
+            executeScript("return arguments[0];", driver);
+            fail("Exception should have been thrown");
+        } catch (IllegalArgumentException e) {
+            // this is expected
+        }
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testShouldBeAbleToPassInMoreThanOneArgument() {
+        if (!(driver instanceof JavascriptExecutor)) {
+            return;
+        }
+
+        String result = (String) executeScript("return arguments[0] + arguments[1];", "one", "two");
+
+        assertEquals("onetwo", result);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testJavascriptStringHandlingShouldWorkAsExpected() {
+
+        String value = (String) executeScript("return '';");
+        assertEquals("", value);
+
+        value = (String) executeScript("return ' '");
+        assertEquals(" ", value);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testCanPassAMapAsAParameter() {
+
+        List<Integer> nums = ImmutableList.of(1, 2);
+        Map<String, Object> args = ImmutableMap.of("bar", "test", "foo", nums);
+
+        Object res = ((JavascriptExecutor) driver).executeScript("return arguments[0]['foo'][1]", args);
+
+        assertEquals(2, ((Number) res).intValue());
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FindingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FindingTest.java
new file mode 100644
index 00000000..3fbd6703
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FindingTest.java
@@ -0,0 +1,85 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.NoSuchElementException;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.logging.Logger;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.*;
+
+
+public class FindingTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(FindingTest.class.getName());
+
+    @Before
+    public void createWebDriver() {
+        driver.get(pages.findingTest);
+    }
+
+    @Test
+    public void testCanFindSimpleControl() {
+        assertTrue(driver.findElement(By.id("inputElement")).isDisplayed());
+    }
+
+    @Test
+    public void testCanFindHiddenControl() {
+        assertNotNull(driver.findElement(By.id("mouseHotSpot")));
+    }
+
+    @Test
+    public void testCanFindControlByClassName() {
+        assertNotNull(driver.findElement(By.className("TextInput")));
+    }
+
+    @Test
+    public void testCanFindHiddenControlByClassName() {
+        assertNotNull(driver.findElement(By.className("MouseArea")));
+    }
+
+    @Test
+    public void testCanNotFindNonExistElementByClassName() {
+        try {
+            assertNull(driver.findElement(By.className("NonExistedElement")));
+        } catch (RuntimeException e) {
+            //  this is expected
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+
+    @Test
+    public void testCanNotFindNonExistElementById() {
+        try {
+            driver.findElement(By.id("wrongId"));
+        } catch (RuntimeException e) {
+            //  this is expected
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FormHandlingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FormHandlingTest.java
new file mode 100644
index 00000000..626fb8e2
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/FormHandlingTest.java
@@ -0,0 +1,183 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class FormHandlingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.formHandlingTest);
+    }
+
+    @Test
+    public void testShouldClickOnSubmitInputElements() {
+        WebElement element = driver.findElement(By.id("changeLabelButton"));
+        element.click();
+
+        assertThat(driver.findElement(By.id("notClickableLabel")).getText(), equalTo("Label changed"));
+    }
+
+    @Test
+    public void testClickingOnUnclickableElementsDoesNothing() {
+
+        WebElement element = driver.findElement(By.xpath("//Text"));
+        try {
+            element.click();
+        } catch (Exception e) {
+            e.printStackTrace();
+            fail("Clicking on the unclickable should be a no-op");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToFindAFormThatDoesNotExist() {
+
+        try {
+            driver.findElement(By.id("there is no spoon")).click();
+            fail("Should not have succeeded");
+        } catch (RuntimeException e) {
+            assertThat(e, is(instanceOf(NoSuchElementException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToEnterTextIntoATextAreaBySettingItsValue() {
+        WebElement textarea = driver.findElement(By.id("workingArea"));
+        textarea.clear();
+        String cheesy = "brie and cheddar";
+        textarea.sendKeys(cheesy);
+        assertThat(textarea.getText(), equalTo(cheesy));
+    }
+
+    @Test
+    public void testSendKeysKeepsCapitalization() {
+        WebElement textarea = driver.findElement(By.id("workingArea"));
+        textarea.clear();
+        String cheesey = "BrIe And CheDdar";
+        textarea.sendKeys(cheesey);
+        assertThat(textarea.getText(), equalTo(cheesey));
+    }
+
+    @Test
+    public void testShouldEnterDataIntoFormFields() {
+        WebElement element = driver.findElement(By.xpath("//TextInput[@id='inputElement']" ));
+        String originalValue = element.getText();
+        assertThat(originalValue, equalTo("Example text"));
+
+        element.clear();
+        element.sendKeys("some text");
+
+        String newFormValue = element.getText();
+        assertThat(newFormValue, equalTo("some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextInInputs() {
+        WebElement element = driver.findElement(By.id("inputElement"));
+        element.clear();
+        element.sendKeys("some");
+        String value = element.getText();
+        assertThat(value, is("some"));
+
+        element.sendKeys(" text");
+        value = element.getText();
+        assertThat(value, is("some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextInInputsWithExistingValue() {
+        WebElement element = driver.findElement(By.id("inputElement"));
+        element.sendKeys(". Some text");
+        String value = element.getText();
+
+        assertThat(value, is("Example text. Some text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextInTextAreas() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        assertThat(element.getText(), is("Example text"));
+
+        element.sendKeys(". Some text");
+        String value = element.getText();
+        // for QTextEdit and QPlainTextEdit cursor set in the begin default text
+        // and sendKeys() insert text before set by default
+        assertThat(value, is(". Some textExample text"));
+    }
+
+    @Test
+    public void testSendingKeyboardEventsShouldAppendTextinTextAreasToTextSendBefore() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        element.clear();
+
+        element.sendKeys("Example text");
+        element.sendKeys(". Some text");
+        String value = element.getText();
+        assertThat(value, is("Example text. Some text"));
+    }
+
+    @Test
+    public void testShouldBeAbleToClearTextFromInputElements() {
+        WebElement element = driver.findElement(By.id("emptyInput"));
+        element.sendKeys("Some text");
+        String value = element.getText();
+        assertThat(value.length(), is(greaterThan(0)));
+
+        element.clear();
+        value = element.getText();
+
+        assertThat(value.length(), is(0));
+    }
+
+    @Test
+    public void testEmptyTextBoxesShouldReturnAnEmptyStringNotNull() {
+        WebElement emptyTextBox = driver.findElement(By.id("emptyInput"));
+        assertEquals(emptyTextBox.getText(), "");
+    }
+
+    @Test
+    public void testShouldBeAbleToClearTextFromTextAreas() {
+        WebElement element = driver.findElement(By.id("workingArea"));
+        element.sendKeys("Some text");
+        String value = element.getText();
+        assertThat(value.length(), is(greaterThan(0)));
+
+        element.clear();
+        value = element.getText();
+
+        assertThat(value.length(), is(0));
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/MiscTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/MiscTest.java
new file mode 100644
index 00000000..a59559ce
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/MiscTest.java
@@ -0,0 +1,73 @@
+/*
+Copyright 2012 Software Freedom Conservancy
+Copyright 2007-2012 Selenium committers
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+ */
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Test;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.xml.sax.ErrorHandler;
+import org.xml.sax.InputSource;
+import org.xml.sax.SAXException;
+import org.xml.sax.SAXParseException;
+
+import javax.xml.parsers.DocumentBuilder;
+import javax.xml.parsers.DocumentBuilderFactory;
+
+import java.io.ByteArrayInputStream;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.*;
+
+public class MiscTest extends JUnit4TestBase {
+
+
+    public class SimpleErrorHandler implements ErrorHandler {
+        public void warning(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+
+        public void error(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+
+        public void fatalError(SAXParseException e) throws SAXException {
+            System.out.println(e.getMessage());
+        }
+    }
+
+    @Test
+    public void testShouldReturnTheSourceOfAPage() {
+        //There is no particular reason to use ClickScrollingTest, we just need any UI with elements
+        driver.get(pages.elementAttributeTest);
+
+        String source = driver.getPageSource().toLowerCase();
+
+        DocumentBuilderFactory factory = DocumentBuilderFactory.newInstance();
+        factory.setValidating(false);
+        factory.setNamespaceAware(true);
+
+        // the "parse" method also validates XML, will throw an exception if misformatted
+        try{
+            DocumentBuilder builder = factory.newDocumentBuilder();
+            builder.setErrorHandler(new SimpleErrorHandler());
+            org.w3c.dom.Document document = builder.parse(new InputSource(new ByteArrayInputStream(source.getBytes("utf-8"))));
+        } catch(Exception e){
+            fail("Exception " + e + " was throwed, when no exception expected!");
+            e.printStackTrace();
+        }
+    }
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1TestContent.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1TestContent.java
new file mode 100644
index 00000000..1fcda176
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1TestContent.java
@@ -0,0 +1,47 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.openqa.selenium.environment.Pages;
+import org.openqa.selenium.environment.webserver.AppServer;
+
+public class Quick1TestContent extends Pages {
+
+
+    public Quick1TestContent(AppServer appServer) {
+        super(appServer);
+
+        windowTest = appServer.whereIs("quick1/WindowTest.qml");
+        findingTest = appServer.whereIs("quick1/FindingTest.qml");
+        clickTest = appServer.whereIs("quick1/ClickTest.qml");
+        coordinatesTest = appServer.whereIs("quick1/CoordinatesTest.qml");
+        elementAttributeTest = appServer.whereIs("quick1/ElementAttributeTest.qml");
+        typingTest = appServer.whereIs("quick1/TypingTest.qml");
+        formHandlingTest = appServer.whereIs("quick1/FormHandlingTest.qml");
+        xpathElementFindingTest = appServer.whereIs("quick1/XPathElementFindingTest.qml");
+        staleElementReferenceTest = appServer.whereIs("quick1/StaleElementReferenceTest.qml");
+        visibilityTest = appServer.whereIs("quick1/VisibilityTest.qml");
+        javascriptTest = appServer.whereIs("quick1/JavascriptTest.qml");
+        basicKeyboardInterfaceTest = appServer.whereIs("quick1/BasicKeyboardInterfaceTest.qml");
+        basicMouseInterfaceTest = appServer.whereIs("quick1/BasicMouseInterfaceTest.qml");
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1WebDriverTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1WebDriverTests.java
new file mode 100644
index 00000000..18de1254
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick1WebDriverTests.java
@@ -0,0 +1,65 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.InteractionTests;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        WindowTest.class,
+        ElementEqualityTest.class,
+        ClickTest.class,
+        FindingTest.class,
+        CoordinatesTest.class,
+        TakesScreenshotTest.class,
+        ElementAttributeTest.class,
+        TypingTest.class,
+        FormHandlingTest.class,
+        MiscTest.class,
+        XPathElementFindingTest.class,
+        StaleElementReferenceTest.class,
+        VisibilityTest.class,
+        InteractionTests.class,
+        ExecutingJavascriptTest.class
+})
+public class Quick1WebDriverTests {
+    @BeforeClass
+    public static void prepareCommonEnvironment() {
+        InProcessTestEnvironment environment = GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+        environment.setTestContent(new Quick1TestContent(environment.getAppServer()));
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+        String testsName = Quick1WebDriverTests.class.getName();
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class).getStatisticCommands().writeToXml(testsName);
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2TestContent.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2TestContent.java
new file mode 100644
index 00000000..33549bb3
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2TestContent.java
@@ -0,0 +1,51 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.openqa.selenium.environment.Pages;
+import org.openqa.selenium.environment.webserver.AppServer;
+
+public class Quick2TestContent extends Pages {
+
+
+    public Quick2TestContent(AppServer appServer) {
+        super(appServer);
+
+        windowTest = appServer.whereIs("quick2/WindowTest.qml");
+        findingTest = appServer.whereIs("quick2/FindingTest.qml");
+        clickTest = appServer.whereIs("quick2/ClickTest.qml");
+        coordinatesTest = appServer.whereIs("quick2/CoordinatesTest.qml");
+        elementAttributeTest = appServer.whereIs("quick2/ElementAttributeTest.qml");
+        typingTest = appServer.whereIs("quick2/TypingTest.qml");
+        formHandlingTest = appServer.whereIs("quick2/FormHandlingTest.qml");
+        xpathElementFindingTest = appServer.whereIs("quick2/XPathElementFindingTest.qml");
+        staleElementReferenceTest = appServer.whereIs("quick2/StaleElementReferenceTest.qml");
+        visibilityTest = appServer.whereIs("quick2/VisibilityTest.qml");
+        javascriptTest = appServer.whereIs("quick2/JavascriptTest.qml");
+        basicKeyboardInterfaceTest = appServer.whereIs("quick2/BasicKeyboardInterfaceTest.qml");
+        basicMouseInterfaceTest = appServer.whereIs("quick2/BasicMouseInterfaceTest.qml");
+        videoTest = appServer.whereIs("quick2/VideoTest.qml");
+        touchTest = appServer.whereIs("quick2/TouchTest.qml");
+        touchScrollTest = appServer.whereIs("quick2/TouchScrollTest.qml");
+        multiTouchTest = appServer.whereIs("quick2/MultiTouchTest.qml");
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2WebDriverTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2WebDriverTests.java
new file mode 100644
index 00000000..3a18a51e
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/Quick2WebDriverTests.java
@@ -0,0 +1,69 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.InteractionTests;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.touch.TouchTests;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        WindowTest.class,
+        ElementEqualityTest.class,
+        ClickTest.class,
+        FindingTest.class,
+        CoordinatesTest.class,
+        TakesScreenshotTest.class,
+        ElementAttributeTest.class,
+        TypingTest.class,
+        FormHandlingTest.class,
+        MiscTest.class,
+        XPathElementFindingTest.class,
+        StaleElementReferenceTest.class,
+        VisibilityTest.class,
+        InteractionTests.class,
+        ExecutingJavascriptTest.class,
+        TouchTests.class,
+        VideoTest.class,
+})
+
+public class Quick2WebDriverTests {
+    @BeforeClass
+    public static void prepareCommonEnvironment() {
+        InProcessTestEnvironment environment = GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+        environment.setTestContent(new Quick2TestContent(environment.getAppServer()));
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+        String testsName = Quick2WebDriverTests.class.getName();
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class).getStatisticCommands().writeToXml(testsName);
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/StaleElementReferenceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/StaleElementReferenceTest.java
new file mode 100644
index 00000000..32fefc74
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/StaleElementReferenceTest.java
@@ -0,0 +1,76 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.StaleElementReferenceException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import static org.junit.Assert.fail;
+
+public class StaleElementReferenceTest extends JUnit4TestBase {
+
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.staleElementReferenceTest);
+    }
+
+    @Test
+    public void testOldPage() {
+        WebElement elem = driver.findElement(By.id("captionLabel"));
+        driver.get(pages.typingTest);
+        try {
+            elem.click();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+
+    @Test
+    public void testShouldNotCrashWhenCallingGetSizeOnAnObsoleteElement() {
+        WebElement elem = driver.findElement(By.id("captionLabel"));
+        driver.get(pages.typingTest);
+        try {
+            elem.getSize();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+
+    @Test
+    public void testShouldNotCrashWhenQueryingTheAttributeTextOfAStaleElement() {
+        WebElement elem = driver.findElement(By.xpath("//Text"));
+        driver.get(pages.typingTest);
+        try {
+            elem.getText();
+            fail();
+        } catch (StaleElementReferenceException e) {
+            // do nothing. this is what we expected.
+        }
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TakesScreenshotTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TakesScreenshotTest.java
new file mode 100644
index 00000000..a1744117
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TakesScreenshotTest.java
@@ -0,0 +1,107 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.OutputType;
+import org.openqa.selenium.TakesScreenshot;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.io.File;
+
+import static org.junit.Assert.assertTrue;
+import static org.openqa.selenium.OutputType.BASE64;
+
+public class TakesScreenshotTest extends JUnit4TestBase {
+    @Test
+    public void testSaveScreenshotAsFile() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get(pages.windowTest);
+
+        File tempFile = getScreenshot().getScreenshotAs(OutputType.FILE);
+        assertTrue(tempFile.exists());
+        assertTrue(tempFile.length() > 0);
+        tempFile.delete();
+    }
+
+    @Test
+    public void testCaptureToBase64() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get(pages.windowTest);
+
+        String screenshot = getScreenshot().getScreenshotAs(BASE64);
+        assertTrue(screenshot.length() > 0);
+    }
+
+    @Test
+    public void testSaveElementScreenshotAsFile() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get(pages.clickTest);
+
+        WebElement el = driver.findElement(By.id("button1"));
+
+        File tempFile = getScreenshot((RemoteWebElement) el).getScreenshotAs(OutputType.FILE);
+        assertTrue(tempFile.exists());
+        assertTrue(tempFile.length() > 0);
+        tempFile.delete();
+    }
+
+    @Test
+    public void testCaptureElementScreenshotToBase64() throws Exception {
+        if (!isAbleToTakeScreenshots(driver)) {
+            return;
+        }
+
+        driver.get(pages.clickTest);
+
+        WebElement el = driver.findElement(By.id("button1"));
+
+        String screenshot = getScreenshot((RemoteWebElement) el).getScreenshotAs(BASE64);
+        assertTrue(screenshot.length() > 0);
+    }
+
+    public TakesScreenshot getScreenshot() {
+        return (TakesScreenshot) driver;
+    }
+
+    public TakesScreenshot getScreenshot(RemoteWebElement element) {
+        return (TakesScreenshot)(new QtWebkitAugmenter().augment(element));
+    }
+
+    private boolean isAbleToTakeScreenshots(WebDriver driver) throws Exception {
+        return driver instanceof TakesScreenshot;
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TypingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TypingTest.java
new file mode 100644
index 00000000..e49b559a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/TypingTest.java
@@ -0,0 +1,439 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.Platform;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.Keys;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+
+public class TypingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.typingTest);
+    }
+
+    @Test
+    public void testQuoteMarks() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("\"");
+        assertThat(inputElement.getText(),  is("\""));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("\""));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("\"");
+        assertThat(inputElement.getText(),  is("\""));
+
+    }
+
+    @Test
+    public void testAtCharacter() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("@");
+        assertThat(inputElement.getText(), is("@"));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("@"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("@");
+        assertThat(inputElement.getText(), is("@"));
+
+    }
+
+    @Test
+    public void testMixCharacter() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("me@eXample.com");
+        assertThat(inputElement.getText(),  is("me@eXample.com"));
+
+        WebElement result = driver.findElement(By.id("result"));
+        assertThat(result.getText(),  is("me@eXample.com"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("me@eXample.com");
+        assertThat(inputElement.getText(),  is("me@eXample.com"));
+        assertThat(result.getText(), is("me@eXample.com"));
+
+    }
+
+    @Test
+    public void testArrowNotPrintable() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys(Keys.ARROW_LEFT);
+        assertThat(inputElement.getText(), is(""));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys(Keys.ARROW_LEFT);
+        assertThat(inputElement.getText(), is(""));
+
+    }
+
+    @Test
+    public void testMixArrowAndOtherKeys() {
+
+        WebElement  inputElement = driver.findElement(By.id("enabledTextElement"));
+        inputElement.clear();
+        inputElement.sendKeys("tet", Keys.ARROW_LEFT, "s");
+        assertThat(inputElement.getText(), is("test"));
+
+        inputElement = driver.findElement(By.id("workingArea"));
+        inputElement.clear();
+        inputElement.sendKeys("tet", Keys.ARROW_LEFT, "s");
+        assertThat(inputElement.getText(), is("test"));
+
+    }
+
+    @Test
+    public void testNumericNonShiftKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        String numericLineCharsNonShifted = "`1234567890-=[]\\;,.'/42";
+        element.sendKeys(numericLineCharsNonShifted);
+
+        assertThat(element.getText(), is(numericLineCharsNonShifted));
+    }
+
+    @Test
+    public void testNumericShiftKeys() {
+
+        WebElement result = driver.findElement(By.id("result"));
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        String numericShiftsEtc = "~!@#$%^&*()_+{}:\"<>?|END~";
+        element.sendKeys(numericShiftsEtc);
+
+        assertThat(element.getText(), is(numericShiftsEtc));
+        assertThat(result.getText(), is(numericShiftsEtc));
+    }
+
+    @Test
+    public void testLowerCaseAlphaKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        String lowerAlphas = "abcdefghijklmnopqrstuvwxyz";
+        element.sendKeys(lowerAlphas);
+
+        assertThat(element.getText(), is(lowerAlphas));
+    }
+
+    @Test
+    public void testUppercaseAlphaKeys() {
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        String upperAlphas = "ABCDEFGHIJKLMNOPQRSTUVWXYZ";
+        element.sendKeys(upperAlphas);
+
+        assertThat(element.getText(), is(upperAlphas));
+    }
+
+    @Test
+    public void testAllPrintableKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        String allPrintable =
+            "!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFGHIJKLMNO" +
+            "PQRSTUVWXYZ [\\]^_`abcdefghijklmnopqrstuvwxyz{|}~";
+        element.sendKeys(allPrintable);
+
+        assertThat(element.getText(), is(allPrintable));
+    }
+
+    @Test
+    public void testArrowKeysAndPageUpAndDown() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("a" + Keys.LEFT + "b" + Keys.RIGHT +
+                         Keys.UP + Keys.DOWN + Keys.PAGE_UP + Keys.PAGE_DOWN + "1");
+        assertThat(element.getText(), is("ba1"));
+    }
+
+    @Test
+    public void testHomeAndEndAndPageUpAndPageDownKeys() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+
+        element.sendKeys("abc" + Keys.HOME + "0" + Keys.LEFT + Keys.RIGHT +
+                         Keys.PAGE_UP + Keys.PAGE_DOWN + Keys.END + "1" + Keys.HOME +
+                         "0" + Keys.PAGE_UP + Keys.END + "111" + Keys.HOME + "00");
+        assertThat(element.getText(), is("0000abc1111"));
+    }
+
+    @Test
+    public void testDeleteAndBackspaceKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcdefghi");
+        assertThat(element.getText(), is("abcdefghi"));
+
+        element.sendKeys(Keys.LEFT, Keys.LEFT, Keys.DELETE);
+        assertThat(element.getText(), is("abcdefgi"));
+
+        element.sendKeys(Keys.LEFT, Keys.LEFT, Keys.BACK_SPACE);
+        assertThat(element.getText(), is("abcdfgi"));
+    }
+
+    @Test
+    public void testSpecialSpaceKeys() {
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd" + Keys.SPACE + "fgh" + Keys.SPACE + "ij");
+        assertThat(element.getText(), is("abcd fgh ij"));
+    }
+
+    @Test
+    public void testSignsKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd" + Keys.MULTIPLY + Keys.SUBTRACT + Keys.ADD +
+                         Keys.DECIMAL + Keys.SEPARATOR +
+                         Keys.ADD + Keys.SEMICOLON + Keys.EQUALS + Keys.DIVIDE + "abcd");
+        assertThat(element.getText(), is("abcd*-+.,+;=/abcd"));
+    }
+
+    private Actions getBuilder(WebDriver driver) {
+        return new Actions(driver);
+    }
+
+    @Test
+    public void testSendingKeysToActiveElement() {
+
+        WebElement inputLine = driver.findElement(By.id("enabledTextElement"));
+        WebElement inputArea = driver.findElement(By.id("workingArea"));
+        inputLine.clear();
+        inputArea.clear();
+
+        assertThat(inputLine.getText(), is(""));
+        assertThat(inputArea.getText(), is(""));
+
+        inputLine.click();
+        assertEquals(inputLine, driver.switchTo().activeElement());
+
+        Action sendKeys = getBuilder(driver).sendKeys("abc def").build();
+        sendKeys.perform();
+
+        assertEquals(inputLine.getText(), "abc def");
+
+        inputArea.click();
+        assertEquals(inputArea, driver.switchTo().activeElement());
+
+        Action sendKeys2 = getBuilder(driver).sendKeys("asd fgh").build();
+        sendKeys2.perform();
+
+        assertEquals(inputArea.getText(), "asd fgh");
+    }
+
+    @Test
+    public void testFunctionKeys() {
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("FUNCTION" + Keys.F4 + "-KEYS" + Keys.F4);
+        element.sendKeys("" + Keys.F4 + "-TOO" + Keys.F4);
+        assertThat(element.getText(), is("FUNCTION-KEYS-TOO"));
+    }
+
+    @Test
+    public void testShiftSelectionDeletes() {
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("abcd efgh");
+        assertThat(element.getText(), is("abcd efgh"));
+
+        element.sendKeys(Keys.SHIFT, Keys.LEFT, Keys.LEFT, Keys.LEFT);
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is("abcd e"));
+    }
+
+    @Test
+    public void testChordControlHomeShiftEndDelete() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFG");
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys("" + Keys.SHIFT + Keys.END);
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    @Test
+    public void testChordReveseShiftHomeSelectionDeletes() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+        element.clear();
+
+        element.sendKeys("done" + Keys.HOME);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.SHIFT + "ALL " + Keys.HOME);
+        assertThat(element.getText(), is("ALL done"));
+
+        element.sendKeys(Keys.DELETE);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME);
+        assertThat(element.getText(), is("done"));
+
+        element.sendKeys("" + Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    // control-x control-v here for cut & paste tests, these work on windows
+    // and linux, but not on the MAC.
+
+    // TO DO:implement identification keys letters
+    // Issue MHA-659
+    @Test
+    public void testChordControlCutAndPaste() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement element = driver.findElement(By.id("enabledTextElement"));
+
+        String paste = "!\"#$%&'()*+,-./0123456789:;<=>?@ ABCDEFG";
+        element.sendKeys(paste);
+        assertThat(element.getText(), is(paste));
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys("" + Keys.SHIFT + Keys.END);
+        element.sendKeys("" + Keys.CONTROL + "x");
+        assertThat(element.getText(), is(""));
+
+        element.sendKeys("" + Keys.CONTROL, "v");
+
+        // Cut the last 3 letters.
+        element.sendKeys("" + Keys.LEFT + Keys.LEFT + Keys.LEFT +
+                         Keys.SHIFT + Keys.END);
+
+        element.sendKeys(Keys.CONTROL, "x");
+        assertThat(element.getText(), is(paste.substring(0, paste.length() - 3)));
+
+        // Paste the last 3 letters.
+        element.sendKeys(Keys.CONTROL, "v");
+        assertThat(element.getText(), is(paste));
+
+        element.sendKeys(Keys.HOME);
+        element.sendKeys(Keys.CONTROL, "v");
+        element.sendKeys(Keys.CONTROL, "v" + "v");
+        element.sendKeys(Keys.CONTROL, "v" + "v" + "v");
+        assertThat(element.getText(), is("EFGEFGEFGEFGEFGEFG" + paste));
+
+        element.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME +
+                         Keys.NULL + Keys.DELETE);
+        assertThat(element.getText(), is(""));
+    }
+
+    // control-c control-v here for copy & paste tests, these work on windows
+    // and linux, but not on the MAC
+
+    // TO DO:implement identification keys letters
+    // Issue MHA-659
+    @Test
+    public void testChordControlCopyAndPaste() {
+        // FIXME: macs don't have HOME keys, would PGUP work?
+        if (Platform.getCurrent().is(Platform.MAC)) {
+            return;
+        }
+
+        WebElement textElement = driver.findElement(By.id("enabledTextElement"));
+
+        String paste = "!0123 ABCD";
+        textElement.sendKeys(paste);
+        assertThat(textElement.getText(), is(paste));
+
+        textElement.sendKeys(Keys.HOME);
+        textElement.sendKeys("" + Keys.SHIFT + Keys.END);
+        textElement.sendKeys("" + Keys.CONTROL + "c");
+
+        WebElement textArea = driver.findElement(By.id("enabledTextElement"));
+
+        textArea.sendKeys(Keys.CONTROL, "v");
+        assertThat(textArea.getText(), is("!0123 ABCD"));
+
+        textArea.sendKeys(Keys.CONTROL, "v");
+        assertThat(textArea.getText(), is("!0123 ABCD!0123 ABCD"));
+
+        textArea.sendKeys("" + Keys.END + Keys.SHIFT + Keys.HOME +
+                          Keys.NULL + Keys.DELETE);
+        assertThat(textArea.getText(), is(""));
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VideoTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VideoTest.java
new file mode 100644
index 00000000..352a2c3e
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VideoTest.java
@@ -0,0 +1,188 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.After;
+import org.junit.AfterClass;
+import org.openqa.selenium.*;
+import org.openqa.selenium.qtwebkit.Player;
+import org.openqa.selenium.remote.QtWebkitAugmenter;
+import org.openqa.selenium.remote.RemoteWebElement;
+import org.openqa.selenium.testing.Ignore;
+
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import org.junit.Test;
+import org.junit.Before;
+
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.assertThat;
+
+public class VideoTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() {
+        driver.get(pages.videoTest);
+        element = driver.findElement(By.id("videoPlayer"));
+        player = getPlayer((RemoteWebElement) element);
+    }
+
+    @After
+    public void stopPlayer() {
+        player.stop();
+        try {
+            Thread.sleep(1000);
+        } catch (InterruptedException e) {
+            e.printStackTrace();
+        }
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+
+    @Test
+    public void testRemotePlayerState() {
+        player.setState(Player.PlayerState.playing);
+        Player.PlayerState state = player.getState();
+        assertEquals(Player.PlayerState.playing, state);
+        assertEquals(String.valueOf(state.ordinal()), element.getAttribute("playbackState"));
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+
+        player.setState(Player.PlayerState.paused);
+        state = player.getState();
+        assertEquals(Player.PlayerState.paused, state);
+        assertEquals(String.valueOf(state.ordinal()), element.getAttribute("playbackState"));
+
+        player.setState(Player.PlayerState.stopped);
+        state = player.getState();
+        assertEquals(String.valueOf(state.ordinal()), element.getAttribute("playbackState"));
+        assertEquals(0, player.getCurrentPlayingPosition(), 0.02);
+        assertEquals(Player.PlayerState.stopped, state);
+    }
+
+    @Test
+    public void testRemotePlayerSetMute() {
+        player.setMute(true);
+        assertEquals("true", element.getAttribute("muted"));
+
+        player.setMute(false);
+        assertEquals("false", element.getAttribute("muted"));
+
+    }
+
+    @Test
+    public void testRemotePlayerGetMute() {
+        assertEquals(player.isMuted() ? "true" : "false", element.getAttribute("muted"));
+        player.setMute(true);
+        assertEquals(player.isMuted() ? "true" : "false", element.getAttribute("muted"));
+
+    }
+
+    @Test
+    public void testRemotePlayerSeek() {
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+        assertEquals(5, player.getCurrentPlayingPosition(), 1);
+
+        player.seek(1.5);
+        assertEquals(1.5, player.getCurrentPlayingPosition(), 0.1);
+
+    }
+
+    @Test
+    public void testRemotePlayerVolume() {
+        player.setVolume(0.5);
+        player.setState(Player.PlayerState.playing);
+        assertEquals(0.5, player.getVolume(), 0.02);
+        assertEquals("0.5", element.getAttribute("volume"));
+
+        player.setVolume(0);
+        assertEquals(0, player.getVolume(), 0.02);
+        assertEquals("0", element.getAttribute("volume"));
+
+        player.setVolume(1.0);
+        assertEquals(1.0, player.getVolume(), 0.02);
+        assertEquals("1", element.getAttribute("volume"));
+    }
+
+    @Test
+    public void testRemotePlayerVolumeAndMute() {
+        player.setVolume(0.5);
+        player.setMute(true);
+        player.setMute(false);
+        assertEquals(0.5, player.getVolume(), 0.02);
+        assertEquals("0.5", element.getAttribute("volume"));
+    }
+
+    @Test
+    @Ignore(value = {QTWEBKIT},
+            reason = "Qt bug https://bugreports.qt-project.org/browse/QTBUG-34004",
+            issues = 764)
+    public void testRemotePlayerSpeed() {
+        assertEquals(player.getCurrentPlayingPosition(), 0, 0);
+
+        player.setState(Player.PlayerState.playing);
+        player.setSpeed(2);
+        assertEquals(2, player.getSpeed(), 0.1);
+        player.setState(Player.PlayerState.paused);
+        player.setState(Player.PlayerState.playing);
+
+        try {
+            Thread.sleep(5000);
+        } catch (InterruptedException ex) {
+        }
+        assertEquals(10, player.getSpeed(), 0.1);
+
+        player.setSpeed(0.1);
+
+        try {
+            Thread.sleep(10000);
+        } catch (InterruptedException ex) {
+        }
+        assertEquals(0.1, player.getSpeed(), 0.01);
+
+        player.setState(Player.PlayerState.paused);
+
+    }
+
+    public Player getPlayer(RemoteWebElement element) {
+        return (Player) (new QtWebkitAugmenter().augment(element));
+    }
+
+    private Player player;
+    private WebElement element;
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VisibilityTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VisibilityTest.java
new file mode 100644
index 00000000..612711de
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/VisibilityTest.java
@@ -0,0 +1,156 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import java.util.concurrent.Callable;
+
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.core.Is.is;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+public class VisibilityTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.visibilityTest);
+    }
+
+    @Test
+    public void testShouldAllowTheUserToTellIfAnElementIsDisplayedOrNot() {
+
+        assertThat(driver.findElement(By.id("displayedLabel")).isDisplayed(), is(true));
+        assertThat(driver.findElement(By.id("notDisplayedLabel")).isDisplayed(), is(false));
+
+    }
+
+    @Test
+    public void testVisibilityShouldTakeIntoWidgetParentVisibility() {
+
+        WebElement element = driver.findElement(By.id("hiddenScrollArea"));
+        WebElement externalElement = driver.findElement(By.id("buttonInScrollArea"));
+
+        assertFalse(element.isDisplayed());
+        assertFalse(externalElement.isDisplayed());
+    }
+
+    @Test
+    public void testShouldModifyTheVisibilityOfAnElementDynamically() {
+
+        WebElement element = driver.findElement(By.id("buttonCanHide"));
+        assertTrue(element.isDisplayed());
+
+        element.click();
+        wait.until(elementNotToDisplayed(element));
+        assertFalse(element.isDisplayed());
+    }
+
+    @Test
+    public void testHiddenInputElementsAreNeverVisible() {
+
+        WebElement shown = driver.findElement(By.id("buttonHidden"));
+
+        assertFalse(shown.isDisplayed());
+    }
+
+    @Test
+    public void testShouldNotBeAbleToClickOnAnElementThatIsNotDisplayed() {
+        WebElement element = driver.findElement(By.id("buttonHidden"));
+
+        try {
+            element.click();
+            fail("You should not be able to click on an invisible element");
+        } catch (ElementNotVisibleException e) {
+            // This is expected
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToTypeAnElementThatIsNotDisplayed() {
+        WebElement element = driver.findElement(By.id("inputHidden"));
+
+        try {
+            element.sendKeys("You don't see me");
+            fail("You should not be able to send keyboard input to an invisible element");
+        } catch (ElementNotVisibleException e) {
+            // This is expected
+        }
+
+        assertThat(element.getText(), is(not("You don't see me")));
+    }
+
+    @Test
+    public void testZeroSizedDivIsShownIfDescendantHasSize() {
+
+        WebElement element = driver.findElement(By.id("zeroLabel"));
+        Dimension size = element.getSize();
+
+        assertEquals("Should have 0 width", 0, size.width);
+        assertEquals("Should have 0 height", 0, size.height);
+        assertTrue(element.isDisplayed());
+    }
+
+    private ExpectedCondition<Boolean> elementNotToDisplayed(final WebElement element) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                return !element.isDisplayed();
+            }
+        };
+    }
+
+    @Test
+    public void parentNodeVisibleWhenAllChildrenAreAbsolutelyPositionedAndOverflowIsHidden() {
+        driver.get(pages.typingTest);
+
+        WebElement element = driver.findElement(By.id("result"));
+        assertTrue(element.isDisplayed());
+    }
+
+    @Test
+    public void tooSmallAWindowWithOverflowHiddenIsNotAProblem() {
+        WebDriver.Window window = driver.manage().window();
+        Dimension originalSize = window.getSize();
+
+        try {
+            // Short in the Y dimension
+            window.setSize(new Dimension(1024, 500));
+
+            driver.get(pages.typingTest);
+
+            WebElement element = driver.findElement(By.id("result"));
+            assertTrue(element.isDisplayed());
+        } finally {
+            window.setSize(originalSize);
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/WindowTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/WindowTest.java
new file mode 100644
index 00000000..c6440c34
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/WindowTest.java
@@ -0,0 +1,216 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.concurrent.Callable;
+import java.util.logging.Logger;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.testing.TestUtilities;
+import org.openqa.selenium.testing.drivers.SauceDriver;
+
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.is;
+import static org.junit.Assert.assertThat;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+public class WindowTest extends JUnit4TestBase {
+
+    private static Logger log = Logger.getLogger(WindowTest.class.getName());
+
+    @Before
+    public void setUp()
+    {
+        driver.get(pages.windowTest);
+    }
+
+    @Test
+    public void testGetsTheSizeOfTheCurrentWindow() {
+        Dimension size = driver.manage().window().getSize();
+        if(log != null && log.getLevel() != null)
+            log.log(log.getLevel(), "Driver: " + driver);
+
+        assertThat(size.width, is(greaterThan(0)));
+        assertThat(size.height, is(greaterThan(0)));
+    }
+
+    @Test
+    public void testSetsTheSizeOfTheCurrentWindow() {
+        // resize relative to the initial size, since we don't know what it is
+        changeSizeBy(-20, -20);
+    }
+
+    @Test
+    public void testGetsThePositionOfTheCurrentWindow() {
+        Point position = driver.manage().window().getPosition();
+
+        assertThat(position.x, is(greaterThanOrEqualTo(0)));
+        assertThat(position.y, is(greaterThanOrEqualTo(0)));
+    }
+
+    @Test
+    public void testSetsThePositionOfTheCurrentWindow() throws InterruptedException {
+        WebDriver.Window window = driver.manage().window();
+        Point position = window.getPosition();
+        Dimension originalSize = window.getSize();
+
+        try {
+            // Some Linux window managers start taking liberties wrt window positions when moving the window
+            // off-screen. Therefore, try to stay on-screen. Hopefully you have more than 210 px,
+            // or this may fail.
+            window.setSize(new Dimension(200, 200));
+            Point targetPosition = new Point(position.x + 10, position.y + 10);
+            window.setPosition(targetPosition);
+
+            wait.until(xEqual(targetPosition));
+            wait.until(yEqual(targetPosition));
+        } finally {
+            window.setSize(originalSize);
+        }
+    }
+
+    @Test
+    @Ignore(QTWEBKIT)
+    public void testCanMaximizeTheWindow() throws InterruptedException {
+        if(SauceDriver.shouldUseSauce() && TestUtilities.getEffectivePlatform().is(Platform.LINUX)) {
+            // This test requires a window manager on Linux, and Sauce currently doesn't have one.
+            return;
+        }
+
+        changeSizeTo(new Dimension(275, 275));
+        maximize();
+    }
+
+    private void changeSizeBy(int deltaX, int deltaY) {
+        WebDriver.Window window = driver.manage().window();
+        Dimension size = window.getSize();
+        changeSizeTo(new Dimension(size.width + deltaX, size.height + deltaY));
+    }
+
+    private void changeSizeTo(Dimension targetSize) {
+        WebDriver.Window window = driver.manage().window();
+
+        window.setSize(targetSize);
+        wait.until(windowHeightToEqual(targetSize));
+        wait.until(windowWidthToEqual(targetSize));
+    }
+
+    private void maximize() {
+        WebDriver.Window window = driver.manage().window();
+
+        Dimension size = window.getSize();
+
+        window.maximize();
+        wait.until(windowWidthToBeGreaterThan(size));
+        wait.until(windowHeightToBeGreaterThan(size));
+    }
+
+    private ExpectedCondition<Boolean> windowWidthToEqual(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.width == size.width) {
+                    return true;
+                }
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowHeightToEqual(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                if(newSize.height == size.height) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowWidthToBeGreaterThan(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                log.info("waiting for width, Current dimensions are " + newSize);
+                if(newSize.width != size.width) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+
+    private ExpectedCondition<Boolean> windowHeightToBeGreaterThan(final Dimension size) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Dimension newSize = driver.manage().window().getSize();
+                log.info("waiting for height, Current dimensions are " + newSize);
+                if(newSize.height != size.height) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+    private ExpectedCondition<Boolean> xEqual(final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.x == targetPosition.x) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+    private ExpectedCondition<Boolean> yEqual(final Point targetPosition) {
+        return new ExpectedCondition<Boolean>() {
+            @Override
+            public Boolean apply(WebDriver input) {
+                Point newPosition = driver.manage().window().getPosition();
+                if(newPosition.y == targetPosition.y) {
+                    return true;
+                }
+
+                return null;
+            }
+        };
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/XPathElementFindingTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/XPathElementFindingTest.java
new file mode 100644
index 00000000..b93a324a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/XPathElementFindingTest.java
@@ -0,0 +1,232 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.InvalidSelectorException;
+import org.openqa.selenium.NoSuchElementException;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import java.util.List;
+
+import static org.hamcrest.Matchers.*;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+
+public class XPathElementFindingTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.xpathElementFindingTest);
+    }
+
+    @Test
+    public void testShouldFindSingleElementByXPath() {
+        WebElement element = driver.findElement(By.xpath("//Text"));
+        assertThat(element.getText(), equalTo("This Is Caption"));
+    }
+
+    @Test
+    public void testShouldThrowAnExceptionWhenThereNotFoundElement() {
+
+        try {
+            WebElement element = driver.findElement(By.xpath("//Text[@id='Not here']"));
+            assertThat(element.getText(), equalTo(""));
+            fail("Should not have succeeded");
+        } catch (NoSuchElementException e) {
+            // this is expected
+        }
+    }
+
+    @Test
+    public void testShouldFindSingleElementByXPathAndId() {
+        WebElement element = driver.findElement(By.xpath("//TextEdit[@id='workingArea']"));
+        assertThat(element.getText(), equalTo("Example text"));
+        assertThat(element.getAttribute("id"), equalTo("workingArea"));
+    }
+
+    @Test
+    public void testShouldFindSingleOfSeveralElementByXPathThroughId() {
+        WebElement element = driver.findElement(By.xpath("//*[@id='noSelected']"));
+        assertThat(element.getText(), equalTo("Second"));
+    }
+
+    @Test
+    public void testShouldThrowAnExceptionWhenIdNotValid() {
+
+        try {
+            WebElement element = driver.findElement(By.xpath("//*[@id='not valid']"));
+            assertThat(element.getText(), equalTo(""));
+            fail("Should not have succeeded");
+        } catch (NoSuchElementException e) {
+            // this is expected
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToIdentifyElementsByClass() {
+        try {
+            driver.findElement(By.xpath("//Rectangle"));
+        } catch (NoSuchElementException e) {
+            fail("Should be able to find element by class name");
+        }
+    }
+
+    @Test
+    public void testShouldFindElementsByXPath() {
+        List<WebElement> listElem = driver.findElements(By.xpath("//TextInput"));
+        assertThat(listElem.size(), equalTo(3));
+    }
+
+    @Test
+    public void testShouldBeAbleToFindManyElementsRepeatedlyByXPath() {
+        String xpathString = "//node()[contains(@id,'input')]";
+        assertThat(driver.findElements(By.xpath(xpathString)).size(), equalTo(3));
+
+
+
+        xpathString = "//node()[contains(@id,'nope')]";
+        assertThat(driver.findElements(By.xpath(xpathString)).size(), equalTo(0));
+    }
+
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathIsSyntacticallyInvalidInDriverFindElement() {
+
+        try {
+            driver.findElement(By.xpath("this][is not][valid"));
+            fail("Should not have succeeded because the xpath expression is syntactically not correct");
+        } catch (RuntimeException e) {
+            // We expect an InvalidSelectorException because the xpath expression is syntactically invalid
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathIsSyntacticallyInvalidInDriverFindElements() {
+
+        try {
+            driver.findElements(By.xpath("this][is not][valid"));
+            fail("Should not have succeeded because the xpath expression is syntactically not correct");
+        } catch (RuntimeException e) {
+            // We expect an InvalidSelectorException because the xpath expression is syntactically
+            // invalid
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInDriverFindElement() {
+
+        try {
+            driver.findElement(By.xpath("count(//input)"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInDriverFindElements() {
+
+        try {
+            driver.findElements(By.xpath("count(//input)"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInElementFindElement() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+        try {
+            externalElement.findElement(By.xpath("this][isnot][valid"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldThrowInvalidSelectorExceptionWhenXPathReturnsWrongTypeInElementFindElements() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElements(By.xpath("this][isnot][valid"));
+            fail("Should not have succeeded because the xpath expression does not select an element");
+        } catch (RuntimeException e) {
+            // We expect an exception because the XPath expression results in a number, not in an element
+            assertThat(e, is(instanceOf(InvalidSelectorException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldFindNestedElementByXPath() {
+        WebElement button = driver.findElement(By.xpath("//PushButton"));
+        assertThat(button.getText(), is("Click here"));
+    }
+
+    @Test
+    public void testShouldDriverFindNestedElementsByXPath() {
+
+        List<WebElement> listElem = driver.findElements(By.xpath("//PushButton"));
+        assertThat(listElem.size(), greaterThan(0));
+    }
+
+    @Test
+    public void testShouldDriverFindNestedElementByXPathThroughId() {
+        WebElement button = driver.findElement(By.xpath("//*[@id='buttonInScrollArea']"));
+        assertThat(button.getText(), is("Click here"));
+    }
+
+    @Test
+    public void testShouldElementFindNestedElement() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElement(By.xpath("//PushButton"));
+        } catch (RuntimeException e) {
+            fail("Should have succeeded because the xpath expression select an element");
+        }
+    }
+
+    @Test
+    public void testShouldElementFindNestedElements() {
+
+        WebElement externalElement = driver.findElement(By.id("scrollArea"));
+
+        try {
+            externalElement.findElements(By.xpath("//PushButton"));
+        } catch (RuntimeException e) {
+            fail("Should have succeeded because the xpath expression select an element");
+        }
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/build.desc b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/build.desc
new file mode 100644
index 00000000..cd2e4be2
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/build.desc
@@ -0,0 +1,47 @@
+java_test(name = "quick1_tests",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit",
+      "webdriver.browserClass" : "QDeclarativeView" },
+  ],
+  srcs = ["Quick1WebDriverTests.java", "Quick1TestContent.java"],
+  deps = [
+    ":tests",
+    "//third_party/java/junit",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//third_party/java/junit"
+  ])
+
+java_test(name = "quick2_tests",
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit",
+      "webdriver.browserClass" : "QQuickView" },
+  ],
+  srcs = ["Quick2WebDriverTests.java", "Quick2TestContent.java"],
+  deps = [
+    ":tests",
+    "//third_party/java/junit",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//third_party/java/junit"
+  ])
+
+
+java_library(name = "tests",
+  srcs = [
+    "interactions/InteractionTests.java",
+    "interactions/touch/TouchTests.java",
+    "*Test.java",
+    "interactions/*.java",
+    "interactions/touch/*.java",
+  ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/remote:common",
+    "//java/client/src/org/openqa/selenium/interactions",
+    "//java/client/test/org/openqa/selenium/environment",
+    "//java/client/test/org/openqa/selenium/testing:junit_4",
+    "//java/client/test/org/openqa/selenium/qtwebkit:test_qtwebkit",
+    "//java/client/test/org/openqa/selenium/testing:proxy",
+    "//java/client/test/org/openqa/selenium/testing:util",
+    "//java/client/test/org/openqa/selenium/v1:small_tests",
+    "//third_party/java/commons-io",
+    "//third_party/java/junit",
+  ])
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicKeyboardInterfaceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicKeyboardInterfaceTest.java
new file mode 100644
index 00000000..2e264aab
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicKeyboardInterfaceTest.java
@@ -0,0 +1,141 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions;
+
+import static org.hamcrest.Matchers.containsString;
+import static org.junit.Assert.assertThat;
+
+import static org.hamcrest.Matchers.is;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.Keys;
+import org.openqa.selenium.WebElement;
+
+public class BasicKeyboardInterfaceTest extends JUnit4TestBase {
+
+    @Before
+    public void setUp() throws Exception {
+        driver.get(pages.basicKeyboardInterfaceTest);
+    }
+
+    @Test
+    public void testBasicKeyboardInput() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+
+        inputElement.sendKeys("abc def");
+        assertThat(inputElement.getText(), is("abc def"));
+    }
+
+    @Test
+    public void testSendingSingleKeyDownUp() {
+
+        WebElement keysEventInput = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElementDown = driver.findElement(By.id("resultIsKeyDown"));
+        WebElement resultElementUp = driver.findElement(By.id("resultIsKeyUp"));
+        WebElement resultElementModifiers = driver.findElement(By.id("resultModifier"));
+
+        keysEventInput.sendKeys("a");
+        assertThat(resultElementDown.getText(), is("Key Down"));
+        assertThat(resultElementUp.getText(), is("Key Up"));
+        assertThat(resultElementModifiers.getText(), is(""));
+    }
+
+    @Test
+    public void testSendingKeysShiftOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.SHIFT);
+        assertThat(resultElement.getText(), containsString("Shift"));
+        assertThat(inputElement.getText(), is(""));
+    }
+
+    @Test
+    public void testSendingKeyCtrlOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.CONTROL);
+        assertThat(resultElement.getText(), containsString("Ctrl"));
+        assertThat(inputElement.getText(), is(""));
+    }
+
+    @Test
+    public void testSendingKeyAltOnly() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys(Keys.ALT);
+        assertThat(resultElement.getText(), containsString("Alt"));
+        assertThat(inputElement.getText(), is(""));
+    }
+
+    @Test
+    @Ignore(value = {Ignore.Driver.QTWEBKIT},
+            reason = "won't fix in near future(hard to resolve without regressions)",
+            issues = 721)
+    public void testSendingKeysWithShiftPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("ab" + Keys.SHIFT);
+        assertThat(resultElement.getText(), containsString("Shift"));
+
+        assertThat(inputElement.getText(), is("AB"));
+
+    }
+
+    @Test
+    public void testSendingKeysWithCtrlPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("www" + Keys.CONTROL);
+        assertThat(resultElement.getText(), containsString("Ctrl"));
+        assertThat(inputElement.getText(), is("www"));
+
+    }
+
+    @Test
+    public void testSendingKeysWithAltPressed() {
+
+        WebElement inputElement = driver.findElement(By.id("enabledTextElement"));
+        WebElement resultElement = driver.findElement(By.id("resultModifier"));
+
+        inputElement.sendKeys("nnn" + Keys.ALT);
+        assertThat(resultElement.getText(), containsString("Alt"));
+        assertThat(inputElement.getText(), is("nnn"));
+
+    }
+
+}
+
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicMouseInterfaceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicMouseInterfaceTest.java
new file mode 100644
index 00000000..f6f800fe
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/BasicMouseInterfaceTest.java
@@ -0,0 +1,155 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.testing.Ignore;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.testing.JavascriptEnabled;
+
+import java.util.concurrent.TimeUnit;
+
+import static org.junit.Assert.*;
+import static org.openqa.selenium.WaitingConditions.*;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
+
+/**
+ * Tests operations that involve mouse and keyboard.
+ */
+public class BasicMouseInterfaceTest extends JUnit4TestBase {
+
+    @Before
+    public void setUpWebDriver()
+    {
+        driver.get(pages.basicMouseInterfaceTest);
+    }
+
+    private Actions getBuilder(WebDriver driver) {
+        return new Actions(driver);
+    }
+
+    private void performDragAndDropWithMouse() {
+
+        WebElement toDrag = driver.findElement(By.id("itemToDrag"));
+        Point oldPosition = toDrag.getLocation();
+
+        int x_offset = 57;
+        int y_offset = 36;
+
+        Action dragItem = getBuilder(driver)
+                            .clickAndHold(toDrag)
+                            .moveByOffset(x_offset, y_offset)
+                            .release()
+                            .build();
+
+        assertEquals(oldPosition, toDrag.getLocation());
+
+        dragItem.perform();
+
+        assertEquals(oldPosition.moveBy(x_offset, y_offset), toDrag.getLocation());
+    }
+
+    @Test
+    // we cannot simulate drag@drop with pure mouse actions. Need separated mouse command for this
+    public void testDraggingElementWithMouseMovesItToAnotherList() {
+        performDragAndDropWithMouse();
+    }
+
+    @Test
+    public void testButtonDownUp() {
+
+        WebElement targetElement = driver.findElement(By.id("pureButton"));
+
+        Action buttonDown = getBuilder(driver).clickAndHold(targetElement).build();
+
+        buttonDown.perform();
+
+        Action buttonUp = getBuilder(driver).release().build();
+
+        buttonUp.perform();
+
+        assertEquals("Released", targetElement.getAttribute("lastButtonEvent"));
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testDoubleClick() {
+
+        WebElement toDoubleClick = driver.findElement(By.id("pureButton"));
+
+        Action dblClick = getBuilder(driver).doubleClick(toDoubleClick).build();
+
+        dblClick.perform();
+        String testFieldContent = wait.until(
+                    elementTextToEqual(toDoubleClick, "DoubleClicked"));
+        assertEquals("Value should change to DoubleClicked.", "DoubleClicked",
+                    testFieldContent);
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testContextClick() {
+
+        WebElement toContextClick = driver.findElement(By.id("pureButton"));
+
+        Action contextClick = getBuilder(driver).contextClick(toContextClick).build();
+
+        contextClick.perform();
+        assertEquals("Value should change to ContextClicked.", "ContextClicked",
+                     toContextClick.getText());
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testMoveAndClick() {
+
+        WebElement toClick = driver.findElement(By.id("pureButton"));
+
+        Action contextClick = getBuilder(driver).moveToElement(toClick).click().build();
+
+        contextClick.perform();
+
+        wait.until(elementTextToEqual(toClick, "Clicked"));
+
+        assertEquals("Value should change to Clicked.", "Clicked",
+                     toClick.getText());
+    }
+
+    @JavascriptEnabled
+    @Test
+    public void testCannotMoveToANullLocator() {
+
+        try {
+          Action contextClick = getBuilder(driver).moveToElement(null).build();
+
+          contextClick.perform();
+          fail("Shouldn't be allowed to click on null element.");
+        } catch (IllegalArgumentException expected) {
+          // Expected.
+        }
+      }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/InteractionTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/InteractionTests.java
new file mode 100644
index 00000000..74f3c94a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/InteractionTests.java
@@ -0,0 +1,29 @@
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+package org.openqa.selenium.qtwebkit.quick_tests.interactions;
+
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+    BasicKeyboardInterfaceTest.class,
+    BasicMouseInterfaceTest.class,
+})
+
+public class InteractionTests {
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/MultiTouchTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/MultiTouchTests.java
new file mode 100644
index 00000000..102c2ba9
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/MultiTouchTests.java
@@ -0,0 +1,72 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions.touch;
+
+
+import org.openqa.selenium.By;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.multitouch.MultiTouchActions;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import org.junit.Test;
+
+public class MultiTouchTests extends JUnit4TestBase {
+    private MultiTouchActions getBuilder(WebDriver driver) {
+        return new MultiTouchActions(driver);
+    }
+
+    private void rotateElement(String elementId, int angle) {
+        WebElement toRotate = driver.findElement(By.id(elementId));
+        Action rotate = getBuilder(driver).pinchRotate(toRotate, angle).build();
+        rotate.perform();
+    }
+
+    private void zoomElement(String elementId, double scale) {
+        WebElement toZoom = driver.findElement(By.id(elementId));
+        Action zoom = getBuilder(driver).pinchZoom(toZoom, scale).build();
+        zoom.perform();
+    }
+
+    @Test
+    public void testCanRotateElement() {
+        driver.get(pages.multiTouchTest);
+        rotateElement("pinchItem", 80);
+        wait.until(WaitingConditions.elementTextToEqual(By.id("rotationLbl"), "80"));
+    }
+
+    @Test
+    public void testCanZoomOutElement() {
+        driver.get(pages.multiTouchTest);
+        zoomElement("pinchItem", 12.5);
+        wait.until(WaitingConditions.elementTextToEqual(By.id("zoomLbl"), "12.5"));
+    }
+
+    @Test
+    public void testCanZoomInElement() {
+        driver.get(pages.multiTouchTest);
+        zoomElement("pinchItem", 0.3);
+        wait.until(WaitingConditions.elementTextToEqual(By.id("zoomLbl"), "0.3"));
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchInteractionTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchInteractionTests.java
new file mode 100644
index 00000000..01359357
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchInteractionTests.java
@@ -0,0 +1,157 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions.touch;
+
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.touch.FlickAction;
+import org.openqa.selenium.interactions.touch.TouchActions;
+import org.openqa.selenium.internal.Locatable;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.touch.TouchTestBase;
+
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.assertThat;
+import static org.hamcrest.Matchers.is;
+
+import org.junit.Test;
+import org.junit.Before;
+import org.openqa.selenium.By;
+import org.openqa.selenium.JavascriptExecutor;
+import org.openqa.selenium.WaitingConditions;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+/**
+ * Tests single tap actions on touch enabled devices.
+ */
+public class TouchInteractionTests extends TouchTestBase {
+
+    private TouchActions getBuilder(WebDriver driver) {
+        return new TouchActions(driver);
+    }
+
+    private void singleTapOnElement(String elementId) {
+        WebElement toSingleTap = driver.findElement(By.id(elementId));
+        Action singleTap = getBuilder(driver).singleTap(toSingleTap).build();
+        singleTap.perform();
+    }
+
+    private void doubleTapOnElement(String elementId) {
+        WebElement toDoubleTap = driver.findElement(By.id(elementId));
+        Action doubleTap = getBuilder(driver).doubleTap(toDoubleTap).build();
+        doubleTap.perform();
+    }
+
+    private void longTapOnElement(String elementId) {
+        WebElement toLongTap = driver.findElement(By.id(elementId));
+        Action longTap = getBuilder(driver).longPress(toLongTap).build();
+        longTap.perform();
+    }
+
+    private void scrollElement(String elementId, int x, int y) {
+        WebElement toScroll= driver.findElement(By.id(elementId));
+        Action scroll = getBuilder(driver).scroll(toScroll, x, y).build();
+        scroll.perform();
+    }
+
+    private void flickElement(String elementId, int xoffset, int yoffset, int speed) {
+        WebElement toFlick = driver.findElement(By.id(elementId));
+        Action flick = getBuilder(driver).flick(toFlick, xoffset, yoffset, speed).build();
+        flick.perform();
+    }
+
+    private Point getLocationOnScreen(By locator) {
+        WebElement element = driver.findElement(locator);
+        return ((Locatable) element).getCoordinates().onScreen();
+    }
+
+
+    @Test
+    public void testCanClickOnMulitouchArea() {
+        driver.get(pages.touchTest);
+        singleTapOnElement("touchArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "PressedReleased"));
+    }
+
+    @Test
+    public void testCanClickOnMouseArea() {
+        driver.get(pages.touchTest);
+        singleTapOnElement("mouseArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "Clicked"));
+    }
+
+    @Test
+    public void testCanDoubleClickOnMouseArea() {
+        driver.get(pages.touchTest);
+        doubleTapOnElement("mouseArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "DoubleClicked"));
+    }
+
+    @Test
+    public void testCanDoubleClickOnMultitouchArea() {
+        driver.get(pages.touchTest);
+        doubleTapOnElement("touchArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "PressedReleasedPressedReleased"));
+    }
+
+    @Test
+    public void testCanLongClick() {
+        driver.get(pages.touchTest);
+        longTapOnElement("mouseArea");
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "LongClicked"));
+    }
+
+    @Test
+    public void testCanDownMoveUp() {
+        driver.get(pages.touchTest);
+        Action down = getBuilder(driver).down(100, 100).build();
+        down.perform();
+        Action move = getBuilder(driver).move(150, 150).build();
+        move.perform();
+        Action up = getBuilder(driver).up(250, 250).build();
+        up.perform();
+
+        assertThat(getLocationOnScreen(By.id("pressPoint")), is(new Point(90, 90)));
+        assertThat(getLocationOnScreen(By.id("movePoint")), is(new Point(140, 140)));
+        assertThat(getLocationOnScreen(By.id("releasePoint")), is(new Point(240, 240)));
+
+    }
+
+    @Test
+    public void testScroll() {
+        driver.get(pages.touchScrollTest);
+        int prewY = getLocationOnScreen(By.id("item6")).getY();
+        scrollElement("item6", 0, -200);
+        int newY = getLocationOnScreen(By.id("item6")).getY();
+        assertTrue("Got: " + newY, newY < prewY);
+    }
+
+    @Test
+    public void testFlick() {
+        driver.get(pages.touchScrollTest);
+        flickElement("listView", 0, -200, FlickAction.SPEED_FAST);
+        wait.until(WaitingConditions.elementTextToEqual(By.id("resultLabel"), "Flicked"));
+
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTestBase.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTestBase.java
new file mode 100644
index 00000000..f4f3f05e
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTestBase.java
@@ -0,0 +1,36 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions.touch;
+
+import static org.hamcrest.Matchers.instanceOf;
+import static org.junit.Assume.assumeThat;
+
+import org.junit.Before;
+import org.openqa.selenium.interactions.HasTouchScreen;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+public abstract class TouchTestBase extends JUnit4TestBase {
+    @Before
+    public void checkHasTouchScreen() {
+        assumeThat(driver, instanceOf(HasTouchScreen.class));
+    }
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTests.java b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTests.java
new file mode 100644
index 00000000..1258f6c4
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/quick_tests/interactions/touch/TouchTests.java
@@ -0,0 +1,41 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.quick_tests.interactions.touch;
+
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.junit.AfterClass;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.touch.TouchInteractionTests;
+import org.openqa.selenium.qtwebkit.quick_tests.interactions.touch.MultiTouchTests;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        MultiTouchTests.class,
+        TouchInteractionTests.class,
+})
+public class TouchTests {
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/touch/MultitiouchTest.java b/java/client/test/org/openqa/selenium/qtwebkit/touch/MultitiouchTest.java
new file mode 100644
index 00000000..05f8a6f8
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/touch/MultitiouchTest.java
@@ -0,0 +1,97 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.touch;
+
+import static org.junit.Assert.assertTrue;
+import org.junit.AfterClass;
+
+import org.junit.Test;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.junit.Assume.assumeThat;
+import org.junit.Before;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.HasMultiTouchScreen;
+import org.openqa.selenium.interactions.multitouch.MultiTouchActions;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+
+public class MultitiouchTest extends JUnit4TestBase {
+
+    @Before
+    public void checkHasMultiTouchScreen() {
+        assumeThat(driver, instanceOf(HasMultiTouchScreen.class));
+    }
+
+    private MultiTouchActions getBuilder(WebDriver driver) {
+        return new MultiTouchActions(driver);
+    }
+
+    private void rotateElement(String elementId, int angle) {
+        WebElement toRotate = driver.findElement(By.id(elementId));
+        Action rotate = getBuilder(driver).pinchRotate(toRotate, angle).build();
+        rotate.perform();
+    }
+
+    private void zoomElement(String elementId, double scale) {
+        WebElement toZoom = driver.findElement(By.id(elementId));
+        Action zoom = getBuilder(driver).pinchZoom(toZoom, scale).build();
+        zoom.perform();
+    }
+
+    @Test
+    public void testCanRotate() {
+        driver.get(pages.pinchTouchTest);
+        rotateElement("picture", 35);
+        WebElement result = driver.findElement(By.id("result_rotate"));
+        wait.until(WaitingConditions.elementTextToEqual(result, "35"));
+    }
+
+    @Test
+    public void testCanRotateNegativeDegree() {
+        driver.get(pages.pinchTouchTest);
+        rotateElement("picture", -35);
+        WebElement result = driver.findElement(By.id("result_rotate"));
+        wait.until(WaitingConditions.elementTextToEqual(result, "-35"));
+    }
+
+    @Test
+    public void testCanZoomOut() {
+        driver.get(pages.pinchTouchTest);
+        zoomElement("picture", 2.5);
+        WebElement result = driver.findElement(By.id("result_scale"));
+        wait.until(WaitingConditions.elementTextToEqual(result, "2.5"));
+    }
+
+    @Test
+    public void testCanZoomIn() {
+        driver.get(pages.pinchTouchTest);
+        zoomElement("picture", 0.4);
+        WebElement result = driver.findElement(By.id("result_scale"));
+        wait.until(WaitingConditions.elementTextToEqual(result, "0.4"));
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchFlickTest.java b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchFlickTest.java
new file mode 100644
index 00000000..e3e156af
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchFlickTest.java
@@ -0,0 +1,121 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.touch;
+
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.touch.FlickAction;
+import org.openqa.selenium.interactions.touch.TouchActions;
+import org.openqa.selenium.interactions.touch.TouchTestBase;
+import org.openqa.selenium.testing.Ignore;
+
+import static org.junit.Assert.assertTrue;
+import static org.openqa.selenium.testing.Ignore.Driver.*;
+
+/**
+ * Tests the basic flick operations on touch enabled devices.
+ */
+@Ignore({OPERA, OPERA_MOBILE})
+public class TouchFlickTest extends TouchTestBase {
+
+    private TouchActions getBuilder(WebDriver driver) {
+        return new TouchActions(driver);
+    }
+
+    @NeedsFreshDriver
+    @Test
+    public void testCanFlickHorizontally() {
+        driver.get(pages.clicksPage);
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link1"));
+        int x = link.getLocation().x;
+        // The element is located at the right of the page,
+        // so it is not initially visible on the screen.
+        assertTrue("Expected x == 1500, but got x = " + x, x > 1500);
+
+        Action flick = getBuilder(driver).flick(200, 0).build();
+        flick.perform();
+        x = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollLeft")).intValue();
+        //Scroll 3*xspeed pixel
+        assertTrue("Expected x == 600, but got x = " + x, x == 600);
+    }
+
+    @Ignore(value = {ANDROID},
+            reason = "Android flick's can result in different offsets")
+    @NeedsFreshDriver
+    @Test
+    public void testCanFlickHorizontallyFast() {
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link2"));
+        int x = link.getLocation().x;
+        // The element is located at the right of the page,
+        // so it is not initially visible on the screen.
+        assertTrue(x > 3500);
+
+        Action flick = getBuilder(driver).flick(750, 0).build();
+        flick.perform();
+        x = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollLeft")).intValue();
+        //Scroll 3*xspeed pixel
+        assertTrue("Got: " + x, x == 2250);
+    }
+
+    @NeedsFreshDriver
+    @Test
+    public void testCanFlickVertically() {
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link3"));
+        int y = link.getLocation().y;
+        // The element is located at the bottom of the page,
+        // so it is not initially visible on the screen.
+        assertTrue(y > 4200);
+
+        Action flick = getBuilder(driver).flick(0, 750).build();
+        flick.perform();
+        y = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollTop")).intValue();
+
+        //Scroll 3*yspeed pixel
+        assertTrue("Got: " + y, y == 2250);
+    }
+
+    @NeedsFreshDriver
+    @Test
+    public void testCanFlickVerticallyFast() {
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link4"));
+        int y = link.getLocation().y;
+        // The element is located at the bottom of the page,
+        // so it is not initially visible on the screen.
+        assertTrue(y > 8700);
+
+        Action flick = getBuilder(driver).flick(0, 1500).build();
+        flick.perform();
+        y = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollTop")).intValue();
+        //Scroll 3*yspeed pixel
+        assertTrue("Got: " + y, y == 4500);
+    }
+
+}
\ No newline at end of file
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchScrollTest.java b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchScrollTest.java
new file mode 100644
index 00000000..c33df58b
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchScrollTest.java
@@ -0,0 +1,84 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.touch;
+
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.touch.TouchActions;
+import org.openqa.selenium.interactions.touch.TouchTestBase;
+import org.openqa.selenium.testing.Ignore;
+
+import static org.junit.Assert.assertTrue;
+import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
+import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
+
+/**
+ * Tests the basic scroll operations on touch enabled devices..
+ */
+@Ignore({OPERA, OPERA_MOBILE})
+public class TouchScrollTest extends TouchTestBase {
+
+    private TouchActions getBuilder(WebDriver driver) {
+        return new TouchActions(driver);
+    }
+
+    @NeedsFreshDriver
+    @Test
+    public void testCanScrollVertically() {
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link3"));
+        int y = link.getLocation().y;
+        // The element is located at the right of the page,
+        // so it is not initially visible on the screen.
+        assertTrue(y > 4200);
+
+        Action scrollDown = getBuilder(driver).scroll(0, 800).build();
+        scrollDown.perform();
+
+        y = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollTop")).intValue();
+        // Scroll position should change
+        assertTrue(y == 800);
+    }
+
+    @NeedsFreshDriver
+    @Test
+    public void testCanScrollHorizontally() {
+        driver.get(pages.longContentPage);
+
+        WebElement link = driver.findElement(By.id("link1"));
+        int x = link.getLocation().x;
+        // The element is located at the right of the page,
+        // so it is not initially visible on the screen.
+        assertTrue("Expected x > 1500, but got x = " + x, x > 1500);
+
+        Action scrollDown = getBuilder(driver).scroll(400, 0).build();
+        scrollDown.perform();
+
+        x = ((Long)((JavascriptExecutor) driver).executeScript("return document.body.scrollLeft")).intValue();
+        // Scroll position should change
+        assertTrue("Expected x == 400, but got x = " + x, x == 400);
+    }
+
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchTests.java b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchTests.java
new file mode 100644
index 00000000..fce3f55c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/touch/TouchTests.java
@@ -0,0 +1,65 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.touch;
+
+
+/*
+Copyright 2012 Selenium committers
+Copyright 2012 Software Freedom Conservancy
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import org.openqa.selenium.interactions.touch.*;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+import org.junit.AfterClass;
+import org.openqa.selenium.interactions.touch.TouchLongPressTest;
+import org.openqa.selenium.interactions.touch.TouchSingleTapTest;
+import org.openqa.selenium.qtwebkit.touch.TouchScrollTest;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+        TouchLongPressTest.class,
+        TouchSingleTapTest.class,
+        TouchScrollTest.class,
+        TouchFlickTest.class,
+        MultitiouchTest.class,
+})
+public class TouchTests {
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsBaseTest.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsBaseTest.java
new file mode 100644
index 00000000..d0a3673c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsBaseTest.java
@@ -0,0 +1,72 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.junit.After;
+import org.junit.Before;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.qtwebkit.*;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.service.DriverService;
+import org.openqa.selenium.support.PageFactory;
+import org.openqa.selenium.support.ui.Wait;
+import org.openqa.selenium.support.ui.WebDriverWait;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+public class QtWebDriverJsBaseTest extends JUnit4TestBase {
+
+  protected QtWebDriverJsPage page;
+  protected WebDriver targetDriver;
+  protected Wait<WebDriver> targetWait;
+
+  @Before
+  public void createDriver() throws Exception {
+    DesiredCapabilities capabilities = DesiredCapabilities.qtwebkit();
+
+    QtWebDriverExecutor webDriverExecutor = QtWebKitDriver.createDefaultExecutor();
+    driver = new QtWebKitDriver(webDriverExecutor, capabilities);
+    page = PageFactory.initElements(driver, QtWebDriverJsPage.class);
+    page.setDriver(driver);
+    wait = new WebDriverWait(driver, 30);
+
+    DriverService webDriver2Service = QtWebDriverService.createDefaultService();
+    QtWebDriverExecutor webDriver2Executor = new QtWebDriverServiceExecutor(webDriver2Service);
+    targetDriver = new QtWebKitDriver(webDriver2Executor, capabilities);
+    page.setTargetDriver(targetDriver);
+    targetWait = new WebDriverWait(targetDriver, 30);
+
+    String targetWebDriverUrl = webDriver2Service.getUrl().toExternalForm();
+    page.setWebDriverUrl(targetWebDriverUrl);
+  }
+
+  @After
+  public void tearDown() throws Exception {
+    if (driver != null) {
+      driver.quit();
+      driver = null;
+    }
+    if (targetDriver != null) {
+      targetDriver.quit();
+      targetDriver = null;
+    }
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsPage.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsPage.java
new file mode 100644
index 00000000..6fab2bc0
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsPage.java
@@ -0,0 +1,371 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.json.JSONException;
+import org.json.JSONObject;
+import org.openqa.selenium.*;
+import org.openqa.selenium.support.FindBy;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+import org.openqa.selenium.support.ui.Select;
+import org.openqa.selenium.support.ui.Wait;
+import org.openqa.selenium.support.ui.WebDriverWait;
+
+import java.util.concurrent.Callable;
+
+import static java.util.concurrent.TimeUnit.SECONDS;
+import static org.junit.Assert.assertNotNull;
+import static org.openqa.selenium.WaitingConditions.elementTextToContain;
+import static org.openqa.selenium.qtwebkit.visualizer_tests.WaitingConditions.elementToBeDisplayed;
+import static org.openqa.selenium.qtwebkit.visualizer_tests.WaitingConditions.pageUrlToBe;
+import static org.openqa.selenium.support.ui.ExpectedConditions.alertIsPresent;
+
+public class QtWebDriverJsPage {
+  private static final long TIME_OUT = 20;
+
+  private WebDriver driver;
+  private WebDriver targetDriver;
+  private String webDriverJsWindowHandle;
+
+  protected Wait<WebDriver> wait;
+  protected Wait<WebDriver> targetWait;
+
+  private WebElement webDriverUrlPort;
+  private WebElement webPage;
+  private String webPageValue;
+
+  private WebElement getButton;
+  private WebElement screenshotButton;
+  private WebElement logsSelect;
+
+  @FindBy(xpath = "//input[@value='Source']")
+  private WebElement sourceButton;
+
+  private WebElement error;
+
+  private WebElement findElementCriteria;
+  private WebElement findElementKey;
+  @FindBy(xpath = "//input[@value = 'Find element']")
+  private WebElement findElementButton;
+  private WebElement foundElement;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Click']")
+  private WebElement foundElementClick;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Submit']")
+  private WebElement foundElementSubmit;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Clear']")
+  private WebElement foundElementClear;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Tag name']")
+  private WebElement foundElementTagName;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Text']")
+  private WebElement foundElementText;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Location']")
+  private WebElement foundElementLocation;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Size']")
+  private WebElement foundElementSize;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Selected?']")
+  private WebElement foundElementSelected;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Enabled?']")
+  private WebElement foundElementEnabled;
+
+  @FindBy(xpath = "//*[@id = 'elementActions']/input[@value = 'Displayed?']")
+  private WebElement foundElementDisplayed;
+
+  private WebElement listWindowButton;
+  private WebElement windowList;
+  private WebElement chooseWindow;
+
+  private WebElement windowSizeWidth;
+  private WebElement windowSizeHeight;
+  @FindBy(xpath = "//input[@value = 'Set window size']")
+  private WebElement windowSizeButton;
+
+  private Point getLocationFromAlert(String caption) {
+    wait.until(alertIsPresent());
+    String value = driver.switchTo().alert().getText().replace(caption, "").trim();
+    driver.switchTo().alert().accept();
+    try {
+      JSONObject json = new JSONObject(value);
+      return new Point(json.getInt("x"), json.getInt("y"));
+    } catch (JSONException e) {
+      throw new RuntimeException(e);
+    }
+  }
+
+  private Dimension getDimensionFromAlert(String caption) {
+    wait.until(alertIsPresent());
+    String value = driver.switchTo().alert().getText().replace(caption, "").trim();
+    driver.switchTo().alert().accept();
+    try {
+      JSONObject json = new JSONObject(value);
+      return new Dimension(json.getInt("width"), json.getInt("height"));
+    } catch (JSONException e) {
+      throw new RuntimeException(e);
+    }
+  }
+
+  private String getStringFromAlert(String caption) {
+    wait.until(alertIsPresent());
+    String value = driver.switchTo().alert().getText().replace(caption, "").trim();
+    driver.switchTo().alert().accept();
+    return value;
+  }
+
+  private boolean getBooleanFromAlert(String caption) {
+    wait.until(alertIsPresent());
+    String value = driver.switchTo().alert().getText().replace(caption, "").trim();
+    driver.switchTo().alert().accept();
+    return Boolean.valueOf(value);
+  }
+
+  private String getVisualizerWindowHandle() {
+    String currentWindowHandle = driver.getWindowHandle();
+    String visualizerWindowHandle = null;
+    for (String windowHandle : driver.getWindowHandles()) {
+      String title = driver.switchTo().window(windowHandle).getTitle();
+      if (title.endsWith(" - Visualizer")) {
+        visualizerWindowHandle = windowHandle;
+        break;
+      }
+    }
+    driver.switchTo().window(currentWindowHandle);
+    return visualizerWindowHandle;
+  }
+
+  public void setDriver(WebDriver driver) {
+    this.driver = driver;
+    wait = new WebDriverWait(driver, TIME_OUT);
+  }
+
+  public void setTargetDriver(WebDriver targetDriver) {
+    this.targetDriver = targetDriver;
+    targetWait = new WebDriverWait(targetDriver, TIME_OUT);
+  }
+
+  public String getWebDriverJsWindowHandle() {
+    return webDriverJsWindowHandle;
+  }
+
+  public String getWebDriverUrlPort() {
+    return webDriverUrlPort.getAttribute("value");
+  }
+
+  public void setWebDriverUrl(String url) {
+    driver.get(url + "/WebDriverJsDemo.html");
+    wait.until(new ExpectedCondition<Object>() {
+      @Override
+      public Object apply(WebDriver driver) {
+        return ((JavascriptExecutor) driver).executeScript("return window.wd;");
+      }
+
+      @Override
+      public String toString() {
+        return "WebDriverJsController to be created";
+      }
+    });
+
+    webDriverJsWindowHandle = driver.getWindowHandle();
+
+    webDriverUrlPort.clear();
+    webDriverUrlPort.sendKeys(url);
+  }
+
+  public String getWebPage() {
+    return webPage.getAttribute("value");
+  }
+
+  public void setWebPage(String webPage) {
+    this.webPage.clear();
+    this.webPage.sendKeys(webPage);
+    webPageValue = webPage;
+  }
+
+  public ExpectedCondition<String> webPageIs(final String expectedWebPage) {
+    return new ExpectedCondition<String>() {
+      private String actualWebPage;
+
+      @Override
+      public String apply(WebDriver driver) {
+        actualWebPage = getWebPage();
+
+        if (expectedWebPage.equals(actualWebPage)) {
+          return actualWebPage;
+        }
+
+        return null;
+      }
+
+      @Override
+      public String toString() {
+        return "expected web page to be '" + expectedWebPage +
+               "' while actual web page is '" + actualWebPage + "'";
+      }
+    };
+  }
+
+  public void clickGet() {
+    getButton.click();
+    targetWait.until(pageUrlToBe(webPageValue));
+  }
+
+  public String clickSource() {
+    String visualizerWindow = getVisualizerWindowHandle();
+    if (visualizerWindow != null) {
+      driver.switchTo().window(visualizerWindow).close();
+    }
+
+    driver.switchTo().window(webDriverJsWindowHandle);
+    sourceButton.click();
+    visualizerWindow = wait.until(new ExpectedCondition<String>() {
+      @Override
+      public String apply(WebDriver driver) {
+        return getVisualizerWindowHandle();
+      }
+    });
+
+    assertNotNull(visualizerWindow);
+    return visualizerWindow;
+  }
+
+  public void clickScreenshotButton() {
+    screenshotButton.click();
+  }
+
+  public void clickLogsSelect(String type) {
+    new Select(logsSelect).selectByValue(type);
+  }
+
+  public String findElement(String criteria, String key) {
+    findElementKey.clear();
+    findElementKey.sendKeys("c7c3179a38f864a463729657f15871326baccede");
+    findElementButton.click();
+    wait.until(elementTextToContain(error, "The element could not be found"));
+
+    new Select(findElementCriteria).selectByValue(criteria);
+    findElementKey.clear();
+    findElementKey.sendKeys(key);
+    findElementButton.click();
+    wait.until(elementTextToContain(foundElement, "Found element"));
+
+    return foundElement.getText().substring("Found element".length()).trim();
+  }
+
+  public void clickElementClick() {
+    foundElementClick.click();
+  }
+
+  public void clickElementSubmit() {
+    foundElementSubmit.click();
+  }
+
+  public void clickElementClear() {
+    foundElementClear.click();
+  }
+
+  public String getFoundElementTagName() {
+    foundElementTagName.click();
+    return getStringFromAlert("Element tag name:");
+  }
+
+  public String getFoundElementText() {
+    foundElementText.click();
+    return getStringFromAlert("Element text:");
+  }
+
+  public Point getFoundElementLocation() {
+    foundElementLocation.click();
+    return getLocationFromAlert("Element location:");
+  }
+
+  public Dimension getFoundElementSize() {
+    foundElementSize.click();
+    return getDimensionFromAlert("Element size:");
+  }
+
+  public boolean isFoundElementSelected() {
+    foundElementSelected.click();
+    return getBooleanFromAlert("Element selection:");
+  }
+
+  public boolean isFoundElementEnabled() {
+    foundElementEnabled.click();
+    return getBooleanFromAlert("Element enabled:");
+  }
+
+  public boolean isFoundElementDisplayed() {
+    foundElementDisplayed.click();
+    return getBooleanFromAlert("Element displayed:");
+  }
+
+  public void keyPress(String label) {
+    driver.findElement(By.xpath(getKeyXPath(label))).click();
+
+    if (label.equals("Shift")) {
+      wait.until(new ExpectedCondition<WebElement>() {
+        @Override
+        public WebElement apply(WebDriver driver) {
+          return driver.findElement(By.xpath(getKeyXPath("A")));
+        }
+      });
+    }
+  }
+
+  private String getKeyXPath(String label) {
+    if (label.equals("'"))
+      label = "\"'\"";
+    else
+      label = "'" + label + "'";
+
+    return String.format("//div[contains(@class, 'ui-keyboard')]//button/span[normalize-space(text()) = %s]", label);
+  }
+
+  public void clickListWindowHandles() {
+    listWindowButton.click();
+    wait.until(elementToBeDisplayed(windowList));
+  }
+
+  public Select getWindowListSelect() {
+    return new Select(windowList);
+  }
+
+  public void clickChooseWindow() {
+    chooseWindow.click();
+  }
+
+  public void setWindowSize(Dimension dimension) {
+    windowSizeWidth.clear();
+    windowSizeWidth.sendKeys(Integer.valueOf(dimension.getWidth()).toString());
+
+    windowSizeHeight.clear();
+    windowSizeHeight.sendKeys(Integer.valueOf(dimension.getHeight()).toString());
+
+    windowSizeButton.click();
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsTest.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsTest.java
new file mode 100644
index 00000000..eefae57a
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverJsTest.java
@@ -0,0 +1,299 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.junit.Test;
+import org.openqa.selenium.*;
+import org.openqa.selenium.qtwebkit.QtWebDriverExecutor;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.support.PageFactory;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+
+import java.util.HashSet;
+import java.util.Set;
+import java.util.concurrent.Callable;
+
+import static java.util.concurrent.TimeUnit.SECONDS;
+import static org.junit.Assert.*;
+import static org.openqa.selenium.WaitingConditions.*;
+import static org.openqa.selenium.qtwebkit.visualizer_tests.WaitingConditions.*;
+
+public class QtWebDriverJsTest extends QtWebDriverJsBaseTest {
+
+  @Test
+  public void checkWebPageUpdateOnSessionReuse() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+
+    String webDriverUrlPort = page.getWebDriverUrlPort();
+    WebDriver originalDriver = driver;
+    try {
+      QtWebDriverExecutor webDriverExecutor = QtWebKitDriver.createDefaultExecutor();
+      driver = new QtWebKitDriver(webDriverExecutor, DesiredCapabilities.qtwebkit());
+      page = PageFactory.initElements(driver, QtWebDriverJsPage.class);
+      page.setDriver(driver);
+      page.setTargetDriver(targetDriver);
+      page.setWebDriverUrl(webDriverUrlPort);
+
+      driver.findElement(By.id("getButton")).click();
+
+      // shall retrieve web page url from previous session according to MHA-879
+      wait.until(page.webPageIs(pages.clicksPage));
+    } finally {
+      originalDriver.quit();
+    }
+  }
+
+  @Test
+  public void checkSourceScreenshotButtonsDisabling() {
+    WebElement sourceButton = driver.findElement(By.id("sourceButton"));
+    WebElement screenshotButton = driver.findElement(By.id("screenshotButton"));
+
+    assertFalse(sourceButton.isEnabled());
+    assertFalse(screenshotButton.isEnabled());
+
+    page.setWebPage(pages.clicksPage);
+
+    wait.until(elementToBeEnabled(sourceButton));
+    wait.until(elementToBeEnabled(screenshotButton));
+
+    page.setWebDriverUrl("");
+
+    wait.until(elementToBeDisabled(sourceButton));
+    wait.until(elementToBeDisabled(screenshotButton));
+  }
+
+  @Test
+  public void canScreenshot() {
+    Set<String> originalWindowHandles = driver.getWindowHandles();
+    page.setWebPage(pages.clicksPage);
+    page.clickScreenshotButton();
+
+    String newWindow = wait.until(newWindowIsOpened(originalWindowHandles));
+    driver.switchTo().window(newWindow);
+    Dimension dimension = VisualizerUtils.getDimensionFromTitle(driver.getTitle());
+    assertTrue("Screenshot has non zero dimension",
+               dimension.getWidth() > 0 && dimension.getHeight() > 0);
+  }
+
+  @Test
+  public void canLogDriver() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+
+    Set<String> originalWindowHandles = driver.getWindowHandles();
+    page.clickLogsSelect("driver");
+    String newWindow = wait.until(newWindowIsOpened(originalWindowHandles));
+    driver.switchTo().window(newWindow);
+    assertTrue(driver.getPageSource().contains("ALL"));
+    assertTrue(driver.getPageSource().contains("INFO"));
+  }
+
+  @Test
+  public void canLogBrowser() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+
+    ((JavascriptExecutor) targetDriver).executeScript("console.log('Fingerprint...');");
+
+    Set<String> originalWindowHandles = driver.getWindowHandles();
+    driver.switchTo().window(page.getWebDriverJsWindowHandle());
+    page.clickLogsSelect("browser");
+    String newWindow = wait.until(newWindowIsOpened(originalWindowHandles));
+    driver.switchTo().window(newWindow);
+    assertTrue(driver.getPageSource().contains("Fingerprint"));
+  }
+
+  @Test
+  public void canFindElement() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+
+    String wdcByTagName = page.findElement("tagName", "h1");
+    String wdcByXPath = page.findElement("xpath", "//h1");
+    assertEquals(wdcByTagName, wdcByXPath);
+  }
+
+  @Test
+  public void canGetFoundElementTagNameAndText() {
+    page.setWebPage(pages.simpleTestPage);
+    page.clickGet();
+    page.findElement("xpath", "//h1");
+    assertEquals(targetDriver.findElement(By.xpath("//h1")).getTagName(), page.getFoundElementTagName());
+    assertEquals(targetDriver.findElement(By.xpath("//h1")).getText(), page.getFoundElementText());
+  }
+
+  @Test
+  public void canGetLocation() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+    page.findElement("id", "normal");
+
+    Point expectedLocation = targetDriver.findElement(By.id("normal")).getLocation();
+    assertEquals(expectedLocation, page.getFoundElementLocation());
+  }
+
+  @Test
+  public void canGetSize() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+    page.findElement("id", "normal");
+
+    Dimension expectedDimension = targetDriver.findElement(By.id("normal")).getSize();
+    assertEquals(expectedDimension, page.getFoundElementSize());
+  }
+
+  @Test
+  public void canClickAndCheckFoundElementSelected() {
+    page.setWebPage(pages.simpleTestPage);
+    page.clickGet();
+    page.findElement("id", "checkbox1");
+
+    assertFalse(page.isFoundElementSelected());
+    page.clickElementClick();
+    assertTrue(page.isFoundElementSelected());
+  }
+
+  @Test
+  public void canCheckFoundElementEnabled() {
+    page.setWebPage(pages.readOnlyPage);
+    page.clickGet();
+
+    page.findElement("id", "textInputnotenabled");
+    assertFalse(page.isFoundElementEnabled());
+
+    page.findElement("id", "writableTextInput");
+    assertTrue(page.isFoundElementEnabled());
+  }
+
+  @Test
+  public void canCheckFoundElementDisplayed() {
+    page.setWebPage(pages.tables);
+    page.clickGet();
+
+    page.findElement("xpath", "//body");
+    assertTrue(page.isFoundElementDisplayed());
+
+    page.findElement("xpath", "//div[contains(@style, 'display: none;')]");
+    assertFalse(page.isFoundElementDisplayed());
+  }
+
+  private ExpectedCondition<String> keyPressed(final String key) {
+    return new ExpectedCondition<String>() {
+      @Override
+      public String apply(WebDriver driver) {
+        String actualValue = getActualValue();
+
+        if (key.equals(actualValue)) {
+          return actualValue;
+        }
+
+        return null;
+      }
+
+      private String getActualValue() {
+        return targetDriver.findElement(By.tagName("body")).getText();
+      }
+
+      @Override
+      public String toString() {
+        return "expected actual value '" + getActualValue() + "' is equal to '" + key + "'";
+      }
+    };
+  }
+
+  @Test
+  public void canKeyPress() {
+    String[] keys = {
+        "Esc", "`", "1", "2", "3", "4", "5", "6", "7", "8", "9", "0", "-", "=", "Bksp",
+        "\u21e5 Tab", "q", "w", "e", "r", "t", "y", "u", "i", "o", "p", "[", "]", "\\",
+        "a", "s", "d", "f", "g", "h", "j", "k", "l", ";", "Enter",
+        "z", "x", "c", "v", "b", "n", "m", ",", ".", "/",
+        "\u21d0", "\u21d1", "\u21d3", "\u21d2"};
+
+/*
+    String[] shiftKeys = {
+        "~", "!", "@", "#", "$", "%", "^", "&", "*", "(", ")", "+",
+        "Q", "W", "E", "R", "T", "Y", "U", "I", "O", "P", "{", "}",
+        "A", "S", "D", "F", "G", "H", "J", "K", "L", ":", "\"",
+        "Z", "X", "C", "V", "B", "N", "M", "<", ">", "?"
+    };
+*/
+
+    page.setWebPage(pages.webdriverjsKeypressPage);
+    page.clickGet();
+
+    for (String key : keys) {
+      page.keyPress(key);
+      wait.until(keyPressed(key));
+    }
+
+//    page.keyPress("Shift");
+//    for (String key : shiftKeys) {
+//      page.keyPress(key);
+//      wait.until(keyPressed(key));
+//    }
+  }
+
+  @Test
+  public void canListAndChooseWindows() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+
+    Set<String> originalWindowHandles = targetDriver.getWindowHandles();
+    targetDriver.findElement(By.id("new-window")).click();
+    targetWait.until(newWindowIsOpened(originalWindowHandles));
+
+    page.clickListWindowHandles();
+
+    Set<String> actualWindowHandles = new HashSet<String>();
+    for (WebElement option : page.getWindowListSelect().getOptions()) {
+      actualWindowHandles.add(option.getText().replace("(active)", "").trim());
+    }
+
+    assertEquals(targetDriver.getWindowHandles(), actualWindowHandles);
+
+    String currentActiveWindow = targetDriver.getWindowHandle();
+    String expectedActiveWindow = VisualizerUtils.findNotEqualsIgnoreCase(targetDriver.getWindowHandles(), currentActiveWindow);
+    page.getWindowListSelect().selectByValue(expectedActiveWindow);
+    page.clickChooseWindow();
+    targetWait.until(activeWindowToBe(expectedActiveWindow));
+
+    // Upon choose window, input field 'Web page' shall be update, MHA-879
+    wait.until(page.webPageIs(pages.xhtmlTestPage));
+  }
+
+  @Test
+  public void canSetWindowSize() {
+    page.setWebPage(pages.clicksPage);
+    page.clickGet();
+    final Dimension dimension = new Dimension(200, 100);
+    page.setWindowSize(dimension);
+    wait.until(new ExpectedCondition<Dimension>() {
+      @Override
+      public Dimension apply(WebDriver driver) {
+        return dimension.equals(targetDriver.manage().window().getSize()) ? dimension : null;
+      }
+    });
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTest.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTest.java
new file mode 100644
index 00000000..0d9edcf3
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTest.java
@@ -0,0 +1,148 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.junit.Test;
+import org.openqa.selenium.By;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.interactions.Action;
+import org.openqa.selenium.interactions.Actions;
+import org.openqa.selenium.interactions.internal.MouseAction;
+import org.openqa.selenium.interactions.multitouch.MultiTouchActions;
+
+import java.util.Set;
+import java.util.concurrent.Callable;
+
+import static java.util.concurrent.TimeUnit.SECONDS;
+import static org.hamcrest.Matchers.equalTo;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertThat;
+import static org.openqa.selenium.WaitingConditions.*;
+import static org.openqa.selenium.qtwebkit.visualizer_tests.WaitingConditions.activeElementToBe;
+import static org.openqa.selenium.support.ui.ExpectedConditions.presenceOfElementLocated;
+import static org.openqa.selenium.support.ui.ExpectedConditions.titleIs;
+
+public class QtWebDriverVisualizerTest extends QtWebDriverJsBaseTest {
+
+  private void rotateElement(String elementId, int angle) {
+    WebElement toRotate = driver.findElement(By.id(elementId));
+    Action rotate = new MultiTouchActions(driver).pinchRotate(toRotate, angle).build();
+    rotate.perform();
+  }
+
+  private void zoomElement(String elementId, double scale) {
+    WebElement toZoom = driver.findElement(By.id(elementId));
+    Action zoom = new MultiTouchActions(driver).pinchZoom(toZoom, scale).build();
+    zoom.perform();
+  }
+
+  @Test
+  public void canOpenLinkAndTypeText() {
+    Set<String> originalWindowHandles = driver.getWindowHandles();
+    page.setWebPage(pages.clicksPage);
+    page.clickSource();
+    wait.until(newWindowIsOpened(originalWindowHandles));
+
+    targetDriver.findElement(By.id("normal")).click();
+    targetWait.until(titleIs("XHTML Test Page"));
+
+    driver.switchTo().window(page.clickSource());
+
+    String typingText = "TheTypingText";
+    String expectedText = "change" + typingText;
+
+    wait.until(presenceOfElementLocated(By.id("username")));
+    WebElement inputField = driver.findElement(By.id("username"));
+    WebElement inputField2 = targetDriver.findElement(By.id("username"));
+
+    inputField.click();
+    wait.until(activeElementToBe(inputField));
+    targetWait.until(activeElementToBe(inputField2));
+
+    inputField.sendKeys(typingText);
+
+    wait.until(elementValueToEqual(inputField2, expectedText));
+    assertThat(inputField2.getAttribute("value"), equalTo(expectedText));
+  }
+
+  @Test
+  public void isClickOnLinkCorrect() {
+    page.setWebPage(pages.clicksPage);
+    driver.switchTo().window(page.clickSource());
+
+    String visualizerTitle = driver.getTitle();
+
+    driver.findElement(By.id("normal")).click();
+    targetWait.until(titleIs("XHTML Test Page"));
+
+    assertEquals("We do not proceed by links in visualizer", visualizerTitle, driver.getTitle());
+  }
+
+  @Test
+  public void canRightClick() {
+    page.setWebPage(pages.javascriptPage);
+    driver.switchTo().window(page.clickSource());
+
+    new Actions(driver).contextClick(driver.findElement(By.id("doubleClickField"))).perform();
+    targetWait.until(elementValueToEqual(targetDriver.findElement(By.id("doubleClickField")), "ContextClicked"));
+  }
+
+  @Test
+  public void canPinchRotate() {
+    page.setWebPage(pages.pinchTouchTest);
+    driver.switchTo().window(page.clickSource());
+
+    rotateElement("picture", 35);
+    WebElement result = targetDriver.findElement(By.id("result_rotate"));
+    targetWait.until(elementTextToEqual(result, "35"));
+  }
+
+  @Test
+  public void canPinchRotateNegativeDegree() {
+    page.setWebPage(pages.pinchTouchTest);
+    driver.switchTo().window(page.clickSource());
+
+    rotateElement("picture", -35);
+    WebElement result = targetDriver.findElement(By.id("result_rotate"));
+    targetWait.until(org.openqa.selenium.WaitingConditions.elementTextToEqual(result, "-35"));
+  }
+
+  @Test
+  public void canPinchZoomOut() {
+    page.setWebPage(pages.pinchTouchTest);
+    driver.switchTo().window(page.clickSource());
+
+    zoomElement("picture", 2.5);
+    WebElement result = targetDriver.findElement(By.id("result_scale"));
+    targetWait.until(org.openqa.selenium.WaitingConditions.elementTextToEqual(result, "2.5"));
+  }
+
+  @Test
+  public void canPinchZoomIn() {
+    page.setWebPage(pages.pinchTouchTest);
+    driver.switchTo().window(page.clickSource());
+
+    zoomElement("picture", 0.5);
+    WebElement result = targetDriver.findElement(By.id("result_scale"));
+    targetWait.until(org.openqa.selenium.WaitingConditions.elementTextToEqual(result, "0.5"));
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTests.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTests.java
new file mode 100644
index 00000000..520707d6
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/QtWebDriverVisualizerTests.java
@@ -0,0 +1,52 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.junit.runner.RunWith;
+import org.junit.runners.Suite;
+
+
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.testing.JUnit4TestBase;
+
+@RunWith(Suite.class)
+@Suite.SuiteClasses({
+    QtWebDriverJsTest.class,
+    QtWebDriverVisualizerTest.class,
+    VisualizerSourceTest.class
+})
+
+public class QtWebDriverVisualizerTests {
+
+    @BeforeClass
+    public static void prepareCommonEnvironment() {
+        GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+    }
+
+    @AfterClass
+    public static void cleanUpDriver() {
+        JUnit4TestBase.removeDriver();
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerSourceTest.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerSourceTest.java
new file mode 100644
index 00000000..16c9938c
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerSourceTest.java
@@ -0,0 +1,65 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.Test;
+import org.openqa.selenium.qtwebkit.Visualizer;
+import org.openqa.selenium.testing.JUnit4TestBase;
+import static org.junit.Assert.*;
+import static org.hamcrest.Matchers.*;
+
+public class VisualizerSourceTest extends JUnit4TestBase {
+  @Before
+  public void setUp() throws Exception {
+    driver.get(pages.visualizerPage);
+    try {
+        Thread.sleep(500);
+    } catch (InterruptedException ex) {
+    }
+  }
+
+  @AfterClass
+  public static void cleanUpDriver() {
+    JUnit4TestBase.removeDriver();
+  }
+
+  @Test
+  public void testSource(){
+    String source = ((Visualizer)driver).getVisualizerSource();
+    assertNotNull(source);
+    //System.out.println(source);
+
+    assertThat("JavaScript removal", source, not(containsString("Script to remove")));
+
+    assertThat("Images assemplying is happening", source, containsString("data:image/jpeg;base64,/9j/4AAQ"));
+    assertThat(source, containsString("src=\"data:image/jpeg;base64,/9j/4AAQ"));
+    assertThat(source, containsString("style=\"background:url('data:image/jpeg;base64,/9j/4AAQ"));
+    assertThat(source, containsString("background:url('data:image/jpeg;base64,/9j/4AAQ"));
+
+    assertThat("Stylesheets assemplying is happening", source, containsString("<style type=\"text/css\">* {"));
+    assertThat(source, not(containsString("<link")));
+
+    assertThat("Closing tag persistance", source, containsString("</textarea>"));
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerUtils.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerUtils.java
new file mode 100644
index 00000000..3266bf71
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/VisualizerUtils.java
@@ -0,0 +1,53 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.openqa.selenium.Dimension;
+
+import java.util.Collection;
+import java.util.regex.Matcher;
+import java.util.regex.Pattern;
+
+public class VisualizerUtils {
+
+  /**
+   * Get dimension from title like 'be2a1340-3141-4d5b-a829-8d77cc57add4 (800x512 pixels)'
+   */
+  public static Dimension getDimensionFromTitle(String title) {
+    Matcher m = Pattern.compile(".*\\((?<width>\\d+)x(?<height>\\d+) pixels\\)").matcher(title);
+    if (!m.matches())
+      return null;
+    return new Dimension(Integer.valueOf(m.group("width")), Integer.valueOf(m.group("height")));
+  }
+
+  public static String findNotEqualsIgnoreCase(Collection<String> collection, String value) {
+    for (String item : collection) {
+      if ((item == null || value == null) && item != value)
+        return item;
+
+      if (item != null && !item.equalsIgnoreCase(value))
+        return item;
+    }
+
+    return null;
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/WaitingConditions.java b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/WaitingConditions.java
new file mode 100644
index 00000000..e9ec4ab1
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/WaitingConditions.java
@@ -0,0 +1,170 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.selenium.qtwebkit.visualizer_tests;
+
+import org.openqa.selenium.StaleElementReferenceException;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebElement;
+import org.openqa.selenium.support.ui.ExpectedCondition;
+
+import java.util.concurrent.Callable;
+
+public class WaitingConditions {
+
+  public static ExpectedCondition<String> pageUrlToBe(
+      final String expectedUrl) {
+    if (expectedUrl == null)
+      throw new IllegalArgumentException("expectedUrl");
+
+    return new ExpectedCondition<String>() {
+      private String actualUrl;
+
+      @Override
+      public String apply(WebDriver driver) {
+        actualUrl = driver.getCurrentUrl();
+
+        if (expectedUrl.equals(actualUrl)) {
+          return actualUrl;
+        }
+
+        return null;
+      }
+
+      @Override
+      public String toString() {
+        return "page url to be [" + expectedUrl + "] while actual value is [" + actualUrl + "]";
+      }
+    };
+  }
+
+  public static ExpectedCondition<String> elementAttributeToEqual(
+      final WebElement element, final String attributeName, final String expectedValue) {
+    if (expectedValue == null)
+      throw new IllegalArgumentException("expectedValue");
+
+    return new ExpectedCondition<String>() {
+
+      @Override
+      public String apply(WebDriver driver) {
+        String actualValue = element.getAttribute(attributeName);
+
+        if (expectedValue.equals(actualValue)) {
+          return actualValue;
+        }
+
+        return null;
+      }
+
+      @Override
+      public String toString() {
+        return "expected element " + element + " attribute '" + attributeName + "' " +
+               "to equal '" + expectedValue + "' while actual value is '" + element.getAttribute(attributeName) + "'";
+      }
+    };
+  }
+
+  public static ExpectedCondition<Boolean> elementToBeEnabled(final WebElement element) {
+    return new ExpectedCondition<Boolean>() {
+
+      @Override
+      public Boolean apply(WebDriver driver) {
+        try {
+          return element.isEnabled();
+        } catch (StaleElementReferenceException e) {
+          return true;
+        }
+      }
+    };
+  }
+
+  public static ExpectedCondition<Boolean> elementToBeDisabled(final WebElement element) {
+    return new ExpectedCondition<Boolean>() {
+
+      @Override
+      public Boolean apply(WebDriver driver) {
+        try {
+          return !element.isEnabled();
+        } catch (StaleElementReferenceException e) {
+          return true;
+        }
+      }
+    };
+  }
+
+  public static ExpectedCondition<Boolean> elementToBeDisplayed(final WebElement element) {
+    return new ExpectedCondition<Boolean>() {
+
+      @Override
+      public Boolean apply(WebDriver driver) {
+        try {
+          return element.isDisplayed();
+        } catch (StaleElementReferenceException e) {
+          return true;
+        }
+      }
+    };
+  }
+
+  public static ExpectedCondition<WebElement> activeElementToBe(
+      final WebElement expectedActiveElement) {
+    return new ExpectedCondition<WebElement>() {
+
+      @Override
+      public WebElement apply(WebDriver driver) {
+        WebElement activeElement = driver.switchTo().activeElement();
+
+        if (expectedActiveElement.equals(activeElement)) {
+          return activeElement;
+        }
+
+        return null;
+      }
+
+      @Override
+      public String toString() {
+        return "active element to be: " + expectedActiveElement;
+      }
+    };
+  }
+
+  public static ExpectedCondition<String> activeWindowToBe(
+      final String expectedActiveWindow) {
+    return new ExpectedCondition<String>() {
+
+      @Override
+      public String apply(WebDriver driver) {
+        String actualActiveWindow = driver.getWindowHandle();
+
+        if (expectedActiveWindow.equalsIgnoreCase(actualActiveWindow)) {
+          return actualActiveWindow;
+        }
+
+        return null;
+      }
+
+      @Override
+      public String toString() {
+        return "active window to be: " + expectedActiveWindow;
+      }
+    };
+  }
+}
diff --git a/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/build.desc b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/build.desc
new file mode 100644
index 00000000..f70c86a7
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/qtwebkit/visualizer_tests/build.desc
@@ -0,0 +1,11 @@
+java_test(name = "test_wd_visualizer",
+  srcs = [ "*.java" ],
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit" },
+  ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/qtwebkit",
+    "//java/client/test/org/openqa/selenium:tests",
+    "//third_party/java/junit",
+  ]
+)
diff --git a/java/client/test/org/openqa/selenium/rc/CopyProfileTest.java b/java/client/test/org/openqa/selenium/rc/CopyProfileTest.java
index 7830732e..f2f673a2 100644
--- a/java/client/test/org/openqa/selenium/rc/CopyProfileTest.java
+++ b/java/client/test/org/openqa/selenium/rc/CopyProfileTest.java
@@ -21,7 +21,7 @@
 import org.junit.After;
 import org.junit.Before;
 import org.junit.Test;
-import org.openqa.selenium.Pages;
+import org.openqa.selenium.environment.Pages;
 import org.openqa.selenium.Platform;
 import org.openqa.selenium.WebDriver;
 import org.openqa.selenium.environment.GlobalTestEnvironment;
diff --git a/java/client/test/org/openqa/selenium/rc/SetProxyTest.java b/java/client/test/org/openqa/selenium/rc/SetProxyTest.java
index 686c1d0f..ae195255 100644
--- a/java/client/test/org/openqa/selenium/rc/SetProxyTest.java
+++ b/java/client/test/org/openqa/selenium/rc/SetProxyTest.java
@@ -32,7 +32,7 @@
 import org.junit.Test;
 import org.junit.runner.RunWith;
 
-import org.openqa.selenium.Pages;
+import org.openqa.selenium.environment.Pages;
 import org.openqa.selenium.Proxy;
 import org.openqa.selenium.WebDriver;
 import org.openqa.selenium.environment.GlobalTestEnvironment;
diff --git a/java/client/test/org/openqa/selenium/safari/CrossDomainTest.java b/java/client/test/org/openqa/selenium/safari/CrossDomainTest.java
index a74616ce..ceb0dfe2 100644
--- a/java/client/test/org/openqa/selenium/safari/CrossDomainTest.java
+++ b/java/client/test/org/openqa/selenium/safari/CrossDomainTest.java
@@ -27,7 +27,7 @@
 import org.junit.Test;
 import org.openqa.selenium.By;
 import org.openqa.selenium.JavascriptExecutor;
-import org.openqa.selenium.Pages;
+import org.openqa.selenium.environment.Pages;
 import org.openqa.selenium.StaleElementReferenceException;
 import org.openqa.selenium.WebDriver;
 import org.openqa.selenium.WebDriverException;
diff --git a/java/client/test/org/openqa/selenium/testing/Ignore.java b/java/client/test/org/openqa/selenium/testing/Ignore.java
index 4677dfda..8151c38e 100644
--- a/java/client/test/org/openqa/selenium/testing/Ignore.java
+++ b/java/client/test/org/openqa/selenium/testing/Ignore.java
@@ -42,6 +42,7 @@ public static enum Driver {
     PHANTOMJS,
     REMOTE,
     SAFARI,
+    QTWEBKIT,
   }
 
   Driver[] value() default {Driver.ALL};
diff --git a/java/client/test/org/openqa/selenium/testing/JUnit4TestBase.java b/java/client/test/org/openqa/selenium/testing/JUnit4TestBase.java
index 41425e58..4b4aecfc 100644
--- a/java/client/test/org/openqa/selenium/testing/JUnit4TestBase.java
+++ b/java/client/test/org/openqa/selenium/testing/JUnit4TestBase.java
@@ -22,6 +22,8 @@
 import static org.hamcrest.Matchers.not;
 import static org.junit.Assert.assertThat;
 
+import org.json.JSONException;
+import org.json.JSONObject;
 import org.junit.Before;
 import org.junit.Rule;
 import org.junit.rules.TestName;
@@ -29,19 +31,23 @@
 import org.junit.rules.TestWatcher;
 import org.junit.runner.Description;
 import org.junit.runner.RunWith;
-import org.openqa.selenium.Pages;
+import org.openqa.selenium.environment.Pages;
 import org.openqa.selenium.WebDriver;
 import org.openqa.selenium.environment.GlobalTestEnvironment;
 import org.openqa.selenium.environment.InProcessTestEnvironment;
-import org.openqa.selenium.environment.TestEnvironment;
 import org.openqa.selenium.environment.webserver.AppServer;
 import org.openqa.selenium.internal.WrapsDriver;
+import org.openqa.selenium.logging.LogEntry;
+import org.openqa.selenium.logging.profiler.EventType;
+import org.openqa.selenium.remote.CapabilityType;
+import org.openqa.selenium.remote.DesiredCapabilities;
 import org.openqa.selenium.remote.RemoteWebDriver;
 import org.openqa.selenium.support.ui.ExpectedCondition;
 import org.openqa.selenium.support.ui.Wait;
 import org.openqa.selenium.support.ui.WebDriverWait;
 import org.openqa.selenium.testing.drivers.WebDriverBuilder;
 
+import java.util.List;
 import java.util.logging.Logger;
 
 @RunWith(SeleniumTestRunner.class)
@@ -49,7 +55,7 @@ public abstract class JUnit4TestBase implements WrapsDriver {
 
   private static final Logger logger = Logger.getLogger(JUnit4TestBase.class.getName());
 
-  protected TestEnvironment environment;
+  protected InProcessTestEnvironment environment;
   protected AppServer appServer;
   protected Pages pages;
   private static ThreadLocal<WebDriver> storedDriver = new ThreadLocal<WebDriver>();
@@ -62,7 +68,7 @@ public void prepareEnvironment() throws Exception {
     environment = GlobalTestEnvironment.get(InProcessTestEnvironment.class);
     appServer = environment.getAppServer();
 
-    pages = new Pages(appServer);
+    pages = environment.getTestContent();
 
     String hostName = environment.getAppServer().getHostName();
     String alternateHostName = environment.getAppServer().getAlternateHostName();
@@ -92,6 +98,30 @@ protected void starting(Description description) {
     protected void finished(Description description) {
       super.finished(description);
       logger.info("<<< Finished " + description);
+      if (driver != null && ((RemoteWebDriver) driver).getSessionId() != null) {
+        List<LogEntry> entries;
+        try {
+          entries = driver.manage().logs().get("profiler").getAll();
+        } catch (Exception e) {
+          logger.warning("<<< Error: can't get valid logs...");
+          e.printStackTrace();
+          return;
+        }
+        String[] testCase = new String[2];
+        for (LogEntry entry : entries) {
+          try {
+            JSONObject json = new JSONObject(entry.getMessage());
+            if (json.getString("event").equals(EventType.HTTP_COMMAND.toString())) {
+              testCase[0] = description.getClassName();
+              testCase[1] = description.getMethodName();
+              environment.addTestToCommand(json.getString("command"), json.getString("url"),
+                                           json.getString("method"), testCase);
+            }
+          } catch (JSONException e) {
+            e.printStackTrace();
+          }
+        }
+      }
     }
   };
   
@@ -104,7 +134,16 @@ public static WebDriver actuallyCreateDriver() {
 
     if (driver == null ||
         (driver instanceof RemoteWebDriver && ((RemoteWebDriver)driver).getSessionId() == null)) {
-      driver = new WebDriverBuilder().get();
+      DesiredCapabilities caps = new DesiredCapabilities();
+      caps.setCapability(CapabilityType.ENABLE_PROFILING_CAPABILITY, true);
+      WebDriverBuilder builder = new WebDriverBuilder();
+
+      String startClass = System.getProperty("webdriver.browserClass");
+      if (null != startClass) {
+        caps.setCapability("browserClass", startClass);
+      }
+      builder.setDesiredCapabilities(caps);
+      driver = builder.get();
       storedDriver.set(driver);
     }
     return storedDriver.get();
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/Browser.java b/java/client/test/org/openqa/selenium/testing/drivers/Browser.java
index 9c2686fc..db203982 100644
--- a/java/client/test/org/openqa/selenium/testing/drivers/Browser.java
+++ b/java/client/test/org/openqa/selenium/testing/drivers/Browser.java
@@ -36,7 +36,8 @@ public boolean isJavascriptEnabled() {
   opera,
   opera_mobile,
   phantomjs,
-  safari;
+  safari,
+  qtwebkit;
 
   private static final Logger log = Logger.getLogger(Browser.class.getName());
 
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/BrowserToCapabilities.java b/java/client/test/org/openqa/selenium/testing/drivers/BrowserToCapabilities.java
index fd90cd2b..3878c9f4 100644
--- a/java/client/test/org/openqa/selenium/testing/drivers/BrowserToCapabilities.java
+++ b/java/client/test/org/openqa/selenium/testing/drivers/BrowserToCapabilities.java
@@ -24,6 +24,7 @@
 
 import static org.openqa.selenium.remote.CapabilityType.HAS_NATIVE_EVENTS;
 
+import org.openqa.selenium.Platform;
 import org.openqa.selenium.remote.DesiredCapabilities;
 
 public class BrowserToCapabilities {
@@ -81,6 +82,10 @@ public static DesiredCapabilities of(Browser browser) {
         caps = DesiredCapabilities.safari();
         break;
 
+      case qtwebkit:
+          caps = new DesiredCapabilities("qtwebkit", "", Platform.ANY);
+          break;
+
       default:
         throw new RuntimeException("Cannot determine browser config to use");
     }
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/QtWebKitDriverSupplier.java b/java/client/test/org/openqa/selenium/testing/drivers/QtWebKitDriverSupplier.java
new file mode 100644
index 00000000..3499ed92
--- /dev/null
+++ b/java/client/test/org/openqa/selenium/testing/drivers/QtWebKitDriverSupplier.java
@@ -0,0 +1,49 @@
+package org.openqa.selenium.testing.drivers;
+
+import com.google.common.base.Supplier;
+import org.openqa.selenium.Capabilities;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.qtwebkit.QtWebDriverExecutor;
+import org.openqa.selenium.qtwebkit.QtWebDriverService;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.LocalFileDetector;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import java.net.URL;
+import java.net.MalformedURLException;
+
+public class QtWebKitDriverSupplier implements Supplier<WebDriver>{
+
+
+    private Capabilities desiredCapabilities;
+    private Capabilities requiredCapabilities;
+
+    public QtWebKitDriverSupplier(Capabilities desiredCapabilities,
+                          Capabilities requiredCapabilities) {
+        this.desiredCapabilities = desiredCapabilities;
+        this.requiredCapabilities = requiredCapabilities;
+    }
+
+    public WebDriver get() {
+        if (desiredCapabilities == null ){
+            return null;
+        }
+
+        if (!DesiredCapabilities.qtwebkit().getBrowserName().equals(desiredCapabilities.getBrowserName())) {
+            return null;
+        }
+
+        String ip = System.getProperty(QtWebDriverService.QT_DRIVER_EXE_PROPERTY);
+        if (ip == null) {
+            ip = "http://localhost:9517";
+            System.setProperty(QtWebDriverService.QT_DRIVER_EXE_PROPERTY, ip);
+        }
+
+        QtWebDriverExecutor executor = QtWebKitDriver.createDefaultExecutor();
+        RemoteWebDriver driver = new QtWebKitDriver(executor, desiredCapabilities, requiredCapabilities);
+		driver.setFileDetector(new LocalFileDetector());
+
+        return driver;
+    }
+}
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/RemoteSupplier.java b/java/client/test/org/openqa/selenium/testing/drivers/RemoteSupplier.java
index 59c999c7..c55b4447 100644
--- a/java/client/test/org/openqa/selenium/testing/drivers/RemoteSupplier.java
+++ b/java/client/test/org/openqa/selenium/testing/drivers/RemoteSupplier.java
@@ -24,6 +24,8 @@
 import org.openqa.selenium.remote.LocalFileDetector;
 import org.openqa.selenium.remote.RemoteWebDriver;
 
+import java.net.MalformedURLException;
+
 public class RemoteSupplier implements Supplier<WebDriver> {
 
   private static OutOfProcessSeleniumServer server = new OutOfProcessSeleniumServer();
@@ -47,7 +49,7 @@ public WebDriver get() {
     }
 
     RemoteWebDriver driver = new RemoteWebDriver(
-        server.getWebDriverUrl(), desiredCapabilities, requiredCapabilities);  
+        server.getWebDriverUrl(), desiredCapabilities, requiredCapabilities);
     driver.setFileDetector(new LocalFileDetector());
     return driver;
   }
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/TestIgnorance.java b/java/client/test/org/openqa/selenium/testing/drivers/TestIgnorance.java
index 57625bf8..2f2dc82b 100644
--- a/java/client/test/org/openqa/selenium/testing/drivers/TestIgnorance.java
+++ b/java/client/test/org/openqa/selenium/testing/drivers/TestIgnorance.java
@@ -29,6 +29,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.PHANTOMJS;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 import static org.openqa.selenium.testing.Ignore.Driver.REMOTE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
 import static org.openqa.selenium.testing.drivers.Browser.chrome;
@@ -212,6 +213,10 @@ private void addIgnoresForBrowser(Browser browser, IgnoreComparator comparator)
         comparator.addDriver(SAFARI);
         break;
 
+      case qtwebkit:
+          comparator.addDriver(QTWEBKIT);
+          break;
+
       default:
         throw new RuntimeException("Cannot determine which ignore to add ignores rules for");
     }
diff --git a/java/client/test/org/openqa/selenium/testing/drivers/WebDriverBuilder.java b/java/client/test/org/openqa/selenium/testing/drivers/WebDriverBuilder.java
index d9e71b52..6db4f0d8 100644
--- a/java/client/test/org/openqa/selenium/testing/drivers/WebDriverBuilder.java
+++ b/java/client/test/org/openqa/selenium/testing/drivers/WebDriverBuilder.java
@@ -85,6 +85,7 @@ private List<Supplier<WebDriver>> getSuppliers(Capabilities desiredCaps,
     List<Supplier<WebDriver>> suppliers = Lists.newArrayList();
     suppliers.add(new ExternalDriverSupplier(desiredCaps, requiredCaps));
     suppliers.add(new SauceBackedDriverSupplier(desiredCaps));
+    suppliers.add(new QtWebKitDriverSupplier(desiredCaps, requiredCaps));
     suppliers.add(new RemoteSupplier(desiredCaps, requiredCaps));
     suppliers.add(new OperaDriverSupplier(desiredCaps));
     suppliers.add(new PhantomJSDriverSupplier(desiredCaps));
diff --git a/java/server/Server.iml b/java/server/Server.iml
new file mode 100644
index 00000000..e56c22b6
--- /dev/null
+++ b/java/server/Server.iml
@@ -0,0 +1,190 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<module type="JAVA_MODULE" version="4">
+  <component name="NewModuleRootManager" inherit-compiler-output="true">
+    <exclude-output />
+    <content url="file://$MODULE_DIR$">
+      <sourceFolder url="file://$MODULE_DIR$/src" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/test" isTestSource="true" />
+    </content>
+    <orderEntry type="inheritedJdk" />
+    <orderEntry type="sourceFolder" forTests="false" />
+    <orderEntry type="library" name="junit" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/net/net.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="jruby" level="project" />
+    <orderEntry type="library" name="bouncycastle" level="project" />
+    <orderEntry type="library" name="apache-httpclient" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/server/src/org/openqa/grid/grid.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="jmock" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/test/org/openqa/selenium/qtwebkit/test_qtwebkit.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/qtwebkit/qtwebkit.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="jetty" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/browserlaunchers/locators/locators.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="browserlaunchers" level="project" />
+    <orderEntry type="library" name="interactions" level="project" />
+    <orderEntry type="library" name="selenium2" level="project" />
+    <orderEntry type="library" name="hamcrest" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/java/android/android-14.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/io/io.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/java/yaml/snakeyaml-1.8.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/java/json/json-20080701.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="easymock" level="project" />
+    <orderEntry type="library" name="drivers" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/java/commons-logging/commons-logging-1.1.1.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="testing" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/java/mx4j/mx4j-tools-3.0.1.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/server/src/org/openqa/jetty/jetty.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="guava-libraries" level="project" />
+    <orderEntry type="library" name="jcip_annotations" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/server/src/org/openqa/grid/common/common.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="logging" level="project" />
+    <orderEntry type="library" name="remote1" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/firefox/firefox.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="remote" level="project" />
+    <orderEntry type="library" name="servlet-api" level="project" />
+    <orderEntry type="library" name="selenium1" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/os/os.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../build/java/client/src/org/openqa/selenium/support/events/events.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="xml" level="project" />
+    <orderEntry type="module-library">
+      <library>
+        <CLASSES>
+          <root url="jar://$MODULE_DIR$/../../third_party/closure/bin/compiler-20120917.jar!/" />
+        </CLASSES>
+        <JAVADOC />
+        <SOURCES />
+      </library>
+    </orderEntry>
+    <orderEntry type="library" name="testng" level="project" />
+    <orderEntry type="library" name="selenium" level="project" />
+    <orderEntry type="module" module-name="Client" />
+  </component>
+</module>
+
diff --git a/java/server/src/org/openqa/grid/build.desc b/java/server/src/org/openqa/grid/build.desc
index 732bf854..e6cbe81d 100644
--- a/java/server/src/org/openqa/grid/build.desc
+++ b/java/server/src/org/openqa/grid/build.desc
@@ -9,6 +9,7 @@ java_library(name = "grid",
   ],
   deps = [
     "//java/client/src/org/openqa/selenium:webdriver-api",
+    "//java/client/src/org/openqa/selenium/qtwebkit:qtwebkit",
     "//java/server/src/org/openqa/grid/common",
     "//third_party/java/apache-httpclient",
     "//third_party/java/guava-libraries",
diff --git a/java/server/src/org/openqa/grid/common/build.desc b/java/server/src/org/openqa/grid/common/build.desc
index c6c3ada7..75f1dea1 100644
--- a/java/server/src/org/openqa/grid/common/build.desc
+++ b/java/server/src/org/openqa/grid/common/build.desc
@@ -3,6 +3,7 @@ java_library(name = "common",
   srcs = [ "**/*.java" ],
   embedded = [
     "defaults",
+    "qtjsons",
   ],
   deps = [
     "//java/client/src/org/openqa/selenium/net",
diff --git a/java/server/src/org/openqa/grid/common/qtjsons/qthub.json b/java/server/src/org/openqa/grid/common/qtjsons/qthub.json
new file mode 100644
index 00000000..78c131ed
--- /dev/null
+++ b/java/server/src/org/openqa/grid/common/qtjsons/qthub.json
@@ -0,0 +1,15 @@
+{
+  "host": null,
+  "port": 4444,
+  "newSessionWaitTimeout": -1,
+  "servlets" : [],
+  "prioritizer": null,
+  "capabilityMatcher": "org.openqa.grid.internal.utils.QtCapabilityMatcher",
+  "throwOnCapabilityNotPresent": true,
+  "nodePolling": 5000,
+
+  "cleanUpCycle": 5000,
+  "timeout": 300000,
+  "browserTimeout": 0,
+  "maxSession": 5
+}
\ No newline at end of file
diff --git a/java/server/src/org/openqa/grid/common/qtjsons/qtnode1.json b/java/server/src/org/openqa/grid/common/qtjsons/qtnode1.json
new file mode 100644
index 00000000..5260f0be
--- /dev/null
+++ b/java/server/src/org/openqa/grid/common/qtjsons/qtnode1.json
@@ -0,0 +1,26 @@
+{
+    "capabilities":
+        [
+            {
+                "browserName": "qtwebkit",
+                "hybrid": {
+                    "html": true,
+                    "qml": true,
+                    "qtVersion": "4.8.2"
+                },
+                "platform": "LINUX",
+                "maxInstances": 5,
+                "seleniumProtocol": "WebDriver"
+            }
+        ],
+    "configuration": {
+	    "proxy": "org.openqa.grid.selenium.proxy.DefaultRemoteProxy",
+	    "maxSession": 1,
+	    "port": 5555,
+	    "host": "localhost",
+	    "register": true,
+	    "registerCycle": 5000,
+	    "hubPort": 4444,
+	    "hubHost": "localhost"
+    }
+}
\ No newline at end of file
diff --git a/java/server/src/org/openqa/grid/internal/TestSession.java b/java/server/src/org/openqa/grid/internal/TestSession.java
index 626115b2..c4222c33 100644
--- a/java/server/src/org/openqa/grid/internal/TestSession.java
+++ b/java/server/src/org/openqa/grid/internal/TestSession.java
@@ -375,7 +375,6 @@ private HttpRequest prepareProxyRequest(HttpServletRequest request
 /*, ForwardConfiguration config*/)
       throws IOException {
     URL remoteURL = slot.getRemoteURL();
-
     String pathSpec = request.getServletPath() + request.getContextPath();
     String path = request.getRequestURI();
     if (!path.startsWith(pathSpec)) {
diff --git a/java/server/src/org/openqa/grid/internal/utils/QtCapabilityMatcher.java b/java/server/src/org/openqa/grid/internal/utils/QtCapabilityMatcher.java
new file mode 100644
index 00000000..acdecd6b
--- /dev/null
+++ b/java/server/src/org/openqa/grid/internal/utils/QtCapabilityMatcher.java
@@ -0,0 +1,88 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.grid.internal.utils;
+
+import org.json.JSONException;
+import org.json.JSONObject;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+
+import java.util.Iterator;
+import java.util.Map;
+
+/**
+ * Custom implementation of the capability matcher for QtWebKitDriver.
+ * <p/>
+ * This matcher will look at the key "hybrid" and
+ * will try to find a node that has those capabilities.
+ */
+public class QtCapabilityMatcher extends DefaultCapabilityMatcher {
+
+    public QtCapabilityMatcher() {
+        super();
+    }
+
+    public boolean matches(Map<String, Object> nodeCapability,
+                           Map<String, Object> requestedCapability) {
+
+        for (String key : requestedCapability.keySet()) {
+            if (requestedCapability.get(key) != null) {
+                if (key.equalsIgnoreCase(QtWebKitDriver.HYBRID)) {
+                    JSONObject nodeTypes = (JSONObject) nodeCapability.get(key);
+                    JSONObject requestedTypes = (JSONObject) requestedCapability.get(key);
+                    String caps = null;
+                    Iterator<String> iter = requestedTypes.keys();
+                    while (iter.hasNext()) {
+                        caps = iter.next();
+                        if (caps.equalsIgnoreCase("qtVersion")) {
+                            String value = null;
+                            try {
+                                value = requestedTypes.get(caps).toString();
+                            } catch (JSONException e) {
+                                e.printStackTrace();
+                            }
+
+                            if (!("ANY".equalsIgnoreCase(value) || "".equals(value) || "*".equals(value))) {
+                                try {
+                                    if (value.charAt(0) != (nodeTypes.get(caps)).toString().charAt(0)) {
+                                        return false;
+                                    }
+                                } catch (JSONException e) {
+                                    e.printStackTrace();
+                                }
+                            }
+                        }  else {
+                            try {
+                                if (!(requestedTypes.get(caps)).equals(nodeTypes.get(caps))) {
+                                    return false;
+                                }
+                            } catch (JSONException e) {
+                                return false;
+                            }
+                        }
+                    }
+                }
+            }
+        }
+        return super.matches(nodeCapability, requestedCapability);
+    }
+
+}
diff --git a/java/server/src/org/openqa/selenium/remote/server/DefaultDriverSessions.java b/java/server/src/org/openqa/selenium/remote/server/DefaultDriverSessions.java
index 8c3ff8b5..bc8a0e71 100644
--- a/java/server/src/org/openqa/selenium/remote/server/DefaultDriverSessions.java
+++ b/java/server/src/org/openqa/selenium/remote/server/DefaultDriverSessions.java
@@ -49,6 +49,7 @@ public class DefaultDriverSessions implements DriverSessions {
     put(DesiredCapabilities.opera(), "com.opera.core.systems.OperaDriver");
     put(DesiredCapabilities.safari(), "org.openqa.selenium.safari.SafariDriver");
     put(DesiredCapabilities.phantomjs(), "org.openqa.selenium.phantomjs.PhantomJSDriver");
+    put(DesiredCapabilities.qtwebkit(), "org.openqa.selenium.qtwebkit.QtWebKitDriver");
   }};
 
   public DefaultDriverSessions() {
diff --git a/java/server/test/org/openqa/grid/e2e/GridE2ETests.java b/java/server/test/org/openqa/grid/e2e/GridE2ETests.java
index db4c16c4..f30b3a17 100644
--- a/java/server/test/org/openqa/grid/e2e/GridE2ETests.java
+++ b/java/server/test/org/openqa/grid/e2e/GridE2ETests.java
@@ -41,6 +41,7 @@
     NodeTimeOutTest.class,
     SmokeTest.class, // slow
     ExtraServletUtilTest.class,
+    GridQtWebDriverTest.class
 })
 public class GridE2ETests {
 
diff --git a/java/server/test/org/openqa/grid/e2e/GridQtWebDriverTest.java b/java/server/test/org/openqa/grid/e2e/GridQtWebDriverTest.java
new file mode 100644
index 00000000..308210a8
--- /dev/null
+++ b/java/server/test/org/openqa/grid/e2e/GridQtWebDriverTest.java
@@ -0,0 +1,243 @@
+/****************************************************************************
+**
+** Copyright © 1992-2014 Cisco and/or its affiliates. All rights reserved.
+** All rights reserved.
+** 
+** $CISCO_BEGIN_LICENSE:APACHE$
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+** http://www.apache.org/licenses/LICENSE-2.0
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+**
+** $CISCO_END_LICENSE$
+**
+****************************************************************************/
+
+package org.openqa.grid.e2e;
+
+import org.junit.After;
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.fail;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import org.openqa.grid.common.RegistrationRequest;
+import org.openqa.grid.e2e.utils.GridTestHelper;
+import org.openqa.grid.e2e.utils.RegistryTestHelper;
+import org.openqa.grid.internal.utils.SelfRegisteringRemote;
+import org.openqa.selenium.WebDriver;
+import org.openqa.selenium.WebDriverException;
+import org.openqa.selenium.environment.GlobalTestEnvironment;
+import org.openqa.selenium.environment.InProcessTestEnvironment;
+import org.openqa.selenium.environment.webserver.AppServer;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
+import org.openqa.selenium.remote.DesiredCapabilities;
+import org.openqa.selenium.remote.RemoteWebDriver;
+import org.openqa.selenium.environment.Pages;
+
+import java.net.MalformedURLException;
+import java.net.URL;
+import java.util.HashMap;
+import java.util.Map;
+
+import org.openqa.grid.web.Hub;
+import org.openqa.grid.internal.utils.GridHubConfiguration;
+
+public class GridQtWebDriverTest {
+
+    private static Hub hub;
+
+    @BeforeClass
+    public static void prepare() throws Exception {
+
+        GridHubConfiguration hubConfiguration = new GridHubConfiguration();
+        hubConfiguration.loadFromJSON("qtjsons/qthub.json");
+        hub = GridTestHelper.getHub(hubConfiguration);
+
+        RegistrationRequest req = RegistrationRequest.build("-role", "node",
+                                      "-nodeConfig", "qtjsons/qtnode1.json",
+                                      "-DRemoteIP=http://127.0.0.1:9517");
+        SelfRegisteringRemote remote = new SelfRegisteringRemote(req);
+
+        remote.startRemoteServer();
+
+        remote.getConfiguration().put(RegistrationRequest.TIME_OUT, -1);
+        remote.sendRegistrationRequest();
+        RegistryTestHelper.waitForNode(hub.getRegistry(), 1);
+    }
+
+    @AfterClass
+    public static void stop() throws Exception {
+        if (hub != null) {
+            hub.stop();
+        }
+    }
+
+    @Before
+    public void initCaps() {
+        desiredCapabilities = DesiredCapabilities.qtwebkit();
+    }
+
+    @Before
+    public void prepareEnvironment() throws Exception {
+        environment = GlobalTestEnvironment.get(InProcessTestEnvironment.class);
+        appServer = environment.getAppServer();
+        pages = environment.getTestContent();
+    }
+
+    @After
+    public void cleanDrivers() {
+        if (driver != null) {
+            driver.quit();
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithCapabilitiesThatExactMatchOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("qtVersion", "4.8.2");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            driver.get(pages.colorPage);
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithNoHybridCapabilitiesOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("qtVersion", "4.8.2");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        desiredCapabilities.setCapability("FakeCapabilities", true);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            driver.get(pages.rectanglesPage);
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        } catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithHybridCapabilitiesDontSetOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("qtVersion", "4.8.2");
+        types.put("fake", true);
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            driver.get(pages.rectanglesPage);
+            fail("Should not to be here ...");
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        } catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithQtVersionThatDoNotMatchOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("qtVersion", "5.1.0");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            driver.get(pages.colorPage);
+            fail("Should not have succeeded");
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        }  catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithHybridTypeThatDoNotMatchOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("widget", true);
+        types.put("qtVersion", "4.8");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            fail("Should not have succeeded");
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        }  catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldNotBeAbleToRunWithHybridTypeThatSetFalseAndDoNotMatchOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", false);
+        types.put("qtVersion", "4.8");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            fail("Should not have succeeded");
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        }  catch (RuntimeException e) {
+            // expected
+            assertThat(e, is(instanceOf(WebDriverException.class)));
+        }
+    }
+
+    @Test
+    public void testShouldBeAbleToRunWithQtVersionThatNoBestMatchOnGrid() {
+        Map<String, Object> types = new HashMap<String, Object>();
+        types.put("html", true);
+        types.put("qml", true);
+        types.put("qtVersion", "4.8.5");
+        desiredCapabilities.setCapability(QtWebKitDriver.HYBRID, types);
+        try {
+            driver = new RemoteWebDriver(new URL(hub.getUrl() + "/wd/hub"), desiredCapabilities);
+            driver.get(pages.html5Page);
+        } catch (MalformedURLException e) {
+            e.printStackTrace();
+        }  catch (RuntimeException e) {
+            e.printStackTrace();
+            fail("Should not to be here ...");
+        }
+    }
+
+    private WebDriver driver;
+    private DesiredCapabilities desiredCapabilities;
+
+    private InProcessTestEnvironment environment;
+    private AppServer appServer;
+    private Pages pages;
+
+}
\ No newline at end of file
diff --git a/java/server/test/org/openqa/grid/e2e/build.desc b/java/server/test/org/openqa/grid/e2e/build.desc
index 3012380f..5f61f8d6 100644
--- a/java/server/test/org/openqa/grid/e2e/build.desc
+++ b/java/server/test/org/openqa/grid/e2e/build.desc
@@ -5,11 +5,13 @@ java_test(name = "test",
     "misc/**/*.java",
     "node/*.java",
     "utils/**/*.java",
+    "GridQtWebDriverTest.java",
     
   ],
   deps = [
     "//java/client/src/com/thoughtworks/selenium",
     "//java/server/src/org/openqa/grid/selenium",
     "//java/client/test/org/openqa/selenium",
+    "//java/client/src/org/openqa/selenium/qtwebkit:qtwebkit",
     "//third_party/java/mockito",
   ])
\ No newline at end of file
diff --git a/java/server/test/org/openqa/grid/internal/DefaultToFIFOPriorityTest.java b/java/server/test/org/openqa/grid/internal/DefaultToFIFOPriorityTest.java
index 40284b4f..32de8159 100644
--- a/java/server/test/org/openqa/grid/internal/DefaultToFIFOPriorityTest.java
+++ b/java/server/test/org/openqa/grid/internal/DefaultToFIFOPriorityTest.java
@@ -42,7 +42,7 @@ public class DefaultToFIFOPriorityTest {
 
   private static Registry registry;
 
-  // priority rule : nothing defined = FIFO
+    // priority rule : nothing defined = FIFO
   private static Prioritizer fifo = null;
 
   private static Map<String, Object> ff = new HashMap<String, Object>();
@@ -72,29 +72,32 @@ public static void setup() throws InterruptedException {
       requests.add(req);
     }
 
-
     // use all the spots ( so 1 ) of the grid so that a queue buils up
     MockedRequestHandler newSessionRequest =GridHelper.createNewSessionHandler(registry, ff);
     newSessionRequest.process();
     session = newSessionRequest.getSession();
 
+    assertEquals(registry.getNewSessionRequestCount(), 0);
+    int i = 0;
     // fill the queue with MAX requests.
     for (MockedRequestHandler h : requests) {
+      i++;
       final MockedRequestHandler req = h;
       new Thread(new Runnable() {  // Thread safety reviewed
         public void run() {
           req.process();
         }
       }).start();
+      while (registry.getNewSessionRequestCount() != i) {
+        Thread.sleep(250);
+      }
+      assertEquals(registry.getNewSessionRequestCount(), i);
     }
 
-
     // free the grid : the queue is consumed, and the test with the highest
     // priority should be processed.
-    while (requests.size() != MAX) {
-      Thread.sleep(250);
-    }
     registry.terminateSynchronousFOR_TEST_ONLY(session);
+
   }
 
 
@@ -110,6 +113,7 @@ public void validateRequestAreHandledFIFO() throws InterruptedException {
       }
       Thread.sleep(250);
     }
+
     assertNotNull(requests.get(0).getSession());
     assertEquals(1, requests.get(0).getRequest().getDesiredCapabilities().get("_priority"));
   }
diff --git a/java/server/test/org/openqa/selenium/remote/server/SessionLogsTest.java b/java/server/test/org/openqa/selenium/remote/server/SessionLogsTest.java
index 170abbbb..4388e72b 100644
--- a/java/server/test/org/openqa/selenium/remote/server/SessionLogsTest.java
+++ b/java/server/test/org/openqa/selenium/remote/server/SessionLogsTest.java
@@ -25,6 +25,7 @@
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA;
 import static org.openqa.selenium.testing.Ignore.Driver.OPERA_MOBILE;
 import static org.openqa.selenium.testing.Ignore.Driver.SAFARI;
+import static org.openqa.selenium.testing.Ignore.Driver.QTWEBKIT;
 
 import com.google.common.base.Charsets;
 import com.google.common.io.CharStreams;
@@ -42,6 +43,7 @@
 import org.junit.Test;
 import org.openqa.selenium.logging.SessionLogHandler;
 import org.openqa.selenium.logging.SessionLogs;
+import org.openqa.selenium.qtwebkit.QtWebKitDriver;
 import org.openqa.selenium.remote.DesiredCapabilities;
 import org.openqa.selenium.remote.LocalFileDetector;
 import org.openqa.selenium.remote.RemoteWebDriver;
@@ -56,7 +58,7 @@
 import java.util.Map;
 import java.util.Set;
 
-@Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, SAFARI})
+@Ignore({ANDROID, CHROME, HTMLUNIT, IE, IPHONE, OPERA, OPERA_MOBILE, QTWEBKIT, SAFARI})
 public class SessionLogsTest extends JUnit4TestBase {
 
   private static OutOfProcessSeleniumServer server;
diff --git a/java/server/test/org/openqa/selenium/remote/server/build.desc b/java/server/test/org/openqa/selenium/remote/server/build.desc
index b15e0919..d264f1f9 100644
--- a/java/server/test/org/openqa/selenium/remote/server/build.desc
+++ b/java/server/test/org/openqa/selenium/remote/server/build.desc
@@ -39,3 +39,29 @@ java_library(
     "//java/client/test/org/openqa/selenium/remote:common-tests",
     "//third_party/java/junit",
   ])
+
+
+java_test(name = "test_qtwebkit",
+  srcs = [
+    "*.java",
+    "handler/*.java",
+    "rest/*.java",
+    "testing/*.java",
+    "xdrpc/*.java",
+  ],
+  sysproperties = [
+    { "selenium.browser" : "qtwebkit" },
+    { "selenium.browser.qtwebkit" : "true" },
+  ],
+  deps = [
+    "//java/client/src/org/openqa/selenium/qtwebkit",
+    "//java/client/src/org/openqa/selenium/chrome",
+    "//java/client/src/org/openqa/selenium/firefox",
+    "//java/client/src/org/openqa/selenium/htmlunit",
+    "//java/client/src/org/openqa/selenium/ie",
+    "//java/server/src/org/openqa/selenium/remote/server",
+    "//java/client/test/org/openqa/selenium:base",
+    "//java/client/test/org/openqa/selenium/remote:common-tests",
+    "//java/client/test/org/openqa/selenium/testing/drivers",
+    "//third_party/java/junit",
+  ])
diff --git a/javascript/chrome-driver/atoms.js b/javascript/chrome-driver/atoms.js
index 969f5bae..19dafa15 100644
--- a/javascript/chrome-driver/atoms.js
+++ b/javascript/chrome-driver/atoms.js
@@ -216,7 +216,7 @@ webdriver.chrome.isElementClickable = function(elem, coord) {
         false, 'Element is not clickable at point ' + coordStr);
   }
   var elemAtPointHTML = elemAtPoint.outerHTML;
-  if (elemAtPoint.hasChildNodes()) {
+  if (elemAtPoint.hasChildNodes() && elemAtPointHTML) {
     var inner = elemAtPoint.innerHTML;
     var closingTag = '</' + elemAtPoint.tagName + '>';
     var innerStart = elemAtPointHTML.length - inner.length - closingTag.length;
diff --git a/javascript/remote/ui/client.js b/javascript/remote/ui/client.js
index 9695da9f..e82bc0d1 100644
--- a/javascript/remote/ui/client.js
+++ b/javascript/remote/ui/client.js
@@ -106,6 +106,7 @@ remote.ui.Client.SUPPORTED_BROWSERS = [
   'android',
   'chrome',
   'firefox',
+  'qtwebkit',
   'internet explorer',
   'iphone',
   'opera'
diff --git a/javascript/selenium-core/scripts/user-extensions.js b/javascript/selenium-core/scripts/user-extensions.js
index 1015ebd1..b708c068 100755
--- a/javascript/selenium-core/scripts/user-extensions.js
+++ b/javascript/selenium-core/scripts/user-extensions.js
@@ -1,3 +1,12 @@
 // User extensions can be added here.
 //
 // Keep this file to avoid  mystifying "Invalid Character" error in IE
+
+Selenium.prototype.doRunScriptBySrc = function(src) {
+    var win = this.browserbot.getCurrentWindow();
+    var doc = win.document;
+    var scriptTag = doc.createElement('script');
+    scriptTag.type = "text/javascript"
+    scriptTag.src = src;
+    doc.head.appendChild(scriptTag);
+}
\ No newline at end of file
diff --git a/javascript/webdriver/actionsequence.js b/javascript/webdriver/actionsequence.js
index 8aac13d4..5e75a4ef 100644
--- a/javascript/webdriver/actionsequence.js
+++ b/javascript/webdriver/actionsequence.js
@@ -354,3 +354,206 @@ webdriver.ActionSequence.prototype.sendKeys = function(var_args) {
   var keys = goog.array.flatten(goog.array.slice(arguments, 0));
   return this.scheduleKeyboardAction_('sendKeys', keys);
 };
+
+
+/**
+ * Single tap on the touch enabled device.
+ * @param {!webdriver.WebElement} element The element to tap on.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchSingleTap = function(element) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_SINGLE_TAP);
+
+  var id = element.toWireValue().then(function(value) {
+      return value['ELEMENT'];
+    });
+  command.setParameter('element', id);
+
+  this.schedule_(webdriver.CommandName.TOUCH_SINGLE_TAP, command);
+  return this;
+};
+
+
+/**
+ * Finger down on the screen.
+ * @param {number} x X coordinate on the screen
+ * @param {number} y Y coordinate on the screen
+ */
+webdriver.ActionSequence.prototype.touchDown = function(x, y) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_DOWN);
+
+  command.setParameter('x', x);
+  command.setParameter('y', y);
+
+  this.schedule_(webdriver.CommandName.TOUCH_DOWN, command);
+  return this;
+};
+
+
+/**
+ * Finger up on the screen.
+ * @param {number} x X coordinate on the screen
+ * @param {number} y Y coordinate on the screen
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchUp = function(x, y) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_UP);
+
+  command.setParameter('x', x);
+  command.setParameter('y', y);
+
+  this.schedule_(webdriver.CommandName.TOUCH_UP, command);
+  return this;
+};
+
+
+/**
+ * Finger move on the screen.
+ * @param {number} x X coordinate on the screen
+ * @param {number} y Y coordinate on the screen
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchMove = function(x, y) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_MOVE);
+
+  command.setParameter('x', x);
+  command.setParameter('y', y);
+
+  this.schedule_(webdriver.CommandName.TOUCH_MOVE, command);
+  return this;
+};
+
+
+/**
+ * Scroll on the touch screen using finger based motion events.
+ * @param {(!webdriver.WebElement|{x: number, y: number})} elementOrOffset Either
+ *     the element where scrolls starts or offset in pixels to scroll by.
+ * @param {({x: number, y: number})=} opt_offset The offset in pixels to scroll by
+ *     if the first argument is the element.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchScroll = function(elementOrOffset, opt_offset) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_SCROLL);
+
+  if (opt_offset != undefined) {
+    var id = elementOrOffset.toWireValue().then(function(value) {
+        return value['ELEMENT'];
+      });
+    command.setParameter('element', id);
+    command.setParameter('xoffset', opt_offset.x);
+    command.setParameter('yoffset', opt_offset.y);
+  } else {
+    command.setParameter('xoffset', elementOrOffset.x);
+    command.setParameter('yoffset', elementOrOffset.y);
+  }
+
+  this.schedule_(webdriver.CommandName.TOUCH_SCROLL, command);
+  return this;
+};
+
+
+/**
+ * Double tap on the touch screen using finger motion events.
+ * @param {!webdriver.WebElement} element The element to double tap on.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchDoubleTap = function(element) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_DOUBLE_TAP);
+
+  var id = element.toWireValue().then(function(value) {
+      return value['ELEMENT'];
+    });
+  command.setParameter('element', id);
+
+  this.schedule_(webdriver.CommandName.TOUCH_DOUBLE_TAP, command);
+  return this;
+};
+
+
+/**
+ * Long press on the touch screen using finger motion events.
+ * @param {!webdriver.WebElement} element The element to long press on.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchLongPress = function(element) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_LONG_PRESS);
+
+  var id = element.toWireValue().then(function(value) {
+      return value['ELEMENT'];
+    });
+  command.setParameter('element', id);
+
+  this.schedule_(webdriver.CommandName.TOUCH_LONG_PRESS, command);
+  return this;
+};
+
+
+/**
+ * Flick on the touch screen using finger motion events.
+ * @param {(!webdriver.WebElement|{x: number, y: number})} elementOrSpeed Either
+ *     the element where flick starts or speed in pixels per second.
+ * @param {({x: number, y: number})=} opt_offset The offset in pixels to flick by
+ *     if the first argument is the element.
+ * @param {number=} opt_speed The speed in pixels per seconds if the first argument
+ *     is the element.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchFlick = function(elementOrSpeed, opt_offset, opt_speed) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_FLICK);
+
+  if (arguments.length == 3) {
+    var id = elementOrSpeed.toWireValue().then(function(value) {
+        return value['ELEMENT'];
+      });
+    command.setParameter('element', id);
+    command.setParameter('xoffset', opt_offset.x);
+    command.setParameter('yoffset', opt_offset.y);
+    command.setParameter('speed', opt_speed);
+  } else {
+    command.setParameter('xspeed', elementOrSpeed.x);
+    command.setParameter('yspeed', elementOrSpeed.y);
+  }
+
+  this.schedule_(webdriver.CommandName.TOUCH_FLICK, command);
+  return this;
+};
+
+
+/**
+ * Pinch and rotate on the touch screen using finger motion events.
+ * @param {!webdriver.WebElement} element The element to rotate.
+ * @param {!number} angle The angle by which to rotate.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchPinchRotate = function(element, angle) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_PINCH_ROTATE);
+
+  var id = element.toWireValue().then(function(value) {
+      return value['ELEMENT'];
+    });
+  command.setParameter('element', id);
+  command.setParameter('angle', angle);
+
+  this.schedule_(webdriver.CommandName.TOUCH_PINCH_ROTATE, command);
+  return this;
+};
+
+
+/**
+ * Pinch and zoom on the touch screen using finger motion events.
+ * @param {!webdriver.WebElement} element The element to zoom.
+ * @param {!number} scale The scale by which to zoom.
+ * @return {!webdriver.ActionSequence} A self reference.
+ */
+webdriver.ActionSequence.prototype.touchPinchZoom = function(element, scale) {
+  var command = new webdriver.Command(webdriver.CommandName.TOUCH_PINCH_ZOOM);
+
+  var id = element.toWireValue().then(function(value) {
+      return value['ELEMENT'];
+    });
+  command.setParameter('element', id);
+  command.setParameter('scale', scale);
+
+  this.schedule_(webdriver.CommandName.TOUCH_PINCH_ZOOM, command);
+  return this;
+};
diff --git a/javascript/webdriver/command.js b/javascript/webdriver/command.js
index 3db8443f..0b29ceba 100644
--- a/javascript/webdriver/command.js
+++ b/javascript/webdriver/command.js
@@ -213,6 +213,8 @@ webdriver.CommandName = {
   TOUCH_DOUBLE_TAP: 'touchDoubleTap',
   TOUCH_LONG_PRESS: 'touchLongPress',
   TOUCH_FLICK: 'touchFlick',
+  TOUCH_PINCH_ROTATE: 'touchPinchRotate',
+  TOUCH_PINCH_ZOOM: 'touchPinchZoom',
 
   GET_AVAILABLE_LOG_TYPES: 'getAvailableLogTypes',
   GET_LOG: 'getLog',
diff --git a/javascript/webdriver/exports/exports.js b/javascript/webdriver/exports/exports.js
index 6f2795f4..4d5a229d 100644
--- a/javascript/webdriver/exports/exports.js
+++ b/javascript/webdriver/exports/exports.js
@@ -21,6 +21,7 @@ goog.require('bot.Error');
 goog.require('bot.ErrorCode');
 goog.require('bot.response');
 goog.require('webdriver.ActionSequence');
+goog.require('webdriver.AbstractBuilder');
 goog.require('webdriver.Builder');
 goog.require('webdriver.Button');
 goog.require('webdriver.By');
@@ -45,6 +46,7 @@ goog.require('webdriver.testing.assert');
 goog.require('webdriver.testing.asserts');
 
 exports.ActionSequence = webdriver.ActionSequence;
+exports.AbstractBuilder = webdriver.AbstractBuilder;
 exports.Builder = webdriver.Builder;
 exports.Button = webdriver.Button;
 exports.By = webdriver.By;
diff --git a/javascript/webdriver/http/http.js b/javascript/webdriver/http/http.js
index a15f2eae..54a53ada 100644
--- a/javascript/webdriver/http/http.js
+++ b/javascript/webdriver/http/http.js
@@ -279,6 +279,26 @@ webdriver.http.Executor.COMMAND_MAP_ = (function() {
       put(webdriver.CommandName.MOVE_TO, post('/session/:sessionId/moveto')).
       put(webdriver.CommandName.SEND_KEYS_TO_ACTIVE_ELEMENT,
           post('/session/:sessionId/keys')).
+      put(webdriver.CommandName.TOUCH_SINGLE_TAP,
+          post('/session/:sessionId/touch/click')).
+      put(webdriver.CommandName.TOUCH_DOWN,
+          post('/session/:sessionId/touch/down')).
+      put(webdriver.CommandName.TOUCH_UP,
+          post('/session/:sessionId/touch/up')).
+      put(webdriver.CommandName.TOUCH_MOVE,
+          post('/session/:sessionId/touch/move')).
+      put(webdriver.CommandName.TOUCH_SCROLL,
+          post('/session/:sessionId/touch/scroll')).
+      put(webdriver.CommandName.TOUCH_DOUBLE_TAP,
+          post('/session/:sessionId/touch/doubleclick')).
+      put(webdriver.CommandName.TOUCH_LONG_PRESS,
+          post('/session/:sessionId/touch/longclick')).
+      put(webdriver.CommandName.TOUCH_FLICK,
+          post('/session/:sessionId/touch/flick')).
+      put(webdriver.CommandName.TOUCH_PINCH_ROTATE,
+          post('/session/:sessionId/touch/-cisco-pinch-rotate')).
+      put(webdriver.CommandName.TOUCH_PINCH_ZOOM,
+          post('/session/:sessionId/touch/-cisco-pinch-zoom')).
       put(webdriver.CommandName.ACCEPT_ALERT,
           post('/session/:sessionId/accept_alert')).
       put(webdriver.CommandName.DISMISS_ALERT,
diff --git a/javascript/webdriver/session.js b/javascript/webdriver/session.js
index 03d3219e..89850cd0 100644
--- a/javascript/webdriver/session.js
+++ b/javascript/webdriver/session.js
@@ -35,6 +35,29 @@ webdriver.Session = function(id, capabilities) {
 };
 
 
+/**
+ * Returns a list of the currently active sessions.
+ * @param {!webdriver.CommandExecutor} executor
+ * @return {!webdriver.promise.Promise} A promise that will be resolved with an
+ *     array of sessions.
+ */
+webdriver.Session.getSessions = function(executor) {
+  var command = new webdriver.Command(webdriver.CommandName.GET_SESSIONS);
+  var fn = goog.bind(executor.execute, executor, command);
+  return webdriver.promise.controlFlow().execute(function() {
+    return webdriver.promise.checkedNodeCall(fn).then(function(response) {
+      bot.response.checkResponse(response);
+      var sessions = [];
+      for (var session in response['value']) {
+        session = response['value'][session];
+        sessions.push(new webdriver.Session(session['id'], session['capabilities']));
+      }
+      return sessions;
+    });
+  }, 'Session.getSessions()');
+};
+
+
 /**
  * @return {string} This session's ID.
  */
diff --git a/rake-tasks/crazy_fun/mappings/java.rb b/rake-tasks/crazy_fun/mappings/java.rb
index 9a032884..9b3308dd 100644
--- a/rake-tasks/crazy_fun/mappings/java.rb
+++ b/rake-tasks/crazy_fun/mappings/java.rb
@@ -513,6 +513,14 @@ def handle(fun, dir, args)
                 ant.sysproperty :key => 'webdriver.chrome.driver', :value => chromedriver
               end
 
+              if qtwebdriver
+                ant.sysproperty :key => 'webdriver.qtwebdriver.driver', :value => qtwebdriver
+              end
+
+              if qtwebdriverargs
+                ant.sysproperty :key => 'webdriver.qtwebdriver.args', :value => qtwebdriverargs
+              end
+
               if safaridriver
                 ant.sysproperty :key => 'webdriver.safari.driver', :value => safaridriver
               end
@@ -612,6 +620,14 @@ def chromedriver
       return ENV['chromedriver']
     end
 
+    def qtwebdriver
+      return ENV['qtwebdriver']
+    end
+
+    def qtwebdriverargs
+      return ENV['qtwebdriverargs']
+    end
+
     def safaridriver
       return ENV['safaridriver']
     end
diff --git a/selenium.iml b/selenium.iml
index 020d514e..a5f96dbb 100644
--- a/selenium.iml
+++ b/selenium.iml
@@ -1,26 +1,17 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<module classpath="eclipse" classpath-dir="$MODULE_DIR$" type="JAVA_MODULE" version="4">
-  <component name="FacetManager">
-    <facet type="android" name="Android">
-      <configuration>
-        <option name="GEN_FOLDER_RELATIVE_PATH_APT" value="/gen" />
-        <option name="GEN_FOLDER_RELATIVE_PATH_AIDL" value="/gen" />
-        <option name="MANIFEST_FILE_RELATIVE_PATH" value="/AndroidManifest.xml" />
-        <option name="RES_FOLDER_RELATIVE_PATH" value="/res" />
-        <option name="ASSETS_FOLDER_RELATIVE_PATH" value="/assets" />
-        <option name="LIBS_FOLDER_RELATIVE_PATH" value="/libs" />
-        <option name="REGENERATE_R_JAVA" value="true" />
-        <option name="REGENERATE_JAVA_BY_AIDL" value="true" />
-        <option name="USE_CUSTOM_APK_RESOURCE_FOLDER" value="false" />
-        <option name="CUSTOM_APK_RESOURCE_FOLDER" value="" />
-        <option name="USE_CUSTOM_COMPILER_MANIFEST" value="false" />
-        <option name="CUSTOM_COMPILER_MANIFEST" value="" />
-        <option name="APK_PATH" value="" />
-        <option name="LIBRARY_PROJECT" value="false" />
-        <option name="RUN_PROCESS_RESOURCES_MAVEN_TASK" value="true" />
-        <option name="GENERATE_UNSIGNED_APK" value="false" />
-      </configuration>
-    </facet>
+<module type="JAVA_MODULE" version="4">
+  <component name="NewModuleRootManager" inherit-compiler-output="true">
+    <exclude-output />
+    <content url="file://$MODULE_DIR$">
+      <sourceFolder url="file://$MODULE_DIR$/android/gen" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/android/src" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/java/client/test" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/java/server/src" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/java/server/test" isTestSource="false" />
+      <sourceFolder url="file://$MODULE_DIR$/java/client/src" isTestSource="false" />
+    </content>
+    <orderEntry type="inheritedJdk" />
+    <orderEntry type="sourceFolder" forTests="false" />
   </component>
 </module>
 
diff --git a/third_party/java/little_proxy/build.desc b/third_party/java/little_proxy/build.desc
index a2879b48..158fc1ba 100644
--- a/third_party/java/little_proxy/build.desc
+++ b/third_party/java/little_proxy/build.desc
@@ -2,7 +2,7 @@
 java_binary(name = "little_proxy",
   main_class = "org.littleshoot.proxy.Launcher",
   deps = [
-    "littleproxy-0.5.3.jar",
+    "littleproxy-0.5-SNAPSHOT.jar",
     "//third_party/java/commons_cli",
     "//third_party/java/commons-codec",
     "//third_party/java/commons-lang",
diff --git a/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT-sources.jar b/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT-sources.jar
new file mode 100644
index 00000000..5d05642b
Binary files /dev/null and b/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT-sources.jar differ
diff --git a/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT.jar b/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT.jar
new file mode 100644
index 00000000..bc34b3d6
Binary files /dev/null and b/third_party/java/little_proxy/littleproxy-0.5-SNAPSHOT.jar differ